{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f86cdc07-09d7-443a-a751-0f4b0a3bb66c",
          "code": "4046-02-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4046-02-0",
          "code_system": "CAS",
          "references": [
            "ad26ecae-a12f-46c3-926d-d3f18190ac42",
            "db353ddb-03e2-47ee-ba71-dd9310b01eff"
          ]
        },
        {
          "uuid": "22f88165-121d-4514-b8c5-a68775cd65a8",
          "code": "C83699",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83699",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ad26ecae-a12f-46c3-926d-d3f18190ac42"
          ]
        },
        {
          "uuid": "54621b16-bdb1-4a92-bad6-11bc0bafa971",
          "code": "C099085",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67099085",
          "code_system": "MESH",
          "references": [
            "ad26ecae-a12f-46c3-926d-d3f18190ac42"
          ]
        },
        {
          "uuid": "09bd8fd4-9914-4cf6-91ff-84cdf45eb12e",
          "code": "223-745-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.587",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ad26ecae-a12f-46c3-926d-d3f18190ac42"
          ]
        },
        {
          "uuid": "3e4c3655-1448-481a-9965-d905648e79ac",
          "code": "1420983",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1420983/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ad26ecae-a12f-46c3-926d-d3f18190ac42"
          ]
        },
        {
          "uuid": "e522c308-7fbb-4266-843c-9af0f39cd589",
          "code": "736681",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/736681",
          "code_system": "PUBCHEM",
          "references": [
            "ad26ecae-a12f-46c3-926d-d3f18190ac42"
          ]
        },
        {
          "uuid": "efb1b815-ac9c-f675-32dc-ee63b132620d",
          "code": "C275",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Antioxidant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C275",
          "code_system": "NCI_THESAURUS",
          "references": [
            "84d1b327-2576-f808-9cc6-701c4a778489"
          ]
        },
        {
          "uuid": "55fb8e4e-1230-4cf8-f2d0-dad52bcc5e16",
          "code": "DB11285",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11285",
          "code_system": "DRUG BANK",
          "references": [
            "84d1b327-2576-f808-9cc6-701c4a778489"
          ]
        },
        {
          "uuid": "88d6a889-28c1-4ae1-9127-16cfb683f58e",
          "code": "5B8915UELW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9a85a2f6-4da8-c04b-a370-6cf612f40e1b",
          "code": "DTXSID001021502",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001021502",
          "code_system": "EPA CompTox",
          "references": [
            "84d1b327-2576-f808-9cc6-701c4a778489"
          ]
        },
        {
          "uuid": "4194ebb5-92fd-71b7-7a38-d5c5bb1159ae",
          "code": "14879",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=14879",
          "code_system": "NSC",
          "references": [
            "d1112877-917c-89ad-85a7-8eed16c0d79d"
          ]
        },
        {
          "uuid": "807c1ed8-77f3-8ddf-b491-ac9985909412",
          "code": "5B8915UELW",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5B8915UELW",
          "code_system": "DAILYMED",
          "references": [
            "668e8a5d-fd49-4619-f14e-abef912cb1d5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e454cc4f-4c44-431a-a89e-b52c42d4b3ba",
          "name": "2-PROPENOIC ACID, 3-(4-HYDROXY-3-METHOXYPHENYL)-, ETHYL ESTER",
          "stdName": "2-PROPENOIC ACID, 3-(4-HYDROXY-3-METHOXYPHENYL)-, ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6c75ff1-04ef-4f45-95ca-41f95f7b6f33",
            "6193e877-c9c2-49b3-a8f8-7897ce21a82f"
          ],
          "display_name": false
        },
        {
          "uuid": "0cbbdea5-875a-425c-8806-a913bd86c5f7",
          "name": "ETHYL 4'-HYDROXY-3'-METHOXYCINNAMAT",
          "stdName": "ETHYL 4'-HYDROXY-3'-METHOXYCINNAMAT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6c75ff1-04ef-4f45-95ca-41f95f7b6f33",
            "6193e877-c9c2-49b3-a8f8-7897ce21a82f"
          ],
          "display_name": false
        },
        {
          "uuid": "5d8d74d5-492e-48e9-9e88-d36cf33eb270",
          "name": "ETHYL FERULATE",
          "stdName": "ETHYL FERULATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6c75ff1-04ef-4f45-95ca-41f95f7b6f33",
            "28eeb8fb-a755-4050-9cff-0b122b467ed8",
            "27a24a48-9cfa-4d9a-9c29-0cc88788eb78",
            "6193e877-c9c2-49b3-a8f8-7897ce21a82f",
            "fc945044-5ae1-4af3-bec8-5692efb2e1d6"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "28865f8a-cf84-4569-b908-e6b8a0f24447",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c3993a65-f2c8-412c-956a-a8b4f938b8b4",
          "name": "NOMCORT EF",
          "stdName": "NOMCORT EF",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e15b9f1f-6c30-434e-96cb-7d166a6ad8ee",
            "6193e877-c9c2-49b3-a8f8-7897ce21a82f"
          ],
          "display_name": false
        },
        {
          "uuid": "34b355f8-3b06-3078-9262-03c0bc8e3d18",
          "name": "NSC-14879",
