{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f33ce2eb-1ff2-4796-a137-ddc417507192",
          "code": "20701-68-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20701-68-2",
          "code_system": "CAS",
          "references": [
            "635d841f-1c61-40c8-aa8d-fcfb12b322b8",
            "95a44bee-eef9-4f32-a210-e4575af40e38"
          ]
        },
        {
          "uuid": "b0648c69-f8e0-43a6-bd51-7e1f5c551bb6",
          "code": "C528535",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67528535",
          "code_system": "MESH",
          "references": [
            "635d841f-1c61-40c8-aa8d-fcfb12b322b8"
          ]
        },
        {
          "uuid": "4aeb7228-af9f-43e7-bac6-6407131fd629",
          "code": "1427184",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427184/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "635d841f-1c61-40c8-aa8d-fcfb12b322b8"
          ]
        },
        {
          "uuid": "1ac64702-f2bb-40fe-bda4-79f2ecf4ef61",
          "code": "9543674",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9543674",
          "code_system": "PUBCHEM",
          "references": [
            "635d841f-1c61-40c8-aa8d-fcfb12b322b8"
          ]
        },
        {
          "uuid": "2c2290fc-f1d0-4ced-8fe2-5769c50e72d1",
          "code": "1427185",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427185/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ce72946d-6403-da16-5f66-21ca6ea301f7"
          ]
        },
        {
          "uuid": "839bf211-d47a-457f-a53e-b9da42c1ad51",
          "code": "565ZMT5QRG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "04e62a26-c1c6-0f20-6d9a-40b3a125b26f",
          "code": "DTXSID90885146",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90885146",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "21c89bd5-469e-47f7-3a00-bcb3e4ff95fe",
          "code": "565ZMT5QRG",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=565ZMT5QRG",
          "code_system": "DAILYMED",
          "references": [
            "94a18642-fa36-649e-9a23-61b8b46f595a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a22a0ab3-eaa3-4c7b-99db-66b9665587a4",
          "name": "(9Z)-9-OCTADECENEDIOIC ACID",
          "stdName": "(9Z)-9-OCTADECENEDIOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
            "2d497dae-6c3b-4ba7-b7d9-348fa1c6069a"
          ],
          "display_name": false
        },
        {
          "uuid": "6dfc026e-2dca-4ad5-b0b0-888db3b0dea7",
          "name": "(Z)-9-OCTADECENE-1,18-DIOIC ACID",
          "stdName": "(Z)-9-OCTADECENE-1,18-DIOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
            "2d497dae-6c3b-4ba7-b7d9-348fa1c6069a"
          ],
          "display_name": false
        },
        {
          "uuid": "51a229a3-c9d9-428e-9ea9-1d87ca0328db",
          "name": "(Z)-9-OCTADECENEDIOIC ACID",
          "stdName": "(Z)-9-OCTADECENEDIOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
            "2d497dae-6c3b-4ba7-b7d9-348fa1c6069a"
          ],
          "display_name": false
        },
        {
          "uuid": "6c51ad91-35a5-4e40-85ca-4797add11014",
          "name": "9-OCTADECENEDIOIC ACID, (9Z)-",
          "stdName": "9-OCTADECENEDIOIC ACID, (9Z)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
            "064b061c-99d1-4817-8816-b06947923fa6"
          ],
          "display_name": false
        },
        {
          "uuid": "b5d7e538-575b-4890-a67d-ef16ffcd3a9d",
          "name": "9-OCTADECENEDIOIC ACID, (Z)-",
          "stdName": "9-OCTADECENEDIOIC ACID, (Z)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
            "2d497dae-6c3b-4ba7-b7d9-348fa1c6069a"
          ],
          "display_name": false
        },
        {
          "uuid": "eab8bb31-2e90-4f26-8220-f605d718723a",
          "name": "C18:1 DIOIC ACID",
          "stdName": "C18:1 DIOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
            "2d0d970a-3f04-4c90-8801-4e5956ab21ba"
          ],
          "display_name": false
        },
        {
          "uuid": "826e02ba-6b66-424b-aa4a-cd335cebbf7d",
          "name": "CIS-9-OCTADECENEDIOIC ACID",
          "stdName": "CIS-9-OCTADECENEDIOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
            "2d497dae-6c3b-4ba7-b7d9-348fa1c6069a"
          ],
          "display_name": false
        },
        {
          "uuid": "d1244abc-c1d0-4d12-bf71-433f8a853a90",
          "name": "O.D.A.WHITE",
          "stdName": "O.D.A.WHITE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
            "064b061c-99d1-4817-8816-b06947923fa6"
          ],
          "display_name": false
        },
        {
          "uuid": "05d0b2b3-c48d-11f7-ee65-2ab137cdbed6",
          "name": "OCTADECENEDIOATE",
          "stdName": "OCTADECENEDIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce72946d-6403-da16-5f66-21ca6ea301f7"
          ],
          "display_name": false
        },
        {
          "uuid": "debdacd4-5aba-42e8-b976-cd00e8f085b9",
          "name": "OCTADECENEDIOIC ACID",
          "stdName": "OCTADECENEDIOIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
            "0cf2cbe6-7229-494e-bea5-44b8c378b9de",
            "064b061c-99d1-4817-8816-b06947923fa6"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9e76d71e-6342-48a1-9b8f-370fd700d37b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9f731e7d-5369-4c61-9243-46ac71528a1b",
          "name": "ORISTAR ODDA",
