{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "26bffbcb-238b-4a5a-b5a3-2a37145791f3",
          "code": "ISOBORNYL ACETATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=254",
          "code_system": "JECFA EVALUATION",
          "references": [
            "4f700407-db95-42e1-b657-a237678bb214"
          ]
        },
        {
          "uuid": "80f2db51-619f-45d3-89df-b81e0979192c",
          "code": "125-12-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=125-12-2",
          "code_system": "CAS",
          "references": [
            "4f700407-db95-42e1-b657-a237678bb214",
            "0b68239d-fcde-4c69-b032-07ef4740dbe3"
          ]
        },
        {
          "uuid": "f688b210-a95e-43bd-8a24-f78af0f67ac3",
          "code": "C011331",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67011331",
          "code_system": "MESH",
          "references": [
            "4f700407-db95-42e1-b657-a237678bb214"
          ]
        },
        {
          "uuid": "4159948f-a5c2-427c-af86-4ed5b12752b8",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "4f700407-db95-42e1-b657-a237678bb214"
          ]
        },
        {
          "uuid": "4129d0f1-bc4f-436e-9548-93fb8ef48179",
          "code": "128875",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2604",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "4f700407-db95-42e1-b657-a237678bb214"
          ]
        },
        {
          "uuid": "501aab75-e44e-4a54-9d55-d2460bffd324",
          "code": "SUB14273MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4f700407-db95-42e1-b657-a237678bb214"
          ]
        },
        {
          "uuid": "7cdbf684-89ea-41d7-8b04-311ddc83f0ec",
          "code": "204-727-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.298",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4f700407-db95-42e1-b657-a237678bb214"
          ]
        },
        {
          "uuid": "a7b31270-7c97-435a-962b-0d7f1ecfa84c",
          "code": "637531",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/637531",
          "code_system": "PUBCHEM",
          "references": [
            "4f700407-db95-42e1-b657-a237678bb214"
          ]
        },
        {
          "uuid": "11ff5ac6-0467-e8c4-34a7-5837b6592667",
          "code": "DTXSID7042061",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7042061",
          "code_system": "EPA CompTox",
          "references": [
            "b098e939-a2b1-0844-4319-c6fbd2da12dc"
          ]
        },
        {
          "uuid": "cde6341e-6c34-d733-294b-6c015702aabc",
          "code": "2398330",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2398330/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ce7f995c-7011-de97-44b4-8bc7246164ab"
          ]
        },
        {
          "uuid": "8190da8c-3d8f-4971-893b-4cf53d4895c7",
          "code": "54T6CCU09Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0c57654a-f30a-5a11-2c47-98a2949f2762",
          "code": "62486",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=62486",
          "code_system": "NSC",
          "references": [
            "a6f913bb-fa6f-e5e6-2fd7-d37b768ee6c5"
          ]
        },
        {
          "uuid": "c45c9e57-ba00-9a5e-3d40-fefb4eb4f522",
          "code": "100000088902",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "06d0dd8c-3f30-1c5f-b439-43ef61336a69"
          ]
        },
        {
          "uuid": "e5af9ef3-973b-90a7-dc65-3d0569678ab0",
          "code": "54T6CCU09Z",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=54T6CCU09Z",
          "code_system": "DAILYMED",
          "references": [
            "6f36d907-2b9f-43a8-56db-29e25af5e533"
          ]
        },
        {
          "uuid": "f81907d5-74c3-f1f4-63ef-1cb8ed1d8a4a",
          "code": "1387",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1387/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "ff9cbb61-b924-dba1-bf6e-9e242406eda2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2bb6dd57-02ff-4fd0-afba-7c3752c675a6",
          "name": "(±)-ISOBORNYL ACETATE",
          "stdName": "(+/-)-ISOBORNYL ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63964342-b8ab-44bc-a212-a00b0c8fd6be",
            "4042fde6-8ee7-48ad-b416-e5a9b5512d52"
          ],
          "display_name": false
        },
        {
          "uuid": "bc47bdc5-6ecb-4fef-8e46-329e0c85abae",
          "name": "BICYCLO(2.2.1)HEPTAN-2-OL, 1,7,7-TRIMETHYL-, 2-ACETATE, (1R,2R,4R)-REL-",
          "stdName": "BICYCLO(2.2.1)HEPTAN-2-OL, 1,7,7-TRIMETHYL-, 2-ACETATE, (1R,2R,4R)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63964342-b8ab-44bc-a212-a00b0c8fd6be",
            "4042fde6-8ee7-48ad-b416-e5a9b5512d52"
          ],
          "display_name": false
        },
        {
          "uuid": "d12c360d-3efd-4915-ad54-ee0126dee163",
