{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "66ad4b3d-1c67-4571-9686-7658156ab248",
          "code": "B01AA10",
          "comments": "ATC|BLOOD AND BLOOD FORMING ORGANS|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Vitamin K antagonists|diphenadione",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=B01AA10&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "a69157bf-a426-4e64-a03d-c083fe802ccf",
          "code": "QB01AA10",
          "comments": "VATC|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Vitamin K antagonists|diphenadione",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QB01AA10&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "5ec36351-e561-4e4f-9554-a9ca7afbaff3",
          "code": "82-66-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=82-66-6",
          "code_system": "CAS",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396",
            "7601007c-25a2-4fea-8cdd-653adcf97bb9"
          ]
        },
        {
          "uuid": "c06eac4f-f4cc-43db-88d7-924ae71d43d3",
          "code": "C75156",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75156",
          "code_system": "NCI_THESAURUS",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "66bb8a54-cb70-4fe3-9573-2d6a85fed62e",
          "code": "C100262",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67100262",
          "code_system": "MESH",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "55ded9cc-0e4d-439e-8b65-54171d3d79df",
          "code": "DIPHENADIONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diphenadione",
          "code_system": "WIKIPEDIA",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "b8397746-36a0-4f92-bc10-beb006347789",
          "code": "SUB07209MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "bce0d53c-32d8-42a9-a980-09828a28fa9a",
          "code": "67701",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2186",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "6f12f93b-0545-4e35-b9b8-29662d8a7b96",
          "code": "557",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=557",
          "code_system": "INN",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "aad49229-4878-4fa1-bc24-aa8c55db3088",
          "code": "m4605",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4605?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "91d798ae-9725-4407-88fc-db0b233850a1",
          "code": "CHEMBL1413199",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1413199",
          "code_system": "ChEMBL",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "7aec7220-d917-4ee9-ae6f-36f8709be940",
          "code": "201-434-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.304",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "3c759073-b571-40e4-b9a5-991ab6ba4643",
          "code": "6719",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6719",
          "code_system": "PUBCHEM",
          "references": [
            "86df574a-4025-4c56-bd83-b8cb8d3fd396"
          ]
        },
        {
          "uuid": "09b65527-bf3f-d2f8-e7a4-375c263bedf1",
          "code": "2788",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2788",
          "code_system": "HSDB",
          "references": [
            "07387738-8e18-a546-83bf-d038f75172f3"
          ]
        },
        {
          "uuid": "7358b8eb-d37d-657a-3325-a0461861e96f",
          "code": "DTXSID4032378",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4032378",
          "code_system": "EPA CompTox",
          "references": [
            "1d99704a-8463-507a-0bd9-77e18c5d0aac"
          ]
        },
        {
          "uuid": "e66f3b28-db41-b526-672f-ba6eeb096573",
          "code": "C263",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Anticoagulant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C263",
          "code_system": "NCI_THESAURUS",
          "references": [
            "60e15435-8497-188d-21e3-d9e02236a717"
          ]
        },
        {
          "uuid": "25e28080-9471-4db7-9c51-4765dde79629",
          "code": "54CA01C6JX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6b545eb7-d392-23c3-6573-7a53d2882d84",
          "code": "4450",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4450",
          "code_system": "DRUG CENTRAL",
          "references": [
            "60e15435-8497-188d-21e3-d9e02236a717"
          ]
        },
        {
          "uuid": "da5e2191-8435-bfe5-eb60-c7fa93bf0eec",
          "code": "DB13347",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13347",
          "code_system": "DRUG BANK",
          "references": [
            "60e15435-8497-188d-21e3-d9e02236a717"
          ]
        },
        {
          "uuid": "55d13f10-5796-2b8d-254a-3e031eb8431d",
          "code": "100000082897",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "eb0a8e34-8d32-d6ec-4871-51acfe24cecb"
          ]
        },
        {
          "uuid": "9bec977f-8a30-ada9-5958-9d7714a44202",
