{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "66a9320f-ad0c-4557-aa89-6ee9eaeda677", "code": "5468-75-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=5468-75-7", "code_system": "CAS", "references": [ "01fe5f29-205a-456f-94a9-df6b966abfbb", "77bff3c2-6545-42ce-8a70-f5bb10dd2e15" ] }, { "uuid": "30c395a3-6f1a-4e3d-a8ea-687973b5e33a", "code": "226-789-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.354", "code_system": "ECHA (EC/EINECS)", "references": [ "01fe5f29-205a-456f-94a9-df6b966abfbb" ] }, { "uuid": "b17ffd19-6313-430b-8514-704806d8fff2", "code": "7621-06-9", "type": "ALTERNATIVE", "url": "https://commonchemistry.cas.org/detail?cas_rn=7621-06-9", "code_system": "CAS", "references": [ "77bff3c2-6545-42ce-8a70-f5bb10dd2e15" ] }, { "uuid": "3e6ea587-ed29-6cbe-f740-36e803d22d23", "code": "DTXSID9027601", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9027601", "code_system": "EPA CompTox", "references": [ "46176ef0-c28a-c52b-5489-ce8484dcf620" ] }, { "uuid": "a4eed300-097e-4cc2-baf0-083cfe61bf5e", "code": "586X0864EC", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "40ffd14f-b794-2d0e-1857-b0c7515d285e", "code": "15087", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=15087", "code_system": "NSC", "references": [ "ce9f73e4-1f7f-4d1d-3240-5015d566ea18" ] } ], "substance_class": "chemical", "names": [ { "uuid": "5bb01271-3182-432e-93eb-3c4f06574c47", "name": "2,2'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(AZO))BIS(N-(2-METHYLPHENYL)-3-OXOBUTYRAMIDE)", "stdName": "2,2'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(AZO))BIS(N-(2-METHYLPHENYL)-3-OXOBUTYRAMIDE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "88f9748c-1b4b-421d-8549-3e00c1bb4b57", "43c62e6c-1288-4db9-9aa4-b3e8934c77e0" ], "display_name": false }, { "uuid": "fb8513c3-c858-4f0e-b7c0-5fe0ecb613b3", "name": "BENZIDINE YELLOW G", "stdName": "BENZIDINE YELLOW G", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "88f9748c-1b4b-421d-8549-3e00c1bb4b57", "43c62e6c-1288-4db9-9aa4-b3e8934c77e0" ], "display_name": true }, { "uuid": "1cc2f80a-9fba-44b5-a147-8e4420d162ce", "name": "C.I. 21095", "stdName": "C.I. 21095", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "88f9748c-1b4b-421d-8549-3e00c1bb4b57", "20a07808-d460-432a-b3ff-c0254b500981" ], "display_name": false }, { "uuid": "97a2badd-8cab-4869-84a2-de1b1e68a7e1", "name": "C.I. PIGMENT YELLOW 14", "stdName": "C.I. PIGMENT YELLOW 14", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "88f9748c-1b4b-421d-8549-3e00c1bb4b57", "365767cc-747f-412c-bd7c-eb5968904a51" ], "display_name": false }, { "uuid": "6640feb6-fea2-4dfd-a69d-682f9c3b5ad9", "name": "CI 21095", "stdName": "CI 21095", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "77bff3c2-6545-42ce-8a70-f5bb10dd2e15" ], "display_name": false }, { "uuid": "fdd6e302-42b9-4055-a3a2-9b1b3b9b31e2", "name": "NSC-15087", "stdName": "NSC-15087", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "88f9748c-1b4b-421d-8549-3e00c1bb4b57", "26ddc600-320d-44d7-a993-b9faf84bb828" ], "display_name": false }, { "uuid": "91cfaeeb-94c6-481d-9c94-1802840aeb9e", "name": "PERMANENT YELLOW G", "stdName": "PERMANENT YELLOW G", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "88f9748c-1b4b-421d-8549-3e00c1bb4b57", "20a07808-d460-432a-b3ff-c0254b500981" ], "display_name": false }, { "uuid": "31b77f7b-ba8a-4eb0-b7db-5bc8910156bd", "name": "PIGMENT YELLOW 14", "stdName": "PIGMENT YELLOW 14", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "88f9748c-1b4b-421d-8549-3e00c1bb4b57", "20a07808-d460-432a-b3ff-c0254b500981" ], "display_name": false } ], "references": [ { "uuid": "365767cc-747f-412c-bd7c-eb5968904a51", "citation": "saxs", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "88f9748c-1b4b-421d-8549-3e00c1bb4b57", "citation": "SAX DANGEROUS PROPERTIES", "doc_type": "SAX DANGEROUS PROPERTIES", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "20a07808-d460-432a-b3ff-c0254b500981", "citation": "http://www.chemblink.com/products/5468-75-7.htm", "url": "http://www.chemblink.com/products/5468-75-7.htm", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "43c62e6c-1288-4db9-9aa4-b3e8934c77e0", "citation": "SAXS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "26ddc600-320d-44d7-a993-b9faf84bb828", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "01fe5f29-205a-456f-94a9-df6b966abfbb", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390825000, "tags": [ "NOMEN" ] }, { "uuid": "86fccb7d-deb1-468f-8305-5f4ad7f69302", "citation": "SRS import [586X0864EC]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=586X0864EC", "doc_type": "SRS", "public_domain": true, "document_date": 1493390825000, "tags": [ "NOMEN" ] }, { "uuid": "46176ef0-c28a-c52b-5489-ce8484dcf620", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5468-75-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "77bff3c2-6545-42ce-8a70-f5bb10dd2e15", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "ce9f73e4-1f7f-4d1d-3240-5015d566ea18", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "497acda8-3701-475b-87a7-5165577bf259", "id": "497acda8-3701-475b-87a7-5165577bf259", "molfile": "\n Marvin 01132103512D \n\n 46 49 0 0 0 0 999 V2000\n 9.2138 -1.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6263 -1.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4513 -1.9064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2138 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.3888 -2.6208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9763 -3.3352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1513 -3.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7389 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9139 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5014 -3.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9139 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7389 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1513 -4.7642 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6764 -3.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2639 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4389 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0265 -3.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2015 -3.3353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7890 -4.0498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9640 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.5515 -4.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9640 -5.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2735 -4.7642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5515 -3.