{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3cdc5f0c-cb63-4b3a-9c8d-497d28a0b6b2",
          "code": "12221-69-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=12221-69-1",
          "code_system": "CAS",
          "references": [
            "7d18d162-167c-4d4a-9d55-6584426f0045",
            "7c194e87-1e8b-4fde-a8ae-44d9ada40068"
          ]
        },
        {
          "uuid": "07ac5880-51cd-4de9-8b71-968c00d90b93",
          "code": "C050846",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67050846",
          "code_system": "MESH",
          "references": [
            "7d18d162-167c-4d4a-9d55-6584426f0045"
          ]
        },
        {
          "uuid": "c252c4ee-81d4-468e-be5e-4dd9a0aaa496",
          "code": "12011963",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12011963",
          "code_system": "PUBCHEM",
          "references": [
            "7d18d162-167c-4d4a-9d55-6584426f0045"
          ]
        },
        {
          "uuid": "d88343a1-6742-4250-9661-723b19f88684",
          "code": "58KJM7T349",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a1348e5d-7f3c-d10a-cb29-688eb737c751",
          "code": "DTXSID30879822",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30879822",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "fa1ec9ec-cd8a-e51d-7c6f-7854510edc55",
          "code": "58KJM7T349",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(58KJM7T349)",
          "code_system": "DAILYMED",
          "references": [
            "0269714a-db1e-d55b-c39d-a095eaa779cf"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ad0e1f9b-02bd-45bc-ae56-39ab969cf113",
          "name": "4H-1,2,4-TRIAZOLIUM, 1,4-DIMETHYL-5-(2-(4-(METHYL(PHENYLMETHYL)AMINO)PHENYL)DIAZENYL)-, BROMIDE (1:1)",
          "stdName": "4H-1,2,4-TRIAZOLIUM, 1,4-DIMETHYL-5-(2-(4-(METHYL(PHENYLMETHYL)AMINO)PHENYL)DIAZENYL)-, BROMIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de21b240-cb4d-4063-aa7b-a58c67112635",
            "d655cb34-0a6b-4eeb-a3fe-fd61ef68bccf"
          ],
          "display_name": false
        },
        {
          "uuid": "486a24c3-24d3-4cb2-94ac-4649755a31f0",
          "name": "BASIC RED 46",
          "stdName": "BASIC RED 46",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5c64eb3-d939-48b9-91a8-d86758c1dfcb",
            "e20d1259-2c3b-43cc-85ea-8be35243d740",
            "d655cb34-0a6b-4eeb-a3fe-fd61ef68bccf"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ad714231-2011-4a63-904c-6cb3ef971dc0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e350b79f-9c37-4f2e-a54b-fd45f592d89d",
          "name": "C.I.110825",
          "stdName": "C.I.110825",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d655cb34-0a6b-4eeb-a3fe-fd61ef68bccf",
            "8112f3af-ce9f-42a2-ac14-41bdcc4df4e0"
          ],
          "display_name": false
        },
        {
          "uuid": "01afbcf7-0aba-40c4-a7ed-37cae53b26e6",
          "name": "C.I.BASIC RED 46",
          "stdName": "C.I.BASIC RED 46",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d655cb34-0a6b-4eeb-a3fe-fd61ef68bccf",
            "8112f3af-ce9f-42a2-ac14-41bdcc4df4e0"
          ],
          "display_name": false
        },
        {
          "uuid": "eed78224-9748-4c55-bbb0-75ef92e5efa0",
          "name": "DIACRYL RED GRL-N",
          "stdName": "DIACRYL RED GRL-N",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de21b240-cb4d-4063-aa7b-a58c67112635",
            "d655cb34-0a6b-4eeb-a3fe-fd61ef68bccf"
          ],
          "display_name": false
        },
        {
          "uuid": "75c5795c-3098-486e-8806-6c035dbab74b",
          "name": "LOWACRYL RED 46",
          "stdName": "LOWACRYL RED 46",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5c64eb3-d939-48b9-91a8-d86758c1dfcb",
            "d655cb34-0a6b-4eeb-a3fe-fd61ef68bccf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b5c64eb3-d939-48b9-91a8-d86758c1dfcb",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d655cb34-0a6b-4eeb-a3fe-fd61ef68bccf",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8112f3af-ce9f-42a2-ac14-41bdcc4df4e0",
          "citation": "http://www.worlddyevariety.com/basic-dyes/basic-red-46.html",
          "url": "http://www.worlddyevariety.com/basic-dyes/basic-red-46.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de21b240-cb4d-4063-aa7b-a58c67112635",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d18d162-167c-4d4a-9d55-6584426f0045",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391756000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "028bc2c9-4aea-4964-9fa9-2e50f2667afa",
          "citation": "SRS import [58KJM7T349]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=58KJM7T349",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391756000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e20d1259-2c3b-43cc-85ea-8be35243d740",
          "citation": "BASIC RED 46 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7c194e87-1e8b-4fde-a8ae-44d9ada40068",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5fd4f0d6-b9c1-2029-9165-431bf52f8146",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0269714a-db1e-d55b-c39d-a095eaa779cf",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4dee4727-1454-4a22-9af2-b46fadb6a166",
          "id": "4dee4727-1454-4a22-9af2-b46fadb6a166",
