{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a84f31a8-5d73-4521-ad8d-da4d254f5af8",
          "code": "D11AX01",
          "comments": "ATC|DERMATOLOGICALS|OTHER DERMATOLOGICAL PREPARATIONS|OTHER DERMATOLOGICAL PREPARATIONS|Other dermatologicals|minoxidil",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D11AX01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "92008a94-6987-4877-8c1d-d6fcb46761c4",
          "code": "C02DC01",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|ANTIHYPERTENSIVES|ARTERIOLAR SMOOTH MUSCLE, AGENTS ACTING ON|Pyrimidine derivatives|minoxidil",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C02DC01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "e70bbc9f-a01f-479a-baeb-3612ebdd72ff",
          "code": "N0000175564",
          "comments": "Established Pharmacologic Class [EPC]|Arteriolar Vasodilator [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175564",
          "code_system": "NDF-RT",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "234d4883-406d-4c92-b0ce-fcd9d35dc607",
          "code": "N0000175379",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Cardiovascular Activity Alteration [PE]|Vascular Alterations [PE]|Vascular Tone Alteration [PE]|Vasodilation [PE]|Arterial Vasodilation [PE]|Arteriolar Vasodilation [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175379",
          "code_system": "NDF-RT",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "2b542a6b-ce2f-4a08-bf70-e6eb77691563",
          "code": "QC02DC01",
          "comments": "VATC|ANTIHYPERTENSIVES|ARTERIOLAR SMOOTH MUSCLE, AGENTS ACTING ON|Pyrimidine derivatives|minoxidil",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC02DC01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "659040fb-65d1-4665-9e05-a98c0b3c97df",
          "code": "38304-91-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=38304-91-5",
          "code_system": "CAS",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1",
            "f920ca8e-85aa-48ba-9a16-691982abf4d1"
          ]
        },
        {
          "uuid": "ed449c25-d004-4bc6-94f3-0a2a97fb1e15",
          "code": "C47623",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47623",
          "code_system": "NCI_THESAURUS",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "3cfec86a-4501-4c2b-ba49-2272bb0b8a60",
          "code": "D008914",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008914",
          "code_system": "MESH",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "d06845c4-2481-4925-91c8-39685e000ca6",
          "code": "NBK548394",
          "comments": "LiverTox|Cardiac|Antihypertensive|Miscellaneous",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548394/",
          "code_system": "LIVERTOX",
          "references": [
            "102b6b8c-6c2e-098a-7de3-e8acf2cdfc24"
          ]
        },
        {
          "uuid": "e749ff50-8d14-44f2-bdff-342d9a83cf0e",
          "code": "MINOXIDIL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Minoxidil",
          "code_system": "WIKIPEDIA",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "e6cee3c1-a08c-4ee0-803b-27c941a445dc",
          "code": "QD11AX01",
          "comments": "VATC|OTHER DERMATOLOGICAL PREPARATIONS|OTHER DERMATOLOGICAL PREPARATIONS|Other dermatologicals|minoxidil, topical",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD11AX01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "259f806e-a8eb-4e80-911b-e2d7c4df329d",
          "code": "16317-69-4",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16317-69-4",
          "code_system": "CAS",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1",
            "ce0d18fd-0549-488d-ab22-e0da405289be"
          ]
        },
        {
          "uuid": "f9243808-e957-4101-b045-8d8dbbbe7901",
          "code": "SUB08982MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "83bc8253-3339-4c35-9454-200d4fd29998",
          "code": "2987",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2987",
          "code_system": "INN",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "d35cb6dd-6123-4397-bd5d-81a45655f307",
          "code": "253-874-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.048.959",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "147eb68d-3f80-4fa1-a081-c5096b3025b5",
          "code": "4254",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4254",
          "code_system": "IUPHAR",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "0c003623-1c81-4a1c-8538-3dab4f0f6e9e",
          "code": "6984",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6984/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "c9f2cab3-7583-464d-8f88-0748390e3b3c",
          "code": "m7555",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7555?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "78b59436-369a-4f40-95f2-bf298944fc65",
