{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0c0ad93d-973e-4ead-8e10-960e82a5d4a9",
          "code": "C03BA07",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|LOW-CEILING DIURETICS, EXCL. THIAZIDES|Sulfonamides, plain|clofenamide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03BA07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "b7a35a56-521c-41bd-9df9-0cfa93948208",
          "code": "QC03BA07",
          "comments": "VATC|DIURETICS|LOW-CEILING DIURETICS, EXCL. THIAZIDES|Sulfonamides, plain|clofenamide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03BA07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "cfa8b229-6c5f-4390-962f-019730b5a09d",
          "code": "QC03BB07",
          "comments": "VATC|DIURETICS|LOW-CEILING DIURETICS, EXCL. THIAZIDES|Sulfonamides and potassium in combination|clofenamide and potassium",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03BB07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "7cc5f407-e0ab-4309-ab5b-f000516bddcc",
          "code": "671-95-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=671-95-4",
          "code_system": "CAS",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1",
            "09f27b82-10ed-4255-b632-0559523c5ead"
          ]
        },
        {
          "uuid": "472ddb3f-24b3-4d5e-96d0-c937eea9315f",
          "code": "C77559",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77559",
          "code_system": "NCI_THESAURUS",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "cc57c8b8-a36d-42a9-83ff-98f994b21839",
          "code": "CLOFENAMIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Clofenamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "6c13c958-cbd5-4685-86e6-da9b1a0ac837",
          "code": "C03BB07",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|LOW-CEILING DIURETICS, EXCL. THIAZIDES|Sulfonamides and potassium in combination|clofenamide and potassium",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03BB07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "2d1a3e47-38ee-4f6c-a8d7-e5b4801badd7",
          "code": "SUB06697MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "a2929b79-efb7-45aa-8d48-9808ccc1a85d",
          "code": "1396",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1396",
          "code_system": "INN",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "fdfaa72a-73da-4703-a03b-1f2d7c452a33",
          "code": "m1078",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1078?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "09ba6c20-e1ea-4d3b-82d4-fc50ef6ef526",
          "code": "CHEMBL1865258",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1865258",
          "code_system": "ChEMBL",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "898720b2-556d-494d-86d3-060dd8473fe2",
          "code": "211-588-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.536",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "c75ce615-9644-484e-bb28-5c7a02b5762d",
          "code": "69594",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69594",
          "code_system": "PUBCHEM",
          "references": [
            "60795411-67cc-4dd9-a690-d66dd425caa1"
          ]
        },
        {
          "uuid": "edaf5a74-9265-0fd6-162e-abef1f208d5e",
          "code": "DTXSID4046153",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4046153",
          "code_system": "EPA CompTox",
          "references": [
            "781b44a6-9fc5-4a11-6bd3-05061b7d90b2"
          ]
        },
        {
          "uuid": "39d40ace-fe6d-3c38-c10d-a9fd6f039126",
          "code": "C448",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C448",
          "code_system": "NCI_THESAURUS",
          "references": [
            "25bdbc97-ae8a-2123-e603-640b412ff054"
          ]
        },
        {
          "uuid": "b1fbe6f9-6ccd-4e91-9735-5b0af3115ddd",
          "code": "582ILN204B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "58c5fe40-51a2-b619-6281-c6b736c89e2c",
          "code": "693",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/693",
          "code_system": "DRUG CENTRAL",
          "references": [
            "25bdbc97-ae8a-2123-e603-640b412ff054"
          ]
        },
        {
          "uuid": "5bf5a04a-cc17-e10c-6435-00813effa635",
          "code": "DB13663",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB13663",
          "code_system": "DRUG BANK",
          "references": [
            "25bdbc97-ae8a-2123-e603-640b412ff054"
          ]
        },
        {
          "uuid": "c491e641-3adc-c466-fe46-9fa12dcf3009",
          "code": "100000084290",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3e5586f5-79d2-b210-175c-c75e64369440"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b7502eb3-79a8-4874-8016-82a8b3c97ab4",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "91ab8cb8-eece-415d-b20e-28ecca5fd174",
            "refuuid": "81c1c793-d14e-4691-90fc-ae0617200cc1",
            "name": "CLOFENAMIDE",
            "unii": "582ILN204B",
            "linking_id": "582ILN204B",
            "ref_pname": "CLOFENAMIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "85b95bf7-10d0-4c72-a806-c35ae5391f8e",
          "name": "4-CHLORO-M-BENZENEDISULFONAMIDE",
          "stdName": "4-CHLORO-M-BENZENEDISULFONAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64f465ea-f7f0-4967-8357-095aaea8c348"
          ],
          "display_name": false
        },
        {
          "uuid": "d8b224f4-afa9-4c18-86f5-6b0961db33cd",
          "name": "CHLORAMIDOBENZOL",
          "stdName": "CHLORAMIDOBENZOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64f465ea-f7f0-4967-8357-095aaea8c348"
          ],
          "display_name": false
        },
        {
          "uuid": "0f149252-2a1b-414c-b390-c9e6792836c7",
          "name": "CLOFENAMIDE",
          "stdName": "CLOFENAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc7adb0d-9b1c-40b2-894c-b2f5c11c211f",
            "64cdd829-fb53-4a5b-a115-63113f6584a2",
            "f5da865d-0148-42ac-8402-e4d793949f62",
            "64f465ea-f7f0-4967-8357-095aaea8c348",
            "9fdc4f2e-60f8-43b7-8dcd-95b19b1a9b79",
            "628b3328-c244-45fa-aba1-71d61825842b",
            "3035f6dc-825c-4b04-acbf-68bf8849f608",
            "a69297b2-08c0-4cbe-bb56-079379175a79",
            "c1504fb9-812a-4f05-aa39-33fcaf66ff77"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "77b461f4-7d12-4fd4-b285-7b7ec539e78e",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "574a5e21-5b06-4028-b230-7617a6984560",
          "name": "CLOFENAMIDE [JAN]",