          "name": "FEMA NO. 2160",
          "stdName": "FEMA NO. 2160",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4042fde6-8ee7-48ad-b416-e5a9b5512d52",
            "80250ebe-95a0-4fc4-9a5b-8d2a9c82b46e"
          ],
          "display_name": false
        },
        {
          "uuid": "d1bdaa2b-de9c-4e95-8d5e-d69e916bb921",
          "name": "ISOBORNEOL, ACETATE",
          "stdName": "ISOBORNEOL, ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63964342-b8ab-44bc-a212-a00b0c8fd6be",
            "4042fde6-8ee7-48ad-b416-e5a9b5512d52"
          ],
          "display_name": false
        },
        {
          "uuid": "b3ccf75a-18db-4bc1-9d91-2cd0b2cb8972",
          "name": "ISOBORNYL ACETATE",
          "stdName": "ISOBORNYL ACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6bdba75-3973-425c-a2ad-4c257a2775f0",
            "cb7a8275-fb23-4dfa-89f9-ef378b338fb2",
            "5d583069-7a2d-47b0-8bd4-d84eca7fb9c9",
            "92d61a8b-fa8e-49bd-9136-6755afa2ef65",
            "ad388b4c-8966-4b0b-88b6-35d0c310e8fb",
            "bb92b3b7-175d-469c-bab8-07289bb98ab6",
            "f811f47b-b223-4255-9a85-4405a940bde7",
            "b61fa4be-d3a3-4ea7-a28e-a6a429d39865",
            "9f9b8d98-aa92-4e3b-892f-1802d6804b81",
            "4042fde6-8ee7-48ad-b416-e5a9b5512d52"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1a3a1d40-7226-4923-8b25-da930b7eee6a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5b3c462d-b00d-4e7d-816f-0c4cce1e5fe6",
          "name": "ISOBORNYL ACETATE [FCC]",
          "stdName": "ISOBORNYL ACETATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f9b8d98-aa92-4e3b-892f-1802d6804b81",
            "4042fde6-8ee7-48ad-b416-e5a9b5512d52"
          ],
          "display_name": false
        },
        {
          "uuid": "be67745f-7bef-401c-8cfa-8948c595276e",
          "name": "ISOBORNYL ACETATE [FHFI]",
          "stdName": "ISOBORNYL ACETATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb92b3b7-175d-469c-bab8-07289bb98ab6",
            "4042fde6-8ee7-48ad-b416-e5a9b5512d52"
          ],
          "display_name": false
        },
        {
          "uuid": "62263ffa-ffa3-5d6f-03b3-2a51d313867d",
          "name": "Isobornyl acetate [WHO-DD]",
          "stdName": "ISOBORNYL ACETATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e70c3e3-83bc-15e7-9435-5f05ad80bcc3"
          ],
          "display_name": false
        },
        {
          "uuid": "40a0e5a6-2620-4cdb-bb01-33584b1d9d46",
          "name": "NSC-62486",
          "stdName": "NSC-62486",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63964342-b8ab-44bc-a212-a00b0c8fd6be",
            "4042fde6-8ee7-48ad-b416-e5a9b5512d52"
          ],
          "display_name": false
        },
        {
          "uuid": "1d34d08c-1769-4a5b-8db8-d9618e5380ee",
          "name": "PICHTOSIN",
          "stdName": "PICHTOSIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4042fde6-8ee7-48ad-b416-e5a9b5512d52",
            "80250ebe-95a0-4fc4-9a5b-8d2a9c82b46e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9f9b8d98-aa92-4e3b-892f-1802d6804b81",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ad388b4c-8966-4b0b-88b6-35d0c310e8fb",
          "citation": "MERCK",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80250ebe-95a0-4fc4-9a5b-8d2a9c82b46e",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4042fde6-8ee7-48ad-b416-e5a9b5512d52",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63964342-b8ab-44bc-a212-a00b0c8fd6be",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb92b3b7-175d-469c-bab8-07289bb98ab6",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6bdba75-3973-425c-a2ad-4c257a2775f0",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb7a8275-fb23-4dfa-89f9-ef378b338fb2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f700407-db95-42e1-b657-a237678bb214",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390985000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf6d6846-4851-475c-b849-2c3836b7ed0a",
          "citation": "AN OVERVIEW OF THE EFFECTS OF TOBACCO INGREDIENTS ON SMOKE CHEMISTRY AND TOXICITY; FOOD AND CHEMICAL TOXICOLOGY; BAKER, RR; 42(SUPPL):53-83, 2004",
          "url": "http://www.sciencedirect.com/science/article/pii/S0278691504000043",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de95f2bd-6bf1-4e50-b3de-c314fc912402",
          "citation": "SRS import [54T6CCU09Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=54T6CCU09Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390985000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a3fcd62-03a3-4617-8822-2efedf6e1ace",
          "citation": "Food Chemical Codex",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d583069-7a2d-47b0-8bd4-d84eca7fb9c9",
