{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c034cf1f-7474-4034-806c-a54fb2c63344", "code": "A03FA03", "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS FOR FUNCTIONAL GASTROINTESTINAL DISORDERS|PROPULSIVES|Propulsives|domperidone", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=A03FA03&showdescription=yes", "code_system": "WHO-ATC", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "96acdaa4-c36e-40ab-ad22-adf11a9d39aa", "code": "QA03FA03", "comments": "VATC|DRUGS FOR FUNCTIONAL GASTROINTESTINAL DISORDERS|PROPULSIVES|Propulsives|domperidone", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA03FA03&showdescription=yes", "code_system": "WHO-VATC", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "f86fe422-1f42-42ef-b783-51f23ad53600", "code": "57808-66-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=57808-66-9", "code_system": "CAS", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70", "534d3987-51d9-4901-b939-eddf38190bf1" ] }, { "uuid": "b82b18a4-3bf3-4425-bcc2-02b171ad0b39", "code": "C454", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C454", "code_system": "NCI_THESAURUS", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "66719f4b-8cf4-4795-9580-4e84930b2f15", "code": "D004294", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68004294", "code_system": "MESH", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "882a2ee0-f580-4830-a013-21ebce168cfa", "code": "NBK548487", "comments": "LiverTox|Gastroinestinal|Prokinetic agent|Antidopaminergic", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548487/", "code_system": "LIVERTOX", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "05529338-5f20-4263-a54c-ac4a29a51ce3", "code": "DOMPERIDONE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Domperidone", "code_system": "WIKIPEDIA", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "79819c00-6917-4ff8-bf76-67d58d0364fb", "code": "SUB06361MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "9a9448c6-c3e8-4446-a095-6f8d5969ae0f", "code": "QP51AX24", "comments": "VATC|ANTIPROTOZOALS|AGENTS AGAINST PROTOZOAL DISEASES|Other antiprotozoal agents|domperidone", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP51AX24&showdescription=yes", "code_system": "WHO-VATC", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "18a3fe64-6134-4907-a314-20c1afbd9d3f", "code": "260-968-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.408", "code_system": "ECHA (EC/EINECS)", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "b1011446-4325-42aa-bd0d-7b50b4273758", "code": "965", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=965", "code_system": "IUPHAR", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "a4793263-ca9a-40d6-9dd5-cd44b9d98ba7", "code": "3626", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3626/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "062d777d-5abf-4cb8-af5f-5713551589b4", "code": "m4737", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m4737?q=authorize", "code_system": "MERCK INDEX", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "06e45b96-040d-42a3-97b3-a375a8ec91d4", "code": "DB01184", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB01184", "code_system": "DRUG BANK", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "37f315c6-3420-41f8-8686-8fcca9455170", "code": "21 CFR 520.766", "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.766 Domperidone.