{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "918a547e-352e-4460-83e2-d8646b56490e",
          "code": "52136-25-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=52136-25-1",
          "code_system": "CAS",
          "references": [
            "6f14f4b3-18a1-4825-bc6c-ea1b6eabe9ce",
            "58e05cd6-ca23-41e8-95ea-4198b47a2abe"
          ]
        },
        {
          "uuid": "517c5f62-ba4d-4c7b-a821-3e800c6a934d",
          "code": "C99772",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C99772",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6f14f4b3-18a1-4825-bc6c-ea1b6eabe9ce"
          ]
        },
        {
          "uuid": "bb4cffc3-df91-4607-a681-52d72a302430",
          "code": "257-687-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.052.426",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6f14f4b3-18a1-4825-bc6c-ea1b6eabe9ce"
          ]
        },
        {
          "uuid": "a72772ed-e1ac-4ab6-876e-3b441acfe461",
          "code": "104094",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/104094",
          "code_system": "PUBCHEM",
          "references": [
            "6f14f4b3-18a1-4825-bc6c-ea1b6eabe9ce"
          ]
        },
        {
          "uuid": "d07995c6-8c57-6e13-def3-0ed1c58d36a1",
          "code": "DTXSID60200145",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60200145",
          "code_system": "EPA CompTox",
          "references": [
            "e2d521f3-fdac-b2bf-7ab3-0c4972579190"
          ]
        },
        {
          "uuid": "e283b592-a61f-0092-5b5c-c0e5a423dbeb",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e4b568b9-71a8-0576-15ef-f88d7691979a"
          ]
        },
        {
          "uuid": "8efba8d1-28b2-4961-b7bb-600499acb698",
          "code": "578544UDFJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a60346ea-d58a-4fc3-ad89-8d4510ad5832",
          "name": "2,5-CYCLOHEXADIENE-1,4-DIONE, 2-((4-(BIS(2-HYDROXYETHYL)AMINO)PHENYL)AMINO)-5-((2-HYDROXYETHYL)AMINO)-",
          "stdName": "2,5-CYCLOHEXADIENE-1,4-DIONE, 2-((4-(BIS(2-HYDROXYETHYL)AMINO)PHENYL)AMINO)-5-((2-HYDROXYETHYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39ca9a4f-7b1e-4137-9df6-01ed1f41b4b2",
            "81ce7d57-17d1-4579-92df-c40b7a11f008"
          ],
          "display_name": false
        },
        {
          "uuid": "c216ed27-5fdb-4aa1-8588-fb5c511f36fe",
          "name": "2-((4-(BIS(2-HYDROXYETHYL)AMINO)PHENYL)AMINO)-5-((2-HYDROXYETHYL)AMINO)-2,5-CYCLOHEXADIENE-1,4-DIONE",
          "stdName": "2-((4-(BIS(2-HYDROXYETHYL)AMINO)PHENYL)AMINO)-5-((2-HYDROXYETHYL)AMINO)-2,5-CYCLOHEXADIENE-1,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ce7d57-17d1-4579-92df-c40b7a11f008",
            "aad0c4fc-0cc3-44c9-93da-cc9b952ec33c"
          ],
          "display_name": false
        },
        {
          "uuid": "cb0fc00a-627c-483c-b772-b996702f1c65",
          "name": "2-.BETA.-HYDROXYETHYLAMINO-5-(4'-BIS-(.BETA.-HYDROXYETHYL)-AMINO)ANILINO-1,4- BENZOQUINONE",
          "stdName": "2-.BETA.-HYDROXYETHYLAMINO-5-(4'-BIS-(.BETA.-HYDROXYETHYL)-AMINO)ANILINO-1,4- BENZOQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ce7d57-17d1-4579-92df-c40b7a11f008",
            "aad0c4fc-0cc3-44c9-93da-cc9b952ec33c"
          ],
          "display_name": false
        },
        {
          "uuid": "328b0c84-6a8e-4195-baf9-fde23602ac73",
          "name": "HC GREEN NO. 1",
          "stdName": "HC GREEN NO. 1",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ce7d57-17d1-4579-92df-c40b7a11f008",
            "aad0c4fc-0cc3-44c9-93da-cc9b952ec33c",
            "35a5669f-582b-47f1-bf83-e5f1d58eb4a5"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "72a7234e-e869-46d7-849e-eaec225e5dcd",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c8c02b53-c39c-4150-a4f9-241693c75efc",
          "name": "IMEXINE IK",
          "stdName": "IMEXINE IK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ce7d57-17d1-4579-92df-c40b7a11f008",
            "aad0c4fc-0cc3-44c9-93da-cc9b952ec33c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "81ce7d57-17d1-4579-92df-c40b7a11f008",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39ca9a4f-7b1e-4137-9df6-01ed1f41b4b2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f14f4b3-18a1-4825-bc6c-ea1b6eabe9ce",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1c47047-f2b3-4e82-a791-e9f2953857fa",
          "citation": "SRS import [578544UDFJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=578544UDFJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35a5669f-582b-47f1-bf83-e5f1d58eb4a5",
          "citation": "HC GREEN NO. 1 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aad0c4fc-0cc3-44c9-93da-cc9b952ec33c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e2d521f3-fdac-b2bf-7ab3-0c4972579190",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=52136-25-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e4b568b9-71a8-0576-15ef-f88d7691979a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "58e05cd6-ca23-41e8-95ea-4198b47a2abe",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d52a98f4-1270-4fa4-b67e-dd9003c998c9",