          "citation": "ISOBORNYL ACETATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f811f47b-b223-4255-9a85-4405a940bde7",
          "citation": "ISOBORNYL ACETATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b61fa4be-d3a3-4ea7-a28e-a6a429d39865",
          "citation": "ISOBORNYL ACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "92d61a8b-fa8e-49bd-9136-6755afa2ef65",
          "citation": "ISOBORNYL ACETATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b098e939-a2b1-0844-4319-c6fbd2da12dc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=125-12-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "06d0dd8c-3f30-1c5f-b439-43ef61336a69",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ee554777-4a9a-72c6-a17f-9255a3cf35ce",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0b68239d-fcde-4c69-b032-07ef4740dbe3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ce7f995c-7011-de97-44b4-8bc7246164ab",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "a6f913bb-fa6f-e5e6-2fd7-d37b768ee6c5",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4e70c3e3-83bc-15e7-9435-5f05ad80bcc3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6f36d907-2b9f-43a8-56db-29e25af5e533",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ff9cbb61-b924-dba1-bf6e-9e242406eda2",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e88b74ba-eb71-4ff4-97e5-60b57dd0fbb6",
          "id": "e88b74ba-eb71-4ff4-97e5-60b57dd0fbb6",
          "molfile": "\n  Marvin  01132112022D          \n\n 14 15  0  0  0  0            999 V2000\n   24.7681   -6.7038    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   24.0536   -6.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.0536   -5.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7681   -5.0538    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   24.7681   -4.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4825   -5.4663    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   25.4825   -6.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1970   -5.0538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.9115   -5.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.6259   -5.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.9115   -6.2913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4325   -5.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7180   -6.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7180   -5.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  1  0  0  0\n  1 12  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  6  4  1  0  0  0  0\n  4 12  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  6  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)O[C@@H]1C[C@H]2CC[C@]1(C)C2(C)C",
          "formula": "C12H20O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ee249fff-5191-4c4b-8efb-3bf1c07f7d56"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "196.2865",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0a5e187f-f1c2-4432-b191-a476ad5486e8",
      "version": "13",
      "structure": {
        "id": "b1b39309-6ab6-4f38-bb25-afa7bc99209b",
        "molfile": "\n  Marvin  01132109132D          \n\n 14 15  0  0  0  0            999 V2000\n   26.9115   -5.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.6259   -5.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.9115   -6.2913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1970   -5.0538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4825   -5.4663    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   24.7681   -5.0538    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   24.0536   -5.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.0536   -6.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7681   -6.7038    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   25.4825   -6.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4325   -5.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7180   -6.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7180   -5.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7681   -4.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  5  4  1  6  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  5 10  1  0  0  0  0\n 10  9  1  0  0  0  0\n  6 11  1  6  0  0  0\n  9 11  1  6  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n  6 14  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)O[C@@H]1C[C@H]2CC[C@]1(C)C2(C)C",
        "formula": "C12H20O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "196.2865",
        "optical_activity": "( + / - )",
        "references": [
          "3a3fcd62-03a3-4617-8822-2efedf6e1ace",
          "de95f2bd-6bf1-4e50-b3de-c314fc912402"
        ],
        "stereo_centers": 3
      },
      "unii": "54T6CCU09Z"
    }
  ]
}