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2735 -3.3353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9640 -2.6208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5515 -1.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9640 -1.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5515 -0.4774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2735 -0.4774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6859 -1.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2735 -1.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6859 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4389 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0265 -1.9064 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2639 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6263 -3.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4513 -3.3352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2138 -4.0498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6263 -4.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2138 -5.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6263 -6.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4513 -6.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8637 -5.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4513 -4.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8637 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 37 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 12 2 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 14 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 36 14 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 34 2 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 24 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 24 25 2 0 0 0 0\n 24 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 28 27 1 0 0 0 0\n 27 32 2 0 0 0 0\n 29 28 2 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 2 0 0 0 0\n 32 31 1 0 0 0 0\n 32 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 37 38 2 0 0 0 0\n 37 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 41 40 1 0 0 0 0\n 40 45 2 0 0 0 0\n 42 41 2 0 0 0 0\n 43 42 1 0 0 0 0\n 44 43 2 0 0 0 0\n 45 44 1 0 0 0 0\n 45 46 1 0 0 0 0\nM END", "smiles": "Cc1ccccc1NC(=O)C(C(=O)C)/N=N/c2ccc(cc2Cl)-c3ccc(c(c3)Cl)/N=N/C(C(=O)C)C(=O)Nc4ccccc4C", "formula": "C34H30Cl2N6O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b556c9e4-f516-4535-ba63-8d00caa9aac9" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "657.547", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "bb89e844-c276-489b-bdad-86e433b6f344", "version": "5", "structure": { "id": "a1df95a7-4156-42e8-b683-46c4ef6f5cca", "molfile": "\n Marvin 01132108252D \n\n 46 49 0 0 0 0 999 V2000\n 0.9640 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7890 -4.0498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2015 -3.3353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0265 -3.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4389 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2639 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6764 -3.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5014 -3.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9139 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7389 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1513 -3.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9763 -3.3352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3888 -2.6208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2138 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6263 -3.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4513 -3.3352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2138 -4.0498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6263 -4.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4513 -4.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8637 -5.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4513 -6.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6263 -6.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2138 -5.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8637 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6263 -1.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4513 -1.9064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2138 -1.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7389 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1513 -4.7642 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9139 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2639 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4389 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0265 -1.9064 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5515 -4.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2735 -4.7642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9640 -5.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5515 -3.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2735 -3.3353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9640 -2.6208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5515 -1.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2735 -1.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6859 -1.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2735 -0.4774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5515 -0.4774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9640 -1.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6859 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 18 2 0 0 0 0\n 19 24 1 0 0 0 0\n 14 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 1 0 0 0 0\n 11 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 30 8 2 0 0 0 0\n 7 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 4 2 0 0 0 0\n 5 33 1 0 0 0 0\n 1 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 34 36 1 0 0 0 0\n 1 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 37 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 2 0 0 0 0\n 44 45 1 0 0 0 0\n 45 40 2 0 0 0 0\n 41 46 1 0 0 0 0\nM END", "smiles": "Cc1ccccc1NC(=O)C(C(=O)C)/N=N/c2ccc(cc2Cl)-c3ccc(c(c3)Cl)/N=N/C(C(=O)C)C(=O)Nc4ccccc4C", "formula": "C34H30Cl2N6O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "657.547", "optical_activity": "UNSPECIFIED", "references": [ "86fccb7d-deb1-468f-8305-5f4ad7f69302", "43c62e6c-1288-4db9-9aa4-b3e8934c77e0" ], "stereo_centers": 2 }, "modifications": { "uuid": "2135abb3-a76b-4480-9017-0a550e9f1929" }, "unii": "586X0864EC" } ] }