{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d14121b3-6c3c-47fd-8689-bc7f53f1238b",
          "code": "200-496-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.451",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "1e414b0d-e52c-4bf9-97f4-882462578689",
          "code": "155",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/155/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "9777ed8b-6d35-4346-ba0a-0dff14e40ed5",
          "code": "m1303",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1303?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "cb13d270-7d63-40f9-8468-bc1babd0ea81",
          "code": "DB01614",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01614",
          "code_system": "DRUG BANK",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "0f0bcf2f-261a-43e1-b81f-ece662eabcb8",
          "code": "CHEMBL39560",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL39560",
          "code_system": "ChEMBL",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "ad0a24e0-2709-401d-b4a4-fcf996eb4aa5",
          "code": "6077",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6077",
          "code_system": "PUBCHEM",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "a84a0f4f-0f7e-4efd-92f6-6bdce598a622",
          "code": "N05AA04",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANTIPSYCHOTICS|Phenothiazines with aliphatic side-chain|acepromazine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05AA04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "1f392206-71f4-4acf-8b28-11fcae61069d",
          "code": "QN05AA04",
          "comments": "VATC|PSYCHOLEPTICS|ANTIPSYCHOTICS|Phenothiazines with aliphatic side-chain|acepromazine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05AA04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "4bc49c36-d269-46f9-9ea8-ca22c5ce2c7c",
          "code": "61-00-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=61-00-7",
          "code_system": "CAS",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8",
            "a0ae8d7e-6709-4977-bcb2-4224254d6fd4"
          ]
        },
        {
          "uuid": "2d3a67b4-7c63-4d8b-9f9e-4f067ddb1e8e",
          "code": "C77568",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77568",
          "code_system": "NCI_THESAURUS",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "8ce0b3b9-3cab-47df-9f3a-11c7c324caed",
          "code": "D000075",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68000075",
          "code_system": "MESH",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "f3197e56-8a58-4b52-99e1-3c9637ad1f1d",
          "code": "ACEPROMAZINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Acepromazine",
          "code_system": "WIKIPEDIA",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "c610d016-90ae-4c59-8b97-b5fbefc125a2",
          "code": "21 CFR 522.23",
          "comments": "PART 522 IMPLANTATION OR INJECTABLE DOSAGE FORM NEW ANIMAL DRUGS|Sec. 522.23 Acepromazine.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=522.23",
          "code_system": "CFR",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "e863e336-13e1-4cf3-a018-f7177f8d4ad2",
          "code": "SUB05213MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "7b812bb8-e01e-414b-b72b-6d8f34e0d0b0",
          "code": "667",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=667",
          "code_system": "INN",
          "references": [
            "806405de-2f58-419d-96c9-8f41a06872a8"
          ]
        },
        {
          "uuid": "a75ea7e3-5a4f-9ddb-41d6-7dc556ee635c",
          "code": "DTXSID1022552",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1022552",
          "code_system": "EPA CompTox",
          "references": [
            "c332f7c4-911a-88e0-4abb-c9db2867158d"
          ]
        },
        {
          "uuid": "aba78b3a-fec9-3fbe-12c9-8322cf53ddaa",
          "code": "C66883",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Dopamine Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66883",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c56a2963-ed62-d50e-3ce1-8c02f0177fc1"
          ]
        },
        {
          "uuid": "48b89a49-1d8a-4c6e-9ee3-28fb30c79f96",
          "code": "54EJ303F0R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "306d8c89-8f7a-0a87-58a3-54a85b0b4867",
          "code": "73",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/73",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c56a2963-ed62-d50e-3ce1-8c02f0177fc1"