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.766", "code_system": "CFR", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "592f507a-4f8c-4cb4-a08a-08c778eb552d", "code": "CHEMBL219916", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL219916", "code_system": "ChEMBL", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "a3c32a5b-b4f2-47ab-91c1-d1a18da65594", "code": "3151", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3151", "code_system": "PUBCHEM", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "fb012f63-8563-412e-896d-5f0263682d95", "code": "4110", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4110", "code_system": "INN", "references": [ "fe361ee9-e635-49e7-96fc-edb12218ed70" ] }, { "uuid": "b548c872-e394-064d-9dd0-4ce0e0532186", "code": "336111", "comments": "ORPHAN DRUG|Designated|Treatment of hypoprolactinemia in breastfeeding mothers, and in some hypoprolactinemic conditions following the use of cabergoline or bromocriptine in mothers who wish to initiate or return to breastfeeding", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=336111", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "110ce825-c8d5-b0c2-cf49-19ca8411fe3a", "code": "Domperidone", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM495/", "code_system": "LACTMED", "references": [ "5b6ed4b2-4221-e881-1e2c-fdb43010e4d6" ] }, { "uuid": "80be49c5-c867-aece-757f-1c3881f3c9fe", "code": "DTXSID1045116", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1045116", "code_system": "EPA CompTox", "references": [ "80d66cbe-3116-74f9-dffe-e8183d8f49c6" ] }, { "uuid": "9cbbb4ec-e8b8-b34e-d1f8-b7ee22b3cf74", "code": "C29710", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antipsychotic Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29710", "code_system": "NCI_THESAURUS", "references": [ "5b6ed4b2-4221-e881-1e2c-fdb43010e4d6" ] }, { "uuid": "53e8fe74-11dd-4f5b-a169-561127285148", "code": "5587267Z69", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "72ccc443-4a5d-d47a-fd7a-76e259b8dff4", "code": "945", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/945", "code_system": "DRUG CENTRAL", "references": [ "5b6ed4b2-4221-e881-1e2c-fdb43010e4d6" ] }, { "uuid": "d69ab328-cc4e-0c06-30b9-77984a8ca3e1", "code": "31515", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31515", "code_system": "CHEBI", "references": [ "5b6ed4b2-4221-e881-1e2c-fdb43010e4d6" ] }, { "uuid": "caac72b2-8978-3e50-9fab-2f43e0f60bd2", "code": "100000092257", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "e30ec51e-a5fc-686b-8fe6-9d268dce60c1" ] }, { "uuid": "68344653-325a-6b9a-be3e-0691d7b84d9e", "code": "5587267Z69", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5587267Z69", "code_system": "DAILYMED", "references": [ "0d23f6b1-9eb3-2244-5a99-318efc4c2b02" ] }, { "uuid": "78a4528d-31ed-26f6-63b9-3403a84ba94e", "code": "299589", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=299589", "code_system": "NSC", "references": [ "19de6582-9e7d-965a-7221-3ea7ffa6c9ca" ] }, { "uuid": "759dea4c-8121-5cb1-7263-9638e2f24005", "code": "759575", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759575", "code_system": "NSC", "references": [ "19de6582-9e7d-965a-7221-3ea7ffa6c9ca" ] } ], "substance_class": "chemical", "references": [ { "uuid": "24252803-ddfb-49a3-9239-4c6cd45a020c", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "320fd924-a9da-4884-8999-54d92444918f", "citation": "INN Proposed List 36", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL36.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8cf8c5f2-accf-4035-b1a1-b395969e5121", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7bef2aa8-cd7a-42c3-a088-189b0ff5ad73", "citation": "EP 7.2", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "632bed9d-158e-420c-8450-7966505b6956", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "178f7422-cc58-4a18-a082-81346576bd21", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7b365706-6446-45fa-9353-71b72ea37f50", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f028ed89-1245-426b-acb0-071e75e703d4", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "032c6c2b-fedb-4223-bed3-77583a1d0125", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fe361ee9-e635-49e7-96fc-edb12218ed70", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389714000, "tags": [ "NOMEN" ] }, { "uuid": "11f9410c-6191-4dd2-8370-59f0ff931d2d", "citation": "USP-MC", "url": "https://mc.usp.org/monographs/domperidone-1-0", "doc_type": "USP-MC", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6dbc2886-f347-4a95-bbfe-3ad062c24a10", "citation": "SRS import [5587267Z69]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5587267Z69", "doc_type": "SRS", "public_domain": true, "document_date": 1493389714000, "tags": [ "NOMEN" ] }, { "uuid": "673f35d0-1014-4e69-aa70-5e809016362d", "citation": "DOMPERIDONE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e52ece1f-ceb1-46c3-917e-9ef671f8e18f", "citation": "DOMPERIDONE [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "af3f440c-118e-41bf-aef4-d5bc3a94c381", "citation": "DOMPERIDONE [EP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2cbd1315-4e5d-480b-a3e8-83f6f9e639ab", "citation": "DOMPERIDONE [JAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "cca554d3-759e-46c7-aa95-433fc2a2a700", "citation": "DOMPERIDONE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "35b8ba28-a7aa-4dfd-9a21-5807b870dd19", "citation": "DOMPERIDONE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "4f34b786-b008-410b-bae0-dce87dcc4192", "citation": "DOMPERIDONE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "8968714a-d037-4b32-a199-9008a2fd09f6", "citation": "DOMPERIDONE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "016a4b6b-7689-20c0-e0d9-9650776865fd", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+57808-66-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "80d66cbe-3116-74f9-dffe-e8183d8f49c6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57808-66-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7d4ac1f5-8138-acfc-c170-fcc1e49d3d01", "citation": "Obach, R. S., Huynh, P., Allen, M. C. and Beedham, C. (2004), Human Liver Aldehyde Oxidase: Inhibition by 239 Drugs. The Journal of Clinical Pharmacology, 44: 7–19. doi:10.1177/0091270003260336", "url": "http://onlinelibrary.wiley.com/doi/10.1177/0091270003260336/full", "doc_type": "JA", "public_domain": true }, { "uuid": "e30ec51e-a5fc-686b-8fe6-9d268dce60c1", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "41186d6c-bd27-34e4-5303-74ba818a32e8", "citation": "GREEN BOOK", "doc_type": "SRS", "public_domain": true }, { "uuid": "5b6ed4b2-4221-e881-1e2c-fdb43010e4d6", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "534d3987-51d9-4901-b939-eddf38190bf1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "f61b7bf0-9e14-4b70-98f5-77c7c159c9cc", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "cf42171c-be81-8bb1-310f-6774d00466fe", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true }, { "uuid": "19de6582-9e7d-965a-7221-3ea7ffa6c9ca", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "14dcd1bf-4640-4144-8a75-5350c0644729", "citation": "Michaud, Veronique, Chantal Simard, and Jacques Turgeon. \"An improved HPLC assay with fluorescence detection for the determination of domperidone and three major metabolites for application to in vitro drug metabolism studies.\" Journal of Chromatography B 852.1-2 (2007): 611-616.", "url": "https://pillbuys.com/research/Domperidone/21.pdf", "doc_type": "JA", "public_domain": true }, { "uuid": "6808f3c1-abff-47a0-bdf8-2f8d2c4258a5", "citation": "Michaud, Veronique, Chantal Simard, and Jacques Turgeon. \"An improved HPLC assay with fluorescence detection for the determination of domperidone and three major metabolites for application to in vitro drug metabolism studies.\" Journal of Chromatography B 852.1-2 (2007): 611-616.", "url": "https://pillbuys.com/research/Domperidone/21.pdf", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "78a02e63-230e-4a36-b4ea-a8b1df87bc73", "citation": "Michaud, Veronique, Chantal Simard, and Jacques Turgeon. \"An improved HPLC assay with fluorescence detection for the determination of domperidone and three major metabolites for application to in vitro drug metabolism studies.