{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bf4e862d-be3e-4c40-a53d-038602a43a81",
          "code": "23787-90-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23787-90-8",
          "code_system": "CAS",
          "references": [
            "3c8f91be-569e-423c-a968-56cf072b2dc5",
            "9b112224-03e5-482d-aaa9-aab191b38a7c"
          ]
        },
        {
          "uuid": "5e28171f-c023-4a01-9833-1c69f03074c3",
          "code": "33407-62-4",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=33407-62-4",
          "code_system": "CAS",
          "references": [
            "3c8f91be-569e-423c-a968-56cf072b2dc5",
            "996360f7-484c-4d89-942b-49ea7c496f2c"
          ]
        },
        {
          "uuid": "f4a695f1-f430-4091-bbb9-68c595d9c5be",
          "code": "245-890-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.704",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3c8f91be-569e-423c-a968-56cf072b2dc5"
          ]
        },
        {
          "uuid": "d7d1c2ff-6bc7-4b97-961f-98919e1fcb27",
          "code": "21116680",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21116680",
          "code_system": "PUBCHEM",
          "references": [
            "3c8f91be-569e-423c-a968-56cf072b2dc5"
          ]
        },
        {
          "uuid": "02ce442b-b2e6-ac7d-1ef2-21abc3fc772f",
          "code": "DTXSID2047228",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2047228",
          "code_system": "EPA CompTox",
          "references": [
            "1a2d835c-be22-5a8e-2d57-80b607333b46"
          ]
        },
        {
          "uuid": "be59abad-2476-4764-bb5c-1222ef59bea3",
          "code": "5916QUE93V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d18a3a56-2229-4c30-89d0-401fd527695c",
          "name": "2H-2,4A-METHANONAPHTHALEN-8(5H)-ONE, 1,3,4,6,7,8A-HEXAHYDRO-1,1,5,5-TETRAMETHYL-",
          "stdName": "2H-2,4A-METHANONAPHTHALEN-8(5H)-ONE, 1,3,4,6,7,8A-HEXAHYDRO-1,1,5,5-TETRAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cccfe128-07a5-41fb-ad57-525a531f089d",
            "96f94d7f-e78d-4ac8-b829-c379b5489f19"
          ],
          "display_name": false
        },
        {
          "uuid": "3491295f-9643-43aa-9b2d-bb34914d18db",
          "name": "ISOLONGIFOLANONE",
          "stdName": "ISOLONGIFOLANONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31554229-cf8e-4cb4-bdcb-5473d6167771",
            "cccfe128-07a5-41fb-ad57-525a531f089d"
          ],
          "display_name": true
        },
        {
          "uuid": "ac9f319b-21f3-4e42-9949-0f79e40f5fa4",
          "name": "ISOLONGIFOLANONE- PARENT",
          "stdName": "ISOLONGIFOLANONE- PARENT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cccfe128-07a5-41fb-ad57-525a531f089d",
            "df853249-29b7-4c37-9b1e-5765f2d95345"
          ],
          "display_name": false
        },
        {
          "uuid": "b74561ac-5124-42b5-8ce9-714d39c594a8",
          "name": "ISOLONGIFOLENE KETONE",
          "stdName": "ISOLONGIFOLENE KETONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31554229-cf8e-4cb4-bdcb-5473d6167771",
            "cccfe128-07a5-41fb-ad57-525a531f089d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "31554229-cf8e-4cb4-bdcb-5473d6167771",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cccfe128-07a5-41fb-ad57-525a531f089d",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96f94d7f-e78d-4ac8-b829-c379b5489f19",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df853249-29b7-4c37-9b1e-5765f2d95345",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c8f91be-569e-423c-a968-56cf072b2dc5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392172000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23c68807-f267-450d-a04d-4e9eb41f7b6e",
          "citation": "SRS import [5916QUE93V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5916QUE93V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392172000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a2d835c-be22-5a8e-2d57-80b607333b46",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=23787-90-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9b112224-03e5-482d-aaa9-aab191b38a7c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "996360f7-484c-4d89-942b-49ea7c496f2c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "93e5a148-1c94-468e-8a9a-7cdc9585d336",
          "id": "93e5a148-1c94-468e-8a9a-7cdc9585d336",
          "molfile": "\n  Marvin  01132107402D          \n\n 16 18  0  0  0  0            999 V2000\n    7.6071   -4.9551    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.6071   -5.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3216   -6.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0360   -5.7801    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.5597   -4.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0360   -4.9551    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.7505   -4.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7505   -3.7176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4650   -4.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4650   -5.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7505   -6.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2808   -6.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2202   -6.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3216   -4.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8519   -3.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7913   -3.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  1  0  0  0\n  1 14  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  4 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)CCC(=O)C2C(C)(C)[C@H]3CC[C@]21C3",
          "formula": "C15H24O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ec9c275a-731c-45d2-b4ae-081040fc4586"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "220.351",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "e7b3e873-656e-4ecf-906f-de7ee31d0a6b",
      "version": "3",
      "structure": {
        "id": "cad4b2d5-f103-4bf1-861e-fb5f47839e6f",
        "molfile": "\n  Marvin  01132110282D          \n\n 16 18  0  0  1  0            999 V2000\n   10.2808   -6.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7505   -6.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4650   -5.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4650   -4.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7505   -4.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7505   -3.7176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0360   -4.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3216   -4.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8519   -3.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7913   -3.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6071   -4.9551    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.6071   -5.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3216   -6.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0360   -5.7801    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5597   -4.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2202   -6.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14  7  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n 11 15  1  1  0  0  0\n  2 16  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)CCC(=O)C2C(C)(C)[C@H]3CC[C@]21C3",
        "formula": "C15H24O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "220.351",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "23c68807-f267-450d-a04d-4e9eb41f7b6e",
          "df853249-29b7-4c37-9b1e-5765f2d95345"
        ],
        "stereo_centers": 3
      },
      "unii": "5916QUE93V"
    }
  ]
}