          ]
        },
        {
          "uuid": "728ec326-b416-ca37-3068-f6a18067fb1d",
          "code": "44932",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:44932",
          "code_system": "CHEBI",
          "references": [
            "c56a2963-ed62-d50e-3ce1-8c02f0177fc1"
          ]
        },
        {
          "uuid": "ae7d311f-42f9-6439-a9e1-5609ac09996d",
          "code": "100000087916",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1c580cef-90a1-37e4-cc8a-7def5b320551"
          ]
        },
        {
          "uuid": "1d547ab4-4665-5819-1896-987c4fe62d52",
          "code": "54EJ303F0R",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=54EJ303F0R",
          "code_system": "DAILYMED",
          "references": [
            "ee34b74f-b7af-b694-6ce1-722c5c388b66"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "31a27188-69fd-4794-922e-f01acfb0b1c7",
          "amount": {
            "uuid": "2cee4cb1-87be-4037-ab97-3969787248dc"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "15d28a63-c773-4718-84a0-ab8ff3d29d61",
            "refuuid": "a6813f76-45ad-4c49-80e7-5a414d9a4691",
            "name": "ACEPROMAZINE",
            "unii": "54EJ303F0R",
            "linking_id": "54EJ303F0R",
            "ref_pname": "ACEPROMAZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4a8b0d0d-59be-429d-b962-561b71999782",
          "amount": {
            "uuid": "84e2299e-3cac-4879-9501-593463720da8"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "efa9d0c2-93b5-4fe3-9d7e-b6f6388476c2",
            "refuuid": "98cbf175-c24b-486c-af6c-c42c6d0c2380",
            "name": "ACEPROMAZINE MALEATE",
            "unii": "37862HP2OM",
            "linking_id": "37862HP2OM",
            "ref_pname": "ACEPROMAZINE MALEATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "de24dced-cfe0-424c-961e-e9e941677c27",
          "amount": {
            "uuid": "8465e7dc-a642-4737-b2f1-4402134ec205"
          },
          "comments": "Increased sedation seen in dogs with the ABCB1-1Δ mutation.",
          "type": "TRANSPORTER->SUBSTRATE",
          "references": [
            "59841da3-0c91-4d37-99d5-efda1cfc0e3c"
          ],
          "related_substance": {
            "uuid": "7449f0ef-4a19-4471-a879-2fd6c0b36219",
            "refuuid": "ac3a9662-0cc6-4abc-adb0-424142912a99",
            "name": "ATP-dependent translocase ABCB1 (Canis lupus familiaris)",
            "unii": "XBG3W2GCL2",
            "linking_id": "XBG3W2GCL2",
            "ref_pname": "ATP-dependent translocase ABCB1 (Canis lupus familiaris)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "acd55469-c1d7-4882-9638-63f431833ec6",
          "amount": {
            "uuid": "2f678c04-c0ff-4801-bbf0-eda0cc2fc283",
            "low": 10
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "8934436d-7371-9066-2e1b-a63d93972196"
          ],
          "related_substance": {
            "uuid": "ca396854-3db8-488f-947e-94d8396c0ca0",
            "refuuid": "9bfef87f-df60-4cc3-a78f-4a9ab1339e24",
            "name": "5-HYDROXYTRYPTAMINE RECEPTOR 1A",
            "unii": "UKK18ES9TF",
            "linking_id": "UKK18ES9TF",
            "ref_pname": "5-HYDROXYTRYPTAMINE RECEPTOR 1A",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2959dc29-97d9-4752-890f-79ffd1afced1",
          "amount": {
            "uuid": "a398fd5e-0cd2-4dbf-8216-64bd907bf705"
          },
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "2376dfe1-1c49-4804-acdb-2eba928694c2",
            "refuuid": "d78d31c8-4aa9-4058-b1bc-4b11d2e862e3",
            "name": "5-HYDROXYTRYPTAMINE RECEPTOR 2A",
            "unii": "NQI5D806LC",
            "linking_id": "NQI5D806LC",
            "ref_pname": "5-HYDROXYTRYPTAMINE RECEPTOR 2A"
          }
        },
        {
          "uuid": "5ca13b98-dd79-48fd-8e4c-d357b6dd0b48",
          "amount": {
            "uuid": "3cbdcc12-8154-4760-9794-d592abee73f9"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "8934436d-7371-9066-2e1b-a63d93972196"
          ],
          "related_substance": {
            "uuid": "0ebe08d4-a8d0-4ea4-ba98-50f8358fe659",
            "refuuid": "8a5e8a47-f550-4902-8d11-e0aa6920db0b",
            "name": "D(2) DOPAMINE RECEPTOR",
            "unii": "19GBD6T9L7",
            "linking_id": "19GBD6T9L7",
            "ref_pname": "D(2) DOPAMINE RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d1908e39-cf1d-48b3-899a-c83c14b75e69",
