{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d12ee6c9-2b61-4f3f-9844-563e88a32aff",
          "code": "65-46-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=65-46-3",
          "code_system": "CAS",
          "references": [
            "14b1903d-469a-473b-93b7-d1ec55cf3867",
            "9910b2f7-9103-4150-8519-1f6b7954cb2f"
          ]
        },
        {
          "uuid": "6a3e7f08-bea3-4111-8931-60975d8749d7",
          "code": "C409",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C409",
          "code_system": "NCI_THESAURUS",
          "references": [
            "14b1903d-469a-473b-93b7-d1ec55cf3867"
          ]
        },
        {
          "uuid": "aa41fb82-f58f-4b3f-bd30-6387bce965f4",
          "code": "D003562",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68003562",
          "code_system": "MESH",
          "references": [
            "14b1903d-469a-473b-93b7-d1ec55cf3867"
          ]
        },
        {
          "uuid": "779d5817-2519-4a0e-8e24-70c5cf472e40",
          "code": "CYTIDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cytidine",
          "code_system": "WIKIPEDIA",
          "references": [
            "14b1903d-469a-473b-93b7-d1ec55cf3867"
          ]
        },
        {
          "uuid": "2d2abc00-a895-4d03-acef-8fd9017a8413",
          "code": "200-610-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.555",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "14b1903d-469a-473b-93b7-d1ec55cf3867"
          ]
        },
        {
          "uuid": "1c743d3b-870f-4cee-a16d-c537ef3813b0",
          "code": "m4053",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4053?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "14b1903d-469a-473b-93b7-d1ec55cf3867"
          ]
        },
        {
          "uuid": "61f8c082-f6d0-4ade-b65e-67a67c4e19ae",
          "code": "SUB22640",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "14b1903d-469a-473b-93b7-d1ec55cf3867"
          ]
        },
        {
          "uuid": "8161d2f7-ae75-4ec4-9730-50f72595d884",
          "code": "6175",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6175",
          "code_system": "PUBCHEM",
          "references": [
            "14b1903d-469a-473b-93b7-d1ec55cf3867"
          ]
        },
        {
          "uuid": "48344f52-a58a-4db4-6323-24589a3129b9",
          "code": "DTXSID60891552",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60891552",
          "code_system": "EPA CompTox",
          "references": [
            "2ec3a46f-b0e4-f8c2-140a-f1190021ac2f"
          ]
        },
        {
          "uuid": "59ead80d-f7e3-2288-5d5e-2a111f76ad23",
          "code": "C707",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Nucleic Acids, Nucleosides, and Nucleotides[C708]|Nucleoside",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "786e8a07-625a-2822-aa27-fdadbe1ce2a4"
          ]
        },
        {
          "uuid": "7b588bef-4314-d278-1888-7dd5370390a6",
          "code": "79671-4",
          "comments": "LOINC|ACTIVE|CHEM|CSF|Cytidine [Moles/volume] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/79671-4/",
          "code_system": "LOINC",
          "references": [
            "786e8a07-625a-2822-aa27-fdadbe1ce2a4"
          ]
        },
        {
          "uuid": "c1102591-c6c4-5a6e-a9fc-73b2b96434c6",
          "code": "79684-7",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Cytidine/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/79684-7/",
          "code_system": "LOINC",
          "references": [
            "786e8a07-625a-2822-aa27-fdadbe1ce2a4"
          ]
        },
        {
          "uuid": "fdd6502b-3973-ec16-534f-5d4b8844f6bf",
          "code": "79675-5",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Cytidine [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/79675-5/",
          "code_system": "LOINC",
          "references": [
            "786e8a07-625a-2822-aa27-fdadbe1ce2a4"
          ]
        },
        {
          "uuid": "3bebc95f-158d-84a3-5590-b59d22656b41",
          "code": "4271 (Number of products:1)",
          "comments": "Dietary Supplement Label Database|chemical|Cytidine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=4271&item=Cytidine",
          "code_system": "DSLD",
          "references": [
            "786e8a07-625a-2822-aa27-fdadbe1ce2a4"
          ]
        },
        {
          "uuid": "1652b01e-5c60-7727-ed67-118884889209",
          "code": "DB02097",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02097",
          "code_system": "DRUG BANK",
          "references": [
            "786e8a07-625a-2822-aa27-fdadbe1ce2a4"
          ]
        },
        {
          "uuid": "82fe2c4a-fd2c-40cb-b15e-47c213c488d9",
          "code": "5CSZ8459RP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4b242668-5c2e-bfa3-f4a3-1c543e71b4d6",
