{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7b255111-e647-4022-add2-bdd637e9e197",
          "code": "545-80-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=545-80-2",
          "code_system": "CAS",
          "references": [
            "02cf19e1-5679-4375-b512-fb1eab3992e1",
            "f4363a10-4c0b-46ad-a426-8711afda6a97"
          ]
        },
        {
          "uuid": "9a28761d-36d2-4a2b-87e6-35aa2140b177",
          "code": "C030725",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67030725",
          "code_system": "MESH",
          "references": [
            "02cf19e1-5679-4375-b512-fb1eab3992e1"
          ]
        },
        {
          "uuid": "e7693f21-22c6-404c-baed-a68680a3b6f4",
          "code": "SUB09964MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "02cf19e1-5679-4375-b512-fb1eab3992e1"
          ]
        },
        {
          "uuid": "60da8931-7031-4399-acfb-978dd43ca7ad",
          "code": "858",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=858",
          "code_system": "INN",
          "references": [
            "02cf19e1-5679-4375-b512-fb1eab3992e1"
          ]
        },
        {
          "uuid": "f5395faa-4360-4472-994c-1367baf3125e",
          "code": "208-894-6",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "02cf19e1-5679-4375-b512-fb1eab3992e1"
          ]
        },
        {
          "uuid": "e7454812-cc57-4d82-98d3-8a57edd6a67a",
          "code": "33927",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/33927/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "02cf19e1-5679-4375-b512-fb1eab3992e1"
          ]
        },
        {
          "uuid": "ae06384c-e085-4414-9f56-fe7bd362998b",
          "code": "m8941",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8941?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "02cf19e1-5679-4375-b512-fb1eab3992e1"
          ]
        },
        {
          "uuid": "9dd0ca07-8501-4d53-b05d-071e17993153",
          "code": "CHEMBL2110948",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110948",
          "code_system": "ChEMBL",
          "references": [
            "02cf19e1-5679-4375-b512-fb1eab3992e1"
          ]
        },
        {
          "uuid": "c605136a-ded5-48ce-b0a8-c04d3be3fca7",
          "code": "11017",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11017",
          "code_system": "PUBCHEM",
          "references": [
            "02cf19e1-5679-4375-b512-fb1eab3992e1"
          ]
        },
        {
          "uuid": "0b93b153-f75a-41b7-9658-1c14c8f196be",
          "code": "564C0W9848",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5d669f03-3d7f-b484-f014-e4994b4a6c3b",
          "code": "C175193",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C175193",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b66f3c13-5394-d1f3-3cba-21a1b683d603"
          ]
        },
        {
          "uuid": "863209f2-de02-0556-7e7d-e53a73996521",
          "code": "100000081916",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9583a749-eaac-140f-c45a-cddde693dc2a"
          ]
        },
        {
          "uuid": "4272c078-4826-96cc-7602-a4d8528c4bad",
          "code": "DTXSID80969686",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80969686",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "efa3cbd2-2c8f-42e2-8a4d-8d6403d819e4",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "53c0701d-3b56-45cd-8332-5a47a360f266",
            "refuuid": "7141d052-0de0-4c31-914a-f7156875175c",
            "name": "POLDINE",
            "unii": "8R92106W2F",
            "linking_id": "8R92106W2F",
            "ref_pname": "POLDINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "15d44e7c-0ba7-45f5-a18d-2fa984417f8f",
          "name": "(1-METHYL-2-PYRROLIDINYL)METHYL BENZILATE METHYL METHOSULFATE",
          "stdName": "(1-METHYL-2-PYRROLIDINYL)METHYL BENZILATE METHYL METHOSULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "1b2795c7-2c92-4973-be0a-26631e964f4a"
          ],
          "display_name": false
        },
        {
          "uuid": "c2d36f31-c019-47fb-be4a-1f6df2366c67",
          "name": "2-(HYDROXYMETHYL)-1,1-DIMETHYLPYRROLIDINIUM METHYL SULPHATE BENZILATE",
          "stdName": "2-(HYDROXYMETHYL)-1,1-DIMETHYLPYRROLIDINIUM METHYL SULPHATE BENZILATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8832ee23-7151-4d39-a22f-891476eda9cb"
          ],
          "display_name": false
        },
        {
          "uuid": "a29e94d3-e7c9-4e74-b8f5-920112128573",
          "name": "2-(Hydroxymethyl)-1,1-dimethylpyrrolidinium methyl sulfate benzilate",
          "stdName": "2-(HYDROXYMETHYL)-1,1-DIMETHYLPYRROLIDINIUM METHYL SULFATE BENZILATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "ca1bb8f1-4f86-445b-8404-43fffa983147"
          ],
          "display_name": false
        },
        {
          "uuid": "f73f73f5-cf2b-4770-a319-ecf93c648e91",
          "name": "ALFALAND",
          "stdName": "ALFALAND",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "1b2795c7-2c92-4973-be0a-26631e964f4a"
          ],
          "display_name": false
        },
        {
          "uuid": "e179888b-cecd-4744-8b18-5fd1965d6bc2",
          "name": "CLB-499",
          "stdName": "CLB-499",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "1b2795c7-2c92-4973-be0a-26631e964f4a"
          ],
          "display_name": false
        },
        {
