{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5438d8a1-891e-41f5-bb8e-9f386684f1ab",
          "code": "1147842-10-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1147842-10-1",
          "code_system": "CAS",
          "references": [
            "aba2b7a7-bf4e-455e-93b0-724e13d7343a",
            "cd67def7-9720-472d-a3f1-04877eff9c46"
          ]
        },
        {
          "uuid": "ea959c7c-799f-4d68-b90d-698723be9841",
          "code": "44241635",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44241635",
          "code_system": "PUBCHEM",
          "references": [
            "aba2b7a7-bf4e-455e-93b0-724e13d7343a"
          ]
        },
        {
          "uuid": "a5e2fa86-a82d-42d7-9359-593e191daabd",
          "code": "55GLK18X45",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ca0e4df9-9656-a4c1-8956-c7d419004e69",
          "code": "DTXSID70150849",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70150849",
          "code_system": "EPA CompTox",
          "references": [
            "0e0d15e3-6bf4-6cf7-37be-9a97469d64d1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c287be41-2ed3-4a52-ba72-f60fbcf30ed7",
          "name": "2,4,6-OCTATRIENOIC ACID, POTASSIUM SALT (1:1), (2E,4E,6E)-",
          "stdName": "2,4,6-OCTATRIENOIC ACID, POTASSIUM SALT (1:1), (2E,4E,6E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d10146f-73c4-48f0-87b3-a356c53778c8",
            "1f7a5e89-3a84-48ec-89e3-290c7be0faa0"
          ],
          "display_name": false
        },
        {
          "uuid": "99a8e0b0-6d86-4a61-9b9f-98b0a5a0b7a1",
          "name": "2E,4E,6E-OCTA-2,4,6-TRIENOIC ACID POTASSIUM SALT",
          "stdName": "2E,4E,6E-OCTA-2,4,6-TRIENOIC ACID POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "292b9415-d76f-4603-aa43-1964947bfb12",
            "1f7a5e89-3a84-48ec-89e3-290c7be0faa0"
          ],
          "display_name": false
        },
        {
          "uuid": "46d4c6a7-496e-4277-b07e-77c41c082544",
          "name": "POTASSIUM OCTATRIENOATE",
          "stdName": "POTASSIUM OCTATRIENOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7e3e2a8-e635-4f37-b150-792d41db942c",
            "db171e41-0877-45a5-96d1-5285253f1ca5",
            "1f7a5e89-3a84-48ec-89e3-290c7be0faa0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f5f9fae6-aa84-4370-9c01-f342c309587c",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "d7e3e2a8-e635-4f37-b150-792d41db942c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1f7a5e89-3a84-48ec-89e3-290c7be0faa0",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d10146f-73c4-48f0-87b3-a356c53778c8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "292b9415-d76f-4603-aa43-1964947bfb12",
          "citation": "http://www.sumobrain.com/patents/wipo/Compounds-provided-with-antioxidant-activity/WO2011132177.html",
          "url": "http://www.sumobrain.com/patents/wipo/Compounds-provided-with-antioxidant-activity/WO2011132177.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aba2b7a7-bf4e-455e-93b0-724e13d7343a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391540000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c958bd0-d8f8-4e38-b167-34c4e1ff375f",
          "citation": "SRS import [55GLK18X45]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=55GLK18X45",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391540000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db171e41-0877-45a5-96d1-5285253f1ca5",
          "citation": "POTASSIUM OCTATRIENOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eeaa26af-e93d-6d73-49e1-6f690c08803a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1147842-10-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cd67def7-9720-472d-a3f1-04877eff9c46",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0e0d15e3-6bf4-6cf7-37be-9a97469d64d1",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c6b222f8-36e3-452c-a6c1-66315c58b6f6",
          "id": "c6b222f8-36e3-452c-a6c1-66315c58b6f6",
          "molfile": "\n  Marvin  01132110162D          \n\n  1  0  0  0  0  0            999 V2000\n   10.1775   -4.9315    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d70854c0-7fe3-4b87-9816-72f854985a97"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "ce56a66e-0bd8-494a-8039-521d26875103",
          "id": "ce56a66e-0bd8-494a-8039-521d26875103",
          "molfile": "\n  Marvin  01132110392D          \n\n 10  9  0  0  0  0            999 V2000\n   11.8274   -7.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2399   -7.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8274   -6.3604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2399   -5.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8274   -4.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2399   -4.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8274   -3.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2399   -2.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0649   -2.7881    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.8274   -2.0737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\nM  CHG  1   9  -1\nM  END",
          "smiles": "C/C=C/C=C/C=C/C(=O)[O-]",
          "formula": "C8H9O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "91b7a8fc-a82c-4865-ba8e-ade6f200e254"
          },
          "defined_stereo": 0,
          "ez_centers": 3,
          "molecular_weight": "137.1562",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "468ef6ac-28d4-40cd-910a-2bdc4067e05a",
      "version": "6",
      "structure": {
        "id": "7e5d52e2-736e-4420-8bfa-106774ab4ce2",
        "molfile": "\n  Marvin  01132106342D          \n\n 11  9  0  0  0  0            999 V2000\n   10.1775   -4.9315    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n   12.2399   -2.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8274   -3.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2399   -4.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8274   -4.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2399   -5.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8274   -6.3604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2399   -7.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8274   -7.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0649   -2.7881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8274   -2.0737    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2 11  1  0  0  0  0\n  2 10  2  0  0  0  0\n  8  9  1  0  0  0  0\n  7  8  2  0  0  0  0\n  6  7  1  0  0  0  0\n  5  6  2  0  0  0  0\n  4  5  1  0  0  0  0\n  3  4  2  0  0  0  0\n  2  3  1  0  0  0  0\nM  CHG  2   1   1  11  -1\nM  END",
        "smiles": "C/C=C/C=C/C=C/C(=O)[O-].[K+]",
        "formula": "C8H9O2.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 3,
        "molecular_weight": "176.2545",
        "optical_activity": "NONE",
        "references": [
          "8c958bd0-d8f8-4e38-b167-34c4e1ff375f",
          "7d10146f-73c4-48f0-87b3-a356c53778c8"
        ],
        "stereo_centers": 0
      },
      "unii": "55GLK18X45"
    }
  ]
}