{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b6ea5a18-cfdd-4660-a384-cc967f5f7acc",
          "code": "81777-89-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=81777-89-1",
          "code_system": "CAS",
          "references": [
            "15e83057-bb12-4312-89e0-8c2602075302",
            "e5030f18-7f6b-4249-8b8a-5fdde20a532a"
          ]
        },
        {
          "uuid": "0fe5e93d-d3c4-432c-90d4-dbc50e331ad3",
          "code": "C095255",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67095255",
          "code_system": "MESH",
          "references": [
            "15e83057-bb12-4312-89e0-8c2602075302"
          ]
        },
        {
          "uuid": "55676048-8c64-4abe-818e-44c13b2c74e7",
          "code": "CLOMAZONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Clomazone",
          "code_system": "WIKIPEDIA",
          "references": [
            "15e83057-bb12-4312-89e0-8c2602075302"
          ]
        },
        {
          "uuid": "a8482bcd-8d84-4900-b280-3b891ad54c41",
          "code": "125401",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1851",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "15e83057-bb12-4312-89e0-8c2602075302"
          ]
        },
        {
          "uuid": "c7e11a27-2226-4b81-892d-0baf31861baf",
          "code": "m3644",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3644?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "15e83057-bb12-4312-89e0-8c2602075302"
          ]
        },
        {
          "uuid": "0ef05b85-e85e-4a13-af5e-b73bb44e9558",
          "code": "54778",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54778",
          "code_system": "PUBCHEM",
          "references": [
            "15e83057-bb12-4312-89e0-8c2602075302"
          ]
        },
        {
          "uuid": "b378f43e-dc26-57e1-a870-71c08b505d21",
          "code": "6614",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6614",
          "code_system": "HSDB",
          "references": [
            "4d30626a-5331-d31b-2f75-c42172abce10"
          ]
        },
        {
          "uuid": "1e300191-4072-778a-5fe5-0d50b6709848",
          "code": "DTXSID1032355",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1032355",
          "code_system": "EPA CompTox",
          "references": [
            "006e0905-dc6b-75aa-cc52-a6c94be71eb0"
          ]
        },
        {
          "uuid": "d0bc5d27-fae3-4152-890a-f9c60761147b",
          "code": "570RAC03NF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "964b8b4c-a53f-e363-fb29-c397693590b6",
          "code": "3751",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3751",
          "code_system": "CHEBI",
          "references": [
            "88e53328-4295-dd95-c1f2-df14e875c114"
          ]
        },
        {
          "uuid": "036ddbce-a19b-3278-1711-f39d95c3d91f",
          "code": "clomazone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/clomazone.html",
          "code_system": "ALANWOOD",
          "references": [
            "fc76a0fc-9247-363a-2c73-3af9e1bb6fa3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bf24857c-85cc-4965-acfa-06937df9ef24",
          "name": "2-((2-CHLOROPHENYL)METHYL)-4,4-DIMETHYL-3-ISOXAZOLIDINONE",
          "stdName": "2-((2-CHLOROPHENYL)METHYL)-4,4-DIMETHYL-3-ISOXAZOLIDINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbfe21cf-d559-46c4-a779-41541462e7bb",
            "101e9367-93d6-470f-ab42-04055a3b0b36"
          ],
          "display_name": false
        },
        {
          "uuid": "8051c537-a4e1-4f6a-bd97-9406539ec33b",
          "name": "2-(2-CHLOROBENZYL)-4,4-DIMETHYL-1,2-OXAZOLIDIN-3-ONE",
          "stdName": "2-(2-CHLOROBENZYL)-4,4-DIMETHYL-1,2-OXAZOLIDIN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbfe21cf-d559-46c4-a779-41541462e7bb",
            "654e9ebc-dcef-4a97-bcee-10b203f51cf1"
          ],
          "display_name": false
        },
        {
          "uuid": "6e0d13ad-d640-4b8f-a607-f6a2014b1f09",
          "name": "CLOMAZONE",
          "stdName": "CLOMAZONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f6bb138-cc39-4245-a2c6-eff0515cbbf9",
            "9f726ffa-4ca7-4bb1-9049-d09051823078",
            "fb1a9d62-1b77-4b57-8d10-7fae81e420e2",
            "64a885d7-85df-4f19-b6b2-7da9fa6bdcb0",
            "87ab9b4b-3d47-4785-a857-84ccac84c37c",
            "b4c6648f-02f0-4cab-aae3-36e07766d42d"
          ],
          "display_name": true
        },
        {
          "uuid": "a78cff3a-e575-4549-878e-e456cc980242",
          "name": "CLOMAZONE [ISO]",
          "stdName": "CLOMAZONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f6bb138-cc39-4245-a2c6-eff0515cbbf9",
            "87ab9b4b-3d47-4785-a857-84ccac84c37c"
          ],
          "display_name": false
        },
        {
          "uuid": "d8832b5e-9564-4b47-9b8a-7f7058682b9c",
          "name": "CLOMAZONE [MI]",
          "stdName": "CLOMAZONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64a885d7-85df-4f19-b6b2-7da9fa6bdcb0",
            "87ab9b4b-3d47-4785-a857-84ccac84c37c"
          ],
          "display_name": false
        },
        {
          "uuid": "f31db4bd-c137-43fa-ab02-77c2a9b7dcc7",
          "name": "COMMAND",
          "stdName": "COMMAND",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87ab9b4b-3d47-4785-a857-84ccac84c37c",
            "11d124c7-5460-4075-b3cd-80e08235e241"
          ],
          "display_name": false
        },
        {
          "uuid": "d4a2d630-ee8a-408c-a504-182a2f30c2ef",
          "name": "DIMETHAZONE",
          "stdName": "DIMETHAZONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4ef2f6e-5d28-4564-a801-36ca2193d0a0",
            "87ab9b4b-3d47-4785-a857-84ccac84c37c",
            "c286e834-3c56-4ad6-b405-c6acc12e9ba4",
            "df7f3d82-05f5-4c63-b897-754034520141"
          ],
          "display_name": false
        },
        {
          "uuid": "1018e00e-b7d0-42bc-9a85-baddd66d46c0",
          "name": "DIMETHAZONE [HSDB]",
          "stdName": "DIMETHAZONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4ef2f6e-5d28-4564-a801-36ca2193d0a0",