          "uuid": "03ac8096-c436-4fb0-b95e-fb910d71f35e",
          "name": "I.S. 499",
          "stdName": "I.S. 499",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "ca1bb8f1-4f86-445b-8404-43fffa983147"
          ],
          "display_name": false
        },
        {
          "uuid": "fa95e3cf-6c70-4a49-8097-5e083862892c",
          "name": "I.S.-499",
          "stdName": "I.S.-499",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "ca1bb8f1-4f86-445b-8404-43fffa983147"
          ],
          "display_name": false
        },
        {
          "uuid": "8ff71f41-ca16-41ff-a13b-154d5f921c69",
          "name": "IS-499",
          "stdName": "IS-499",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "f9ff8c62-497d-4e06-b1c2-efbacd0a3223"
          ],
          "display_name": false
        },
        {
          "uuid": "a45b2e1f-bc65-477a-bf80-24d8d05761df",
          "name": "MCN-R-726-47",
          "stdName": "MCN-R-726-47",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "ca1bb8f1-4f86-445b-8404-43fffa983147"
          ],
          "display_name": false
        },
        {
          "uuid": "11b402c5-629b-431a-b176-056192cbc381",
          "name": "NACTATE",
          "stdName": "NACTATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "1b2795c7-2c92-4973-be0a-26631e964f4a"
          ],
          "display_name": false
        },
        {
          "uuid": "622793c7-f24f-4eba-b640-3ad43c8ac209",
          "name": "NACTON",
          "stdName": "NACTON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "ca1bb8f1-4f86-445b-8404-43fffa983147"
          ],
          "display_name": false
        },
        {
          "uuid": "98493f24-9ff5-4342-88e7-eeb02a56e351",
          "name": "POLDINE METHOSULFATE",
          "stdName": "POLDINE METHOSULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "1b2795c7-2c92-4973-be0a-26631e964f4a"
          ],
          "display_name": false
        },
        {
          "uuid": "ab6f9df9-44ca-4220-acad-5965e8e2167b",
          "name": "POLDINE METHYL METHOSULFATE",
          "stdName": "POLDINE METHYL METHOSULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "1b2795c7-2c92-4973-be0a-26631e964f4a"
          ],
          "display_name": false
        },
        {
          "uuid": "00b5f1b9-537f-497a-a397-a39657a20640",
          "name": "POLDINE METHYLSULFATE",
          "stdName": "POLDINE METHYLSULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "9f2439b9-73ed-4d24-af91-fa9215702fc6",
            "bd48c8a5-8e47-4587-a6a4-8bed027018f2",
            "25e98c4e-011f-433f-a221-e0e00ef3e71e",
            "5b45e517-7c49-4107-a8a2-a2759a64439f",
            "e0f41da8-b018-47e1-b9ca-e940bf1d7d04"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "2314a169-7c50-4c09-a7c0-79d101fcd5f8",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "badb3611-93ba-4fa4-ad5a-0e13f3231dff",
          "name": "POLDINE METHYLSULFATE [MI]",
          "stdName": "POLDINE METHYLSULFATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "25e98c4e-011f-433f-a221-e0e00ef3e71e"
          ],
          "display_name": false
        },
        {
          "uuid": "c3048cac-b405-43c0-89c6-f525ad45c551",
          "name": "POLDINE METHYLSULFATE [USAN]",
          "stdName": "POLDINE METHYLSULFATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b45e517-7c49-4107-a8a2-a2759a64439f"
          ],
          "display_name": false
        },
        {
          "uuid": "e1c02d77-5f3e-49af-a93d-ffe3d6764153",
          "name": "POLDINE METHYLSULPHATE",
          "stdName": "POLDINE METHYLSULPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8832ee23-7151-4d39-a22f-891476eda9cb"
          ],
          "display_name": false
        },
        {
          "uuid": "06a0a1f7-e97f-44c8-8707-f45e968ba688",
          "name": "POLDINE METILSULFATE",
          "stdName": "POLDINE METILSULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b2a5439-57bf-4833-bcaa-715750e8a2ab",
            "5717fa85-e1be-43f5-a81b-03212f37981f",
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "13551f6f-3439-46ba-8c13-fa785b0c8ca9",
            "511727a4-73ba-49e7-aa4b-3fe18f8296d2",
            "046b2c8e-7273-41a3-bebf-bfc83a0d3ba6",
            "7a50ba7e-028c-4265-9b7f-5ed144781570",
            "50e1cdc9-0c7a-49b3-b851-e15740316d18"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "b4bcab2f-90a9-41bd-9981-7f948cec5cd7",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "efbb22f8-1252-478b-93fb-122873f5e537",
          "name": "POLDINE METILSULFATE [MART.]",
          "stdName": "POLDINE METILSULFATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5717fa85-e1be-43f5-a81b-03212f37981f"
          ],
          "display_name": false
        },
        {
          "uuid": "2dc849b8-22c2-49dc-8646-24785fd6d768",
          "name": "POLDINE METILSULPHATE",
          "stdName": "POLDINE METILSULPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8832ee23-7151-4d39-a22f-891476eda9cb"
          ],
          "display_name": false
        },
        {
          "uuid": "7e618323-2791-4882-80f0-9d59a59e5b8a",
          "name": "PYRROLIDINIUM, 2-(((2-HYDROXY-2,2-DIPHENYLACETYL)OXY)METHYL)-1,1-DIMETHYL-, METHYL SULFATE (1:1)",
          "stdName": "PYRROLIDINIUM, 2-(((2-HYDROXY-2,2-DIPHENYLACETYL)OXY)METHYL)-1,1-DIMETHYL-, METHYL SULFATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "1b2795c7-2c92-4973-be0a-26631e964f4a"
          ],
