{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "168d5875-1fed-4f02-be0d-4926bf93c989",
          "code": "2497-07-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2497-07-6",
          "code_system": "CAS",
          "references": [
            "5df57774-3ce4-46c3-9287-cca92e0bc514",
            "bdf81069-5c49-4484-b869-1816fafc2ce8"
          ]
        },
        {
          "uuid": "7f61bff7-d0f7-4125-902f-4560ef662b15",
          "code": "C088207",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67088207",
          "code_system": "MESH",
          "references": [
            "5df57774-3ce4-46c3-9287-cca92e0bc514"
          ]
        },
        {
          "uuid": "9d401513-2415-45e8-9506-852511b9d013",
          "code": "OXYDISULFOTON",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Oxydisulfoton",
          "code_system": "WIKIPEDIA",
          "references": [
            "5df57774-3ce4-46c3-9287-cca92e0bc514"
          ]
        },
        {
          "uuid": "e2998e91-a1d2-411b-bcce-2b7d6746fd0e",
          "code": "340200",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3365",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "5df57774-3ce4-46c3-9287-cca92e0bc514"
          ]
        },
        {
          "uuid": "2cdbb93d-e2c4-49a9-9f88-5d9d2d5a64f4",
          "code": "219-679-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.891",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5df57774-3ce4-46c3-9287-cca92e0bc514"
          ]
        },
        {
          "uuid": "2ab0fca5-0fd9-4abb-afa3-0b7c0d06c042",
          "code": "17242",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17242",
          "code_system": "PUBCHEM",
          "references": [
            "5df57774-3ce4-46c3-9287-cca92e0bc514"
          ]
        },
        {
          "uuid": "4c2567a2-b7a8-52af-2996-e7ae503be9ec",
          "code": "6425",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6425",
          "code_system": "HSDB",
          "references": [
            "ab1a85f8-96ec-ddf4-f143-fe04745d9e84"
          ]
        },
        {
          "uuid": "3020c1b6-3443-9dd6-3ed2-61d3bf8719c3",
          "code": "DTXSID4037536",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4037536",
          "code_system": "EPA CompTox",
          "references": [
            "78727ea7-48dc-5bbc-c256-916aa578aee9"
          ]
        },
        {
          "uuid": "6498a7f1-3b00-43e7-ac0a-aa86e5a4ba13",
          "code": "573PQK81XK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8092cee5-162c-9dac-740f-dbd0b1fa8080",
          "code": "oxydisulfoton",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/oxydisulfoton.html",
          "code_system": "ALANWOOD",
          "references": [
            "08bf4e10-3ecb-a8b3-0971-1b602994c8c8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "df2ff9bc-7d56-4aae-b14d-8d95c8725524",
          "name": "DISULFOTON SULFOXIDE",
          "stdName": "DISULFOTON SULFOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee3a33ed-869e-4bc3-8177-01c1bd41120c",
            "8a3060bd-b09b-4c5b-8143-9ff64bc653db"
          ],
          "display_name": false
        },
        {
          "uuid": "699c81e4-774e-457d-a0af-191607a02c22",
          "name": "DISYSTON SULFOXIDE",
          "stdName": "DISYSTON SULFOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee3a33ed-869e-4bc3-8177-01c1bd41120c",
            "8a3060bd-b09b-4c5b-8143-9ff64bc653db"
          ],
          "display_name": false
        },
        {
          "uuid": "b1eced35-919f-4f89-a980-97530357a0d5",
          "name": "ETHYLTHIOMETON SULFOXIDE",
          "stdName": "ETHYLTHIOMETON SULFOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee3a33ed-869e-4bc3-8177-01c1bd41120c",
            "8a3060bd-b09b-4c5b-8143-9ff64bc653db"
          ],
          "display_name": false
        },
        {
          "uuid": "d3608136-d375-4dd5-b481-a07f41790d61",
          "name": "O,O-DIETHYL S-(2-ETHYLTHIONYLETHYL) PHOSPHORODITHIOATE",
          "stdName": "O,O-DIETHYL S-(2-ETHYLTHIONYLETHYL) PHOSPHORODITHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee3a33ed-869e-4bc3-8177-01c1bd41120c",
            "8a3060bd-b09b-4c5b-8143-9ff64bc653db"
          ],
          "display_name": false
        },
        {
          "uuid": "e08de214-935c-4aeb-8708-66445b24351e",
          "name": "OXYDISULFOTON",
          "stdName": "OXYDISULFOTON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee3a33ed-869e-4bc3-8177-01c1bd41120c",
            "f78288d0-05e0-4002-8190-019401a523ea",
            "37eaf743-56cb-4cd5-bbe3-204fb9e71868",
            "cb905130-7d52-4903-a3d6-8240869e5eff",
            "98fb4d16-01a6-4a28-9aaa-23ca5df430d9",
            "5469f4fd-1348-4f9f-a5a5-86875a380e3c"
          ],
          "display_name": true
        },
        {
          "uuid": "ebcb8380-c36d-47d6-9b0c-d26e3e50f02d",
          "name": "OXYDISULFOTON [HSDB]",
          "stdName": "OXYDISULFOTON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee3a33ed-869e-4bc3-8177-01c1bd41120c",
            "cb905130-7d52-4903-a3d6-8240869e5eff"
          ],
          "display_name": false
        },
        {
          "uuid": "d90c49cb-92a0-484f-b63f-86183ddd0d07",
          "name": "OXYDISULFOTON [ISO]",
          "stdName": "OXYDISULFOTON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee3a33ed-869e-4bc3-8177-01c1bd41120c",
            "37eaf743-56cb-4cd5-bbe3-204fb9e71868"