          "stdName": "CLOFENAMIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "628b3328-c244-45fa-aba1-71d61825842b"
          ],
          "display_name": false
        },
        {
          "uuid": "b2d9a89f-2af9-43c3-9e09-8c59e223acf8",
          "name": "CLOFENAMIDE [MI]",
          "stdName": "CLOFENAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64cdd829-fb53-4a5b-a115-63113f6584a2"
          ],
          "display_name": false
        },
        {
          "uuid": "94c1f9e4-0a48-ac18-8af6-208d8b00793f",
          "name": "Clofenamide [WHO-DD]",
          "stdName": "CLOFENAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c50d19e-39d6-5c63-2cfb-fbc2bf3ba79c"
          ],
          "display_name": false
        },
        {
          "uuid": "a9b8b8b1-b6ce-4f0e-8c64-ca003fd87843",
          "name": "MONOCHLORPHENAMIDE",
          "stdName": "MONOCHLORPHENAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64f465ea-f7f0-4967-8357-095aaea8c348"
          ],
          "display_name": false
        },
        {
          "uuid": "13ec8b9f-d43b-48bb-b846-7779bae48a11",
          "name": "clofenamide [INN]",
          "stdName": "CLOFENAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5da865d-0148-42ac-8402-e4d793949f62"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "64f465ea-f7f0-4967-8357-095aaea8c348",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f5da865d-0148-42ac-8402-e4d793949f62",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "628b3328-c244-45fa-aba1-71d61825842b",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64cdd829-fb53-4a5b-a115-63113f6584a2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9fdc4f2e-60f8-43b7-8dcd-95b19b1a9b79",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60795411-67cc-4dd9-a690-d66dd425caa1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390717000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "868f6be9-8fbc-407b-8332-44e12093ff7a",
          "citation": "SRS import [582ILN204B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=582ILN204B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390717000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc7adb0d-9b1c-40b2-894c-b2f5c11c211f",
          "citation": "CLOFENAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c1504fb9-812a-4f05-aa39-33fcaf66ff77",
          "citation": "CLOFENAMIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3035f6dc-825c-4b04-acbf-68bf8849f608",
          "citation": "CLOFENAMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a69297b2-08c0-4cbe-bb56-079379175a79",
          "citation": "CLOFENAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "781b44a6-9fc5-4a11-6bd3-05061b7d90b2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=671-95-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e5586f5-79d2-b210-175c-c75e64369440",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "25bdbc97-ae8a-2123-e603-640b412ff054",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "09f27b82-10ed-4255-b632-0559523c5ead",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9c50d19e-39d6-5c63-2cfb-fbc2bf3ba79c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b239ee5e-3573-4796-be1b-d8306149f9c4",
          "id": "b239ee5e-3573-4796-be1b-d8306149f9c4",
          "molfile": "\n  Marvin  01132109142D          \n\n 15 15  0  0  0  0            999 V2000\n    6.4267   -3.8410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6036   -3.8410    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7805   -3.8410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6036   -4.6641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6036   -3.0179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3186   -2.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3186   -1.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6036   -1.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6036   -0.5446    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.8927   -1.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8927   -2.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1736   -1.3552    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7496   -2.0743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5976   -0.6360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4544   -0.9312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  2  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 12  2  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1S(=O)(=O)N)S(=O)(=O)N)Cl",
          "formula": "C6H7ClN2O4S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2e3e2c35-9868-4938-80cb-86f46122d94a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.7161",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "81c1c793-d14e-4691-90fc-ae0617200cc1",
      "version": "11",
      "structure": {
        "id": "7d59095b-e75f-448c-a20d-739ad2da031c",
        "molfile": "\n  Marvin  01132106302D          \n\n 15 15  0  0  0  0            999 V2000\n    4.1736   -1.3552    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6036   -3.8410    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8927   -1.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8927   -2.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6036   -3.0179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6036   -1.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5976   -0.6360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4544   -0.9312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7805   -3.8410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6036   -4.6641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7496   -2.0743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4267   -3.8410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3186   -2.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3186   -1.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6036   -0.5446    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  3  2  0  0  0  0\n  7  1  2  0  0  0  0\n  8  1  2  0  0  0  0\n  9  2  2  0  0  0  0\n 10  2  2  0  0  0  0\n 11  1  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14  6  1  0  0  0  0\n 15  6  1  0  0  0  0\n  5 13  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1S(=O)(=O)N)S(=O)(=O)N)Cl",
        "formula": "C6H7ClN2O4S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.7161",
        "optical_activity": "NONE",
        "references": [
          "868f6be9-8fbc-407b-8332-44e12093ff7a",
          "64f465ea-f7f0-4967-8357-095aaea8c348",
          "f5da865d-0148-42ac-8402-e4d793949f62"
        ],
        "stereo_centers": 0
      },
      "unii": "582ILN204B"
    }
  ]
}