          "amount": {
            "uuid": "1c08fa00-4794-4e52-b052-f19079ccb0b2"
          },
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "b31505d3-6be2-47cd-80cf-6aba66ad14bf",
            "refuuid": "84edf12e-87a3-43e0-8526-ad45513dcd09",
            "name": "D(1A) DOPAMINE RECEPTOR",
            "unii": "54202V7DRJ",
            "linking_id": "54202V7DRJ",
            "ref_pname": "D(1A) DOPAMINE RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0015b82b-a7bf-4c34-9861-efdce3d6dac2",
          "amount": {
            "uuid": "858a9db7-1736-45a1-b0d8-dd26102863df"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "462f05df-32a6-414e-8f72-bb3c8e2e6b3a",
            "refuuid": "f386e954-6128-404d-9d70-c1671215b52a",
            "name": "Acepromazine hydrochloride",
            "unii": "2P2K7C8D3K",
            "linking_id": "2P2K7C8D3K",
            "ref_pname": "Acepromazine hydrochloride",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bc6782d0-0e43-4dd0-a895-87d43a15c693",
          "name": "10-(3-(DIMETHYLAMINO)PROPYL)PHENOTHIAZIN-2-YL METHYL KETONE",
          "stdName": "10-(3-(DIMETHYLAMINO)PROPYL)PHENOTHIAZIN-2-YL METHYL KETONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93275485-ce58-4925-a8ec-a9bdf29729da"
          ],
          "display_name": false
        },
        {
          "uuid": "eadceee9-07a4-4dfa-b96d-4d9b1aea61c8",
          "name": "ACE",
          "stdName": "ACE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6228c03e-098c-4e60-848c-8fda3246f0fd",
            "e1c9b874-2b74-4faf-b837-360eb021c508"
          ],
          "display_name": false
        },
        {
          "uuid": "752725ac-a5fd-4b94-a008-444b9a3d1a09",
          "name": "ACEPROMAZINE",
          "stdName": "ACEPROMAZINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93275485-ce58-4925-a8ec-a9bdf29729da",
            "aa7681fa-a092-4915-ad14-6a1b3ef071ed",
            "e1c9b874-2b74-4faf-b837-360eb021c508",
            "1b09c0b3-86fe-4a01-ba66-fb79dbcdc581",
            "1c6308c5-031e-495f-9bfd-50a49f3a0e9a",
            "ac33a4a5-f8ad-4ae7-8d5b-52fb636a11f8",
            "10bcc192-e68e-407c-8487-f18c0f2cd088",
            "9ffd85ee-60b7-4e34-aa41-b93ca126f093",
            "52886f97-2dcf-49b2-bc82-c4a1039892ef",
            "d12e82e6-f3a5-480d-9a79-f4d6a8aa8392"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f8788726-8852-4e35-bad8-ca4deeccb621",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "8f0551bd-60b1-4ee5-ba3c-ddd7bddf46e3",
          "name": "ACEPROMAZINE [MART.]",
          "stdName": "ACEPROMAZINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b09c0b3-86fe-4a01-ba66-fb79dbcdc581"
          ],
          "display_name": false
        },
        {
          "uuid": "5cf7b7b3-7c98-4d47-947e-5be18bb0d186",
          "name": "ACEPROMAZINE [MI]",
          "stdName": "ACEPROMAZINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1c9b874-2b74-4faf-b837-360eb021c508",
            "9ffd85ee-60b7-4e34-aa41-b93ca126f093"
          ],
          "display_name": false
        },
        {
          "uuid": "97a30575-57f5-4f5f-95bc-e0ca10012c28",
          "name": "ACETYLPROMAZINE",
          "stdName": "ACETYLPROMAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6228c03e-098c-4e60-848c-8fda3246f0fd",
            "e1c9b874-2b74-4faf-b837-360eb021c508"
          ],
          "display_name": false
        },
        {
          "uuid": "91a9e6a1-ed33-4231-8dfa-7bc9d78a2cd1",
          "name": "ACEZINE 2",
          "stdName": "ACEZINE 2",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6228c03e-098c-4e60-848c-8fda3246f0fd",
            "e1c9b874-2b74-4faf-b837-360eb021c508"
          ],
          "display_name": false
        },
        {
          "uuid": "e312e578-81a5-437d-8372-75b4915d7ff0",
          "name": "ACP",
          "stdName": "ACP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6228c03e-098c-4e60-848c-8fda3246f0fd",
            "e1c9b874-2b74-4faf-b837-360eb021c508"
          ],
          "display_name": false
        },
        {
          "uuid": "010efb82-5305-421d-8a2d-5cf9d541f10d",
          "name": "ATRAVET",
          "stdName": "ATRAVET",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6228c03e-098c-4e60-848c-8fda3246f0fd",
            "e1c9b874-2b74-4faf-b837-360eb021c508"
          ],
          "display_name": false
        },
        {
