{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "752fede8-2f36-415b-86c7-ec734c94fbde", "code": "57XK524B7M", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ac0b4c55-a10c-45a5-9ae7-31890c3da1cd", "code": "79815-20-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=79815-20-6", "code_system": "CAS", "references": [ "f813f44a-221d-4ee6-9699-09d21ecea897" ] }, { "uuid": "451d62c4-e1a1-4f77-9629-619aded73e7a", "code": "2733920", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2733920", "code_system": "PUBCHEM", "references": [ "58fff384-9f7d-457a-8e5d-8bb31a7319e1" ] }, { "uuid": "83d01fec-abab-fc0d-b499-6e2d6835bc90", "code": "DTXSID101036449", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID101036449", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "469a09a1-edfe-4261-ac56-26a423ca702d", "amount": { "uuid": "da096b7b-f0c0-472d-8766-33a51d5b156a" }, "type": "RACEMATE->ENANTIOMER", "references": [ "f813f44a-221d-4ee6-9699-09d21ecea897" ], "related_substance": { "uuid": "aee9c4ed-fea6-487a-8011-a86d9c8e6589", "refuuid": "2c4ffb53-fab0-4365-a9b5-fecbcad639cf", "name": "INDOLINE-2-CARBOXYLIC ACID", "unii": "ZHU9PQB6S7", "linking_id": "ZHU9PQB6S7", "ref_pname": "INDOLINE-2-CARBOXYLIC ACID", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "101b4589-38e0-488e-ac22-19c9664c4ff2", "name": "(-)-2,3-DIHYDROINDOLE-2-CARBOXYLIC ACID", "stdName": "(-)-2,3-DIHYDROINDOLE-2-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f813f44a-221d-4ee6-9699-09d21ecea897" ], "display_name": false }, { "uuid": "9173ddd6-3302-455e-9797-471e7ca6f5ef", "name": "(S)-INDOLINE-2-CARBOXYLIC ACID", "stdName": "(S)-INDOLINE-2-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f813f44a-221d-4ee6-9699-09d21ecea897" ], "display_name": false }, { "uuid": "8804cb78-2ab4-40c4-a1fa-d1fdb033ed52", "name": "1H-INDOLE-2-CARBOXYLIC ACID, 2,3-DIHYDRO-, (2S)-", "stdName": "1H-INDOLE-2-CARBOXYLIC ACID, 2,3-DIHYDRO-, (2S)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f813f44a-221d-4ee6-9699-09d21ecea897" ], "display_name": false }, { "uuid": "28af2687-1ed6-45ff-a964-cae68ffcb5c8", "name": "INDOLINE-2-CARBOXYLIC ACID, (S)-", "stdName": "INDOLINE-2-CARBOXYLIC ACID, (S)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b103cfa6-998b-41a0-b7c1-20eab5ed2a35", "f813f44a-221d-4ee6-9699-09d21ecea897" ], "display_name": true }, { "uuid": "26957a91-2c9d-49dd-83be-f8754d1ee089", "name": "L-INDOLINE-2-CARBOXYLIC ACID", "stdName": "L-INDOLINE-2-CARBOXYLIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f813f44a-221d-4ee6-9699-09d21ecea897" ], "display_name": false } ], "references": [ { "uuid": "b103cfa6-998b-41a0-b7c1-20eab5ed2a35", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f545f83b-a5bc-4a61-a77b-9d8864df57fe", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f813f44a-221d-4ee6-9699-09d21ecea897", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "58fff384-9f7d-457a-8e5d-8bb31a7319e1", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fb0d21bf-2af5-4672-9f2f-39ed6e1d8a82", "id": "fb0d21bf-2af5-4672-9f2f-39ed6e1d8a82", "molfile": "\n Marvin 02052110322D \n\n 12 13 0 0 1 0 999 V2000\n 15.2780 -4.7844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8655 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2779 -3.3555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0405 -4.0700 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.5556 -4.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7709 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7709 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5556 -3.4025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0565 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3420 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3420 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0565 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 6 0 0 0\n 4 5 1 0 0 0 0\n 4 8 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 12 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)C[C@@H](C(=O)O)N2", "formula": "C9H9NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "632ce9ec-0037-438c-b3de-d974772eff1a" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "163.1736", "optical_activity": "UNSPECIFIED", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "9543df7e-5f37-4951-b25e-1b85f5975fdf", "version": "11", "structure": { "id": "de6c32ae-0e3e-4324-badc-851067efd28d", "molfile": "\n JSDraw202052110322D\n\n 12 13 0 0 1 0 0 V2000\n 28.8893 -9.0469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1093 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8892 -6.3450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5493 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6324 -8.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1487 -8.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1487 -6.9159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6324 -6.4338 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7977 -6.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4467 -6.9159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4467 -8.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7977 -9.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 4 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 6 12 1 0 0 0 0\n 4 2 1 6 0 0 0\nM END", "smiles": "c1ccc2c(c1)C[C@@H](C(=O)O)N2", "formula": "C9H9NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "163.1736", "optical_activity": "( - )", "references": [ "b103cfa6-998b-41a0-b7c1-20eab5ed2a35", "f813f44a-221d-4ee6-9699-09d21ecea897" ], "stereo_centers": 1 }, "unii": "57XK524B7M" } ] }