{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a84da8f3-9e83-4119-9d05-8f00bd3c1d1a",
          "code": "85985-61-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=85985-61-1",
          "code_system": "CAS",
          "references": [
            "ae47dd94-16fe-497e-8947-297e2832caf2",
            "4d5f5021-2848-4333-8962-0ee59782ace0"
          ]
        },
        {
          "uuid": "d161a490-0d74-4b85-ae35-6eb17432ba89",
          "code": "23685471",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23685471",
          "code_system": "PUBCHEM",
          "references": [
            "ae47dd94-16fe-497e-8947-297e2832caf2"
          ]
        },
        {
          "uuid": "fbab900e-c8f3-04de-760d-f876cf1d7572",
          "code": "DTXSID50235325",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50235325",
          "code_system": "EPA CompTox",
          "references": [
            "518e5077-2908-94bc-cbbd-0d71112d74bc"
          ]
        },
        {
          "uuid": "b4dd7f08-4b5a-781e-b23d-e1ae8196477e",
          "code": "DBSALT002289",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT002289",
          "code_system": "DRUG BANK",
          "references": [
            "5fe90fcb-5032-3dc2-0044-e0529b3315a8"
          ]
        },
        {
          "uuid": "50d34e87-2562-4066-b069-5ff349304bf7",
          "code": "5850KHR68O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "5eb310b4-6aec-4058-be92-e012cd204683",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "95236cdb-6a36-4b1c-b5cb-dfcb7934f8b9",
            "refuuid": "e20e0a8b-b4ed-438d-a116-b83fddc48dee",
            "name": "ENOXOLONE",
            "unii": "P540XA09DR",
            "linking_id": "P540XA09DR",
            "ref_pname": "ENOXOLONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "940cfcfd-f310-49d2-b273-8bfcdfc07ff4",
          "name": "ENOXOLONE MONOPOTASSIUM",
          "stdName": "ENOXOLONE MONOPOTASSIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "372d9e81-2222-4b32-aee4-47289e84d610",
            "03cca99c-1d35-4d05-bcd0-e7697b862b53"
          ],
          "display_name": false
        },
        {
          "uuid": "53393a55-ad14-4692-ace5-2db35d7acc97",
          "name": "ENOXOLONE POTASSIUM",
          "stdName": "ENOXOLONE POTASSIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "372d9e81-2222-4b32-aee4-47289e84d610",
            "03cca99c-1d35-4d05-bcd0-e7697b862b53"
          ],
          "display_name": false
        },
        {
          "uuid": "38c9ffd0-8ee0-4108-8f27-dd95509cd630",
          "name": "GLYCYRRHETIC ACID POTASSIUM SALT",
          "stdName": "GLYCYRRHETIC ACID POTASSIUM SALT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9d2f856-3cd9-43b0-8bbb-7be04e682f84",
            "03cca99c-1d35-4d05-bcd0-e7697b862b53"
          ],
          "display_name": false
        },
        {
          "uuid": "1722dcd7-d317-40ab-9c73-c3d427d1918b",
          "name": "MONOPOTASSIUM GLYCYRRHETIN",
          "stdName": "MONOPOTASSIUM GLYCYRRHETIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a758516e-187c-41c3-861e-57f7747e2074",
            "03cca99c-1d35-4d05-bcd0-e7697b862b53"
          ],
          "display_name": false
        },
        {
          "uuid": "33ef9f8d-a3ee-41a1-ae70-ed0ec1dca373",
          "name": "OLEAN-12-EN-29-OIC ACID, 3-HYDROXY-11-OXO-, MONOPOTASSIUM SALT, (3.BETA.,20.BETA.)-",
          "stdName": "OLEAN-12-EN-29-OIC ACID, 3-HYDROXY-11-OXO-, MONOPOTASSIUM SALT, (3.BETA.,20.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a758516e-187c-41c3-861e-57f7747e2074",
            "03cca99c-1d35-4d05-bcd0-e7697b862b53"
          ],
          "display_name": false
        },
        {
          "uuid": "5ccdc668-8a22-4ea2-9e8f-6977c24001d3",
          "name": "OLEAN-12-EN-29-OIC ACID, 3-HYDROXY-11-OXO-, POTASSIUM SALT (1:1), (3.BETA.,20.BETA.)-",
          "stdName": "OLEAN-12-EN-29-OIC ACID, 3-HYDROXY-11-OXO-, POTASSIUM SALT (1:1), (3.BETA.,20.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a758516e-187c-41c3-861e-57f7747e2074",
            "03cca99c-1d35-4d05-bcd0-e7697b862b53"
          ],
          "display_name": false
        },
        {
          "uuid": "7912623e-6f7c-4b2b-892c-fda307355574",
          "name": "POTASSIUM GLYCYRRHETINATE",
          "stdName": "POTASSIUM GLYCYRRHETINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eeb4315f-9e02-4111-83e9-f6c131aa2149",
            "d9d2f856-3cd9-43b0-8bbb-7be04e682f84",
