{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0b08b584-6144-4c73-9716-82ae3388cb59", "code": "67801-47-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=67801-47-2", "code_system": "CAS", "references": [ "6c217a5c-c7da-480c-841d-6bb0cab67be2", "9d8f98de-4f30-4a8d-bcec-d2f13d08494f" ] }, { "uuid": "5db10cb0-76a6-4824-956c-9d141b7da9b1", "code": "267-168-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.061.044", "code_system": "ECHA (EC/EINECS)", "references": [ "6c217a5c-c7da-480c-841d-6bb0cab67be2" ] }, { "uuid": "4f293d51-f38e-d2a5-c471-7d6112861fa3", "code": "DTXSID1052375", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1052375", "code_system": "EPA CompTox", "references": [ "2a332c39-67a0-2be5-cb24-6978233061e8" ] }, { "uuid": "86c72de3-dcd5-4fa7-afe0-2d554fd0a2af", "code": "55494K367R", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "82579a26-f4cc-4454-a027-5abd1a2cc25f", "name": "BENZOIC ACID, 2-((3,7-DIMETHYL-2,6-OCTADIEN-1-YLIDENE)AMINO)-, METHYL ESTER", "stdName": "BENZOIC ACID, 2-((3,7-DIMETHYL-2,6-OCTADIEN-1-YLIDENE)AMINO)-, METHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "aee53c78-15dc-4603-a39f-2eba20813dba", "4bbb7c05-c409-463e-9bc3-70af538ea1df" ], "display_name": false }, { "uuid": "85fa0745-045b-480a-93c0-532c0089ac7f", "name": "METHYL 2-((3,7-DIMETHYL-2,6-OCTADIEN-1-YLIDENE)AMINO)BENZOATE", "stdName": "METHYL 2-((3,7-DIMETHYL-2,6-OCTADIEN-1-YLIDENE)AMINO)BENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "143c2cbc-d141-4b93-8453-927203a992c9", "4bbb7c05-c409-463e-9bc3-70af538ea1df" ], "display_name": true } ], "references": [ { "uuid": "143c2cbc-d141-4b93-8453-927203a992c9", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4bbb7c05-c409-463e-9bc3-70af538ea1df", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aee53c78-15dc-4603-a39f-2eba20813dba", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6c217a5c-c7da-480c-841d-6bb0cab67be2", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392806000, "tags": [ "NOMEN" ] }, { "uuid": "341bcd86-d54f-4b85-a46d-645e96eebf9f", "citation": "SRS import [55494K367R]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=55494K367R", "doc_type": "SRS", "public_domain": true, "document_date": 1493392806000, "tags": [ "NOMEN" ] }, { "uuid": "6a4a9034-3b1f-407d-b6ee-55e6fc3f1bc8", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2a332c39-67a0-2be5-cb24-6978233061e8", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=67801-47-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9d8f98de-4f30-4a8d-bcec-d2f13d08494f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "519e8576-fe08-403d-8222-5e0ca1c18acd", "id": "519e8576-fe08-403d-8222-5e0ca1c18acd", "molfile": "\n Marvin 01132104152D \n\n 21 21 0 0 0 0 999 V2000\n 2.8439 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1310 -0.4074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1310 -1.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8518 -1.6374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4259 -1.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7129 -1.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7129 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4259 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1310 -2.8752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8439 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5568 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2698 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2698 -1.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9827 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6956 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4086 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1215 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8345 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1215 -1.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/C=N/c1ccccc1C(=O)OC)/C)C", "formula": "C18H23NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "00493573-4dc5-4a18-95bc-99dc466fc376" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "285.3814", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f6a7811c-a3fd-4772-ac3c-bb34105cfe8b", "version": "3", "structure": { "id": "3b3cbbdb-56af-44a3-a3f7-18858bdaccf1", "molfile": "\n Marvin 01132103082D \n\n 21 21 0 0 0 0 999 V2000\n 2.8439 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5568 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2698 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9827 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6956 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4086 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1215 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8345 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2698 -1.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1215 -1.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1310 -2.8752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4259 -2.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4259 -1.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7129 -1.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7129 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1310 -1.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1310 -0.4074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8439 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8518 -1.6374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 11 2 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 9 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 17 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 18 19 1 0 0 0 0\n 18 21 2 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/C=N/c1ccccc1C(=O)OC)/C)C", "formula": "C18H23NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "285.3814", "optical_activity": "NONE", "references": [ "341bcd86-d54f-4b85-a46d-645e96eebf9f", "6a4a9034-3b1f-407d-b6ee-55e6fc3f1bc8" ], "stereo_centers": 0 }, "unii": "55494K367R" } ] }