{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d22d5e31-fb05-4b30-88f4-30650c31e3b1",
          "code": "521-10-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=521-10-8",
          "code_system": "CAS",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3",
            "c1618bb2-7074-495c-ab36-bdae95ab91d1"
          ]
        },
        {
          "uuid": "004611f8-aa12-4c8a-90e9-22d019710418",
          "code": "C83950",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83950",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "c275271d-7c2d-4498-839a-cea9dba7e4f1",
          "code": "D008695",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008695",
          "code_system": "MESH",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "adbc5985-2b78-434d-b86d-40892e0d66a3",
          "code": "METHANDRIOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Methandriol",
          "code_system": "WIKIPEDIA",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "97e1adc7-b81a-490c-b91c-97b171b3b3c7",
          "code": "SUB08835MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "c2f35f93-c434-4610-9a04-c8cd638863fe",
          "code": "1882",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1882",
          "code_system": "INN",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "52fd6c96-e58e-4c21-bd2a-032b353e9a43",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "4f1ea2d5-6902-4f7f-b05b-ab81e8a1d57b",
          "code": "6817",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6817/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "79ca8bfd-6703-4e49-9fce-e35630bc13f2",
          "code": "m7292",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7292?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "cb57e76e-9205-4861-9128-3ecafb1db351",
          "code": "CHEMBL1079446",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1079446",
          "code_system": "ChEMBL",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "b3e94833-0d68-47f7-a0c9-0f94dec2a2c9",
          "code": "208-301-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.548",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "1e48656c-f007-419c-9a8f-b2d90951d5d4",
          "code": "229021",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/229021",
          "code_system": "PUBCHEM",
          "references": [
            "7506463b-4c7a-4e18-8d7b-4ec17c40bff3"
          ]
        },
        {
          "uuid": "e08f5830-de4a-51cc-548e-13e449e47c97",
          "code": "C2360",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7de010e1-aade-d0d3-b536-6cc4df786b32"
          ]
        },
        {
          "uuid": "00166dd6-2ac4-429e-97ac-616fb412dbcf",
          "code": "5730Z864KG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "95a410c6-cf77-d3d9-abe8-77e84abd3a01",
          "code": "1733",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1733",
          "code_system": "DRUG CENTRAL",
          "references": [
            "7de010e1-aade-d0d3-b536-6cc4df786b32"
          ]
        },
        {
          "uuid": "22d74847-cd49-4a1e-fd5b-deda5137fa0d",
          "code": "100000081226",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5cb2c4fe-c527-fb68-8e7d-5571672b3cbb"
          ]
        },
        {
          "uuid": "f5383115-7991-8b9e-6a70-e6e96b6ee70d",
          "code": "DTXSID50878534",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50878534",
          "code_system": "EPA CompTox",
          "references": [
            "7de010e1-aade-d0d3-b536-6cc4df786b32"
          ]
        },
        {
          "uuid": "f1ec2628-8453-3eb1-368c-a09f75c5003e",
          "code": "22366",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=22366",
          "code_system": "NSC",
          "references": [
            "92156530-8454-eeb4-6680-ee29ac13c3f9"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f12d2d65-c300-4e79-8faf-89bdc241af18",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "fd6c6bad-65de-4eb2-aba4-8319c653446a",
            "refuuid": "dcda1ec4-367e-4083-aaaa-e48880cc1aab",
            "name": "METHANDRIOL",
            "unii": "5730Z864KG",
            "linking_id": "5730Z864KG",
            "ref_pname": "METHANDRIOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "568d6d1e-7341-442e-a556-4c321890e45b",
          "name": "17.ALPHA.-METHYLANDROST-5-ENE-3.BETA.,17.BETA.-DIOL",
          "stdName": "17.ALPHA.-METHYLANDROST-5-ENE-3.BETA.,17.BETA.-DIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "667b0cf9-c0b3-4c46-87bb-7dd6f54ab97c"
          ],
          "display_name": false
        },
        {
          "uuid": "cf12d629-2732-4e63-88ee-ef68a31ca7a3",
          "name": "METHANDRIOL",
          "stdName": "METHANDRIOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "072f8b88-1474-46da-a8ce-2a616983f20d",
            "275ba227-cc58-4859-9ef4-d57b53b8293e",
            "0e4dbde5-4a72-4ca2-8796-1da708ea082d",
            "219c6cea-91d6-4270-b6be-af2d5e7f70fe",
            "69832c73-44ca-49c4-b17f-c6a678a321a5",
            "b5681866-77e1-428b-95b3-4d818d7d46b3",
            "3ffb424e-abf7-4ab8-ba5e-62d2fa2aa2dc",
            "ba691d6e-ac11-4541-ab63-fce537071b88",
            "e7dc298d-b992-4553-bd9c-99b6f5f5cacc",
            "9f05af2b-43d8-4b4e-8980-08133320a671",
