{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d759e19f-dce7-4aef-be72-6c5551d51ebd",
          "code": "127-43-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=127-43-5",
          "code_system": "CAS",
          "references": [
            "6a09ad04-2770-4185-a4bf-378f8aaa69a4",
            "a2e86764-46d8-4685-9ba5-8b5fa2212589"
          ]
        },
        {
          "uuid": "fcb4ccfd-0ebd-44e9-a240-fbb08ae24058",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "6a09ad04-2770-4185-a4bf-378f8aaa69a4"
          ]
        },
        {
          "uuid": "b4d96d54-af21-48c3-b80b-b81a8bc203d2",
          "code": "METHYL-BETA-IONONE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4682",
          "code_system": "JECFA EVALUATION",
          "references": [
            "6a09ad04-2770-4185-a4bf-378f8aaa69a4"
          ]
        },
        {
          "uuid": "a8de1699-18d9-4965-9161-2c25ac5432d0",
          "code": "204-843-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.404",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6a09ad04-2770-4185-a4bf-378f8aaa69a4"
          ]
        },
        {
          "uuid": "b7c65889-c087-4a9b-bdf9-1e2a61fb3bdc",
          "code": "5375218",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5375218",
          "code_system": "PUBCHEM",
          "references": [
            "6a09ad04-2770-4185-a4bf-378f8aaa69a4"
          ]
        },
        {
          "uuid": "9d635a75-25d5-bf4f-b406-15b742533605",
          "code": "DTXSID6051643",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6051643",
          "code_system": "EPA CompTox",
          "references": [
            "25d195ef-3dfd-9f25-a927-a4d60655b53a"
          ]
        },
        {
          "uuid": "28ed6483-b621-4edc-b12e-6e83a607adb6",
          "code": "54PXU8D4R5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "59d1833c-5f2a-4efb-df5f-ec26fe0cdf9c",
          "code": "163995",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=163995",
          "code_system": "NSC",
          "references": [
            "4535a332-9419-0278-428a-1030bcbc8978"
          ]
        },
        {
          "uuid": "def431d3-f5e6-839e-fa8e-410620a7465c",
          "code": "335",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/335/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "15cda874-6c44-5beb-8237-8a813c8974e5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a8c088bb-8634-453d-9c66-8d3eb4d1101e",
          "name": ".BETA.-CETONE",
          "stdName": ".BETA.-CETONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4957e97-8dcc-4abe-99a4-cc8cd2cef5fe"
          ],
          "display_name": false
        },
        {
          "uuid": "35f90106-c9d3-4294-a6b1-7de26dae4a02",
          "name": ".BETA.-METHYL IONONE",
          "stdName": ".BETA.-METHYL IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "722850cc-da55-4dfe-b98e-4e41b5a0d5ae"
          ],
          "display_name": true
        },
        {
          "uuid": "6715db18-e49f-41da-8d70-9be3fc460a0e",
          "name": ".BETA.-METHYLIONONE",
          "stdName": ".BETA.-METHYLIONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4957e97-8dcc-4abe-99a4-cc8cd2cef5fe"
          ],
          "display_name": false
        },
        {
          "uuid": "6309f1e0-d547-448e-baa4-bd5a5277bda2",
          "name": "1-PENTEN-3-ONE, 1-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-",
          "stdName": "1-PENTEN-3-ONE, 1-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1f5e07a-756d-4cb9-ba14-2ae3c356254c"
          ],
          "display_name": false
        },
        {
          "uuid": "3a7b51b9-376b-400e-ae0c-c6d707f52872",
          "name": "5-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-4-PENTEN-3-ONE",
          "stdName": "5-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-4-PENTEN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9406d206-647e-4dc5-a1d3-91b7c9a71a63"
          ],
          "display_name": false
        },
        {
          "uuid": "2a977d8a-fe03-4f87-ab98-61fccc1079b9",
          "name": "FEMA NO. 2712",
          "stdName": "FEMA NO. 2712",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee8ad902-ec92-41a1-99a5-acb985a771f7",
            "be675b30-e59e-4261-b8d3-225686cd5934"
          ],
          "display_name": false
        },
        {
          "uuid": "df3f5fc5-4bde-4659-ac44-f3559cdb2fca",
          "name": "METHYL-.BETA.-IONONE",
          "stdName": "METHYL-.BETA.-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4957e97-8dcc-4abe-99a4-cc8cd2cef5fe",
            "e5b43dd2-7ddb-4f61-b04b-1d6c591239b2",
            "dfb6c564-c351-45ab-ac97-a332a00f3254"
          ],
          "display_name": false
        },
        {
          "uuid": "5ded6728-d72a-4290-87e0-ba35e1baa7f7",
          "name": "METHYL-.BETA.-IONONE [FHFI]",
          "stdName": "METHYL-.BETA.-IONONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5b43dd2-7ddb-4f61-b04b-1d6c591239b2"
          ],
          "display_name": false
        },
        {
          "uuid": "f27ece22-f414-421a-95fe-aa0143fcfb72",
          "name": "METHYL-BETA-IONONE",
          "stdName": "METHYL-BETA-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30386047-60a9-4cfb-bfba-b993f477fd42"
          ],
          "display_name": false
        },
        {
          "uuid": "6a878e5c-cdad-4d71-893b-f4e73c059c2c",
          "name": "METHYLIONONE",