          "stdName": "ORISTAR ODDA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
            "064b061c-99d1-4817-8816-b06947923fa6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2d0d970a-3f04-4c90-8801-4e5956ab21ba",
          "citation": "http://www.mib.manchester.ac.uk/aboutus/newsandevents/events/Chahal.pdf",
          "url": "http://www.mib.manchester.ac.uk/aboutus/newsandevents/events/Chahal.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "635d841f-1c61-40c8-aa8d-fcfb12b322b8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391532000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8bf32f4-d6e6-486d-a571-218618aec30f",
          "citation": "SRS import [565ZMT5QRG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=565ZMT5QRG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391532000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0cf2cbe6-7229-494e-bea5-44b8c378b9de",
          "citation": "OCTADECENEDIOIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "064b061c-99d1-4817-8816-b06947923fa6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c12cd715-8741-4273-a27d-2d4b1a5ebec2",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d497dae-6c3b-4ba7-b7d9-348fa1c6069a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce72946d-6403-da16-5f66-21ca6ea301f7",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "95a44bee-eef9-4f32-a210-e4575af40e38",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "94a18642-fa36-649e-9a23-61b8b46f595a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c93c3952-9c03-4964-9479-aff6235d1822",
          "id": "c93c3952-9c03-4964-9479-aff6235d1822",
          "molfile": "\n  Marvin  01132110242D          \n\n 22 21  0  0  0  0            999 V2000\n   -0.9847   -4.5114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5722   -3.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9847   -3.0825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2528   -3.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6653   -3.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4903   -3.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9028   -2.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7278   -2.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1403   -1.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9653   -1.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3778   -0.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2028   -0.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6153   -1.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4403   -1.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8528   -2.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6779   -2.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0903   -3.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9153   -3.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3279   -3.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1529   -3.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5653   -4.5114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5653   -3.0825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\nM  END",
          "smiles": "C(=C/CCCCCCCC(=O)O)/CCCCCCCC(=O)O",
          "formula": "C18H32O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "08969330-bbcf-460f-bd11-0256ffd44b41"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "312.445",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a437a5b6-7cff-4689-b893-5b076f5f0bcb",
      "version": "8",
      "structure": {
        "id": "02e147ca-a13b-44fe-81e7-51a513b9e465",
        "molfile": "\n  Marvin  01132100282D          \n\n 22 21  0  0  0  0            999 V2000\n   -0.5722   -3.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9847   -4.5114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9847   -3.0825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2528   -3.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6653   -3.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4903   -3.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9028   -2.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7278   -2.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1403   -1.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9653   -1.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3778   -0.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2028   -0.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6153   -1.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4403   -1.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8528   -2.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6779   -2.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0903   -3.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9153   -3.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3279   -3.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1529   -3.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5653   -4.5114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5653   -3.0825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
        "smiles": "C(=C/CCCCCCCC(=O)O)/CCCCCCCC(=O)O",
        "formula": "C18H32O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "312.445",
        "optical_activity": "NONE",
        "references": [
          "d8bf32f4-d6e6-486d-a571-218618aec30f",
          "064b061c-99d1-4817-8816-b06947923fa6"
        ],
        "stereo_centers": 0
      },
      "unii": "565ZMT5QRG"
    }
  ]
}