            "eb59e049-cfc7-450f-ac47-cf097f85f296"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "080bc74b-4270-43a2-8a5c-33820e3dda44",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "5e114dee-1d17-431c-bb5a-1429e12f1a4a",
          "name": "METHANDRIOL [MART.]",
          "stdName": "METHANDRIOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "275ba227-cc58-4859-9ef4-d57b53b8293e"
          ],
          "display_name": false
        },
        {
          "uuid": "37ad6659-28e3-4bd7-923a-2cc83dc98c7f",
          "name": "METHANDRIOL [MI]",
          "stdName": "METHANDRIOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb59e049-cfc7-450f-ac47-cf097f85f296"
          ],
          "display_name": false
        },
        {
          "uuid": "b4ef6635-a06e-4ccd-b5e5-79ab4f659f48",
          "name": "METHANDRIOL [VANDF]",
          "stdName": "METHANDRIOL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "072f8b88-1474-46da-a8ce-2a616983f20d"
          ],
          "display_name": false
        },
        {
          "uuid": "9ffff5a4-009c-b043-c1d5-a46b8dff946a",
          "name": "Methandriol [WHO-DD]",
          "stdName": "METHANDRIOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83f40866-2be5-62a4-4cc3-9bc459b2c54f"
          ],
          "display_name": false
        },
        {
          "uuid": "21dc376d-f285-4676-963b-68485adc3039",
          "name": "NSC-22366",
          "stdName": "NSC-22366",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "857b58a4-7ae4-4340-ab54-6e5d21ca3ac5"
          ],
          "display_name": false
        },
        {
          "uuid": "ad324b57-df87-41ae-a36a-09a6d13b73d1",
          "name": "ORABOL",
          "stdName": "ORABOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aec9e564-b42a-4370-bd42-ccff9527d78f",
            "40b17b5f-edb7-4666-99a4-897513728d42"
          ],
          "display_name": false
        },
        {
          "uuid": "6dac4ca8-2ffd-4577-858a-82dc4538f369",
          "name": "SINESEX",
          "stdName": "SINESEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52d6cb37-9c3a-4285-a905-60af0bf07d4c"
          ],
          "display_name": false
        },
        {
          "uuid": "3ef19a7f-65c8-44fd-8115-e412aade0fb2",
          "name": "STENEDIOL",
          "stdName": "STENEDIOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52d6cb37-9c3a-4285-a905-60af0bf07d4c"
          ],
          "display_name": false
        },
        {
          "uuid": "5125f436-52c0-4b9a-bc6b-a78198309e35",
          "name": "TROFORMONE",
          "stdName": "TROFORMONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52d6cb37-9c3a-4285-a905-60af0bf07d4c"
          ],
          "display_name": false
        },
        {
          "uuid": "d5c2b41b-7cf5-4071-95b1-6a5ef882cff6",
          "name": "methandriol [INN]",
          "stdName": "METHANDRIOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5681866-77e1-428b-95b3-4d818d7d46b3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3ffb424e-abf7-4ab8-ba5e-62d2fa2aa2dc",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "667b0cf9-c0b3-4c46-87bb-7dd6f54ab97c",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5681866-77e1-428b-95b3-4d818d7d46b3",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "275ba227-cc58-4859-9ef4-d57b53b8293e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb59e049-cfc7-450f-ac47-cf097f85f296",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aec9e564-b42a-4370-bd42-ccff9527d78f",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40b17b5f-edb7-4666-99a4-897513728d42",
          "citation": "D08196",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e4dbde5-4a72-4ca2-8796-1da708ea082d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "072f8b88-1474-46da-a8ce-2a616983f20d",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52d6cb37-9c3a-4285-a905-60af0bf07d4c",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "857b58a4-7ae4-4340-ab54-6e5d21ca3ac5",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7506463b-4c7a-4e18-8d7b-4ec17c40bff3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389646000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b243473f-489f-42e8-a1ab-62a6b8241b0f",
          "citation": "SRS import [5730Z864KG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5730Z864KG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389646000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ece9af7-f0bd-47f1-8e71-5aebc0e3ea0c",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7dc298d-b992-4553-bd9c-99b6f5f5cacc",
          "citation": "METHANDRIOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9f05af2b-43d8-4b4e-8980-08133320a671",
          "citation": "METHANDRIOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "219c6cea-91d6-4270-b6be-af2d5e7f70fe",
          "citation": "METHANDRIOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "69832c73-44ca-49c4-b17f-c6a678a321a5",
          "citation": "METHANDRIOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ba691d6e-ac11-4541-ab63-fce537071b88",
          "citation": "METHANDRIOL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5cb2c4fe-c527-fb68-8e7d-5571672b3cbb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "7de010e1-aade-d0d3-b536-6cc4df786b32",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c1618bb2-7074-495c-ab36-bdae95ab91d1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "83f40866-2be5-62a4-4cc3-9bc459b2c54f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "92156530-8454-eeb4-6680-ee29ac13c3f9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7b711549-40e3-416d-b133-e088c5df1496",