          "molfile": "\n  Marvin  01132104042D          \n\n  1  0  0  0  0  0            999 V2000\n    8.6222   -7.8581    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Br",
          "formula": "BrH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "55ff01b7-57ef-44b6-a484-ddb8ac4738f8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "80.9115",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9a0190ac-dbc3-4110-8652-7621d58922e8",
          "id": "9a0190ac-dbc3-4110-8652-7621d58922e8",
          "molfile": "\n  Marvin  01132108002D          \n\n 24 26  0  0  0  0            999 V2000\n    7.3443   -7.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7311   -7.4187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9241   -7.5903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5117   -6.8758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0637   -6.2627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8921   -5.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8174   -6.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5318   -6.1857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5318   -5.3607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2463   -4.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9608   -5.3607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6752   -4.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6752   -4.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9608   -3.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2463   -4.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3897   -3.7107    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.3897   -2.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1042   -4.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8186   -3.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8186   -2.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5331   -2.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2476   -2.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2476   -3.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5331   -4.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  2  3  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  3  0  0  0\n 10 11  1  0  0  0  0\n 15 10  1  0  0  0  0\n 11 12  2  3  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 16  2  3  0  0  0\n 15 14  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 24  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\nM  CHG  1  16   1\nM  END",
          "smiles": "C[N+](=C1C=CC(=NN=c2n(C)cnn2C)C=C1)Cc3ccccc3",
          "formula": "C18H21N6",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "da0d7bab-0382-4dd4-85fc-e5a37942a99e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "321.4002",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "84eb867c-7cc1-4724-b390-531070721c80",
      "version": "7",
      "structure": {
        "id": "b80b0bcd-86cd-4210-a319-86cc0a6cb088",
        "molfile": "\n  Marvin  01132109312D          \n\n 25 26  0  0  0  0            999 V2000\n    8.6222   -7.8581    0.0000 Br  0  5  0  0  0  0  0  0  0  0  0  0\n    8.2463   -4.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2463   -4.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5318   -5.3607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5318   -6.1857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8174   -6.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7311   -7.4187    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.3443   -7.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9241   -7.5903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5117   -6.8758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0637   -6.2627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8921   -5.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9608   -5.3607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6752   -4.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6752   -4.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3897   -3.7107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1042   -4.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8186   -3.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5331   -4.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2476   -3.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2476   -2.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5331   -2.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8186   -2.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3897   -2.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9608   -3.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  3 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 18 23  1  0  0  0  0\n 16 24  1  0  0  0  0\n 25 15  2  0  0  0  0\n  2 25  1  0  0  0  0\nM  CHG  2   1  -1   7   1\nM  END",
        "smiles": "CN(Cc1ccccc1)c2ccc(cc2)/N=N/c3[n+](C)cnn3C.[Br-]",
        "formula": "C18H21N6.Br",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "401.3037",
        "optical_activity": "NONE",
        "references": [
          "de21b240-cb4d-4063-aa7b-a58c67112635",
          "028bc2c9-4aea-4964-9fa9-2e50f2667afa"
        ],
        "stereo_centers": 0
      },
      "unii": "58KJM7T349"
    }
  ]
}