{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "819e0022-36c9-47cd-9a28-60d04d1e48c4",
          "code": "5BNC061EBB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "03305967-28e3-469b-bfc0-925ac83cbcc2",
          "code": "1863065-92-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1863065-92-2",
          "code_system": "CAS",
          "references": [
            "be545b5a-58f3-4e89-8ca3-4736340591f0",
            "57c97e5e-db1e-4189-a33b-d94484d2b8a7"
          ]
        },
        {
          "uuid": "55bacee3-566c-4668-9e0e-4cdf211e0d00",
          "code": "7032",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I. |Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "be545b5a-58f3-4e89-8ca3-4736340591f0"
          ]
        },
        {
          "uuid": "2167ee08-19c8-4ab8-9618-137c0956c250",
          "code": "77565944",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/77565944",
          "code_system": "PUBCHEM",
          "references": [
            "be545b5a-58f3-4e89-8ca3-4736340591f0"
          ]
        },
        {
          "uuid": "5f481745-d22a-595b-fe73-19ba401d2115",
          "code": "DTXSID301016900",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301016900",
          "code_system": "EPA CompTox",
          "references": [
            "42eb800f-f387-252b-1f30-497ca7c44133"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6a68fb4f-0e76-4bbf-a445-883a4ac92ca2",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ba0e9359-1373-4fe4-be8e-85c615cac7f4",
            "refuuid": "5fa0816d-9a14-43ef-b90d-017ec5759f81",
            "name": "ADB-CHMINACA, (±)-",
            "unii": "5BNC061EBB",
            "linking_id": "5BNC061EBB",
            "ref_pname": "ADB-CHMINACA, (±)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1e675952-06b6-45d9-b8bc-0920598c2367",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "48f8690a-eaf2-4cb6-9b58-15bffb328f3a",
            "refuuid": "715a7ad6-be4a-4cea-8acb-a0ca345a395d",
            "name": "ADB-CHMINACA",
            "unii": "SL4C60689M",
            "linking_id": "SL4C60689M",
            "ref_pname": "ADB-CHMINACA",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2d0f1072-8a3d-4e2f-b6e8-ba6531d75432",
          "name": "1H-INDAZOLE-3-CARBOXAMIDE, N-(1-(AMINOCARBONYL)-2,2-DIMETHYLPROPYL)-1-(CYCLOHEXYLMETHYL)-",
          "stdName": "1H-INDAZOLE-3-CARBOXAMIDE, N-(1-(AMINOCARBONYL)-2,2-DIMETHYLPROPYL)-1-(CYCLOHEXYLMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c13c87d9-1ced-4aaf-9603-1e3392687aff",
            "c72aa0d0-b91e-4e74-8c46-8a80e937c8ff"
          ],
          "display_name": false
        },
        {
          "uuid": "586fcd25-c833-4afc-acdf-bc391abde247",
          "name": "ADB-CHMINACA, (±)-",
          "stdName": "ADB-CHMINACA, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c72aa0d0-b91e-4e74-8c46-8a80e937c8ff",
            "330c1817-bafa-449c-a1d6-4bbdc0d68e6d"
          ],
          "display_name": true
        },
        {
          "uuid": "4fc975ef-c805-461d-b121-a0c569ffdf68",
          "name": "MAB-CHMINACA, (±)-",
          "stdName": "MAB-CHMINACA, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b47c7f54-9039-4c30-99eb-16a65e2dcadb",
            "c72aa0d0-b91e-4e74-8c46-8a80e937c8ff"
          ],
          "display_name": false
        },
        {
          "uuid": "3576282e-dc38-4ccb-bf22-3aa4285a20d9",
          "name": "N-(1-AMINO-3,3-DIMETHYL-1-OXOBUTAN-2-YL)-1-(CYCLOHEXYLMETHYL)-1H-INDAZOLE-3-CARBOXAMIDE",
          "stdName": "N-(1-AMINO-3,3-DIMETHYL-1-OXOBUTAN-2-YL)-1-(CYCLOHEXYLMETHYL)-1H-INDAZOLE-3-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c72aa0d0-b91e-4e74-8c46-8a80e937c8ff",
            "b0bdc4d2-1d5d-4570-b984-13525344e11d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b0bdc4d2-1d5d-4570-b984-13525344e11d",
          "citation": "Said IOUGHLISSEN-French ANSM; 2/17/2016 E-Mail List",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c72aa0d0-b91e-4e74-8c46-8a80e937c8ff",
          "citation": "ORPHAN DRUG",
          "doc_type": "ORPHAN DRUG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "330c1817-bafa-449c-a1d6-4bbdc0d68e6d",
          "citation": "ORPHAN DRUG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c13c87d9-1ced-4aaf-9603-1e3392687aff",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b47c7f54-9039-4c30-99eb-16a65e2dcadb",
          "citation": "https://en.wikipedia.org/wiki/ADB-CHMINACA",
          "url": "https://en.wikipedia.org/wiki/ADB-CHMINACA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be545b5a-58f3-4e89-8ca3-4736340591f0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393252000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0be62979-33dc-4fae-b9cc-6b2399dff40e",
          "citation": "SRS import [5BNC061EBB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5BNC061EBB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393252000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57c97e5e-db1e-4189-a33b-d94484d2b8a7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "42eb800f-f387-252b-1f30-497ca7c44133",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "90bb0615-6a12-4f22-9f86-f102054e54a8",
