{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2ed3b02f-9cfa-47d1-9d37-09d8c9616c20",
          "code": "58882-17-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58882-17-0",
          "code_system": "CAS",
          "references": [
            "ed709302-1010-4bc4-a873-8755d6dffd96",
            "5dc11d54-5be6-4529-9f90-40804c81fa14"
          ]
        },
        {
          "uuid": "f3557c88-18c4-4820-a062-876904342dd1",
          "code": "C82309",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C82309",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ed709302-1010-4bc4-a873-8755d6dffd96"
          ]
        },
        {
          "uuid": "1f48e010-b863-410f-90f6-a796905a0443",
          "code": "SUB10394MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ed709302-1010-4bc4-a873-8755d6dffd96"
          ]
        },
        {
          "uuid": "c03016fc-354e-4929-93a4-608d67fa78dc",
          "code": "6628",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6628",
          "code_system": "INN",
          "references": [
            "ed709302-1010-4bc4-a873-8755d6dffd96"
          ]
        },
        {
          "uuid": "4a92f44c-2bff-4056-9d70-a7c5e98e2381",
          "code": "261-482-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.875",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ed709302-1010-4bc4-a873-8755d6dffd96"
          ]
        },
        {
          "uuid": "c0cbba57-6f94-4ce5-93d7-a149936e575f",
          "code": "314611",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/314611/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ed709302-1010-4bc4-a873-8755d6dffd96"
          ]
        },
        {
          "uuid": "e4bbd6fd-dc6f-461c-8eab-6e25f9512fda",
          "code": "CHEMBL2105417",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2105417",
          "code_system": "ChEMBL",
          "references": [
            "ed709302-1010-4bc4-a873-8755d6dffd96"
          ]
        },
        {
          "uuid": "f099e433-141b-406a-94ad-f3666143dada",
          "code": "42865",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/42865",
          "code_system": "PUBCHEM",
          "references": [
            "ed709302-1010-4bc4-a873-8755d6dffd96"
          ]
        },
        {
          "uuid": "f5283496-84f9-6dd3-12b1-0c62a78d021f",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f47afe45-a793-fca6-1262-5e485c6acaff"
          ]
        },
        {
          "uuid": "fef7729c-9fcd-43a3-a00a-eb99ae5e8b65",
          "code": "54M9O25201",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0ba70a7f-8775-cfd1-cae0-44fac997f7d5",
          "code": "100000084384",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6924b3cb-a51b-a5aa-3be0-a375f4ea563f"
          ]
        },
        {
          "uuid": "2f434945-0377-ecb1-830f-7f9602cdc3ca",
          "code": "BB-99",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/BB-99/relevant/1/",
          "code_system": "USAN",
          "references": [
            "00a979dd-18b1-48fa-9516-7fda9690d868"
          ]
        },
        {
          "uuid": "99961e13-e7f0-3f76-9e1b-f929ec4bc5fa",
          "code": "DTXSID70866716",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70866716",
          "code_system": "EPA CompTox",
          "references": [
            "f47afe45-a793-fca6-1262-5e485c6acaff"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b3cbfc09-e102-43b9-a41d-9e1974268a52",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "afa149b9-76a2-4835-91d5-737bc2197bb0",
            "refuuid": "15a38159-4ef1-458a-b649-c4614c80cf36",
            "name": "ROXADIMATE",
            "unii": "54M9O25201",
            "linking_id": "54M9O25201",
            "ref_pname": "ROXADIMATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e9e96574-e004-42f3-9da7-9d78d9946e46",
          "name": "BENZOIC ACID, 4-(BIS(2-HYDROXYPROPYL)AMINO)-, ETHYL ESTER",
          "stdName": "BENZOIC ACID, 4-(BIS(2-HYDROXYPROPYL)AMINO)-, ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75d7d379-a6d3-4713-8d3f-0abb78ab323d",
            "439cbb0a-7e23-4364-b487-5ff86d7fd9e2"
          ],
          "display_name": false
        },
        {
          "uuid": "74677ae7-d18b-49cc-ac02-5dc88dad39e7",
          "name": "ETHYL (±)-P-(BIS(2-HYDROXYPROPYL)AMINO)BENZOATE",
          "stdName": "ETHYL (+/-)-P-(BIS(2-HYDROXYPROPYL)AMINO)BENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75d7d379-a6d3-4713-8d3f-0abb78ab323d",
            "439cbb0a-7e23-4364-b487-5ff86d7fd9e2"
          ],
          "display_name": false
        },
        {
          "uuid": "879cffaf-5243-46cb-882d-8d363abfd65d",
          "name": "ETHYL 4-(BIS(HYDROXYPROPYL)) AMINOBENZOATE",
          "stdName": "ETHYL 4-(BIS(HYDROXYPROPYL)) AMINOBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c4976fa-4f41-48e5-b4ed-a09334c6a8b4",
            "439cbb0a-7e23-4364-b487-5ff86d7fd9e2"
          ],
          "display_name": false
        },
        {
          "uuid": "ee99e894-c382-4c66-a371-ec2f4065a022",
