{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "52597d3d-d114-4dbc-b9a3-195dd7861cb4",
          "code": "302-40-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=302-40-9",
          "code_system": "CAS",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954",
            "d018d998-6fc9-4586-82d1-05daaf0121c9"
          ]
        },
        {
          "uuid": "8f020365-9311-435a-b799-13f5465fb6d2",
          "code": "C81454",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81454",
          "code_system": "NCI_THESAURUS",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954"
          ]
        },
        {
          "uuid": "15adaf00-ca56-425e-9697-deb2052fc3ea",
          "code": "D001535",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001535",
          "code_system": "MESH",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954"
          ]
        },
        {
          "uuid": "c16259af-905b-4b78-85ef-7a18a4e4abdd",
          "code": "BENACTYZINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Benactyzine",
          "code_system": "WIKIPEDIA",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954"
          ]
        },
        {
          "uuid": "8e546229-064f-4ed2-ae68-c4fec343f9cd",
          "code": "SUB05696MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954"
          ]
        },
        {
          "uuid": "2dbc0a6d-82a3-45ed-b70a-573e65344adc",
          "code": "496",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=496",
          "code_system": "INN",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954"
          ]
        },
        {
          "uuid": "b3cc3d62-d16c-479e-b559-0171643069ce",
          "code": "1361",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1361/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954"
          ]
        },
        {
          "uuid": "85693e40-19f9-4909-9619-2522b4fcd44f",
          "code": "m2301",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2301?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954"
          ]
        },
        {
          "uuid": "5ae79d3c-fcc2-4fef-b904-f703bfe1ae27",
          "code": "CHEMBL70352",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL70352",
          "code_system": "ChEMBL",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954"
          ]
        },
        {
          "uuid": "ef76c46c-d4af-4ef2-835f-50a6690f12af",
          "code": "206-123-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.568",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954"
          ]
        },
        {
          "uuid": "eb69bc9b-257c-43f8-ba0c-6852725eb5da",
          "code": "9330",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9330",
          "code_system": "PUBCHEM",
          "references": [
            "85048331-0642-4091-9986-1be7a5132954"
          ]
        },
        {
          "uuid": "3a06af52-c3d7-c9a6-47cc-a08445ad4e56",
          "code": "3292",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3292",
          "code_system": "HSDB",
          "references": [
            "e88d3836-06a3-520c-ebcf-d6bc092ce860"
          ]
        },
        {
          "uuid": "74471803-a79e-a435-4838-04855491d147",
          "code": "DTXSID0022644",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0022644",
          "code_system": "EPA CompTox",
          "references": [
            "43d13b37-4522-117f-2332-111c87c5a412"
          ]
        },
        {
          "uuid": "1b3dae6a-8f90-fd81-41e6-bf447ee671c5",
          "code": "C29704",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticholinergic Agent[C66880]|Antimuscarinic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29704",
          "code_system": "NCI_THESAURUS",
          "references": [
            "89105661-3fb5-e19b-0d6b-b2b0a5dc2ab0"
          ]
        },
        {
          "uuid": "fc1c0f46-dbdc-48ac-b682-9a13a52ee210",
          "code": "595EG71R3F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2d49df41-5510-d347-c8c5-aa12b03903b0",
          "code": "298",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/298",
          "code_system": "DRUG CENTRAL",
          "references": [
            "89105661-3fb5-e19b-0d6b-b2b0a5dc2ab0"
          ]
        },
        {
          "uuid": "d50b9109-722f-8ef9-1daf-c7fef2d0f193",
          "code": "DB09023",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB09023",
          "code_system": "DRUG BANK",
          "references": [
            "89105661-3fb5-e19b-0d6b-b2b0a5dc2ab0"
          ]
        },
        {
          "uuid": "d477a65e-c8b4-517e-6b70-19fa1254b39e",
          "code": "100000086589",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a9d138a3-c8c2-81c6-0742-573c38e3b2a1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f60d2807-1b62-4e6f-848c-7f5a8dca1779",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "27792aac-d669-4786-b7ac-8c5d6855fb6b",
            "refuuid": "21232f24-433c-40cb-950c-767f8c7a39c5",
            "name": "BENACTYZINE",
            "unii": "595EG71R3F",
            "linking_id": "595EG71R3F",
