{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fd758164-d0cb-7482-ec5e-24bef3655e88",
          "code": "109971",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/109971",
          "code_system": "PUBCHEM",
          "references": [
            "e9ac6dd3-14a9-94cc-ab8b-402d2900c292"
          ]
        },
        {
          "uuid": "0ca32166-b7fa-4a45-b948-532711fb32b2",
          "code": "5C67LDQ3J4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "eaf96485-3274-44b0-89f5-1fd097c9a496",
          "name": "DISODIUM CAPRYLOAMPHODIACETATE",
          "stdName": "DISODIUM CAPRYLOAMPHODIACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cad23c43-e903-4c44-8a62-e14aed1d2182",
            "f75c9850-3d7f-4a95-b32e-9c029b3c099e",
            "055a49c6-7d20-4fbe-b377-b45acd83f329",
            "a1a356fa-4359-469b-bc36-bf1e87ff334e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "97c6b3f8-7a58-4743-b7f7-8401981449a2",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "cad23c43-e903-4c44-8a62-e14aed1d2182",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "055a49c6-7d20-4fbe-b377-b45acd83f329",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f75c9850-3d7f-4a95-b32e-9c029b3c099e",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "988153be-e9e7-455c-971b-e5d16a0329e8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391015000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00685e08-3c9e-4ff5-933c-bf63f35bafa7",
          "citation": "SRS import [5C67LDQ3J4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5C67LDQ3J4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391015000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1a356fa-4359-469b-bc36-bf1e87ff334e",
          "citation": "DISODIUM CAPRYLOAMPHODIACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e9ac6dd3-14a9-94cc-ab8b-402d2900c292",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b2caf185-838a-4caa-856e-599467f29870",
          "id": "b2caf185-838a-4caa-856e-599467f29870",
          "molfile": "\n  Marvin  01132109162D          \n\n  1  0  0  0  0  0            999 V2000\n    7.8878   -5.1688    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "d2142a46-9e38-4169-b200-f4e75b235e36"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e69b9d14-2510-44fb-861e-77642ec27d65",
          "id": "e69b9d14-2510-44fb-861e-77642ec27d65",
          "molfile": "\n  Marvin  01132111562D          \n\n 24 23  0  0  0  0            999 V2000\n   10.2353   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5208   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8108   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0964   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3816   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6672   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9527   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2381   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2381   -2.5947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5236   -1.3574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8136   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0991   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3846   -1.7699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3846   -2.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0991   -3.0071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0991   -3.8319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8136   -4.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8136   -5.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5236   -5.3271    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.0991   -5.4815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6699   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9554   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9554   -2.5947    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.2409   -1.3574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 21  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\nM  CHG  2  19  -1  23  -1\nM  END",
          "smiles": "CCCCCCCC(=O)NCCN(CCOCC(=O)[O-])CC(=O)[O-]",
          "formula": "C16H28N2O6",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a6d8034f-bf75-4414-b7fc-6907d4164c3a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "344.404",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0d9bad6b-b165-45b7-9f0e-1d0ad1e64353",
      "version": "5",
      "structure": {
        "id": "4c4050fd-0552-4542-9c1d-ddd7e45fa3fc",
        "molfile": "\n  Marvin  01132103592D          \n\n 26 23  0  0  0  0            999 V2000\n    0.9554   -2.5947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9554   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2409   -1.3574    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.6699   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3846   -1.7699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0991   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8136   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5236   -1.3574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2381   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2381   -2.5947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9527   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6672   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3816   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0964   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8108   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5208   -1.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2353   -1.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3846   -2.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0991   -3.0071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0991   -3.8319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8136   -4.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8136   -5.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5236   -5.3271    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.0991   -5.4815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8878   -5.1688    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    7.8878   -5.1688    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n  5 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n  2  1  2  0  0  0  0\nM  CHG  4   3  -1  23  -1  25   1  26   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  25  26\nM  SPA   1  1  25\nM  SDI   1  4    7.4678   -5.5888    7.4678   -4.7488\nM  SDI   1  4    8.3078   -4.7488    8.3078   -5.5888\nM  SMT   1 2\nM  END",
        "smiles": "CCCCCCCC(=O)NCCN(CCOCC(=O)[O-])CC(=O)[O-].[Na+].[Na+]",
        "formula": "C16H28N2O6.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "390.3835",
        "optical_activity": "NONE",
        "references": [
          "cad23c43-e903-4c44-8a62-e14aed1d2182",
          "00685e08-3c9e-4ff5-933c-bf63f35bafa7"
        ],
        "stereo_centers": 0
      },
      "unii": "5C67LDQ3J4"
    }
  ]
}