            "87ab9b4b-3d47-4785-a857-84ccac84c37c"
          ],
          "display_name": false
        },
        {
          "uuid": "061e378f-7f82-4d45-bc01-0a65690140ce",
          "name": "FMC-57020",
          "stdName": "FMC-57020",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87ab9b4b-3d47-4785-a857-84ccac84c37c",
            "df7f3d82-05f5-4c63-b897-754034520141"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9f726ffa-4ca7-4bb1-9049-d09051823078",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bbfe21cf-d559-46c4-a779-41541462e7bb",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "654e9ebc-dcef-4a97-bcee-10b203f51cf1",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "101e9367-93d6-470f-ab42-04055a3b0b36",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64a885d7-85df-4f19-b6b2-7da9fa6bdcb0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87ab9b4b-3d47-4785-a857-84ccac84c37c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df7f3d82-05f5-4c63-b897-754034520141",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11d124c7-5460-4075-b3cd-80e08235e241",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4ef2f6e-5d28-4564-a801-36ca2193d0a0",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f6bb138-cc39-4245-a2c6-eff0515cbbf9",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15e83057-bb12-4312-89e0-8c2602075302",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b23c0097-0264-41ed-8587-3d29eead3ce4",
          "citation": "SRS import [570RAC03NF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=570RAC03NF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41a26b70-ddae-4881-ad78-50b361596f4b",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb1a9d62-1b77-4b57-8d10-7fae81e420e2",
          "citation": "CLOMAZONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c286e834-3c56-4ad6-b405-c6acc12e9ba4",
          "citation": "DIMETHAZONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b4c6648f-02f0-4cab-aae3-36e07766d42d",
          "citation": "CLOMAZONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d30626a-5331-d31b-2f75-c42172abce10",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+81777-89-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "006e0905-dc6b-75aa-cc52-a6c94be71eb0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=81777-89-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fc76a0fc-9247-363a-2c73-3af9e1bb6fa3",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "88e53328-4295-dd95-c1f2-df14e875c114",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e5030f18-7f6b-4249-8b8a-5fdde20a532a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ea4086b6-6989-4ebe-b61e-d8ac2715cf9a",
          "id": "ea4086b6-6989-4ebe-b61e-d8ac2715cf9a",
          "molfile": "\n  Marvin  01132112072D          \n\n 16 17  0  0  0  0            999 V2000\n    5.3648   -6.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7022   -5.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9652   -4.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4326   -4.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0897   -4.0498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7712   -4.5287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4944   -4.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2123   -4.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2123   -5.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9158   -5.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6529   -5.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6529   -4.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9341   -4.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9341   -3.3462    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.5138   -5.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0147   -5.9889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n 15  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 15  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  2  0  0  0  0\nM  END",
          "smiles": "CC1(C)CON(Cc2ccccc2Cl)C1=O",
          "formula": "C12H14ClNO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b7c7f1ab-c34c-44f4-91c9-4ac0c481e1e5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "239.6985",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "be5259fd-03b8-45d3-8537-e66e15187f56",
      "version": "6",
      "structure": {
        "id": "913a73b5-996b-4d3d-a7d1-96f6938a1784",
        "molfile": "\n  Marvin  01132107322D          \n\n 16 17  0  0  0  0            999 V2000\n    6.7712   -4.5287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5138   -5.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7022   -5.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3648   -6.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9652   -4.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4326   -4.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0897   -4.0498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0147   -5.9889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4944   -4.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2123   -4.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9341   -4.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6529   -4.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6529   -5.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9158   -5.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2123   -5.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9341   -3.3462    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  2  8  2  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 16  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)CON(Cc2ccccc2Cl)C1=O",
        "formula": "C12H14ClNO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "239.6985",
        "optical_activity": "NONE",
        "references": [
          "41a26b70-ddae-4881-ad78-50b361596f4b",
          "b23c0097-0264-41ed-8587-3d29eead3ce4"
        ],
        "stereo_centers": 0
      },
      "unii": "570RAC03NF"
    }
  ]
}