            "ref_pname": "BENACTYZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "81443e04-7f68-467b-9cf8-949e552cf928",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "81c9a426-a739-4516-a1ad-f450431cdd9c",
            "refuuid": "bf544df8-6266-45c8-b9cd-f3bf06398293",
            "name": "BENACTYZINE HYDROCHLORIDE",
            "unii": "26R628272Q",
            "linking_id": "26R628272Q",
            "ref_pname": "BENACTYZINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a09b6f65-5b42-4983-b088-0be128875375",
          "name": "2-DIETHYLAMINOETHYL BENZILATE",
          "stdName": "2-DIETHYLAMINOETHYL BENZILATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9ed010d-8861-40fe-9d0a-afd2c03279c9"
          ],
          "display_name": false
        },
        {
          "uuid": "369423e4-c409-4cff-8f39-44c917f44b47",
          "name": "BENACTYZINE",
          "stdName": "BENACTYZINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c93f2264-9ea3-45d9-8759-80b83fdf848a",
            "51570fbc-3ee8-402e-a2a8-f1680998bb11",
            "f5e804c5-fb8a-42a4-a057-00d068870581",
            "c07ed824-64df-4638-9888-e66d922961a8",
            "12c80fad-ba35-4af8-a196-e7775b6517b7",
            "aaacac2c-4ba2-4e92-b6cc-202146d75079",
            "c6df6c86-bd87-452b-8694-e3a397395c1a",
            "0b937434-853e-4abc-81f8-0a7ea7aa005e",
            "6e62811b-0b96-4e34-9b93-bc3f5afb69f4",
            "c9ed010d-8861-40fe-9d0a-afd2c03279c9",
            "210e7e10-f8f9-43b2-8a67-9dcad7417afb",
            "fed86981-bb19-4ba8-b1d5-e9475dcf2ab5"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "57db3cef-ae00-41a5-9180-6fb6bbcdae2e",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "2fdafb9c-4f1b-453d-a98d-da4a55514b19",
          "name": "BENACTYZINE [HSDB]",
          "stdName": "BENACTYZINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51570fbc-3ee8-402e-a2a8-f1680998bb11",
            "6e62811b-0b96-4e34-9b93-bc3f5afb69f4"
          ],
          "display_name": false
        },
        {
          "uuid": "b5a3b9d0-dfe1-4abe-8846-ddf6542af60f",
          "name": "BENACTYZINE [MI]",
          "stdName": "BENACTYZINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b937434-853e-4abc-81f8-0a7ea7aa005e",
            "6e62811b-0b96-4e34-9b93-bc3f5afb69f4"
          ],
          "display_name": false
        },
        {
          "uuid": "a85542bb-77a7-46dd-b1f3-692a6cb4daf6",
          "name": "BENACTYZINE [VANDF]",
          "stdName": "BENACTYZINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c93f2264-9ea3-45d9-8759-80b83fdf848a",
            "6e62811b-0b96-4e34-9b93-bc3f5afb69f4"
          ],
          "display_name": false
        },
        {
          "uuid": "a637cb74-a287-7e77-c4e3-262fbf553327",
          "name": "Benactyzine [WHO-DD]",
          "stdName": "BENACTYZINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2d4dbcb-6c6b-53db-73ed-12091b016148"
          ],
          "display_name": false
        },
        {
          "uuid": "c14f6740-e56d-4f18-b9ae-8ea9c804fd9a",
          "name": "benactyzine [INN]",
          "stdName": "BENACTYZINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6df6c86-bd87-452b-8694-e3a397395c1a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c9ed010d-8861-40fe-9d0a-afd2c03279c9",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c6df6c86-bd87-452b-8694-e3a397395c1a",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0b937434-853e-4abc-81f8-0a7ea7aa005e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e62811b-0b96-4e34-9b93-bc3f5afb69f4",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51570fbc-3ee8-402e-a2a8-f1680998bb11",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c07ed824-64df-4638-9888-e66d922961a8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c93f2264-9ea3-45d9-8759-80b83fdf848a",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85048331-0642-4091-9986-1be7a5132954",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389676000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "088a80af-c219-4ed1-85aa-940dcac57ef6",
          "citation": "SRS import [595EG71R3F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=595EG71R3F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389676000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dec2d045-d139-4b0f-8c1d-236e1ae728ed",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5e804c5-fb8a-42a4-a057-00d068870581",
          "citation": "BENACTYZINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "210e7e10-f8f9-43b2-8a67-9dcad7417afb",
          "citation": "BENACTYZINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aaacac2c-4ba2-4e92-b6cc-202146d75079",
          "citation": "BENACTYZINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fed86981-bb19-4ba8-b1d5-e9475dcf2ab5",
          "citation": "BENACTYZINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "12c80fad-ba35-4af8-a196-e7775b6517b7",