          "id": "90bb0615-6a12-4f22-9f86-f102054e54a8",
          "molfile": "\n  Marvin  01132107302D          \n\n 27 29  0  0  0  0            999 V2000\n    7.2755   -2.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1005   -2.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5505   -1.8713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3480   -1.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6506   -3.0813    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.3755   -3.8788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5781   -4.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0280   -3.4388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3306   -4.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7980   -5.5013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3306   -6.1613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5781   -6.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3755   -7.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9530   -6.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7505   -6.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9980   -7.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4480   -8.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6506   -7.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5330   -5.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8180   -6.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1031   -5.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1031   -5.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8180   -4.6763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5330   -5.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4480   -2.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9980   -3.5213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6955   -2.1463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n 25  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 24  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 24 19  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)C(C(=O)N)NC(=O)c1c2ccccc2n(CC3CCCCC3)n1",
          "formula": "C21H30N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c4623386-4774-44b8-bd4e-40f265ce6f7b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "370.4893",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5fa0816d-9a14-43ef-b90d-017ec5759f81",
      "version": "7",
      "structure": {
        "id": "afa3ec7d-88c7-4665-a9f5-100ededc55d0",
        "molfile": "\n  Marvin  01132109062D          \n\n 27 29  0  0  0  0            999 V2000\n    7.3306   -6.1613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7980   -5.5013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3306   -4.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5330   -5.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8180   -4.6763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1031   -5.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1031   -5.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8180   -6.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5330   -5.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5781   -4.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0280   -3.4388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3755   -3.8788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6506   -3.0813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4480   -2.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6955   -2.1463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9980   -3.5213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1005   -2.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2755   -2.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5505   -1.8713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3480   -1.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5781   -6.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3755   -7.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9530   -6.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7505   -6.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9980   -7.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4480   -8.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6506   -7.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  9  2  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 13 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n  1 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 22 27  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)C(C(=O)N)NC(=O)c1c2ccccc2n(CC3CCCCC3)n1",
        "formula": "C21H30N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "370.4893",
        "optical_activity": "( + / - )",
        "references": [
          "0be62979-33dc-4fae-b9cc-6b2399dff40e",
          "b0bdc4d2-1d5d-4570-b984-13525344e11d"
        ],
        "stereo_centers": 1
      },
      "unii": "5BNC061EBB"
    }
  ]
}