          "code": "DB00350",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00350",
          "code_system": "DRUG BANK",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "b76b31ad-f292-4680-a685-46665cd3f26a",
          "code": "CHEMBL802",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL802",
          "code_system": "ChEMBL",
          "references": [
            "dc441b03-6bb5-425f-97b9-dd4b1ff889c1"
          ]
        },
        {
          "uuid": "467ae223-302e-5570-d6a5-060ad7d69530",
          "code": "6538",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6538",
          "code_system": "HSDB",
          "references": [
            "18975920-a226-ed46-bab1-2efa5951c81a"
          ]
        },
        {
          "uuid": "6d7077ab-4d4c-fc34-7825-d6f2e1bbd503",
          "code": "DTXSID9040685",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9040685",
          "code_system": "EPA CompTox",
          "references": [
            "5bb6b592-0fd7-48e3-6452-f7bf4211b5f4"
          ]
        },
        {
          "uuid": "d11a1298-7dce-4c75-95fc-3a67a304e638",
          "code": "Minoxidil",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM184/",
          "code_system": "LACTMED",
          "references": [
            "102b6b8c-6c2e-098a-7de3-e8acf2cdfc24"
          ]
        },
        {
          "uuid": "0a86c200-df9f-bb27-9708-7d07d8083ff7",
          "code": "C270",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Antihypertensive Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C270",
          "code_system": "NCI_THESAURUS",
          "references": [
            "102b6b8c-6c2e-098a-7de3-e8acf2cdfc24"
          ]
        },
        {
          "uuid": "f2f42491-9e1d-e02a-d07d-53c986a53e75",
          "code": "C29707",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Vasodilating Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "102b6b8c-6c2e-098a-7de3-e8acf2cdfc24"
          ]
        },
        {
          "uuid": "341ff15c-7316-4704-a833-052943e66c88",
          "code": "5965120SH1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9eb10498-a6e9-6181-556a-339b698f4488",
          "code": "1814",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1814",
          "code_system": "DRUG CENTRAL",
          "references": [
            "102b6b8c-6c2e-098a-7de3-e8acf2cdfc24"
          ]
        },
        {
          "uuid": "84602817-052c-ee0c-e48e-89638b01f6e2",
          "code": "6942",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6942",
          "code_system": "CHEBI",
          "references": [
            "102b6b8c-6c2e-098a-7de3-e8acf2cdfc24"
          ]
        },
        {
          "uuid": "829b72c2-bbbf-fc02-dabc-6af2e1897908",
          "code": "1444208",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1444208",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "102b6b8c-6c2e-098a-7de3-e8acf2cdfc24"
          ]
        },
        {
          "uuid": "4e03e009-3f24-0cb7-1af9-22262ebc4281",
          "code": "100000090366",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cf2f1891-0ae3-67a0-825c-ddb2f05a2ad3"
          ]
        },
        {
          "uuid": "a08638ff-549d-34fa-b70a-174119a76e58",
          "code": "5965120SH1",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5965120SH1",
          "code_system": "DAILYMED",
          "references": [
            "5ab0d010-235a-29e6-85d7-62097f10f36c"
          ]
        },
        {
          "uuid": "f8d87856-1f1a-1e7b-8718-05db2a8c0c4f",
          "code": "757106",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757106",
          "code_system": "NSC",
          "references": [
            "da41ee5b-94ec-a4c4-ac2a-97e470f8f3ca"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e1af75bf-f265-421c-b391-9db6acd8aed5",
          "amount": {
            "uuid": "06f6d45e-d248-46f1-a2b8-014b5da435db"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ed230bf7-e1ef-433d-b79e-06403049b0c2",
            "refuuid": "b446f099-52f6-4ef4-b3e9-ac83fbe1006a",
            "name": "MINOXIDIL",
            "unii": "5965120SH1",
            "linking_id": "5965120SH1",
            "ref_pname": "MINOXIDIL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d5fc1442-db14-4ca5-9375-bf40a2c44ab3",
          "amount": {
            "uuid": "832b0af1-ac1b-4465-be5a-7eb1b472840a"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "0ee91dca-6dfc-436e-93a8-1138c362677a",
            "refuuid": "0f600dfb-5a46-424e-93a4-b7369fc6030a",
            "name": "MINOXIDIL TARTRATE",
            "unii": "70J7ZH7ECA",
            "linking_id": "70J7ZH7ECA",
            "ref_pname": "MINOXIDIL TARTRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d3e06182-d613-40e2-a0a5-74a882327af7",
          "amount": {
            "uuid": "d1049382-69de-45fe-90f1-9064031f3046"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "5bb0293a-c6d4-4a5a-9272-6827515eee32"
          ],