          "citation": "BENACTYZINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e88d3836-06a3-520c-ebcf-d6bc092ce860",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+302-40-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "43d13b37-4522-117f-2332-111c87c5a412",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=302-40-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a9d138a3-c8c2-81c6-0742-573c38e3b2a1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "89105661-3fb5-e19b-0d6b-b2b0a5dc2ab0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d018d998-6fc9-4586-82d1-05daaf0121c9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c2d4dbcb-6c6b-53db-73ed-12091b016148",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "19e862b6-095d-49ca-bc4c-e25cd8e771f2",
          "id": "19e862b6-095d-49ca-bc4c-e25cd8e771f2",
          "molfile": "\n  Marvin  01132101322D          \n\n 24 25  0  0  0  0            999 V2000\n    0.0000   -1.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6903   -1.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4225   -1.3295    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4587   -0.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7627   -0.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1206   -1.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8554   -1.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5457   -1.8414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2779   -1.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3141   -0.6386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9760   -1.9112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5738   -2.4779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5815   -1.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3727   -1.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9777   -1.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8018   -0.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0159    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4026   -0.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4563   -2.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6414   -2.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1372   -3.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4552   -3.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2702   -3.9749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7743   -3.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 19 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 24 19  2  0  0  0  0\n 21 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)CCOC(=O)C(c1ccccc1)(c2ccccc2)O",
          "formula": "C20H25NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1bfe30e5-5877-4715-885a-cd30f76ae1c6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "327.4182",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "21232f24-433c-40cb-950c-767f8c7a39c5",
      "version": "12",
      "structure": {
        "id": "fd85e2c2-8cd0-443f-b798-8ac15b571be8",
        "molfile": "\n  Marvin  01132113082D          \n\n 24 25  0  0  0  0            999 V2000\n    4.9757   -1.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2776   -1.4690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3138   -0.6386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5811   -1.3604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4560   -2.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5734   -2.4777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5455   -1.8413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4224   -1.3294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8552   -1.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1205   -1.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4023   -0.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3723   -1.6086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6412   -2.4467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7740   -3.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6903   -1.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4586   -0.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7627   -0.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9773   -1.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1370   -3.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2699   -3.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0155    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8014   -0.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4550   -3.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  4  2  0  0  0  0\n 13  5  2  0  0  0  0\n 14  5  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16  8  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 12  1  0  0  0  0\n 20 13  1  0  0  0  0\n 21 14  2  0  0  0  0\n 22 11  2  0  0  0  0\n 23 19  2  0  0  0  0\n 24 21  1  0  0  0  0\n 20 24  2  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
        "smiles": "CCN(CC)CCOC(=O)C(c1ccccc1)(c2ccccc2)O",
        "formula": "C20H25NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "327.4182",
        "optical_activity": "NONE",
        "references": [
          "dec2d045-d139-4b0f-8c1d-236e1ae728ed",
          "088a80af-c219-4ed1-85aa-940dcac57ef6",
          "c6df6c86-bd87-452b-8694-e3a397395c1a"
        ],
        "stereo_centers": 0
      },
      "unii": "595EG71R3F"
    }
  ]
}