          "id": "d52a98f4-1270-4fa4-b67e-dd9003c998c9",
          "molfile": "\n  Marvin  01132111032D          \n\n 26 27  0  0  0  0            999 V2000\n    4.3084   -4.3494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1249   -4.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5374   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3580   -3.6367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7705   -4.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5955   -4.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0080   -5.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8330   -5.0613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5955   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0080   -6.4811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8330   -6.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2412   -7.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0618   -7.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4786   -6.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0618   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2412   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2992   -6.4811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7118   -7.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5368   -7.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9493   -6.4811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7118   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5368   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9493   -5.0613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7705   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3580   -5.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5374   -5.0613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5 25  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 24  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 17  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 21  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  2  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1NC2=CC(=O)C(=CC2=O)NCCO)N(CCO)CCO",
          "formula": "C18H23N3O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b4289c27-a3fd-4d05-a987-51f643432509"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "361.393",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e03fc552-f8fc-496d-ba94-d4c942fce552",
      "version": "5",
      "structure": {
        "id": "219459d9-8d47-4958-83f2-666af7a8e969",
        "molfile": "\n  Marvin  01132101542D          \n\n 26 27  0  0  0  0            999 V2000\n   12.9493   -6.4811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5368   -7.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7118   -7.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9493   -5.0613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5368   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7118   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2992   -6.4811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2412   -7.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0618   -7.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4786   -6.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0618   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2412   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8330   -6.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0080   -6.4811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3084   -4.3494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1249   -4.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5374   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3580   -3.6367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5374   -5.0613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8330   -5.0613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5955   -4.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7705   -4.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3580   -5.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7705   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5955   -5.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0080   -5.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 25 14  1  0  0  0  0\n 14 13  1  0  0  0  0\n 10  7  1  0  0  0  0\n  7  3  1  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8 13  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 22 18  1  0  0  0  0\n 18 17  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 23 19  2  0  0  0  0\n 26 20  2  0  0  0  0\n 26 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1NC2=CC(=O)C(=CC2=O)NCCO)N(CCO)CCO",
        "formula": "C18H23N3O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "361.393",
        "optical_activity": "NONE",
        "references": [
          "39ca9a4f-7b1e-4137-9df6-01ed1f41b4b2",
          "d1c47047-f2b3-4e82-a791-e9f2953857fa"
        ],
        "stereo_centers": 0
      },
      "unii": "578544UDFJ"
    }
  ]
}