          "code": "17562",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17562",
          "code_system": "CHEBI",
          "references": [
            "786e8a07-625a-2822-aa27-fdadbe1ce2a4"
          ]
        },
        {
          "uuid": "df8e61e2-e685-0a21-3fe5-f3d5a3ad9015",
          "code": "100000089044",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "da08eb80-7ca0-f2a3-2936-afc8d541f51e"
          ]
        },
        {
          "uuid": "535a6e56-db32-f75a-8cb4-601ed7097566",
          "code": "20258",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=20258",
          "code_system": "NSC",
          "references": [
            "d541d7c0-f296-0746-ab0b-80e78e8e924c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "be8ee1e3-e7df-459a-bff4-a3ffad38fdae",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c3290381-2527-4d27-9a99-bea5f57bf86e",
            "refuuid": "6aa9d4ac-9a79-4142-a014-285924575813",
            "name": "CYTIDINE",
            "unii": "5CSZ8459RP",
            "linking_id": "5CSZ8459RP",
            "ref_pname": "CYTIDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "82bf903a-cdf2-48c0-b33d-832a3044c14d",
          "amount": {
            "uuid": "51251685-7f4a-4f96-a8b5-ffb687889639"
          },
          "type": "PARENT->IMPURITY",
          "references": [
            "3b0affa4-09f6-40e9-af67-21085d98e896"
          ],
          "related_substance": {
            "uuid": "2cd83c1e-7f08-43d3-8169-be207f9bf2f3",
            "refuuid": "2b258dc9-0ac3-44df-bc57-7712751e5cbe",
            "name": "CYTARABINE",
            "unii": "04079A1RDZ",
            "linking_id": "04079A1RDZ",
            "ref_pname": "CYTARABINE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "793400ff-767a-4ba8-b0ce-a462cfa66734",
          "name": "CYTIDINE",
          "stdName": "CYTIDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55316643-823f-43e6-a255-e4e1e6042a01",
            "3608161f-494c-4d44-82fa-56ff8c82b6be",
            "e813ae2a-bade-41c6-b89b-c33012d76411",
            "9f2ab754-7f71-45d8-a0d8-7ba20585931a",
            "2b2a8b00-cd41-44d0-9f14-bbb4599c0f8a",
            "ec5c1198-ed28-484c-a67a-5fdeef0fe05e",
            "9a2fc02a-611e-4e3b-8769-bb0748fec774",
            "70dfbd9e-2635-423d-9d3a-a2a7461f07ac",
            "2539eb33-b338-43b0-9d3a-fbd143a2881f",
            "ae2dd84d-64f9-4846-befb-5c96b4f478fa"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bf23ab28-6374-43a7-a6db-49af4c2a9e08",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a1ca245d-e993-49af-9c52-95c87b2d432c",
          "name": "CYTIDINE [MART.]",
          "stdName": "CYTIDINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2539eb33-b338-43b0-9d3a-fbd143a2881f"
          ],
          "display_name": false
        },
        {
          "uuid": "641bab0f-5654-463e-9506-b76aba0317a2",
          "name": "CYTIDINE [MI]",
          "stdName": "CYTIDINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3608161f-494c-4d44-82fa-56ff8c82b6be",
            "e813ae2a-bade-41c6-b89b-c33012d76411"
          ],
          "display_name": false
        },
        {
          "uuid": "64ce5915-b6bd-60bd-5a84-ee7f672f784f",
          "name": "Cytidine [WHO-DD]",
          "stdName": "CYTIDINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5efc3248-df8a-3af5-8742-cb70e9b83ad9"
          ],
          "display_name": false
        },
        {
          "uuid": "f92aa7fa-c07c-4839-b858-e274efb82b15",
          "name": "NSC-20258",
          "stdName": "NSC-20258",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7252a46-e1d8-4a11-9ed8-c08dfd109973",
            "e813ae2a-bade-41c6-b89b-c33012d76411"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "55316643-823f-43e6-a255-e4e1e6042a01",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e813ae2a-bade-41c6-b89b-c33012d76411",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2539eb33-b338-43b0-9d3a-fbd143a2881f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3608161f-494c-4d44-82fa-56ff8c82b6be",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70dfbd9e-2635-423d-9d3a-a2a7461f07ac",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b2a8b00-cd41-44d0-9f14-bbb4599c0f8a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7252a46-e1d8-4a11-9ed8-c08dfd109973",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14b1903d-469a-473b-93b7-d1ec55cf3867",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a933fa58-cc79-4f6d-be69-710fcc89ce46",
          "citation": "SRS import [5CSZ8459RP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5CSZ8459RP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a2fc02a-611e-4e3b-8769-bb0748fec774",
          "citation": "CYTIDINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae2dd84d-64f9-4846-befb-5c96b4f478fa",