          ],
          "display_name": false
        },
        {
          "uuid": "1d98f8f0-694b-41ad-a159-a733d84cc12c",
          "name": "PHOSPHORODITHIOIC ACID, O,O-DIETHYL S-(2-(ETHYLSULFINYL)ETHYL) ESTER",
          "stdName": "PHOSPHORODITHIOIC ACID, O,O-DIETHYL S-(2-(ETHYLSULFINYL)ETHYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee3a33ed-869e-4bc3-8177-01c1bd41120c",
            "8a3060bd-b09b-4c5b-8143-9ff64bc653db"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f78288d0-05e0-4002-8190-019401a523ea",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cb905130-7d52-4903-a3d6-8240869e5eff",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee3a33ed-869e-4bc3-8177-01c1bd41120c",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a3060bd-b09b-4c5b-8143-9ff64bc653db",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37eaf743-56cb-4cd5-bbe3-204fb9e71868",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5df57774-3ce4-46c3-9287-cca92e0bc514",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390922000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49bc38eb-0aa8-43b6-8226-6ddf16253c4f",
          "citation": "SRS import [573PQK81XK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=573PQK81XK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390922000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "315f95ae-12d9-42d3-9334-6d809aae8284",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5469f4fd-1348-4f9f-a5a5-86875a380e3c",
          "citation": "OXYDISULFOTON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98fb4d16-01a6-4a28-9aaa-23ca5df430d9",
          "citation": "OXYDISULFOTON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ab1a85f8-96ec-ddf4-f143-fe04745d9e84",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+2497-07-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "78727ea7-48dc-5bbc-c256-916aa578aee9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2497-07-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "08bf4e10-3ecb-a8b3-0971-1b602994c8c8",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "bdf81069-5c49-4484-b869-1816fafc2ce8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c23f2113-5ed6-4695-9954-6364950f17e2",
          "id": "c23f2113-5ed6-4695-9954-6364950f17e2",
          "molfile": "\n  Marvin  01132110022D          \n\n 15 14  0  0  0  0            999 V2000\n   10.6912   -3.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1091   -3.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2783   -3.0596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4523   -3.0596    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4523   -2.2336    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4523   -3.8911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4523   -4.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1537   -5.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6156   -3.0596    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7895   -3.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3738   -3.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5526   -3.7715    0.0000 S   0  0  0  0  0  0  0  0  0  3  0  0\n    5.1318   -3.0494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1422   -4.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3165   -4.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  4  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "CCOP(=S)(OCC)SCCS(=O)CC",
          "formula": "C8H19O3PS3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "26ac6e1a-c594-4fc1-94c7-c225903f502e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "290.407",
          "optical_activity": "NONE",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "458fde34-aeed-4e9e-89e9-58afd3ac3951",
      "version": "5",
      "structure": {
        "id": "facbbf36-535e-408b-b1b1-19e51961dbe4",
        "molfile": "\n  Marvin  01132112592D          \n\n 15 14  0  0  0  0            999 V2000\n    8.4523   -3.0596    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6156   -3.0596    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7895   -3.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3738   -3.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5526   -3.7715    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    5.1422   -4.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3165   -4.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1318   -3.0494    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.2783   -3.0596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1091   -3.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6912   -3.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4523   -3.8911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4523   -4.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1537   -5.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4523   -2.2336    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  1 15  2  0  0  0  0\nM  CHG  2   5   1   8  -1\nM  END",
        "smiles": "CCOP(=S)(OCC)SCC[S+](CC)[O-]",
        "formula": "C8H19O3PS3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "290.407",
        "optical_activity": "( + / - )",
        "references": [
          "315f95ae-12d9-42d3-9334-6d809aae8284",
          "49bc38eb-0aa8-43b6-8226-6ddf16253c4f"
        ],
        "stereo_centers": 1
      },
      "unii": "573PQK81XK"
    }
  ]
}