          "related_substance": {
            "uuid": "9f6c749f-9f31-44b9-9df3-02aa51280022",
            "refuuid": "582e8750-8990-489b-86c1-77c6f5620c5c",
            "name": "MINOXIDIL SULFATE ESTER",
            "unii": "2H6K6Y231J",
            "linking_id": "2H6K6Y231J",
            "ref_pname": "MINOXIDIL SULFATE ESTER"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "49ab399a-0226-4b64-af7f-c23cd0677106",
          "name": "2,4-DIAMINO-6-PIPERIDINOPYRIMIDINE 3-OXIDE.",
          "stdName": "2,4-DIAMINO-6-PIPERIDINOPYRIMIDINE 3-OXIDE.",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a79eb58-dac8-417f-9e22-e670365c5f81"
          ],
          "display_name": false
        },
        {
          "uuid": "2f486fc8-240a-41db-822b-9c570c5bae92",
          "name": "2,4-PYRIMIDINEDIAMINE, 6-(1-PIPERIDINYL)-, 3-OXIDE",
          "stdName": "2,4-PYRIMIDINEDIAMINE, 6-(1-PIPERIDINYL)-, 3-OXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a79eb58-dac8-417f-9e22-e670365c5f81"
          ],
          "display_name": false
        },
        {
          "uuid": "49b027a1-18a2-4ce0-9663-956e30badca3",
          "name": "ALOPEXIL",
          "stdName": "ALOPEXIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e636e23-601c-48bd-a310-65b55a29422c"
          ],
          "display_name": false
        },
        {
          "uuid": "c99c3602-badc-4109-a25c-2cb95f80ef3f",
          "name": "ALOSTIL",
          "stdName": "ALOSTIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e636e23-601c-48bd-a310-65b55a29422c"
          ],
          "display_name": false
        },
        {
          "uuid": "5e2648be-17f7-4597-babe-8dfed32f1e88",
          "name": "LONITEN",
          "stdName": "LONITEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f973cba6-4f9a-4825-bd35-e2327eef5c1c"
          ],
          "display_name": false
        },
        {
          "uuid": "c9b72b7f-0332-40e7-b093-196ad178f004",
          "name": "LONOLOX",
          "stdName": "LONOLOX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e636e23-601c-48bd-a310-65b55a29422c"
          ],
          "display_name": false
        },
        {
          "uuid": "ded885a7-60dd-46f6-b883-9ff1e079e261",
          "name": "MINODYL",
          "stdName": "MINODYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b25c4d4b-e57a-4679-876d-5cbd7701ce72"
          ],
          "display_name": false
        },
        {
          "uuid": "7799cf41-1365-41d2-85db-9497f9d5e1b1",
          "name": "MINOXIDIL",
          "stdName": "MINOXIDIL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d677118-d628-4229-baff-632243cfebc7",
            "9628e86a-f757-422b-9f17-34bca3c30399",
            "22e298b2-a2af-4efb-b3bf-88ccee9a5ccc",
            "f2909838-a139-4984-82d8-1f92e4a58168",
            "95e46c09-e509-41aa-bbc7-8463b126ef28",
            "6a92ef24-27c2-4bfc-a6fe-683b0164a413",
            "3b050d1e-5c48-4c31-b406-f9f7a79b2b9d",
            "cdc13005-32e4-4b46-91d1-4a6d792d44fc",
            "9f4415ae-89a7-45e5-ad66-289ad5ed520d",
            "5d8f0b4e-4b90-4a79-9bd8-796daa688a5c",
            "cc529c66-93ba-4409-9abd-b567451add68",
            "587e263c-d782-41ec-91d2-6a7c2ad89cf6",
            "24d92a1c-750a-4e5c-b863-6c2fdb8a2bc7",
            "46ec1db9-911b-4ffb-9971-f3d02bc8977f",
            "001af94b-6824-4895-bb97-43348c6723ef",
            "15e79c4a-5000-4247-880f-e9530ad1572a",
            "d9699236-2f78-40b7-9717-7c27538b1ad1",
            "96bbecb2-8685-4c96-8ffd-da40d2e31b30",
            "f7d0b3b3-78da-4f53-9a3b-11c4d2b607e5",
            "c3b9d014-91b7-4f02-b119-d8aabe448775",
            "341b8a70-6104-4423-98c6-b5d27f762186",
            "25c7f32d-b850-499d-a1ed-504b0df8166f",
            "c9a491a2-bf65-4ad3-a3f2-49d27f6988ad",
            "69163f39-81dd-4970-9ff2-4ff466067d7a",
            "df5c691d-8e42-476a-9910-d2b77e4072d8"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c99b4248-1259-41ed-b115-4377bec18587",
              "name_org": "INN"
            },
            {
              "uuid": "1ceb4a46-ff57-41a5-a178-cad450afab49",
              "name_org": "USAN"
            },
            {
              "uuid": "2ba8eb9a-d976-452a-8371-c842ace06046",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "39303a0a-9dee-7dc3-5ae4-99ee9cb11db5",
          "name": "MINOXIDIL [EP MONOGRAPH]",
          "stdName": "MINOXIDIL [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47e4e57f-8e0f-0324-f31f-c7140c77460e"
          ],
          "display_name": false
        },
        {
          "uuid": "aa081199-a070-4112-ad64-3a68450cfc0d",
          "name": "MINOXIDIL [HSDB]",
          "stdName": "MINOXIDIL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "df5c691d-8e42-476a-9910-d2b77e4072d8"
          ],
          "display_name": false
        },
        {
          "uuid": "08c70fc1-e2cd-4b12-988e-a293c584d09d",
          "name": "MINOXIDIL [JAN]",