          "stdName": "METHYLIONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30386047-60a9-4cfb-bfba-b993f477fd42"
          ],
          "display_name": false
        },
        {
          "uuid": "9d53ef0f-c85c-4568-969a-72a9e6317045",
          "name": "NSC-163995",
          "stdName": "NSC-163995",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4957e97-8dcc-4abe-99a4-cc8cd2cef5fe"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "722850cc-da55-4dfe-b98e-4e41b5a0d5ae",
          "citation": "GRAS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ee8ad902-ec92-41a1-99a5-acb985a771f7",
          "citation": "CHEMID FEMA BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be675b30-e59e-4261-b8d3-225686cd5934",
          "citation": "CHEMID BATCH 2010",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1f5e07a-756d-4cb9-ba14-2ae3c356254c",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4957e97-8dcc-4abe-99a4-cc8cd2cef5fe",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5b43dd2-7ddb-4f61-b04b-1d6c591239b2",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30386047-60a9-4cfb-bfba-b993f477fd42",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9406d206-647e-4dc5-a1d3-91b7c9a71a63",
          "citation": "YES",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a09ad04-2770-4185-a4bf-378f8aaa69a4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390987000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f14fbe0d-6a9f-4f64-9fe4-b182c5026aa0",
          "citation": "SRS import [54PXU8D4R5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=54PXU8D4R5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390987000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30eb1244-aecd-4e1a-99a7-8c17f7be3e3c",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfb6c564-c351-45ab-ac97-a332a00f3254",
          "citation": "METHYL-.BETA.-IONONE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "25d195ef-3dfd-9f25-a927-a4d60655b53a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=127-43-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4535a332-9419-0278-428a-1030bcbc8978",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a2e86764-46d8-4685-9ba5-8b5fa2212589",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "15cda874-6c44-5beb-8237-8a813c8974e5",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "73d1fe15-4617-4898-8ed3-cafd9be60ec8",
          "id": "73d1fe15-4617-4898-8ed3-cafd9be60ec8",
          "molfile": "\n  Marvin  01132106002D          \n\n 15 15  0  0  0  0            999 V2000\n    5.0906   -3.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8049   -3.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8049   -4.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0906   -4.9181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5230   -4.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2373   -4.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9515   -4.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6658   -4.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6658   -3.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3800   -4.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3800   -5.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6658   -6.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9515   -5.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2373   -6.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1546   -5.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 13  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
          "smiles": "CCC(=O)/C=C/C1=C(C)CCCC1(C)C",
          "formula": "C14H22O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5ee39c13-dce6-4b5b-a52a-e77061357012"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "206.3244",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "90462e9e-e25c-4941-8989-c70027aaec2d",
      "version": "5",
      "structure": {
        "id": "8a865b68-a3ed-4210-800f-428c38a58f80",
        "molfile": "\n  Marvin  01132107122D          \n\n 15 15  0  0  0  0            999 V2000\n    7.9515   -4.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9515   -5.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6658   -6.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3800   -5.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3800   -4.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6658   -4.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6658   -3.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2373   -6.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1546   -5.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2373   -4.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5230   -4.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8049   -4.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8049   -3.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0906   -3.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0906   -4.9181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 12 15  2  0  0  0  0\nM  END",
        "smiles": "CCC(=O)/C=C/C1=C(C)CCCC1(C)C",
        "formula": "C14H22O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "206.3244",
        "optical_activity": "NONE",
        "references": [
          "f14fbe0d-6a9f-4f64-9fe4-b182c5026aa0",
          "30eb1244-aecd-4e1a-99a7-8c17f7be3e3c"
        ],
        "stereo_centers": 0
      },
      "unii": "54PXU8D4R5"
    }
  ]
}