          "display_name": false
        },
        {
          "uuid": "550d8738-3ada-490b-9c44-7ab4c7f0d252",
          "name": "PYRROLIDINIUM, 2-(((HYDROXYDIPHENYLACETYL)OXY)METHYL)-1,1-DIMETHYL-, METHYL SULFATE (SALT)",
          "stdName": "PYRROLIDINIUM, 2-(((HYDROXYDIPHENYLACETYL)OXY)METHYL)-1,1-DIMETHYL-, METHYL SULFATE (SALT)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "1b2795c7-2c92-4973-be0a-26631e964f4a"
          ],
          "display_name": false
        },
        {
          "uuid": "97bf9da0-553e-48ff-9d68-b52af51bfa08",
          "name": "PYRROLIDINIUM, 2-(HYDROXYMETHYL)-1,1-DIMETHYL-, METHYL SULFATE, BENZILATE",
          "stdName": "PYRROLIDINIUM, 2-(HYDROXYMETHYL)-1,1-DIMETHYL-, METHYL SULFATE, BENZILATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
            "1b2795c7-2c92-4973-be0a-26631e964f4a"
          ],
          "display_name": false
        },
        {
          "uuid": "c1b9703e-865c-ad06-3606-ace8d9a30005",
          "name": "Poldine metilsulfate [WHO-DD]",
          "stdName": "POLDINE METILSULFATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "958cf7f0-4370-53fe-17e4-6c43ab1b234d"
          ],
          "display_name": false
        },
        {
          "uuid": "204c4ea7-f90c-4a34-953a-34dd2996f108",
          "name": "poldine metilsulfate [INN]",
          "stdName": "POLDINE METILSULFATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13551f6f-3439-46ba-8c13-fa785b0c8ca9",
            "ec63218f-09c0-4f72-92f4-747c5f545cac"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bd48c8a5-8e47-4587-a6a4-8bed027018f2",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8832ee23-7151-4d39-a22f-891476eda9cb",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b2a5439-57bf-4833-bcaa-715750e8a2ab",
          "citation": "inn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d935021-4b98-4457-9ca8-abb6d12d7cf2",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca1bb8f1-4f86-445b-8404-43fffa983147",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13551f6f-3439-46ba-8c13-fa785b0c8ca9",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b45e517-7c49-4107-a8a2-a2759a64439f",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5717fa85-e1be-43f5-a81b-03212f37981f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25e98c4e-011f-433f-a221-e0e00ef3e71e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "511727a4-73ba-49e7-aa4b-3fe18f8296d2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b2795c7-2c92-4973-be0a-26631e964f4a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9ff8c62-497d-4e06-b1c2-efbacd0a3223",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02cf19e1-5679-4375-b512-fb1eab3992e1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390927000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad3c0dd8-cd20-45bf-be2c-575ba527050b",
          "citation": "SRS import [564C0W9848]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=564C0W9848",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390927000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a50ba7e-028c-4265-9b7f-5ed144781570",
          "citation": "POLDINE METILSULFATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9f2439b9-73ed-4d24-af91-fa9215702fc6",
          "citation": "POLDINE METHYLSULFATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "50e1cdc9-0c7a-49b3-b851-e15740316d18",
          "citation": "POLDINE METILSULFATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e0f41da8-b018-47e1-b9ca-e940bf1d7d04",
          "citation": "POLDINE METHYLSULFATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "046b2c8e-7273-41a3-bebf-bfc83a0d3ba6",
          "citation": "POLDINE METILSULFATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9583a749-eaac-140f-c45a-cddde693dc2a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ec63218f-09c0-4f72-92f4-747c5f545cac",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f4363a10-4c0b-46ad-a426-8711afda6a97",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b66f3c13-5394-d1f3-3cba-21a1b683d603",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "958cf7f0-4370-53fe-17e4-6c43ab1b234d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "570c312b-12f1-4c2c-91ef-609967948d40",
          "id": "570c312b-12f1-4c2c-91ef-609967948d40",
          "molfile": "\n  Marvin  01132104312D          \n\n  6  5  0  0  0  0            999 V2000\n    2.7956   -2.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2124   -1.9041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0373   -1.9041    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8623   -1.9041    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0373   -1.0791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0373   -2.7291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  3  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "COS(=O)(=O)[O-]",
          "formula": "CH3O4S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "de24d6ec-5f18-4926-b964-5da3e0c99ced"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "111.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "1de043fc-dd9f-4a54-9eb9-1cd5f64578a5",
          "id": "1de043fc-dd9f-4a54-9eb9-1cd5f64578a5",