          "stdName": "MINOXIDIL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81e7053a-059a-26ea-f136-1559e75ea122"
          ],
          "display_name": false
        },
        {
          "uuid": "5be03ead-fd3c-47aa-977c-0942bc169f81",
          "name": "MINOXIDIL [MART.]",
          "stdName": "MINOXIDIL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25c7f32d-b850-499d-a1ed-504b0df8166f"
          ],
          "display_name": false
        },
        {
          "uuid": "a18b893a-1b2f-4d96-848d-25750e87eed2",
          "name": "MINOXIDIL [MI]",
          "stdName": "MINOXIDIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24d92a1c-750a-4e5c-b863-6c2fdb8a2bc7"
          ],
          "display_name": false
        },
        {
          "uuid": "db7b2300-ccf8-4e72-89bb-ebd9ae741454",
          "name": "MINOXIDIL [ORANGE BOOK]",
          "stdName": "MINOXIDIL [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9a491a2-bf65-4ad3-a3f2-49d27f6988ad"
          ],
          "display_name": false
        },
        {
          "uuid": "36db3bc2-7f73-4cf3-bd79-35bb6c41fa98",
          "name": "MINOXIDIL [USAN]",
          "stdName": "MINOXIDIL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69163f39-81dd-4970-9ff2-4ff466067d7a"
          ],
          "display_name": false
        },
        {
          "uuid": "05494244-600c-fada-ee2c-854c4d58f1ee",
          "name": "MINOXIDIL [USP MONOGRAPH]",
          "stdName": "MINOXIDIL [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd5f198a-391a-29cc-25f2-b349595405d0"
          ],
          "display_name": false
        },
        {
          "uuid": "1d046213-d68d-4149-978d-fd758cb1ade2",
          "name": "MINOXIDIL [USP-RS]",
          "stdName": "MINOXIDIL [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7d0b3b3-78da-4f53-9a3b-11c4d2b607e5"
          ],
          "display_name": false
        },
        {
          "uuid": "75cf0bfd-3c47-41a6-af1c-b096f6acabb1",
          "name": "MINOXIDIL [VANDF]",
          "stdName": "MINOXIDIL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22e298b2-a2af-4efb-b3bf-88ccee9a5ccc"
          ],
          "display_name": false
        },
        {
          "uuid": "60e0d1fd-eff5-4ccd-bc6d-9f7b85e7cb91",
          "name": "MINOXIMEN",
          "stdName": "MINOXIMEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e636e23-601c-48bd-a310-65b55a29422c"
          ],
          "display_name": false
        },
        {
          "uuid": "590004bc-ec4d-4586-94e3-bdd48a70c455",
          "name": "MINTOP",
          "stdName": "MINTOP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e636e23-601c-48bd-a310-65b55a29422c"
          ],
          "display_name": false
        },
        {
          "uuid": "c7e983e0-447e-c355-647b-ed330a81e6d6",
          "name": "Minoxidil [WHO-DD]",
          "stdName": "MINOXIDIL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10ba1c4f-3d96-1379-ffec-46c3a7a550bc"
          ],
          "display_name": false
        },
        {
          "uuid": "a11a0d14-ffc4-4761-b033-f15fa8719728",
          "name": "NORMOXIDIL",
          "stdName": "NORMOXIDIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e636e23-601c-48bd-a310-65b55a29422c"
          ],
          "display_name": false
        },
        {
          "uuid": "5764714e-dbad-8539-de34-f2699946344f",
          "name": "NSC-757106",
          "stdName": "NSC-757106",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da41ee5b-94ec-a4c4-ac2a-97e470f8f3ca"
          ],
          "display_name": false
        },
        {
          "uuid": "87b5adfd-a212-42f2-aaf6-1d27c6afaaae",
          "name": "PIERMINOX",
          "stdName": "PIERMINOX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e636e23-601c-48bd-a310-65b55a29422c"
          ],
          "display_name": false
        },
        {
          "uuid": "ff5dca63-e249-48d7-a09e-e8460f979b15",
          "name": "PREXIDIL",
          "stdName": "PREXIDIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e636e23-601c-48bd-a310-65b55a29422c"
          ],
          "display_name": false
        },
        {
          "uuid": "f0bfc224-603c-4267-940e-e429901970ca",
          "name": "RIUP",
          "stdName": "RIUP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60e3ca96-aecb-481d-bcaa-3f4aa685f808",
            "295d2f9f-779c-4694-bdef-9ebe7a43b1f3"
          ],
          "display_name": false
        },
        {
          "uuid": "75ee7296-3ec7-44be-9913-cd18cfdc2d26",
          "name": "ROGAINE",
          "stdName": "ROGAINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96bbecb2-8685-4c96-8ffd-da40d2e31b30"
          ],
          "display_name": false
        },
        {
          "uuid": "c06db085-e8ce-4d16-8727-15d1316e6f55",
          "name": "THEROXIDIL",
          "stdName": "THEROXIDIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b25c4d4b-e57a-4679-876d-5cbd7701ce72"
