{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a392ffe8-7e4b-4229-a032-3de78794a304",
          "code": "C92609",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C92609",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d74a04d4-b913-494a-9cb7-dc99c7ef1f43"
          ]
        },
        {
          "uuid": "efd99a72-8e8a-4ea3-be8f-e1c5ebf9d404",
          "code": "3016970",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3016970",
          "code_system": "PUBCHEM",
          "references": [
            "d74a04d4-b913-494a-9cb7-dc99c7ef1f43"
          ]
        },
        {
          "uuid": "b84a3676-2534-abde-d84d-d85c249db773",
          "code": "C92608",
          "comments": "Industrial Aid[C45678]|Paraben",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C92608",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1ce87800-368f-bcaa-dba9-7282b7744d44"
          ]
        },
        {
          "uuid": "68565d01-475a-4556-9b9b-098429d61c65",
          "code": "576E45366K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0193e3a2-7f0c-4534-8bd2-3258900a11b5",
          "name": "P-HYDROXYBENZOIC ACID, PHENOXYETHYL ESTER",
          "stdName": "P-HYDROXYBENZOIC ACID, PHENOXYETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aacfbea6-d31a-4f16-934a-8505a97d07c1",
            "c2bedb0d-b015-481c-97e6-e770dbb0cab9"
          ],
          "display_name": false
        },
        {
          "uuid": "3e6849d0-741f-4b75-b3a3-522f330f47a1",
          "name": "PHENOXYETHYL PARABEN",
          "stdName": "PHENOXYETHYL PARABEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe8d104e-0fc0-44d0-b249-5c344a4afc1b",
            "82657821-dc5a-45d2-97a0-2078d4278c9f"
          ],
          "display_name": false
        },
        {
          "uuid": "60ea49a6-7c9b-4c3e-891e-7b525609451c",
          "name": "PHENOXYETHYLPARABEN",
          "stdName": "PHENOXYETHYLPARABEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aacfbea6-d31a-4f16-934a-8505a97d07c1",
            "c2bedb0d-b015-481c-97e6-e770dbb0cab9",
            "9b90190d-5e9a-4aa0-a31b-04ad56248a29",
            "5ca3cf54-5eef-4be9-87f1-e23641a668ae"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "73f9826b-eb9f-40b3-a732-ba075a0d96fd",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "fe8d104e-0fc0-44d0-b249-5c344a4afc1b",
          "citation": " PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "82657821-dc5a-45d2-97a0-2078d4278c9f",
          "citation": "DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aacfbea6-d31a-4f16-934a-8505a97d07c1",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2bedb0d-b015-481c-97e6-e770dbb0cab9",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b90190d-5e9a-4aa0-a31b-04ad56248a29",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d74a04d4-b913-494a-9cb7-dc99c7ef1f43",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390478000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb0b0c70-44f1-4f5b-a43f-d447a03dc7fc",
          "citation": "SRS import [576E45366K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=576E45366K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390478000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ca3cf54-5eef-4be9-87f1-e23641a668ae",
          "citation": "PHENOXYETHYLPARABEN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1ce87800-368f-bcaa-dba9-7282b7744d44",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "736eb580-e002-46b0-9a33-05e07b4a70f3",
          "id": "736eb580-e002-46b0-9a33-05e07b4a70f3",
          "molfile": "\n  Marvin  01132105592D          \n\n 19 20  0  0  0  0            999 V2000\n    0.0000    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7050   -0.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7050   -1.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4229   -1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1254   -1.2119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1331   -0.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4229   -0.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8638   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8484   -2.4702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5817   -1.2737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2636   -1.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9969   -1.2737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7071   -1.6751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4327   -1.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4327   -0.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1557   -0.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8736   -0.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8736   -1.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1403   -1.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)OCCOC(=O)c2ccc(cc2)O",
          "formula": "C15H14O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "89fd6026-4256-4ef7-a16d-b0ddf77db789"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "258.2698",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "048bb56f-9486-42cc-80a0-f78ae8c8a8be",
      "version": "5",
      "structure": {
        "id": "e36092e3-f54d-44e0-ba7c-b39969f13d2c",
        "molfile": "\n  Marvin  01132111462D          \n\n 19 20  0  0  0  0            999 V2000\n    2.8638   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1254   -1.2119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8484   -2.4702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4229   -1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1331   -0.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5817   -1.2737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7050   -0.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7050   -1.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4229   -0.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4327   -1.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7071   -1.6751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2636   -1.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9969   -1.2737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1403   -1.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4327   -0.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1557   -0.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8736   -1.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8736   -0.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  5  2  0  0  0  0\n 10 12  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12 14  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 10  2  0  0  0  0\n 16 10  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 15  1  0  0  0  0\n 19 17  1  0  0  0  0\n  8  7  2  0  0  0  0\n 19 18  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)OCCOC(=O)c2ccc(cc2)O",
        "formula": "C15H14O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "258.2698",
        "optical_activity": "NONE",
        "references": [
          "aacfbea6-d31a-4f16-934a-8505a97d07c1",
          "bb0b0c70-44f1-4f5b-a43f-d447a03dc7fc"
        ],
        "stereo_centers": 0
      },
      "unii": "576E45366K"
    }
  ]
}