          "citation": "CYTIDINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9f2ab754-7f71-45d8-a0d8-7ba20585931a",
          "citation": "CYTIDINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ec5c1198-ed28-484c-a67a-5fdeef0fe05e",
          "citation": "CYTIDINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "da08eb80-7ca0-f2a3-2936-afc8d541f51e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "786e8a07-625a-2822-aa27-fdadbe1ce2a4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9910b2f7-9103-4150-8519-1f6b7954cb2f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3b0affa4-09f6-40e9-af67-21085d98e896",
          "citation": "EP",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "d541d7c0-f296-0746-ab0b-80e78e8e924c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5efc3248-df8a-3af5-8742-cb70e9b83ad9",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2ec3a46f-b0e4-f8c2-140a-f1190021ac2f",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e3988eb4-a40f-470c-b8ca-c330a6202f61",
          "id": "e3988eb4-a40f-470c-b8ca-c330a6202f61",
          "molfile": "\n  Marvin  01132111472D          \n\n 17 18  0  0  1  0            999 V2000\n    9.7551   -5.4838    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.7655   -4.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8500   -4.7075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4352   -5.0044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1068   -5.5118    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.1254   -4.1503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8000   -3.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8115   -2.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1008   -2.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1120   -1.6689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3835   -2.8924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3721   -3.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7794   -4.0561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8448   -6.2815    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.3244   -6.9474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0052   -6.2700    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.5265   -6.9277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 16  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n 14  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 12  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  6  0  0  0\nM  END",
          "smiles": "c1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)c(=O)nc1N",
          "formula": "C9H13N3O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b4d459f1-af38-473d-bc3a-bd7a752b8463"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "243.217",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6aa9d4ac-9a79-4142-a014-285924575813",
      "version": "19",
      "structure": {
        "id": "c24a98e8-2d4f-4eb1-ab9a-7389a41d9265",
        "molfile": "\n  Marvin  01132110032D          \n\n 17 18  0  0  1  0            999 V2000\n   11.1254   -4.1503    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n   11.1068   -5.5118    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.8448   -6.2815    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.0052   -6.2700    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.5265   -6.9277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7551   -5.4838    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.4352   -5.0044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7655   -4.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8500   -4.7075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3244   -6.9474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3721   -3.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3835   -2.8924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1008   -2.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8115   -2.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8000   -3.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1120   -1.6689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7794   -4.0561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  1  0  0  0  0\n  6  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n  3 10  1  6  0  0  0\n 11  1  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15  1  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 11  2  0  0  0  0\nM  END",
        "smiles": "c1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)c(=O)nc1N",
        "formula": "C9H13N3O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "243.217",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a933fa58-cc79-4f6d-be69-710fcc89ce46",
          "55316643-823f-43e6-a255-e4e1e6042a01"
        ],
        "stereo_centers": 4
      },
      "unii": "5CSZ8459RP"
    }
  ]
}