{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "14492a51-f823-47cf-a40c-339b8e28ed74",
          "code": "101426-31-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=101426-31-7",
          "code_system": "CAS",
          "references": [
            "c6ebaffd-3505-423c-8f10-ccfc9986eaa6",
            "f255a857-8cd9-46f2-972d-85b64726af13"
          ]
        },
        {
          "uuid": "f46a0b86-0b53-4228-a23a-7505ee39979b",
          "code": "44182035",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44182035",
          "code_system": "PUBCHEM",
          "references": [
            "c6ebaffd-3505-423c-8f10-ccfc9986eaa6"
          ]
        },
        {
          "uuid": "6f4087b7-8f38-cd59-fa46-ea75361a586e",
          "code": "DTXSID20143928",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20143928",
          "code_system": "EPA CompTox",
          "references": [
            "87980515-49f3-fa1e-aefa-0b9906e2a1fd"
          ]
        },
        {
          "uuid": "0df5e446-b838-468b-ac93-d7e2fee25142",
          "code": "58A4103WF6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "34c8a970-dfbb-74f2-3e16-0a02264beeb4",
          "code": "1735",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1735/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "7edfaacc-f2c4-6f5d-32b9-7cfc8764c837"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b552a8c2-c86a-4475-a6da-6b94a3f3fd66",
          "name": "2-(4-METHYL-5-THIAZOLYL)ETHYL DECANOATE",
          "stdName": "2-(4-METHYL-5-THIAZOLYL)ETHYL DECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8855557b-3420-49fb-b384-744269e790e3",
            "fd93f2b2-29a5-481c-b511-b45ae4bcabbd",
            "8c43f7c3-2ea3-44e4-85bb-c1db9cef3665",
            "821a8d04-5c1d-4158-a91d-099696e71525"
          ],
          "display_name": true
        },
        {
          "uuid": "1199cea3-e707-46a8-b3e1-7d83fa7ac7c1",
          "name": "2-(4-METHYL-5-THIAZOLYL)ETHYL DECANOATE [FHFI]",
          "stdName": "2-(4-METHYL-5-THIAZOLYL)ETHYL DECANOATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8855557b-3420-49fb-b384-744269e790e3",
            "fd93f2b2-29a5-481c-b511-b45ae4bcabbd"
          ],
          "display_name": false
        },
        {
          "uuid": "b7142736-59fa-4b28-8afb-6eb418caa62e",
          "name": "DECANOIC ACID, 2-(4-METHYL-5-THIAZOLYL)ETHYL ESTER",
          "stdName": "DECANOIC ACID, 2-(4-METHYL-5-THIAZOLYL)ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd00d6c2-3071-42ca-a7f6-5e3c614a0667",
            "fd93f2b2-29a5-481c-b511-b45ae4bcabbd"
          ],
          "display_name": false
        },
        {
          "uuid": "42154548-3380-4a2b-9c14-82824d07c56b",
          "name": "FEMA NO. 4281",
          "stdName": "FEMA NO. 4281",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8855557b-3420-49fb-b384-744269e790e3",
            "fd93f2b2-29a5-481c-b511-b45ae4bcabbd"
          ],
          "display_name": false
        },
        {
          "uuid": "3b7768db-b13e-44e0-9bb3-3d0f27d7bbc2",
          "name": "SULFURYL DECANOATE",
          "stdName": "SULFURYL DECANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd93f2b2-29a5-481c-b511-b45ae4bcabbd",
            "9c67f9b7-6681-479f-ae22-f09003aba990"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8c43f7c3-2ea3-44e4-85bb-c1db9cef3665",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fd93f2b2-29a5-481c-b511-b45ae4bcabbd",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd00d6c2-3071-42ca-a7f6-5e3c614a0667",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c67f9b7-6681-479f-ae22-f09003aba990",
          "citation": "http://www.thegoodscentscompany.com/data/rw1586451.html",
          "url": "http://www.thegoodscentscompany.com/data/rw1586451.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8855557b-3420-49fb-b384-744269e790e3",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6ebaffd-3505-423c-8f10-ccfc9986eaa6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391353000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa96d343-0f8b-4983-a18c-1ea2f76cb5d1",
          "citation": "SRS import [58A4103WF6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=58A4103WF6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391353000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "821a8d04-5c1d-4158-a91d-099696e71525",
          "citation": "2-(4-METHYL-5-THIAZOLYL)ETHYL DECANOATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "87980515-49f3-fa1e-aefa-0b9906e2a1fd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=101426-31-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f255a857-8cd9-46f2-972d-85b64726af13",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7edfaacc-f2c4-6f5d-32b9-7cfc8764c837",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "153190e0-adcd-4a5e-8615-61ff05b52358",
          "id": "153190e0-adcd-4a5e-8615-61ff05b52358",
          "molfile": "\n  Marvin  01132101182D          \n\n 20 20  0  0  0  0            999 V2000\n   13.2269   -5.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5594   -4.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8057   -5.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1383   -4.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3846   -4.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7172   -4.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9635   -4.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2961   -4.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5425   -4.6121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8750   -4.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9612   -3.3067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1213   -4.4627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4539   -3.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7002   -4.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0328   -3.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0328   -3.0035    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2482   -2.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7632   -3.4160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2482   -4.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9933   -4.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 19  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCCC(=O)OCCc1c(C)ncs1",
          "formula": "C16H27NO2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2ce462a4-4bd3-4588-8961-2f640bcf21a6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "297.4578",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5f359e06-1a9d-47a9-9dfe-148810334823",
      "version": "5",
      "structure": {
        "id": "6baa93ac-1354-489a-8553-02d5d12a189f",
        "molfile": "\n  Marvin  01132105362D          \n\n 20 20  0  0  0  0            999 V2000\n   13.2269   -5.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7172   -4.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9635   -4.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1383   -4.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3846   -4.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8057   -5.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5594   -4.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2961   -4.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5425   -4.6121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9933   -4.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4539   -3.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1213   -4.4627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7002   -4.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9612   -3.3067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8750   -4.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0328   -3.0035    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2482   -2.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0328   -3.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2482   -4.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7632   -3.4160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n 16 18  1  0  0  0  0\n  1  7  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 15  1  0  0  0  0\n 10 19  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 18  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 12  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 20  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCCC(=O)OCCc1c(C)ncs1",
        "formula": "C16H27NO2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "297.4578",
        "optical_activity": "NONE",
        "references": [
          "cd00d6c2-3071-42ca-a7f6-5e3c614a0667",
          "fa96d343-0f8b-4983-a18c-1ea2f76cb5d1"
        ],
        "stereo_centers": 0
      },
      "unii": "58A4103WF6"
    }
  ]
}