          "id": "7b711549-40e3-416d-b133-e088c5df1496",
          "molfile": "\n  Marvin  01132106252D          \n\n 22 25  0  0  1  0            999 V2000\n    2.0078  -11.8343    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.7992  -12.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2807  -11.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7992  -10.7664    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.6340  -10.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8069  -10.0288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0078  -11.0277    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.0129  -10.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2933  -10.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5865  -11.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5865  -11.8343    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.2933  -12.2467    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.2933  -13.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5865  -13.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1280  -13.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8425  -13.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5648  -13.0867    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -2.2792  -13.4862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5648  -12.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8425  -11.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1280  -12.2467    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.1280  -11.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  7  1  0  0  0  0\n 12  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  1  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  1  0  0  0\n 12 11  1  0  0  0  0\n 11 21  1  0  0  0  0\n 12 13  1  6  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 21 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12CC[C@@H](CC2=CC[C@@H]3[C@@H]1CC[C@@]4(C)[C@H]3CC[C@]4(C)O)O",
          "formula": "C20H32O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "975f042b-137e-417e-b565-8e78a13603b0"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "304.4676",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dcda1ec4-367e-4083-aaaa-e48880cc1aab",
      "version": "11",
      "structure": {
        "id": "b2a999b0-1027-4f22-bad4-7af3010b74e7",
        "molfile": "\n  Marvin  01132109152D          \n\n 25 28  0  0  1  0            999 V2000\n   -0.1280  -12.2467    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.0078  -11.0277    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.1280  -13.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5865  -11.8343    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0078  -11.8343    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.2933  -12.2467    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7992  -10.7664    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.5865  -13.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2933  -10.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2933  -13.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5865  -11.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8425  -11.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7992  -12.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8425  -13.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2807  -11.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8069  -10.0288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5648  -12.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5648  -13.0867    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.1280  -11.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0129  -10.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2792  -13.4862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6340  -10.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0002  -12.6642    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5865  -12.6616    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2907  -11.4194    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  9  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9 11  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15 13  1  0  0  0  0\n  7 16  1  1  0  0  0\n 17 12  1  0  0  0  0\n 18 17  1  0  0  0  0\n  1 19  1  1  0  0  0\n  2 20  1  1  0  0  0\n 18 21  1  1  0  0  0\n  7 22  1  6  0  0  0\n  5 23  1  6  0  0  0\n  4 24  1  6  0  0  0\n  6 25  1  1  0  0  0\n 18 14  1  0  0  0  0\n 10  8  1  0  0  0  0\n  5  2  1  0  0  0  0\n 15  7  1  0  0  0  0\nM  END",
        "smiles": "C[C@@]12CC[C@@H](CC2=CC[C@]3([H])[C@]1([H])CC[C@@]4(C)[C@@]3([H])CC[C@]4(C)O)O",
        "formula": "C20H32O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "304.4676",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b243473f-489f-42e8-a1ab-62a6b8241b0f",
          "3ece9af7-f0bd-47f1-8e71-5aebc0e3ea0c",
          "b5681866-77e1-428b-95b3-4d818d7d46b3"
        ],
        "stereo_centers": 7
      },
      "unii": "5730Z864KG"
    }
  ]
}