{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0c9e802b-2221-41e5-b575-9fb81b065349",
          "code": "260415-43-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=260415-43-8",
          "code_system": "CAS",
          "references": [
            "b4d01a61-a8ac-4048-8d9d-29e90cffc95a",
            "b13a69f4-0f47-43a7-91ac-738a4714378f"
          ]
        },
        {
          "uuid": "421aca2f-d96d-4756-969f-0621389d2cd3",
          "code": "71587682",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587682",
          "code_system": "PUBCHEM",
          "references": [
            "b4d01a61-a8ac-4048-8d9d-29e90cffc95a"
          ]
        },
        {
          "uuid": "dab0ff12-5179-6fb1-acc7-814978cc0d60",
          "code": "DTXSID50180689",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50180689",
          "code_system": "EPA CompTox",
          "references": [
            "0e0b1924-f1f1-6c21-e3bb-3e0c022dad07"
          ]
        },
        {
          "uuid": "e80f47c6-a6ae-4f56-8f2d-a21f4e499bfe",
          "code": "5B6MP73J6W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "619dc01a-4ca5-4df3-8c4d-e64f5537cfad",
          "name": "DIPOTASSIUM CAPRYLOYL GLUTAMATE",
          "stdName": "DIPOTASSIUM CAPRYLOYL GLUTAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8449d59-124b-46ea-a2df-4666db76acf7",
            "260f88b6-4f4e-4979-baf8-d1ead2aa021e",
            "65bb8de8-45b1-4628-8e00-22ff38aec772"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "43ace7d9-f386-4ab5-ac37-9a95ac44f608",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1228d5a1-d250-43a1-bff2-85113b3e4e18",
          "name": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, DIPOTASSIUM SALT",
          "stdName": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, DIPOTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5d1bf57-0e47-410e-bf97-66d9b291ccc2",
            "65bb8de8-45b1-4628-8e00-22ff38aec772"
          ],
          "display_name": false
        },
        {
          "uuid": "5aecd988-2741-48ac-9738-9352dca9b00d",
          "name": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, POTASSIUM SALT (1:2)",
          "stdName": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, POTASSIUM SALT (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5d1bf57-0e47-410e-bf97-66d9b291ccc2",
            "65bb8de8-45b1-4628-8e00-22ff38aec772"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "260f88b6-4f4e-4979-baf8-d1ead2aa021e",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "65bb8de8-45b1-4628-8e00-22ff38aec772",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5d1bf57-0e47-410e-bf97-66d9b291ccc2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4d01a61-a8ac-4048-8d9d-29e90cffc95a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391547000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "843d38cf-3251-4590-b7b9-bffd646c3b9d",
          "citation": "SRS import [5B6MP73J6W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5B6MP73J6W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391547000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8449d59-124b-46ea-a2df-4666db76acf7",
          "citation": "DIPOTASSIUM CAPRYLOYL GLUTAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0e0b1924-f1f1-6c21-e3bb-3e0c022dad07",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=260415-43-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b13a69f4-0f47-43a7-91ac-738a4714378f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "80f03580-e8ae-483e-ae0f-69f181a9d29a",
          "id": "80f03580-e8ae-483e-ae0f-69f181a9d29a",
          "molfile": "\n  Marvin  01132106422D          \n\n  1  0  0  0  1  0            999 V2000\n    6.5482   -6.6805    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "c7f805e6-3d88-46e1-9380-a02bdba2d442"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "4da03bbb-287d-4c67-8c39-179cdc279545",
          "id": "4da03bbb-287d-4c67-8c39-179cdc279545",
          "molfile": "\n  Marvin  01132104032D          \n\n 19 18  0  0  1  0            999 V2000\n   11.3113   -7.9751    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.5968   -7.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8824   -7.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1679   -7.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1679   -6.7377    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.4535   -7.9751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3113   -8.8001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5968   -9.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5968  -10.0375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8824   -8.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1679   -9.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -8.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7390   -9.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0246   -8.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3102   -9.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5957   -8.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0258   -7.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0258   -6.7377    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.7402   -7.9751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  1  0  0  0\n  1 17  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\nM  CHG  2   5  -1  18  -1\nM  END",
          "smiles": "CCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-]",
          "formula": "C13H21NO5",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d299da23-0e55-4704-8c5b-73b4f4900eb0"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "271.3101",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "db9091fc-1b41-4c90-8762-7f8bf5d001b2",
      "version": "4",
      "structure": {
        "id": "796fdd98-6e84-4838-91d7-57f626afff07",
        "molfile": "\n  Marvin  01132106192D          \n\n 21 18  0  0  1  0            999 V2000\n    6.5482   -6.6805    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n   11.3113   -7.9751    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.3113   -8.8001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5968   -9.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5968  -10.0375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8824   -8.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1679   -9.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -8.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7390   -9.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0246   -8.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3102   -9.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5957   -8.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0258   -7.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0258   -6.7377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7402   -7.9751    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.5968   -7.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8824   -7.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1679   -7.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1679   -6.7377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -7.9751    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   14.1217   -8.8302    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  1  1  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  2 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n  2 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\nM  CHG  4   1   1  15  -1  20  -1  21   1\nM  END",
        "smiles": "CCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[K+].[K+]",
        "formula": "C13H21NO5.2K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "349.5067",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c5d1bf57-0e47-410e-bf97-66d9b291ccc2",
          "843d38cf-3251-4590-b7b9-bffd646c3b9d"
        ],
        "stereo_centers": 1
      },
      "unii": "5B6MP73J6W"
    }
  ]
}