            "03cca99c-1d35-4d05-bcd0-e7697b862b53"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bfb403d3-ce6d-49c9-bbc9-1df7f995705f",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "d9d2f856-3cd9-43b0-8bbb-7be04e682f84",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "03cca99c-1d35-4d05-bcd0-e7697b862b53",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a758516e-187c-41c3-861e-57f7747e2074",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "372d9e81-2222-4b32-aee4-47289e84d610",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae47dd94-16fe-497e-8947-297e2832caf2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391539000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "970327d1-b87c-4cc4-869f-98c456e7012b",
          "citation": "SRS import [5850KHR68O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5850KHR68O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391539000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eeb4315f-9e02-4111-83e9-f6c131aa2149",
          "citation": "POTASSIUM GLYCYRRHETINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0601299-ef1f-f718-f0b7-1c2e70ed6ea9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=85985-61-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5fe90fcb-5032-3dc2-0044-e0529b3315a8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4d5f5021-2848-4333-8962-0ee59782ace0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "518e5077-2908-94bc-cbbd-0d71112d74bc",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "610280b9-3d58-4532-aa61-7dfcaa9cccc6",
          "id": "610280b9-3d58-4532-aa61-7dfcaa9cccc6",
          "molfile": "\n  Marvin  01132105012D          \n\n  1  0  0  0  1  0            999 V2000\n    9.6083   -2.9288    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "33b576f2-98c9-4085-bf55-cff1b29d3899"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "4fa37353-1fca-4b5f-8615-0ff765faec0a",
          "id": "4fa37353-1fca-4b5f-8615-0ff765faec0a",
          "molfile": "\n  Marvin  01132104092D          \n\n 34 38  0  0  1  0            999 V2000\n    3.5559   -6.6762    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.8547   -7.0764    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.5559   -5.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2818   -5.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9953   -5.8417    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.9953   -5.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9953   -6.6762    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.7150   -7.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4223   -6.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4223   -5.8417    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.4223   -5.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7150   -5.4384    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7150   -4.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0139   -4.2037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4223   -4.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1420   -4.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8431   -4.1975    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.8431   -3.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5412   -2.9567    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.1379   -2.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2516   -3.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2516   -4.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5505   -4.5977    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.5505   -3.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5505   -5.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8493   -5.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1420   -5.4384    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1420   -6.2108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9103   -2.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7169   -2.1066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4574   -1.5297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2818   -7.0981    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6075   -7.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9560   -7.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n 32  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n 12  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 32  1  1  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 10  1  0  0  0  0\n 10 27  1  0  0  0  0\n 12 13  1  1  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  6  0  0  0\n 27 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 23  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 21  1  0  0  0  0\n 19 29  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  1  0  0  0\n 23 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  6  0  0  0\n 29 30  1  0  0  0  0\n 29 31  2  0  0  0  0\n 32 33  1  0  0  0  0\n 32 34  1  0  0  0  0\nM  CHG  1   2  -1\nM  END",