          ],
          "display_name": false
        },
        {
          "uuid": "0e16f964-3728-4e25-81f1-c611c4b06c8d",
          "name": "TRICOXIDIL",
          "stdName": "TRICOXIDIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e636e23-601c-48bd-a310-65b55a29422c"
          ],
          "display_name": false
        },
        {
          "uuid": "763b4a8a-3042-4b0c-ba1f-4ebc459e94b3",
          "name": "U-10,858",
          "stdName": "U-10,858",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a79eb58-dac8-417f-9e22-e670365c5f81"
          ],
          "display_name": false
        },
        {
          "uuid": "edd8d986-24c7-47dc-a854-31b7631d01b9",
          "name": "U-10858",
          "stdName": "U-10858",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db0debc7-1389-4f93-a410-6775c0c0ab2c"
          ],
          "display_name": false
        },
        {
          "uuid": "c1d0aade-f820-41f3-8b46-c58d91ef6336",
          "name": "minoxidil [INN]",
          "stdName": "MINOXIDIL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "341b8a70-6104-4423-98c6-b5d27f762186"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "96bbecb2-8685-4c96-8ffd-da40d2e31b30",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2a79eb58-dac8-417f-9e22-e670365c5f81",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db0debc7-1389-4f93-a410-6775c0c0ab2c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f973cba6-4f9a-4825-bd35-e2327eef5c1c",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b25c4d4b-e57a-4679-876d-5cbd7701ce72",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "341b8a70-6104-4423-98c6-b5d27f762186",
          "citation": "INN Proposed List 40",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL40.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "69163f39-81dd-4970-9ff2-4ff466067d7a",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "587e263c-d782-41ec-91d2-6a7c2ad89cf6",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc529c66-93ba-4409-9abd-b567451add68",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9a491a2-bf65-4ad3-a3f2-49d27f6988ad",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25c7f32d-b850-499d-a1ed-504b0df8166f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24d92a1c-750a-4e5c-b863-6c2fdb8a2bc7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "295d2f9f-779c-4694-bdef-9ebe7a43b1f3",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60e3ca96-aecb-481d-bcaa-3f4aa685f808",
          "citation": "D00418",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9628e86a-f757-422b-9f17-34bca3c30399",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22e298b2-a2af-4efb-b3bf-88ccee9a5ccc",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df5c691d-8e42-476a-9910-d2b77e4072d8",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7d0b3b3-78da-4f53-9a3b-11c4d2b607e5",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f4415ae-89a7-45e5-ad66-289ad5ed520d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e636e23-601c-48bd-a310-65b55a29422c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc441b03-6bb5-425f-97b9-dd4b1ff889c1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389748000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "959909cc-67f8-4586-8d30-1a36b51fb640",
          "citation": "SRS import [5965120SH1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5965120SH1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389748000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15e79c4a-5000-4247-880f-e9530ad1572a",
          "citation": "MINOXIDIL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "001af94b-6824-4895-bb97-43348c6723ef",
          "citation": "MINOXIDIL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cdc13005-32e4-4b46-91d1-4a6d792d44fc",
          "citation": "MINOXIDIL [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3b050d1e-5c48-4c31-b406-f9f7a79b2b9d",
          "citation": "MINOXIDIL [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "95e46c09-e509-41aa-bbc7-8463b126ef28",
          "citation": "MINOXIDIL [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c3b9d014-91b7-4f02-b119-d8aabe448775",
          "citation": "MINOXIDIL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d9699236-2f78-40b7-9717-7c27538b1ad1",
          "citation": "MINOXIDIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f2909838-a139-4984-82d8-1f92e4a58168",
          "citation": "MINOXIDIL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d677118-d628-4229-baff-632243cfebc7",
          "citation": "MINOXIDIL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6a92ef24-27c2-4bfc-a6fe-683b0164a413",
          "citation": "MINOXIDIL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46ec1db9-911b-4ffb-9971-f3d02bc8977f",
          "citation": "MINOXIDIL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5d8f0b4e-4b90-4a79-9bd8-796daa688a5c",
