{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "36a8e17f-0bc8-425b-a467-9a5a88b97cd7",
          "code": "13472-08-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13472-08-7",
          "code_system": "CAS",
          "references": [
            "b3ab51ab-5138-49d2-86dc-88c6ad116182",
            "f8a2777a-e21e-46e7-8d6f-2f8e5c5beb2e"
          ]
        },
        {
          "uuid": "7365350b-4179-402f-a54d-a23d8c9a55ee",
          "code": "236-740-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.033.386",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b3ab51ab-5138-49d2-86dc-88c6ad116182"
          ]
        },
        {
          "uuid": "08afe3f5-b423-c90d-ea37-989e4a756fbb",
          "code": "DTXSID8027747",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8027747",
          "code_system": "EPA CompTox",
          "references": [
            "bf9050f0-84f3-e3dd-35c0-7b167fe9166d"
          ]
        },
        {
          "uuid": "1990ded2-d1a8-4387-9ee9-434e5510e9be",
          "code": "5DCY6GCZ6V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d07d6d3f-a317-4227-9cc3-480580214c50",
          "name": "2,2'-(1,2-DIAZENEDIYL)BIS(2-METHYLBUTANENITRILE)",
          "stdName": "2,2'-(1,2-DIAZENEDIYL)BIS(2-METHYLBUTANENITRILE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7b04275-b3af-4b9a-a4d3-96d28ef2d8cc"
          ],
          "display_name": false
        },
        {
          "uuid": "c3697eff-5579-4917-8203-70595c663644",
          "name": "2,2'-AZOBIS(.ALPHA.-METHYLBUTYRONITRILE)",
          "stdName": "2,2'-AZOBIS(.ALPHA.-METHYLBUTYRONITRILE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7b04275-b3af-4b9a-a4d3-96d28ef2d8cc"
          ],
          "display_name": false
        },
        {
          "uuid": "541f1bfb-a537-475a-a2f5-715b55fc615a",
          "name": "2,2'-AZOBIS(2-CYANOBUTANE)",
          "stdName": "2,2'-AZOBIS(2-CYANOBUTANE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7b04275-b3af-4b9a-a4d3-96d28ef2d8cc"
          ],
          "display_name": false
        },
        {
          "uuid": "ec301134-993d-4a6f-800e-a12b42b960e5",
          "name": "2,2'-AZOBIS(2-METHYLBUTANENITRILE)",
          "stdName": "2,2'-AZOBIS(2-METHYLBUTANENITRILE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7b04275-b3af-4b9a-a4d3-96d28ef2d8cc"
          ],
          "display_name": false
        },
        {
          "uuid": "ca640909-adc1-421f-b415-a63d69444266",
          "name": "2,2'-AZOBIS(2-METHYLBUTYRONITRILE)",
          "stdName": "2,2'-AZOBIS(2-METHYLBUTYRONITRILE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d125a47-0591-46d9-b4f0-37ed91ea031f"
          ],
          "display_name": true
        },
        {
          "uuid": "7c4cea2a-eab0-4a8b-8a73-60b09fbddb90",
          "name": "2,2'-DIMETHYL-2,2'-AZODIBUTYRONITRILE",
          "stdName": "2,2'-DIMETHYL-2,2'-AZODIBUTYRONITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7b04275-b3af-4b9a-a4d3-96d28ef2d8cc"
          ],
          "display_name": false
        },
        {
          "uuid": "70b9f00f-84a3-4780-a30e-62dd1a2ab519",
          "name": "BUTANENITRILE, 2,2'-(1,2-DIAZENEDIYL)BIS(2-METHYL-",
          "stdName": "BUTANENITRILE, 2,2'-(1,2-DIAZENEDIYL)BIS(2-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7b04275-b3af-4b9a-a4d3-96d28ef2d8cc"
          ],
          "display_name": false
        },
        {
          "uuid": "86b10e73-a5df-492f-a1d2-02712f7c61db",
          "name": "BUTANENITRILE, 2,2'-AZOBIS(2-METHYL-",
          "stdName": "BUTANENITRILE, 2,2'-AZOBIS(2-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7b04275-b3af-4b9a-a4d3-96d28ef2d8cc"
          ],
          "display_name": false
        },
        {
          "uuid": "02a6b490-c660-42ed-b7f2-1be22ef11fb2",
          "name": "BUTYRONITRILE, 2,2'-AZOBIS(2-METHYL-",
          "stdName": "BUTYRONITRILE, 2,2'-AZOBIS(2-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7b04275-b3af-4b9a-a4d3-96d28ef2d8cc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9d125a47-0591-46d9-b4f0-37ed91ea031f",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d7b04275-b3af-4b9a-a4d3-96d28ef2d8cc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3ab51ab-5138-49d2-86dc-88c6ad116182",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393331000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95fc4643-710d-4d67-a8d8-05f98e447bc8",
          "citation": "SRS import [5DCY6GCZ6V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5DCY6GCZ6V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393331000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf9050f0-84f3-e3dd-35c0-7b167fe9166d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13472-08-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f8a2777a-e21e-46e7-8d6f-2f8e5c5beb2e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a7d50d0b-ce1f-4185-817f-cbf4d2939822",
          "id": "a7d50d0b-ce1f-4185-817f-cbf4d2939822",
          "molfile": "\n  Marvin  01132108432D          \n\n 14 13  0  0  0  0            999 V2000\n    5.4907   -5.6136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7734   -5.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7734   -4.3761    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.9484   -4.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7734   -3.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7734   -2.7224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5984   -4.3761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0109   -3.6616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8358   -3.6616    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.6608   -3.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8358   -2.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1187   -2.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8358   -4.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8358   -5.3153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  7  1  0  0  0  0\n  5  6  3  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  3  0  0  0  0\nM  END",
          "smiles": "CCC(C)(C#N)/N=N/C(C)(CC)C#N",
          "formula": "C10H16N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dbe1941b-1337-4f65-965c-955ae9b9c4ca"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "192.2612",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6e8e0444-4ef9-4a0d-ac65-4acc880046dc",
      "version": "3",
      "structure": {
        "id": "eed8709e-6af1-4d12-a74a-063cb3cda6eb",
        "molfile": "\n  Marvin  01132112222D          \n\n 14 13  0  0  0  0            999 V2000\n    4.7734   -4.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9484   -4.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7734   -3.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7734   -2.7224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7734   -5.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4907   -5.6136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5984   -4.3761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0109   -3.6616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8358   -3.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6608   -3.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8358   -4.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8358   -5.3153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8358   -2.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1187   -2.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  3  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  3  0  0  0  0\n  9 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
        "smiles": "CCC(C)(C#N)/N=N/C(C)(CC)C#N",
        "formula": "C10H16N4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "192.2612",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9d125a47-0591-46d9-b4f0-37ed91ea031f",
          "95fc4643-710d-4d67-a8d8-05f98e447bc8"
        ],
        "stereo_centers": 2
      },
      "unii": "5DCY6GCZ6V"
    }
  ]
}