          "name": "ETHYL 4-(BIS(HYDROXYPROPYL))AMINOBENZOATE",
          "stdName": "ETHYL 4-(BIS(HYDROXYPROPYL))AMINOBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c4976fa-4f41-48e5-b4ed-a09334c6a8b4",
            "439cbb0a-7e23-4364-b487-5ff86d7fd9e2"
          ],
          "display_name": false
        },
        {
          "uuid": "9164ec4b-3aab-48b1-ac8b-f26c9a0fff81",
          "name": "ETHYL DIHYDROXYPROPYL PABA",
          "stdName": "ETHYL DIHYDROXYPROPYL PABA",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "bea6052b-afa3-4e07-a6cb-5dabcb8c6a3c",
            "4611acd6-d3bd-4b6d-9646-fdadde32c3b0",
            "3143cb76-b6d3-43df-bd30-17949d9e01f5",
            "439cbb0a-7e23-4364-b487-5ff86d7fd9e2",
            "5b3796b3-29e5-4d8f-ad91-3c3751d6642b"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b4df6f26-6679-4b96-b55e-f7aa7344fd90",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5e0c88c7-f469-44e1-b05b-4506e2f6ee45",
          "name": "ETHYL DIHYDROXYPROPYL PABA [VANDF]",
          "stdName": "ETHYL DIHYDROXYPROPYL PABA [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4611acd6-d3bd-4b6d-9646-fdadde32c3b0",
            "439cbb0a-7e23-4364-b487-5ff86d7fd9e2"
          ],
          "display_name": false
        },
        {
          "uuid": "b3c53401-82d6-450b-ba1f-ccfc9179b9ad",
          "name": "ROXADIMATE",
          "stdName": "ROXADIMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75d7d379-a6d3-4713-8d3f-0abb78ab323d",
            "439cbb0a-7e23-4364-b487-5ff86d7fd9e2",
            "809b7dec-40aa-4833-980d-4ac055e7a864",
            "2aea33fc-66a1-4001-8a99-baad21c4a36e",
            "d8d75bb9-6f60-428c-9d46-bbb2739cad8c",
            "b66f44f5-d92c-4289-850b-266fd59daa27",
            "012d6370-d34c-4b29-baf7-508bfc2f550d",
            "f0f9597e-6f06-42fa-96ff-f191975b1fdb",
            "eccc7076-c8d3-4ee1-a53d-27c0d34fea2e",
            "68f62100-283c-4b4f-96bb-3915e93f4b7d"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "b7b04c2b-f610-4408-863d-3f0b8233f0bf",
              "name_org": "INN"
            },
            {
              "uuid": "6ec4dfd4-1d9c-470b-9afa-5e1d60d40f11",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "84d0312c-9946-4b2a-855d-292f362c516f",
          "name": "ROXADIMATE [MART.]",
          "stdName": "ROXADIMATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "809b7dec-40aa-4833-980d-4ac055e7a864"
          ],
          "display_name": false
        },
        {
          "uuid": "d7b39372-c5de-4def-89a7-2329ac9d49bb",
          "name": "ROXADIMATE [USAN]",
          "stdName": "ROXADIMATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8d75bb9-6f60-428c-9d46-bbb2739cad8c"
          ],
          "display_name": false
        },
        {
          "uuid": "c50a711e-fad9-3f9d-1cf9-1df1e442ede9",
          "name": "Roxadimate [WHO-DD]",
          "stdName": "ROXADIMATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddc1553b-f467-7537-1654-547c5e67f514"
          ],
          "display_name": false
        },
        {
          "uuid": "16710ea8-fe8a-4519-b339-1f251593cda4",
          "name": "roxadimate [INN]",
          "stdName": "ROXADIMATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b66f44f5-d92c-4289-850b-266fd59daa27"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4611acd6-d3bd-4b6d-9646-fdadde32c3b0",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "439cbb0a-7e23-4364-b487-5ff86d7fd9e2",
          "citation": "NDF-RT",
          "doc_type": "NDF-RT",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75d7d379-a6d3-4713-8d3f-0abb78ab323d",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c4976fa-4f41-48e5-b4ed-a09334c6a8b4",
          "citation": "OTC LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b66f44f5-d92c-4289-850b-266fd59daa27",
          "citation": "INN Proposed List 63",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL63.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d8d75bb9-6f60-428c-9d46-bbb2739cad8c",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "809b7dec-40aa-4833-980d-4ac055e7a864",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b3796b3-29e5-4d8f-ad91-3c3751d6642b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eccc7076-c8d3-4ee1-a53d-27c0d34fea2e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed709302-1010-4bc4-a873-8755d6dffd96",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390549000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87496165-2b52-4bde-a97b-74acc90affea",
          "citation": "SRS import [54M9O25201]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=54M9O25201",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390549000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0f9597e-6f06-42fa-96ff-f191975b1fdb",
          "citation": "ROXADIMATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2aea33fc-66a1-4001-8a99-baad21c4a36e",
          "citation": "ROXADIMATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "012d6370-d34c-4b29-baf7-508bfc2f550d",