          "stdName": "NSC-14879",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1112877-917c-89ad-85a7-8eed16c0d79d"
          ],
          "display_name": false
        },
        {
          "uuid": "b6b2369d-7f13-499b-ab8e-8623aecde570",
          "name": "ORISTRACT EF",
          "stdName": "ORISTRACT EF",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e15b9f1f-6c30-434e-96cb-7d166a6ad8ee",
            "6193e877-c9c2-49b3-a8f8-7897ce21a82f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a6c75ff1-04ef-4f45-95ca-41f95f7b6f33",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "27a24a48-9cfa-4d9a-9c29-0cc88788eb78",
          "citation": "DL",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6193e877-c9c2-49b3-a8f8-7897ce21a82f",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc945044-5ae1-4af3-bec8-5692efb2e1d6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e15b9f1f-6c30-434e-96cb-7d166a6ad8ee",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad26ecae-a12f-46c3-926d-d3f18190ac42",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390720000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b8f4f2d-0e59-4e0b-8980-5d05e684a199",
          "citation": "SRS import [5B8915UELW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5B8915UELW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390720000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28eeb8fb-a755-4050-9cff-0b122b467ed8",
          "citation": "ETHYL FERULATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "84d1b327-2576-f808-9cc6-701c4a778489",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "db353ddb-03e2-47ee-ba71-dd9310b01eff",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d1112877-917c-89ad-85a7-8eed16c0d79d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "668e8a5d-fd49-4619-f14e-abef912cb1d5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9121a57b-5449-41e0-ab0a-dd07939aa009",
          "id": "9121a57b-5449-41e0-ab0a-dd07939aa009",
          "molfile": "\n  Marvin  01132107312D          \n\n 16 16  0  0  0  0            999 V2000\n   -0.3325   -3.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3820   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0965   -3.0206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8110   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8110   -1.7831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5255   -3.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2400   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9545   -3.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9545   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6690   -4.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3834   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0979   -4.2581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3834   -3.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0979   -2.6081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0979   -1.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6690   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 16  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 16  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)/C=C/c1ccc(c(c1)OC)O",
          "formula": "C12H14O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0c95122a-0529-429d-9da6-29655de588a2"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "222.2376",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5c0d7d85-e18e-4ab6-8086-c021cfab7786",
      "version": "9",
      "structure": {
        "id": "72a0ade0-a8e3-4e8b-9959-65e9b56245ab",
        "molfile": "\n  Marvin  01132105562D          \n\n 16 16  0  0  0  0            999 V2000\n    1.8110   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5255   -3.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2400   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9545   -3.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6690   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3834   -3.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0979   -2.6081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0979   -1.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3834   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6690   -4.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9545   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0979   -4.2581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0965   -3.0206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3820   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3325   -3.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8110   -1.7831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  6  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11  4  2  0  0  0  0\n 12  9  1  0  0  0  0\n 13  1  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16  1  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)/C=C/c1ccc(c(c1)OC)O",
        "formula": "C12H14O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "222.2376",
        "optical_activity": "NONE",
        "references": [
          "a6c75ff1-04ef-4f45-95ca-41f95f7b6f33",
          "2b8f4f2d-0e59-4e0b-8980-5d05e684a199"
        ],
        "stereo_centers": 0
      },
      "unii": "5B8915UELW"
    }
  ]
}