          "smiles": "CC1(C)[C@@H]2CC[C@]3(C)[C@H](C(=O)C=C4[C@@H]5C[C@](C)(CC[C@]5(C)CC[C@]43C)C(=O)O)[C@@]2(C)CC[C@@H]1[O-]",
          "formula": "C30H45O4",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "969d5412-4719-4558-99ba-b7e28464e165"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "469.677",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b9fc2892-de24-4357-93b9-a18ae7578b36",
      "version": "8",
      "structure": {
        "id": "5ab49164-7b89-4429-9e9c-63a69c26976f",
        "molfile": "\n  Marvin  01132104422D          \n\n 38 41  0  0  1  0            999 V2000\n    7.8431   -4.9700    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9953   -7.4301    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7150   -6.1520    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6083   -2.9288    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n    9.7169   -2.1066    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.4574   -1.5297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1379   -2.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9103   -2.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2516   -3.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5412   -2.9567    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5505   -3.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2516   -4.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8547   -7.0764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8431   -3.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5505   -4.5977    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6075   -7.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9560   -7.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5559   -6.6762    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5505   -5.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8431   -4.1975    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.5559   -5.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2818   -7.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7150   -7.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1420   -6.2108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8493   -5.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1420   -4.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0139   -4.2037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4223   -4.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9953   -5.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2818   -5.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9953   -6.6762    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4223   -5.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4223   -6.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1420   -5.4384    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7150   -4.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9953   -5.8417    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4223   -5.8417    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7150   -5.4384    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n 20  1  1  1  0  0  0\n 31  2  1  6  0  0  0\n 38  3  1  6  0  0  0\n 10  9  1  0  0  0  0\n 19 15  1  0  0  0  0\n 21 18  1  0  0  0  0\n 28 26  2  0  0  0  0\n 31 23  1  0  0  0  0\n  8  5  1  0  0  0  0\n  8  6  2  0  0  0  0\n 10  7  1  6  0  0  0\n 10  8  1  0  0  0  0\n 12  9  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15 11  1  1  0  0  0\n 15 12  1  0  0  0  0\n 18 13  1  1  0  0  0\n 20 14  1  0  0  0  0\n 20 15  1  0  0  0  0\n 22 16  1  0  0  0  0\n 22 17  1  0  0  0  0\n 22 18  1  0  0  0  0\n 25 19  1  0  0  0  0\n 26 20  1  0  0  0  0\n 30 21  1  0  0  0  0\n 31 22  1  0  0  0  0\n 33 23  1  0  0  0  0\n 34 24  1  6  0  0  0\n 34 25  1  0  0  0  0\n 34 26  1  0  0  0  0\n 35 27  2  0  0  0  0\n 35 28  1  0  0  0  0\n 36 29  1  1  0  0  0\n 36 30  1  0  0  0  0\n 36 31  1  0  0  0  0\n 37 32  1  1  0  0  0\n 37 33  1  0  0  0  0\n 37 34  1  0  0  0  0\n 38 35  1  0  0  0  0\n 38 36  1  0  0  0  0\n 38 37  1  0  0  0  0\nM  CHG  2   4   1   5  -1\nM  END",
        "smiles": "CC1(C)[C@]2([H])CC[C@]3(C)[C@]([H])(C(=O)C=C4[C@]5([H])C[C@](C)(CC[C@]5(C)CC[C@]43C)C(=O)[O-])[C@@]2(C)CC[C@@H]1O.[K+]",
        "formula": "C30H45O4.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "508.7753",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "970327d1-b87c-4cc4-869f-98c456e7012b",
          "a758516e-187c-41c3-861e-57f7747e2074"
        ],
        "stereo_centers": 9
      },
      "unii": "5850KHR68O"
    }
  ]
}