\" Journal of Chromatography B 852.1-2 (2007): 611-616.", "url": "https://pillbuys.com/research/Domperidone/21.pdf", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "70e21582-f017-4f0b-b4f2-c72708cc8c39", "citation": "Claassen, Sonja, and Bernd J. Zünkler. \"Comparison of the effects of metoclopramide and domperidone on HERG channels.\" Pharmacology 74.1 (2005): 31-36.", "url": "https://www.karger.com/Article/Abstract/83234", "doc_type": "JA", "public_domain": true }, { "uuid": "41f1a54b-87ee-4743-aa95-49b6488d121d", "citation": "Michaud, Veronique, Chantal Simard, and Jacques Turgeon. \"An improved HPLC assay with fluorescence detection for the determination of domperidone and three major metabolites for application to in vitro drug metabolism studies.\" Journal of Chromatography B 852.1-2 (2007): 611-616.", "url": "https://pillbuys.com/research/Domperidone/21.pdf", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "feeca157-7722-4222-ab7d-8f67483eca25", "citation": "WHO-SDG", "doc_type": "WHO-SDG", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8904e069-ac5a-248d-34d2-57924b195a3a", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "0d23f6b1-9eb3-2244-5a99-318efc4c2b02", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5cf2425a-bc1d-4420-8b43-e8c59d4d8060", "id": "5cf2425a-bc1d-4420-8b43-e8c59d4d8060", "molfile": "\n Marvin 01132104492D \n\n 30 34 0 0 0 0 999 V2000\n 9.4909 -2.4074 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6917 -2.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1148 -2.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3079 -2.5707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0907 -1.7844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3485 -1.4144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6196 -1.7922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5808 -2.6095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8411 -2.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1453 -2.5397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4159 -2.9196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7232 -2.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9809 -2.8576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2903 -2.4203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2334 -1.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8103 -0.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6009 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7940 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2275 -0.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4342 -1.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.0791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5200 -2.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3128 -3.5095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1918 -1.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9134 -1.3446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4808 -0.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8832 -0.0078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3001 -0.4523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6806 -1.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4746 -1.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 30 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 29 2 0 0 0 0\n 7 6 1 0 0 0 0\n 6 26 1 0 0 0 0\n 8 7 1 0 0 0 0\n 25 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 24 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 22 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 20 15 2 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 25 1 0 0 0 0\n 27 26 2 0 0 0 0\n 28 26 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)[nH]c(=O)n2CCCN3CCC(CC3)n4c5ccc(cc5[nH]c4=O)Cl", "formula": "C22H24ClN5O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "01f9e598-9723-41c1-9514-7f40284e2582" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "425.912", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "01c93821-5be2-4271-80e4-4e376c3e568e", "version": "37", "structure": { "id": "2ccfadd3-3013-4850-8d6b-0db86163024f", "molfile": "\n Marvin 01132102252D \n\n 30 34 0 0 0 0 999 V2000\n 6.4801 -0.