          "citation": "MINOXIDIL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "81e7053a-059a-26ea-f136-1559e75ea122",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "18975920-a226-ed46-bab1-2efa5951c81a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+38304-91-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5bb6b592-0fd7-48e3-6452-f7bf4211b5f4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=38304-91-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fc1a99a7-f687-fd78-eb7a-68a304b5906d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+38304-91-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cf2f1891-0ae3-67a0-825c-ddb2f05a2ad3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "102b6b8c-6c2e-098a-7de3-e8acf2cdfc24",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ce0d18fd-0549-488d-ab22-e0da405289be",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f920ca8e-85aa-48ba-9a16-691982abf4d1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5bb0293a-c6d4-4a5a-9272-6827515eee32",
          "citation": "Drug Metab Dispos 1983;11(5):507",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd5f198a-391a-29cc-25f2-b349595405d0",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "da41ee5b-94ec-a4c4-ac2a-97e470f8f3ca",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "47e4e57f-8e0f-0324-f31f-c7140c77460e",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "10ba1c4f-3d96-1379-ffec-46c3a7a550bc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5ab0d010-235a-29e6-85d7-62097f10f36c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4bb56cc0-94f3-4287-aacb-47535bc9631e",
          "id": "4bb56cc0-94f3-4287-aacb-47535bc9631e",
          "molfile": "\n  Marvin  01132103572D          \n\n 15 16  0  0  0  0            999 V2000\n    0.8250    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2362   -0.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0715   -0.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4698   -1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0715   -2.1439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2362   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250   -2.8499    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250   -1.4224    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4224    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.2999   -1.4224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7163   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5413   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9525   -1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5413   -0.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7163   -0.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n 10  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\nM  CHG  2   8   1   9  -1\nM  END",
          "smiles": "C1CCN(CC1)c2cc(N)[n+](c(N)n2)[O-]",
          "formula": "C9H15N5O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "525810b1-10d5-40b3-bae6-81f823a72f03"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "209.2487",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b446f099-52f6-4ef4-b3e9-ac83fbe1006a",
      "version": "47",
      "structure": {
        "id": "ff6f69f6-5506-4557-b43d-1b83cbe1fcc4",
        "molfile": "\n  Marvin  01132113132D          \n\n 15 16  0  0  0  0            999 V2000\n    0.8250   -1.4224    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    1.2362   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0715   -2.1439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4698   -1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2362   -0.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0715   -0.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2999   -1.4224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4224    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.8250   -2.8499    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7163   -0.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7163   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5413   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5413   -0.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9525   -1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  6  2  0  0  0  0\n  5  1  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 13  1  0  0  0  0\n  3  4  1  0  0  0  0\n 14 15  1  0  0  0  0\nM  CHG  2   1   1   8  -1\nM  END",
        "smiles": "C1CCN(CC1)c2cc(N)[n+](c(N)n2)[O-]",
        "formula": "C9H15N5O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "209.2487",
        "optical_activity": "NONE",
        "references": [
          "96bbecb2-8685-4c96-8ffd-da40d2e31b30",
          "959909cc-67f8-4586-8d30-1a36b51fb640",
          "341b8a70-6104-4423-98c6-b5d27f762186"
        ],
        "stereo_centers": 0
      },
      "unii": "5965120SH1"
    }
  ]
}