{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "093cbb1f-6e28-4f1e-9732-a9027ba82b62",
          "code": "90349-40-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90349-40-9",
          "code_system": "CAS",
          "references": [
            "35337b7f-ee70-4940-a03b-63857e4c6406",
            "f2c03219-dfd5-4209-9ffe-49c4b6c313ba"
          ]
        },
        {
          "uuid": "7339e250-2e42-40a6-814e-0059aeb3f6fa",
          "code": "C99819",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C99819",
          "code_system": "NCI_THESAURUS",
          "references": [
            "35337b7f-ee70-4940-a03b-63857e4c6406"
          ]
        },
        {
          "uuid": "a6505a43-1edc-4b7d-b669-732f38085719",
          "code": "15001944",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15001944",
          "code_system": "PUBCHEM",
          "references": [
            "35337b7f-ee70-4940-a03b-63857e4c6406"
          ]
        },
        {
          "uuid": "28a284d5-fe9c-8a98-aea8-f4e3e7282a92",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f0cf732e-7a14-7242-d1e2-ac4305b5d539"
          ]
        },
        {
          "uuid": "b301c303-363b-449e-971a-7bb507a234cd",
          "code": "55TAL52Z26",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "186ef30e-7565-fa6a-740a-278af6a5c9df",
          "code": "DTXSID90879803",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90879803",
          "code_system": "EPA CompTox",
          "references": [
            "f0cf732e-7a14-7242-d1e2-ac4305b5d539"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0abf0be2-9e9e-4c75-903c-f953c83eed34",
          "name": "BENZONITRILE, 4-((2-HYDROXYETHYL)AMINO)-3-NITRO-",
          "stdName": "BENZONITRILE, 4-((2-HYDROXYETHYL)AMINO)-3-NITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "571e79a9-e83c-476e-af45-357cfed20b63",
            "04ae1c79-bff9-477e-b99d-b80c64729252"
          ],
          "display_name": false
        },
        {
          "uuid": "068f4724-8d66-411b-8704-c6b54f21f731",
          "name": "HC YELLOW 14",
          "stdName": "HC YELLOW 14",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "571e79a9-e83c-476e-af45-357cfed20b63",
            "04ae1c79-bff9-477e-b99d-b80c64729252"
          ],
          "display_name": false
        },
        {
          "uuid": "79feaa8e-b4c2-4569-b7e1-f99c9362657f",
          "name": "HC YELLOW NO. 14",
          "stdName": "HC YELLOW NO. 14",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a4edd12-f4b4-4c74-acf5-a0d5194aa26b",
            "0f02c79f-70a1-420c-95ca-5a3c99e4aaf7",
            "04ae1c79-bff9-477e-b99d-b80c64729252"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "22077bb8-14f8-4043-b624-0f961bfe485b",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "0f02c79f-70a1-420c-95ca-5a3c99e4aaf7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "04ae1c79-bff9-477e-b99d-b80c64729252",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "571e79a9-e83c-476e-af45-357cfed20b63",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35337b7f-ee70-4940-a03b-63857e4c6406",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f63c0a5-052e-4eeb-bdae-d7b311b9575f",
          "citation": "SRS import [55TAL52Z26]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=55TAL52Z26",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a4edd12-f4b4-4c74-acf5-a0d5194aa26b",
          "citation": "HC YELLOW NO. 14 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f0cf732e-7a14-7242-d1e2-ac4305b5d539",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f2c03219-dfd5-4209-9ffe-49c4b6c313ba",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1dddb2a4-f209-4594-b408-2f64df7aa63d",
          "id": "1dddb2a4-f209-4594-b408-2f64df7aa63d",
          "molfile": "\n  Marvin  01132101432D          \n\n 15 15  0  0  0  0            999 V2000\n    6.7642   -8.3540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7642   -7.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4781   -7.1160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4781   -6.2915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1903   -5.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9060   -6.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6211   -5.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6211   -5.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9060   -4.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1903   -5.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4751   -4.6388    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.4751   -3.8144    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7619   -5.0534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3367   -4.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0519   -4.2289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 14  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 15  3  0  0  0  0\nM  CHG  2  11   1  12  -1\nM  END",
          "smiles": "c1cc(c(cc1C#N)[N+](=O)[O-])NCCO",
          "formula": "C9H9N3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9dbdd53a-90be-4c4f-a5d7-2041617703a4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "207.1864",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1d212c41-0e51-4395-9be5-55eaad2670b0",
      "version": "5",
      "structure": {
        "id": "e62d1a70-0276-44f4-9e37-09c892b72ae0",
        "molfile": "\n  Marvin  01132111552D          \n\n 15 15  0  0  0  0            999 V2000\n   11.0528   -4.2292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3375   -4.6392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6219   -5.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9067   -6.2889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1910   -5.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1910   -5.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9067   -4.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6219   -5.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4757   -3.8147    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7625   -5.0538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4757   -4.6392    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.4787   -6.2920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7648   -7.5301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4787   -7.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7648   -8.3547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 12  5  1  0  0  0  0\n 11  6  1  0  0  0  0\n  2  1  3  0  0  0  0\n  8  2  1  0  0  0  0\n  8  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 13  1  0  0  0  0\n 14 13  1  0  0  0  0\nM  CHG  2   9  -1  11   1\nM  END",
        "smiles": "c1cc(c(cc1C#N)[N+](=O)[O-])NCCO",
        "formula": "C9H9N3O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "207.1864",
        "optical_activity": "NONE",
        "references": [
          "3f63c0a5-052e-4eeb-bdae-d7b311b9575f",
          "571e79a9-e83c-476e-af45-357cfed20b63"
        ],
        "stereo_centers": 0
      },
      "unii": "55TAL52Z26"
    }
  ]
}