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5199 -2.7177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3479 -1.4143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2902 -2.4201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2994 -0.4523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.0789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6798 -1.1945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0900 -1.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2333 -1.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4342 -1.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6190 -1.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4737 -1.4039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1449 -2.5394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8826 -0.0078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3072 -2.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3128 -3.5091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5802 -2.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9129 -1.3445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8406 -2.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1914 -1.7248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6908 -2.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9807 -2.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7229 -2.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1140 -2.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4156 -2.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4899 -2.4072 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8101 -0.9955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2275 -0.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6007 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7939 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 4 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 22 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 2 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 3 1 0 0 0 0\n 9 4 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 3 1 0 0 0 0\n 12 7 2 0 0 0 0\n 13 20 1 0 0 0 0\n 14 1 2 0 0 0 0\n 15 8 2 0 0 0 0\n 16 2 2 0 0 0 0\n 17 11 1 0 0 0 0\n 18 11 1 0 0 0 0\n 19 17 1 0 0 0 0\n 20 18 1 0 0 0 0\n 21 12 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 25 1 0 0 0 0\n 24 15 1 0 0 0 0\n 25 13 1 0 0 0 0\n 26 21 1 0 0 0 0\n 27 9 1 0 0 0 0\n 28 10 1 0 0 0 0\n 29 27 2 0 0 0 0\n 30 29 1 0 0 0 0\n 8 7 1 0 0 0 0\n 19 13 1 0 0 0 0\n 24 21 2 0 0 0 0\n 10 6 1 0 0 0 0\n 30 28 2 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)[nH]c(=O)n2CCCN3CCC(CC3)n4c5ccc(cc5[nH]c4=O)Cl", "formula": "C22H24ClN5O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "425.912", "optical_activity": "NONE", "references": [ "6dbc2886-f347-4a95-bbfe-3ad062c24a10", "24252803-ddfb-49a3-9239-4c6cd45a020c", "320fd924-a9da-4884-8999-54d92444918f" ], "stereo_centers": 0 }, "unii": "5587267Z69", "relationships": [ { "uuid": "49049580-db1b-4038-a25e-c435539bbca8", "amount": { "uuid": "84d8a2f1-d239-4c32-bfd9-b3a7391336e2" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "339982ff-a22b-4a81-9a6f-b1acc5f9b57f", "refuuid": "01c93821-5be2-4271-80e4-4e376c3e568e", "name": "DOMPERIDONE", "unii": "5587267Z69", "linking_id": "5587267Z69", "ref_pname": "DOMPERIDONE", "substance_class": "reference" } }, { "uuid": "09ccf73e-fc29-4564-9333-4145fef26a4e", "amount": { "uuid": "ccd00cd2-c2b2-443c-9685-da22fdfb1f73" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "ff5e1866-eab8-4c78-9723-81902face1bf", "refuuid": "1c36e065-9214-4319-bbeb-52e27f1e0236", "name": "DOMPERIDONE