          "molfile": "\n  Marvin  01132101432D          \n\n 25 27  0  0  0  0            999 V2000\n    1.5449   -0.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8347   -1.2251    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    0.6187   -0.4278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3164   -1.8979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8223   -2.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0456   -2.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0498   -1.4826    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.6603   -1.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3704   -1.4868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0806   -1.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0848   -0.2534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7907   -1.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0806   -1.8979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3763   -2.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1736   -1.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7592   -2.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5558   -3.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7500   -3.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1687   -2.8572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3763   -0.9012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1736   -1.1130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7592   -0.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5474    0.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7500    0.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1645   -0.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  7  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 20 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 25 20  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 24 25  1  0  0  0  0\nM  CHG  1   2   1\nM  END",
          "smiles": "C[N+]1(C)CCCC1COC(=O)C(c2ccccc2)(c3ccccc3)O",
          "formula": "C21H26NO3",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "92d1d8bb-f9d8-49ac-bd10-d47d865c5392"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "340.4368",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cb3b2739-c806-499d-b60b-b4c0a28024ed",
      "version": "9",
      "structure": {
        "id": "8ca1576b-3c5f-488b-90f3-fd68092946bf",
        "molfile": "\n  Marvin  01132107182D          \n\n 31 32  0  0  0  0            999 V2000\n    4.0241   -1.8979    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8464   -1.8979    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0241   -1.0756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0241   -2.7202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2019   -1.8979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7865   -2.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8347   -1.2251    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -2.7907   -1.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0806   -1.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3704   -1.4868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0498   -1.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0848   -0.2534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3763   -0.9012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3763   -2.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6603   -1.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0806   -1.8979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3164   -1.8979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5449   -0.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6187   -0.4278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8223   -2.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0456   -2.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1687   -2.8572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1645   -0.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1736   -1.1130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1736   -1.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7500    0.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7592   -0.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7592   -2.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7500   -3.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5558   -3.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5474    0.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 15  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  9  2  0  0  0  0\n 13  8  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15 11  1  0  0  0  0\n 16  8  1  0  0  0  0\n 17  7  1  0  0  0  0\n 18  7  1  0  0  0  0\n 19  7  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 11  1  0  0  0  0\n 22 14  1  0  0  0  0\n 23 13  2  0  0  0  0\n 24 13  1  0  0  0  0\n 25 14  2  0  0  0  0\n 26 23  1  0  0  0  0\n 27 24  2  0  0  0  0\n 28 25  1  0  0  0  0\n 29 22  2  0  0  0  0\n 30 28  2  0  0  0  0\n 31 27  1  0  0  0  0\n 21 20  1  0  0  0  0\n 29 30  1  0  0  0  0\n 26 31  2  0  0  0  0\nM  CHG  2   2  -1   7   1\nM  END",
        "smiles": "C[N+]1(C)CCCC1COC(=O)C(c2ccccc2)(c3ccccc3)O.COS(=O)(=O)[O-]",
        "formula": "C21H26NO3.CH3O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "451.5351",
        "optical_activity": "( + / - )",
        "references": [
          "ad3c0dd8-cd20-45bf-be2c-575ba527050b",
          "bd48c8a5-8e47-4587-a6a4-8bed027018f2",
          "ec63218f-09c0-4f72-92f4-747c5f545cac"
        ],
        "stereo_centers": 1
      },
      "unii": "564C0W9848"
    }
  ]
}