          "citation": "ROXADIMATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3143cb76-b6d3-43df-bd30-17949d9e01f5",
          "citation": "ETHYL DIHYDROXYPROPYL PABA [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "68f62100-283c-4b4f-96bb-3915e93f4b7d",
          "citation": "ROXADIMATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bea6052b-afa3-4e07-a6cb-5dabcb8c6a3c",
          "citation": "ETHYL DIHYDROXYPROPYL PABA [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6924b3cb-a51b-a5aa-3be0-a375f4ea563f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "f47afe45-a793-fca6-1262-5e485c6acaff",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "00a979dd-18b1-48fa-9516-7fda9690d868",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "5dc11d54-5be6-4529-9f90-40804c81fa14",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ddc1553b-f467-7537-1654-547c5e67f514",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ce4cbcb9-94d7-4a40-a164-ff31a6fce0a9",
          "id": "ce4cbcb9-94d7-4a40-a164-ff31a6fce0a9",
          "molfile": "\n  Marvin  01132110392D          \n\n 20 20  0  0  0  0            999 V2000\n    9.2965   -1.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8849   -0.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0575   -0.5738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6459    0.1372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0575    0.8522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8227    0.1372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4111    0.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5837    0.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1721    0.1372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5837   -0.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4111   -0.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3489    0.1372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9373   -0.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1099   -0.5779    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.6983    0.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6983   -1.2930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9373    0.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3488    1.5633    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.9372    2.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1762    1.5633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 12  1  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)c1ccc(cc1)N(CC(C)O)CC(C)O",
          "formula": "C15H23NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "47b8ac3c-0fc3-4227-a9af-17df02153561"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "281.348",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "15a38159-4ef1-458a-b649-c4614c80cf36",
      "version": "13",
      "structure": {
        "id": "9e4770ad-3019-4e1b-9931-a66cfc76963a",
        "molfile": "\n  Marvin  01132108132D          \n\n 20 20  0  0  0  0            999 V2000\n    4.3489    0.1372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6459    0.1372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1721    0.1372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8227    0.1372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9373    0.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9373   -0.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0575    0.8522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5837    0.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5837   -0.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4111   -0.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4111    0.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0575   -0.5738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1099   -0.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3488    1.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6983   -1.2930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1762    1.5633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8849   -0.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6983    0.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9372    2.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2965   -1.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4 10  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  2  2  0  0  0  0\n  8  3  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  5  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 13  1  0  0  0  0\n 19 14  1  0  0  0  0\n 20 17  1  0  0  0  0\n 11  4  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)c1ccc(cc1)N(CC(C)O)CC(C)O",
        "formula": "C15H23NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "281.348",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "75d7d379-a6d3-4713-8d3f-0abb78ab323d",
          "87496165-2b52-4bde-a97b-74acc90affea",
          "b66f44f5-d92c-4289-850b-266fd59daa27"
        ],
        "stereo_centers": 2
      },
      "unii": "54M9O25201"
    }
  ]
}