MALEATE", "unii": "899U5WF46A", "linking_id": "899U5WF46A", "ref_pname": "DOMPERIDONE MALEATE", "substance_class": "reference" } }, { "uuid": "10cda023-9f8a-4baa-99d5-27e43298e11b", "amount": { "uuid": "08961c03-075b-495c-bd33-a296c373a176" }, "type": "IMPURITY->PARENT", "references": [ "11f9410c-6191-4dd2-8370-59f0ff931d2d" ], "related_substance": { "uuid": "d35a96b5-b1d8-4630-84d5-fba0df14ccd5", "refuuid": "03fa3879-c814-4e38-8c20-2f02aad3c182", "name": "5-CHLORO-1-(4-PIPERIDINYL)-2-BENZIMIDAZOLINONE", "unii": "53TAT94YDS", "linking_id": "53TAT94YDS", "ref_pname": "5-CHLORO-1-(4-PIPERIDINYL)-2-BENZIMIDAZOLINONE", "substance_class": "reference" } }, { "uuid": "2e9bd9d4-be48-4beb-92a4-1751ef874a49", "amount": { "uuid": "5a5c2c1b-ed05-490f-b6e3-58293f982cd0" }, "type": "IMPURITY->PARENT", "references": [ "11f9410c-6191-4dd2-8370-59f0ff931d2d" ], "related_substance": { "uuid": "94f39567-1cf3-40b0-8557-8bf2f47ef502", "refuuid": "94f7d93a-c9c9-4b12-a911-05f2155e90dc", "name": "4-(5-CHLORO-2-OXO-2,3-DIHYDRO-1H-BENZIMIDAZOL-1-YL)-1-FORMYLPIPERIDINE", "unii": "YFF7LGR2XQ", "linking_id": "YFF7LGR2XQ", "ref_pname": "4-(5-CHLORO-2-OXO-2,3-DIHYDRO-1H-BENZIMIDAZOL-1-YL)-1-FORMYLPIPERIDINE", "substance_class": "reference" } }, { "uuid": "b2a45b66-7e58-42ee-bc4c-13a5e8114e43", "amount": { "uuid": "398b9dfa-3f74-4eed-b580-849bedb66f59" }, "type": "IMPURITY->PARENT", "references": [ "11f9410c-6191-4dd2-8370-59f0ff931d2d" ], "related_substance": { "uuid": "96ef791a-5f36-489f-9ef0-5473a55e9388", "refuuid": "14984ee6-c214-4d54-8fe1-96f1a0e95679", "name": "5-CHLORO-3-(3-(2-OXO-2,3-DIHYDRO-1H-BENZIMIDAZOL-1-YL)PROPYL)-1-(1-(3-(2-OXO-2,3-DIHYDRO-1H-BENZIMIDAZOL-1-YL) PROPYL) PIPERIDIN-4-YL)- 1,3-DIHYDRO-2H-BENZIMIDAZOL-2-ONE", "unii": "FC9E589L8T", "linking_id": "FC9E589L8T", "ref_pname": "5-CHLORO-3-(3-(2-OXO-2,3-DIHYDRO-1H-BENZIMIDAZOL-1-YL)PROPYL)-1-(1-(3-(2-OXO-2,3-DIHYDRO-1H-BENZIMIDAZOL-1-YL) PROPYL) PIPERIDIN-4-YL)- 1,3-DIHYDRO-2H-BENZIMIDAZOL-2-ONE", "substance_class": "reference" } }, { "uuid": "6409444a-4db3-482c-b08e-f30485cdc51b", "amount": { "uuid": "4da2d6a7-9d75-4ecb-a4e9-351c4add9e0d" }, "type": "IMPURITY->PARENT", "references": [ "11f9410c-6191-4dd2-8370-59f0ff931d2d" ], "related_substance": { "uuid": "709d8479-327a-4d91-81ae-a315bb8bd361", "refuuid": "0ee72b6b-f2e7-4d58-a4eb-9225dc62a3f7", "name": "1-(3-(4-(5-CHLORO-2-OXO-3H-BENZIMIDAZOL-1-YL)PIPERIDIN-1-YL)PROPYL)-3-(3-(2-OXO-3H-BENZIMIDAZOL-1-YL)PROPYL)BENZIMIDAZOL-2-ONE", "unii": "SU3NPR78Z6", "linking_id": "SU3NPR78Z6", "ref_pname": "1-(3-(4-(5-CHLORO-2-OXO-3H-BENZIMIDAZOL-1-YL)PIPERIDIN-1-YL)PROPYL)-3-(3-(2-OXO-3H-BENZIMIDAZOL-1-YL)PROPYL)BENZIMIDAZOL-2-ONE", "substance_class": "reference" } }, { "uuid": "35887790-e3ac-4483-9469-3a110ac5db5b", "amount": { "uuid": "b2295a53-e488-45c6-a567-5316ef4a2557" }, "type": "IMPURITY->PARENT", "references": [ "11f9410c-6191-4dd2-8370-59f0ff931d2d" ], "related_substance": { "uuid": "55627f5e-adb3-4f73-bee9-7323cb2c5f95", "refuuid": "a73a514c-0b09-4656-b45e-e87dd6b9c4df", "name": "1,3-BIS(3-(4-(5-CHLORO-2-OXO-3H-BENZIMIDAZOL-1-YL)PIPERIDIN-1-YL)PROPYL)BENZIMIDAZOL-2-ONE", "unii": "JJ3HBB9FWS", "linking_id": "JJ3HBB9FWS", "ref_pname": "1,3-BIS(3-(4-(5-CHLORO-2-OXO-3H-BENZIMIDAZOL-1-YL)PIPERIDIN-1-YL)PROPYL)BENZIMIDAZOL-2-ONE", "substance_class": "reference" } }, { "uuid": "369abf10-a5df-4499-b515-d8eda13d2cf3", "amount": { "uuid": "6d4ebf9f-fac9-44ab-84cf-c1f2f541b1c5", "average": 3, "high": 4.4, "low": 1.6, "units": "MICROMOLAR" }, "qualification": "IC50", "type": "METABOLIC ENZYME->INHIBITOR", "references": [ "7d4ac1f5-8138-acfc-c170-fcc1e49d3d01" ], "related_substance": { "uuid": "e2041df6-77bb-4775-ab6c-442ba2d2dd8c", "refuuid": "393aa2e6-c500-402e-8f58-a069ed6e2771", "name": "ALDEHYDE OXIDASE", "unii": "LR0F81F33L", "linking_id": "LR0F81F33L", "ref_pname": "ALDEHYDE