{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7a5500f9-6c27-4f88-ace1-32ea96ba86d9",
          "code": "171269-68-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=171269-68-4",
          "code_system": "CAS",
          "references": [
            "e078885c-df0f-4e00-8557-fc19bdf85150",
            "62e132b0-8c11-4ede-bc36-65827face302"
          ]
        },
        {
          "uuid": "d3cf47b4-5dad-4591-b793-67ddeb7ee330",
          "code": "11076632",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11076632",
          "code_system": "PUBCHEM",
          "references": [
            "e078885c-df0f-4e00-8557-fc19bdf85150"
          ]
        },
        {
          "uuid": "1023499a-7347-4c80-af11-f380e6a76729",
          "code": "5971874U76",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e9864c8a-194b-dd00-223f-db928067885d",
          "code": "DTXSID60937964",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60937964",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a63462d7-9042-4e06-a98e-7d2e4f16aff6",
          "name": "(±)-ETHYLPENTYL METHOXYCHROMONE",
          "stdName": "(+/-)-ETHYLPENTYL METHOXYCHROMONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f824112-1fc8-46d2-bf1c-32c5ad0a8914",
            "ba5f0877-84f8-4dbf-8bcf-e49b2ce20318"
          ],
          "display_name": false
        },
        {
          "uuid": "4c0c21bf-86ec-4b2b-ad3c-357507f67c02",
          "name": "4H-1-BENZOPYRAN-4-ONE, 2-(1-ETHYLPENTYL)-7-METHOXY-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 2-(1-ETHYLPENTYL)-7-METHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f824112-1fc8-46d2-bf1c-32c5ad0a8914",
            "bd3df6e1-4694-4134-9e85-74de6dc19635"
          ],
          "display_name": false
        },
        {
          "uuid": "b77ef12e-647e-46c3-a73e-ef80721f66a1",
          "name": "ETHYLPENTYL METHOXYCHROMONE",
          "stdName": "ETHYLPENTYL METHOXYCHROMONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f824112-1fc8-46d2-bf1c-32c5ad0a8914",
            "2b2bc58d-b6ee-4f1d-93eb-3ead419ce31d",
            "bd3df6e1-4694-4134-9e85-74de6dc19635"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "57766a45-1a5b-424a-9226-12359850e8c7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a8b31e8c-280c-4b84-a520-f9ac1ef1364f",
          "name": "ETHYLPENTYL METHOXYCHROMONE, (±)-",
          "stdName": "ETHYLPENTYL METHOXYCHROMONE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f824112-1fc8-46d2-bf1c-32c5ad0a8914",
            "ba5f0877-84f8-4dbf-8bcf-e49b2ce20318"
          ],
          "display_name": false
        },
        {
          "uuid": "2a027406-29b6-4a1c-897b-4ce578c65893",
          "name": "MA-293",
          "stdName": "MA-293",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f824112-1fc8-46d2-bf1c-32c5ad0a8914",
            "bd3df6e1-4694-4134-9e85-74de6dc19635"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bd3df6e1-4694-4134-9e85-74de6dc19635",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0f824112-1fc8-46d2-bf1c-32c5ad0a8914",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba5f0877-84f8-4dbf-8bcf-e49b2ce20318",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e078885c-df0f-4e00-8557-fc19bdf85150",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dd15100-c885-4fc2-b5ca-301f49e5db3a",
          "citation": "SRS import [5971874U76]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5971874U76",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7efefeb0-a0f2-4f6e-aff9-afa6c56a06bc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b2bc58d-b6ee-4f1d-93eb-3ead419ce31d",
          "citation": "ETHYLPENTYL METHOXYCHROMONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62e132b0-8c11-4ede-bc36-65827face302",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "166bb927-5905-4a9c-a9af-865ed55bc0d4",
          "id": "166bb927-5905-4a9c-a9af-865ed55bc0d4",
          "molfile": "\n  Marvin  01132101222D          \n\n 20 21  0  0  0  0            999 V2000\n    7.8169   -7.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5176   -7.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2452   -7.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9458   -7.8038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6734   -7.4147    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.7003   -6.5902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9997   -6.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3741   -7.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3472   -8.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0479   -9.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0479   -9.9356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7754   -8.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4792   -9.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2039   -8.7657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2288   -7.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9398   -7.5347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9398   -6.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5280   -7.5096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8023   -7.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1017   -7.4614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 20  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 19  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 18  2  0  0  0  0\n 16 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)c1cc(=O)c2ccc(cc2o1)OC",
          "formula": "C17H22O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b91e48f4-f627-498b-a64e-a4d4597ef267"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "274.3554",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0d16af69-66bc-402a-93e6-d6338ed65c74",
      "version": "4",
      "structure": {
        "id": "75b3b431-7112-485d-8ebe-8814c173a5fa",
        "molfile": "\n  Marvin  01132106062D          \n\n 20 21  0  0  0  0            999 V2000\n   11.3741   -7.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6734   -7.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9458   -7.8038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2452   -7.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5176   -7.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8169   -7.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7003   -6.5902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9997   -6.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3472   -8.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0479   -9.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7754   -8.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8023   -7.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1017   -7.4614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5280   -7.5096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2288   -7.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4792   -9.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2039   -8.7657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9398   -7.5347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0479   -9.9356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9398   -6.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12 13  1  0  0  0  0\n 11 12  2  0  0  0  0\n 10 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n 13  1  1  0  0  0  0\n  1  9  2  0  0  0  0\n 17 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 15 14  2  0  0  0  0\n 11 16  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 18  1  0  0  0  0\n 10 19  2  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)c1cc(=O)c2ccc(cc2o1)OC",
        "formula": "C17H22O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "274.3554",
        "optical_activity": "( + / - )",
        "references": [
          "9dd15100-c885-4fc2-b5ca-301f49e5db3a",
          "7efefeb0-a0f2-4f6e-aff9-afa6c56a06bc"
        ],
        "stereo_centers": 1
      },
      "unii": "5971874U76"
    }
  ]
}