          "uuid": "f72accc1-4a5b-ebdd-c2ba-d1296e15dace",
          "name": "Acepromazine [WHO-DD]",
          "stdName": "ACEPROMAZINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb208898-dd66-cb1a-d84f-786adb674c27"
          ],
          "display_name": false
        },
        {
          "uuid": "4eb56fe0-fbb6-4ef4-bed3-7591660b9fe4",
          "name": "CONCENTRAT VO34",
          "stdName": "CONCENTRAT VO34",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a562fdac-4f78-46c0-bfb0-613687ba8b94",
            "20061fac-f60c-4ee1-b2fa-838c5d6ff868"
          ],
          "display_name": false
        },
        {
          "uuid": "59c5fd19-2d3a-4db9-a975-9070746209c7",
          "name": "ETHANONE, 1-(10-(3-(DIMETHYLAMINO)PROPYL)-10H-PHENOTHIAZIN-2-YL)-",
          "stdName": "ETHANONE, 1-(10-(3-(DIMETHYLAMINO)PROPYL)-10H-PHENOTHIAZIN-2-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93275485-ce58-4925-a8ec-a9bdf29729da"
          ],
          "display_name": false
        },
        {
          "uuid": "78e7514c-6f45-4cfe-a71f-9e801cfee7d7",
          "name": "acepromazine [INN]",
          "stdName": "ACEPROMAZINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10bcc192-e68e-407c-8487-f18c0f2cd088"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "93275485-ce58-4925-a8ec-a9bdf29729da",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "10bcc192-e68e-407c-8487-f18c0f2cd088",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b09c0b3-86fe-4a01-ba66-fb79dbcdc581",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ffd85ee-60b7-4e34-aa41-b93ca126f093",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1c9b874-2b74-4faf-b837-360eb021c508",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20061fac-f60c-4ee1-b2fa-838c5d6ff868",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a562fdac-4f78-46c0-bfb0-613687ba8b94",
          "citation": "D07065",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6228c03e-098c-4e60-848c-8fda3246f0fd",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa7681fa-a092-4915-ad14-6a1b3ef071ed",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "806405de-2f58-419d-96c9-8f41a06872a8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390811000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc904c8d-fae4-4c0b-b0a6-b591f4191141",
          "citation": "SRS import [54EJ303F0R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=54EJ303F0R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390811000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d12e82e6-f3a5-480d-9a79-f4d6a8aa8392",
          "citation": "ACEPROMAZINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c6308c5-031e-495f-9bfd-50a49f3a0e9a",
          "citation": "ACEPROMAZINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "52886f97-2dcf-49b2-bc82-c4a1039892ef",
          "citation": "ACEPROMAZINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ac33a4a5-f8ad-4ae7-8d5b-52fb636a11f8",
          "citation": "ACEPROMAZINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c332f7c4-911a-88e0-4abb-c9db2867158d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=61-00-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8934436d-7371-9066-2e1b-a63d93972196",
          "citation": "https://www.drugbank.ca/drugs/DB01614",
          "doc_type": "WEBSITE",
          "public_domain": true
        },
        {
          "uuid": "1c580cef-90a1-37e4-cc8a-7def5b320551",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c56a2963-ed62-d50e-3ce1-8c02f0177fc1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a0ae8d7e-6709-4977-bcb2-4224254d6fd4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ee34b74f-b7af-b694-6ce1-722c5c388b66",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "bb208898-dd66-cb1a-d84f-786adb674c27",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "59841da3-0c91-4d37-99d5-efda1cfc0e3c",
          "citation": "Deshpande, D., et al. \"The effect of the canine ABCB1‐1Δ mutation on sedation after intravenous administration of acepromazine.\" Journal of veterinary internal medicine 30.2 (2016): 636-641.",
          "url": "https://onlinelibrary.wiley.com/doi/full/10.1111/jvim.13827",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2c3c3aab-4e84-4a46-a42c-531adcedb923",
          "id": "2c3c3aab-4e84-4a46-a42c-531adcedb923",
