{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a5f4ceff-d944-49a5-9635-0450fa7269c4",
          "code": "103-24-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=103-24-2",
          "code_system": "CAS",
          "references": [
            "f8b74f1f-cacf-44b1-ada7-c1b52252a041",
            "1b17bffe-c671-4120-850c-3ef498ee25f5"
          ]
        },
        {
          "uuid": "4d5539ce-7bc2-407d-bd2b-5040f94601f8",
          "code": "203-091-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.811",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f8b74f1f-cacf-44b1-ada7-c1b52252a041"
          ]
        },
        {
          "uuid": "60537705-8f1b-4a75-8edf-cc38fac83c5f",
          "code": "7642",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7642",
          "code_system": "PUBCHEM",
          "references": [
            "f8b74f1f-cacf-44b1-ada7-c1b52252a041"
          ]
        },
        {
          "uuid": "5e6d9263-f2db-e254-883d-be48b88170aa",
          "code": "2859",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2859",
          "code_system": "HSDB",
          "references": [
            "2d5a27ff-7187-2ba4-cc5b-6473e2671b35"
          ]
        },
        {
          "uuid": "93429782-31c0-4f31-7a0b-ea7aafa6fddf",
          "code": "DTXSID3026697",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3026697",
          "code_system": "EPA CompTox",
          "references": [
            "cf35b87a-ef49-e360-007a-bfa483ed5cca"
          ]
        },
        {
          "uuid": "e57d985e-91fd-4d78-a6c0-5f01cd52a8d6",
          "code": "5D67SBH6QB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "25e9ba59-555c-4fc7-a681-b8c04018562c",
          "name": "AZELAIC ACID, BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "AZELAIC ACID, BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "ee945f70-afd3-412b-bcfb-67324e2eba59"
          ],
          "display_name": false
        },
        {
          "uuid": "4f173f51-3720-4985-851a-51bca806c3f9",
          "name": "BIS(2-ETHYLHEXYL) AZELATE",
          "stdName": "BIS(2-ETHYLHEXYL) AZELATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "ee945f70-afd3-412b-bcfb-67324e2eba59"
          ],
          "display_name": true
        },
        {
          "uuid": "4055d9b7-6b9f-440a-bfcb-bc6ce1abea28",
          "name": "BIS(2-ETHYLHEXYL) NONANEDIOATE",
          "stdName": "BIS(2-ETHYLHEXYL) NONANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "ee945f70-afd3-412b-bcfb-67324e2eba59"
          ],
          "display_name": false
        },
        {
          "uuid": "421ddc59-05d6-40ba-b87a-c823206c3197",
          "name": "DI-2-ETHYLHEXYL AZELATE",
          "stdName": "DI-2-ETHYLHEXYL AZELATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "2394adb8-e291-4a45-92b8-65037074357a",
            "ee945f70-afd3-412b-bcfb-67324e2eba59",
            "91df4a93-3901-40e1-8233-b3a0c5975960"
          ],
          "display_name": false
        },
        {
          "uuid": "38aef28e-5627-4c34-82c9-dcdea128509a",
          "name": "DI-2-ETHYLHEXYL AZELATE [HSDB]",
          "stdName": "DI-2-ETHYLHEXYL AZELATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "2394adb8-e291-4a45-92b8-65037074357a"
          ],
          "display_name": false
        },
        {
          "uuid": "f35b5254-e379-4f02-ad2f-5129cf6e8c63",
          "name": "DIOCTYL NONANEDIOATE",
          "stdName": "DIOCTYL NONANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "ee945f70-afd3-412b-bcfb-67324e2eba59"
          ],
          "display_name": false
        },
        {
          "uuid": "e523058f-1f57-4c54-8176-f7d0d21890bb",
          "name": "DOZ",
          "stdName": "DOZ",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "2394adb8-e291-4a45-92b8-65037074357a"
          ],
          "display_name": false
        },
        {
          "uuid": "e54802be-938f-4159-bc25-653a0355aae2",
          "name": "EMERY 2958",
          "stdName": "EMERY 2958",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "2394adb8-e291-4a45-92b8-65037074357a"
          ],
          "display_name": false
        },
        {
          "uuid": "f102688f-1a83-4197-bbe5-acdfbe97d4d3",
          "name": "NONANEDIOIC ACID, 1,9-BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "NONANEDIOIC ACID, 1,9-BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "ee945f70-afd3-412b-bcfb-67324e2eba59"
          ],
          "display_name": false
        },
        {
          "uuid": "f062a006-4f35-4790-987b-d4cd782b201a",
          "name": "PLASTOLEIN 9058",
          "stdName": "PLASTOLEIN 9058",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "2394adb8-e291-4a45-92b8-65037074357a"
          ],
          "display_name": false
        },
        {
          "uuid": "873a78d3-c4c7-4885-958e-163bb0f3e046",
          "name": "TRUFLEX DOX",
          "stdName": "TRUFLEX DOX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3134ab55-55a0-41d6-9953-9db98afc6792",
            "2394adb8-e291-4a45-92b8-65037074357a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2394adb8-e291-4a45-92b8-65037074357a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3134ab55-55a0-41d6-9953-9db98afc6792",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee945f70-afd3-412b-bcfb-67324e2eba59",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8b74f1f-cacf-44b1-ada7-c1b52252a041",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392045000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff5cdc11-84e7-42b9-b818-d55e095b7f28",
          "citation": "SRS import [5D67SBH6QB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5D67SBH6QB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392045000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91df4a93-3901-40e1-8233-b3a0c5975960",
          "citation": "DI-2-ETHYLHEXYL AZELATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d5a27ff-7187-2ba4-cc5b-6473e2671b35",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+103-24-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cf35b87a-ef49-e360-007a-bfa483ed5cca",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=103-24-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b17bffe-c671-4120-850c-3ef498ee25f5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "eb1b9b57-31b9-44c4-8d15-ab68aaed27c6",
          "id": "eb1b9b57-31b9-44c4-8d15-ab68aaed27c6",
          "molfile": "\n  Marvin  01132112102D          \n\n 29 28  0  0  0  0            999 V2000\n    7.8592    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1447   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4302    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7158   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.0013    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7158    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5724    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2868   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0013    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -5.0013    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7158    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7158   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.4302    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -7.1447   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -7.8592    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 26  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)CCCCCCCC(=O)OCC(CC)CCCC",
          "formula": "C25H48O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f60ace7e-1f21-4414-b071-63f3e377709e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "412.6472",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d1718855-3d6b-4b5a-b8aa-83bd63b0565b",
      "version": "4",
      "structure": {
        "id": "35404e96-bc5f-41e6-9b13-e2be57c15c8d",
        "molfile": "\n  Marvin  01132102502D          \n\n 29 28  0  0  0  0            999 V2000\n   -2.8579   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5724    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7158   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4302    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1447   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8592    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7158    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2868   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0013    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7158   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.4302    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -7.1447   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -7.8592    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0013    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7158    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  1 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n  9 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 15 20  1  0  0  0  0\n 13 14  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 23 28  1  0  0  0  0\n 11 22  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)CCCCCCCC(=O)OCC(CC)CCCC",
        "formula": "C25H48O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "412.6472",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ee945f70-afd3-412b-bcfb-67324e2eba59",
          "ff5cdc11-84e7-42b9-b818-d55e095b7f28"
        ],
        "stereo_centers": 2
      },
      "unii": "5D67SBH6QB"
    }
  ]
}