OXIDASE", "substance_class": "reference" } }, { "uuid": "190471df-d688-4058-9144-6f3138bfa9ac", "amount": { "uuid": "8f977dc6-c172-42ce-8ded-a7880b8cc887" }, "type": "METABOLITE->PARENT", "mediator_substance": { "uuid": "9883baa3-58f8-471f-bb1d-a5c640b63c8b", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "6808f3c1-abff-47a0-bdf8-2f8d2c4258a5" ], "related_substance": { "uuid": "5737df74-5f6f-473b-a4b5-43aa30e5782c", "refuuid": "87a7ef07-8777-492e-9719-f6174e79d74e", "name": "5-Hydroxydomperidone", "unii": "ZE6EAB6RGV", "linking_id": "ZE6EAB6RGV", "ref_pname": "5-Hydroxydomperidone", "substance_class": "reference" } }, { "uuid": "5d463e11-ffdb-434b-a235-6503420fb02b", "amount": { "uuid": "0dd38ed1-e604-4448-9d48-2b2fe31a9557" }, "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "70e21582-f017-4f0b-b4f2-c72708cc8c39", "14dcd1bf-4640-4144-8a75-5350c0644729" ], "related_substance": { "uuid": "e15bc00b-d6b1-4019-a441-b529d5b644c2", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" } }, { "uuid": "c1a4b796-7cda-4835-a615-d9cfcc59b117", "amount": { "uuid": "6f04266e-98c2-45ea-9616-9275120df454", "average": 0.057, "units": "MICROMOLAR" }, "qualification": "IC50", "type": "OFF-TARGET->INHIBITOR", "references": [ "70e21582-f017-4f0b-b4f2-c72708cc8c39" ], "related_substance": { "uuid": "a9c8e7c5-64c3-49e4-9052-2e3a2ad8edd3", "refuuid": "f6c218f4-f9b4-4156-9fab-5aba14f52d44", "name": "POTASSIUM VOLTAGE-GATED CHANNEL SUBFAMILY H MEMBER 2", "unii": "SEV29N8JND", "linking_id": "SEV29N8JND", "ref_pname": "POTASSIUM VOLTAGE-GATED CHANNEL SUBFAMILY H MEMBER 2", "substance_class": "reference" } }, { "uuid": "71236381-ba9c-4da8-bde0-b9da08aaff7e", "amount": { "uuid": "c44a08e6-a54f-4ab4-8e17-45ca5c6de7ba" }, "type": "METABOLITE->PARENT", "mediator_substance": { "uuid": "6db134f2-302a-4c63-b4ce-60b7fdb254c3", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "78a02e63-230e-4a36-b4ea-a8b1df87bc73" ], "related_substance": { "uuid": "7075f8fd-830f-41a3-9e2b-c3f0cc499f31", "refuuid": "03fa3879-c814-4e38-8c20-2f02aad3c182", "name": "5-CHLORO-1-(4-PIPERIDINYL)-2-BENZIMIDAZOLINONE", "unii": "53TAT94YDS", "linking_id": "53TAT94YDS", "ref_pname": "5-CHLORO-1-(4-PIPERIDINYL)-2-BENZIMIDAZOLINONE", "substance_class": "reference" } }, { "uuid": "ff69ce19-31c6-4753-bee1-a3295ff397d4", "amount": { "uuid": "ca392648-ec15-4971-9fc9-de940348b24f" }, "type": "SALT/SOLVATE->PARENT", "references": [ "feeca157-7722-4222-ab7d-8f67483eca25" ], "related_substance": { "uuid": "3636cb06-a4d3-4f62-aa6c-f16f519b3752", "refuuid": "560e9aaa-19fe-4e4d-bcab-981868e4e33c", "name": "DOMPERIDONE ACETATE", "unii": "C55S87J9RC", "linking_id": "C55S87J9RC", "ref_pname": "DOMPERIDONE ACETATE", "substance_class": "reference" } } ], "names": [ { "uuid": "5348fdd8-5971-443c-9c54-4d2d9cbfe620", "name": "2H-BENZIMIDAZOL-2-ONE, 5-CHLORO-1-(1-(3-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-1-YL)PROPYL)-4-PIPERIDINYL)-1,3-DIHYDRO-", "stdName": "2H-BENZIMIDAZOL-2-ONE, 5-CHLORO-1-(1-(3-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-1-YL)PROPYL)-4-PIPERIDINYL)-1,3-DIHYDRO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "24252803-ddfb-49a3-9239-4c6cd45a020c" ], "display_name": false }, { "uuid": "42576d93-d321-460a-aefa-71ba53ba91f3", "name": "5-Chloro-1-[1-[3-(2-oxo-1-benzimidazolinyl)propyl]-4-piperidyl]-2-benzimidazolinone", "stdName": "5-CHLORO-1-(1-(3-(2-OXO-1-BENZIMIDAZOLINYL)PROPYL)-4-PIPERIDYL)-2-BENZIMIDAZOLINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "24252803-ddfb-49a3-9239-4c6cd45a020c" ], "display_name": false }, { "uuid": "15e0ac8d-6917-4322-a03e-a556e56ee50e", "name": "DOMPERIDONE", "stdName": "DOMPERIDONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "632bed9d-158e-420c-8450-7966505b6956", "4f34b786-b008-410b-bae0-dce87dcc4192", "8cf8c5f2-accf-4035-b1a1-b395969e5121", "e52ece1f-ceb1-46c3-917e-9ef671f8e18f", "673f35d0-1014-4e69-aa70-5e809016362d", "cca554d3-759e-46c7-aa95-433fc2a2a700", "032c6c2b-fedb-4223-bed3-77583a1d0125", "35b8ba28-a7aa-4dfd-9a21-5807b870dd19", "24252803-ddfb-49a3-9239-4c6cd45a020c", "178f7422-cc58-4a18-a082-81346576bd21", "af3f440c-118e-41bf-aef4-d5bc3a94c381", "2cbd1315-4e5d-480b-a3e8-83f6f9e639ab", "f028ed89-1245-426b-acb0-071e75e703d4", "320fd924-a9da-4884-8999-54d92444918f", "7b365706-6446-45fa-9353-71b72ea37f50", "7bef2aa8-cd7a-42c3-a088-189b0ff5ad73", "8968714a-d037-4b32-a199-9008a2fd09f6" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "3d8bf022-86f6-4f2e-9b79-3810eabe12a2", "name_org": "INN" }, { "uuid": "368f7ce0-01e9-4af3-8612-4f7fe843160a", "name_org": "USAN" } ] }, { "uuid": "b7b9a754-d275-7bd4-6573-bfcfabccb5cb", "name": "DOMPERIDONE [EP MONOGRAPH]", "stdName": "DOMPERIDONE [EP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cf42171c-be81-8bb1-310f-6774d00466fe" ], "display_name": false }, { "uuid": "b78f3ad5-3b6e-268c-6f05-1da12da776c6", "name": "DOMPERIDONE [GREEN BOOK]", "stdName": "DOMPERIDONE [GREEN BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "41186d6c-bd27-34e4-5303-74ba818a32e8" ], "display_name": false }, { "uuid": "23e41e7e-6e84-4700-af8a-28730e3150ec", "name": "DOMPERIDONE [JAN]", "stdName": "DOMPERIDONE [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "632bed9d-158e-420c-8450-7966505b6956" ], "display_name": false }, { "uuid": "13972312-d430-4a68-9e0b-dc2c4c88c909", "name": "DOMPERIDONE [MART.]", "stdName": "DOMPERIDONE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "178f7422-cc58-4a18-a082-81346576bd21" ], "display_name": false }, { "uuid": "e5e79af6-bd7d-48d5-b15b-e5988bceca00", "name": "DOMPERIDONE [MI]", "stdName": "DOMPERIDONE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b365706-6446-45fa-9353-71b72ea37f50" ], "display_name": false }, { "uuid": "a5b19ea3-4160-49d0-91ed-16318c628039", "name": "DOMPERIDONE [USAN]", "stdName": "DOMPERIDONE [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8cf8c5f2-accf-4035-b1a1-b395969e5121" ], "display_name": false }, { "uuid": "c57e90e7-9d0b-422b-afa2-fdfeb22ef50d", "name": "DOMPERIDONE [VANDF]", "stdName": "DOMPERIDONE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "032c6c2b-fedb-4223-bed3-77583a1d0125" ], "display_name": false }, { "uuid": "17603354-b4b8-fb41-fffc-ba24ee66f170", "name": "Domperidone [WHO-DD]", "stdName": "DOMPERIDONE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8904e069-ac5a-248d-34d2-57924b195a3a" ], "display_name": false }, { "uuid": "64cbcd9b-8c04-4f17-85b3-7f23a7003659", "name": "MOTILIUM", "stdName": "MOTILIUM", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "24252803-ddfb-49a3-9239-4c6cd45a020c" ], "display_name": false }, { "uuid": "2f3daf36-2b58-a20f-f5ab-88f825ada223", "name": "NSC-299589", "stdName": "NSC-299589", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "19de6582-9e7d-965a-7221-3ea7ffa6c9ca" ], "display_name": false }, { "uuid": "a4b422a4-871e-75b1-3d28-04acc4c93497", "name": "NSC-759575", "stdName": "NSC-759575", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "19de6582-9e7d-965a-7221-3ea7ffa6c9ca" ], "display_name": false }, { "uuid": "b37f8103-8113-4d42-89ae-2034f7d2d550", "name": "R 33,812", "stdName": "R 33,812", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "24252803-ddfb-49a3-9239-4c6cd45a020c" ], "display_name": false }, { "uuid": "587779a3-636c-457e-b59e-ae3e88f87bf2", "name": "R-33812", "stdName": "R-33812", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "24252803-ddfb-49a3-9239-4c6cd45a020c" ], "display_name": false }, { "uuid": "9258fc79-b8aa-4fbd-8b7b-bb628e60641a", "name": "domperidone [INN]", "stdName": "DOMPERIDONE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "320fd924-a9da-4884-8999-54d92444918f" ], "display_name": false } ], "modifications": { "uuid": "2184d1be-6c0a-4803-8e07-69573acbad53" } } ] }