          "molfile": "\n  Marvin  01132102232D          \n\n 23 25  0  0  0  0            999 V2000\n    5.4155    2.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4155    1.2698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1444    0.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6902    0.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6902    0.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9614   -0.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9614   -1.2513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2431   -1.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5283   -1.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8065   -1.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8065   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5283   -2.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2431   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9614   -2.8781    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6832   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3980   -2.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1162   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1162   -1.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3980   -1.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6832   -1.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8839   -1.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6796   -1.6246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8733   -0.4168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 20  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 20 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 18 21  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)c1ccc2c(c1)N(CCCN(C)C)c3ccccc3S2",
          "formula": "C19H22N2OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3fd412c7-02fd-4240-bc55-c054835b2936"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "326.4576",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a6813f76-45ad-4c49-80e7-5a414d9a4691",
      "version": "21",
      "structure": {
        "id": "9435f1b8-acdd-4663-a3b8-44455a78dd24",
        "molfile": "\n  Marvin  01132107412D          \n\n 23 25  0  0  0  0            999 V2000\n    4.6832   -1.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9614   -1.2513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6832   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3980   -1.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2431   -1.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9614   -0.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9614   -2.8781    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3980   -2.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1162   -1.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2431   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5283   -1.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6902    0.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1162   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8839   -1.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5283   -2.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8065   -1.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6902    0.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6796   -1.6246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8733   -0.4168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8065   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4155    1.2698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4155    2.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1444    0.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5 10  2  0  0  0  0\n  5 11  1  0  0  0  0\n  6 12  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 14  1  0  0  0  0\n 10 15  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 17  1  0  0  0  0\n 14 18  1  0  0  0  0\n 14 19  2  0  0  0  0\n 15 20  2  0  0  0  0\n 17 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n  7 10  1  0  0  0  0\n  9 13  1  0  0  0  0\n 16 20  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)c1ccc2c(c1)N(CCCN(C)C)c3ccccc3S2",
        "formula": "C19H22N2OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "326.4576",
        "optical_activity": "NONE",
        "references": [
          "93275485-ce58-4925-a8ec-a9bdf29729da",
          "cc904c8d-fae4-4c0b-b0a6-b591f4191141",
          "10bcc192-e68e-407c-8487-f18c0f2cd088"
        ],
        "stereo_centers": 0
      },
      "unii": "54EJ303F0R"
    }
  ]
}