          "code": "9138",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9138",
          "code_system": "NSC",
          "references": [
            "b8e5436f-b8b9-8975-edfe-551971d889f4"
          ]
        },
        {
          "uuid": "689bd372-170b-0614-bba2-74123bc48176",
          "code": "diphacinone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/diphacinone.html",
          "code_system": "ALANWOOD",
          "references": [
            "aac54c16-bc35-2fcb-6ece-7d5a72332f6c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ea0c4675-aedf-419e-8abd-d46e2485a486",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "754a65e4-5ad6-426f-bdc0-7f8488992129",
            "refuuid": "50b02524-bad6-49db-8198-cb6aadb9c228",
            "name": "DIPHENADIONE",
            "unii": "54CA01C6JX",
            "linking_id": "54CA01C6JX",
            "ref_pname": "DIPHENADIONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4d694a75-94b3-4502-8f59-33dbff77c6bd",
          "name": "1,3-INDANDIONE, 2-(DIPHENYLACETYL)-",
          "stdName": "1,3-INDANDIONE, 2-(DIPHENYLACETYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "794cb6c2-dade-4585-b96a-8bb0e1b4b420",
            "bb0c3ce6-f366-4f89-8ce1-1e582bf0b925"
          ],
          "display_name": false
        },
        {
          "uuid": "5c902a2a-208f-4f9c-a65e-b4a8683f107a",
          "name": "1H-INDENE-1,3-(2H)-DIONE, 2-(DIPHENYLACETYL)-",
          "stdName": "1H-INDENE-1,3-(2H)-DIONE, 2-(DIPHENYLACETYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "051fbbb6-544c-44be-8021-5dae947b88ec"
          ],
          "display_name": false
        },
        {
          "uuid": "b8c927d1-f33f-4326-a982-0eb8b3e740e6",
          "name": "2-(DIPHENYLACETYL)-1H-INDENE-1,3(2H)-DIONE",
          "stdName": "2-(DIPHENYLACETYL)-1H-INDENE-1,3(2H)-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "219e62f1-d60e-481a-b760-93ee12eb7bab",
            "d0f95a5a-c7fd-40ae-91ea-a78a251bc9ed"
          ],
          "display_name": false
        },
        {
          "uuid": "14ea50e6-588f-42b2-9e08-54cc3e972cc8",
          "name": "2-(DIPHENYLACETYL)INDAN-1,3-DIONE",
          "stdName": "2-(DIPHENYLACETYL)INDAN-1,3-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "219e62f1-d60e-481a-b760-93ee12eb7bab",
            "1888760a-c2b9-4958-89e2-10362dfb90cd"
          ],
          "display_name": false
        },
        {
          "uuid": "50495be7-4aa7-43a6-a384-d832b35bf789",
          "name": "2-(Diphenylacetyl)-1,3-indandione",
          "stdName": "2-(DIPHENYLACETYL)-1,3-INDANDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "051fbbb6-544c-44be-8021-5dae947b88ec"
          ],
          "display_name": false
        },
        {
          "uuid": "e7225c7b-fed4-4ac5-bb4d-ea18833860cf",
          "name": "DIDANDIN",
          "stdName": "DIDANDIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "794cb6c2-dade-4585-b96a-8bb0e1b4b420",
            "bb0c3ce6-f366-4f89-8ce1-1e582bf0b925"
          ],
          "display_name": false
        },
        {
          "uuid": "075d18de-a5cf-43a3-a17a-6c7e5d8b9262",
          "name": "DIFENADIONE",
          "stdName": "DIFENADIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "794cb6c2-dade-4585-b96a-8bb0e1b4b420",
            "bb0c3ce6-f366-4f89-8ce1-1e582bf0b925"
          ],
          "display_name": false
        },
        {
          "uuid": "2a14228c-9503-4ec9-8d55-7a7fefea06ce",
          "name": "DIPHACINONE",
          "stdName": "DIPHACINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd17b03e-c7df-4189-a0ba-702cd54b0a42",
            "794cb6c2-dade-4585-b96a-8bb0e1b4b420",
            "5e7f2fdb-7e6c-4c43-97ee-b3a63b832e6c",
            "3ca38090-7f06-487e-ae89-a657c32a0d65",
            "a74a4058-6516-456a-9133-11c8140411d5",
            "bb0c3ce6-f366-4f89-8ce1-1e582bf0b925",
            "a0716883-5971-4163-a71a-0881332a6155"
          ],
          "display_name": false
        },
        {
          "uuid": "716a4777-f551-4d31-b271-a3223691b41e",
          "name": "DIPHACINONE [ISO]",
          "stdName": "DIPHACINONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a74a4058-6516-456a-9133-11c8140411d5",
            "5e7f2fdb-7e6c-4c43-97ee-b3a63b832e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "633f94db-77cd-40b7-b59d-2aa2e3f05e69",
          "name": "DIPHACINONE [MI]",
          "stdName": "DIPHACINONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e7f2fdb-7e6c-4c43-97ee-b3a63b832e6c",
            "a0716883-5971-4163-a71a-0881332a6155"
          ],
          "display_name": false
        },
        {
          "uuid": "3abe8c58-ae5c-4880-8ddf-11b23492b10e",
          "name": "DIPHENADIONE",
          "stdName": "DIPHENADIONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d82f70fe-5aea-4260-a5f7-3b33e71d2b3a",
            "8ff00efa-857d-4c29-a4e1-d870cf14d589",
            "5e7f2fdb-7e6c-4c43-97ee-b3a63b832e6c",
            "3c140d15-c71d-4360-ab78-1ed1eda61f56",
            "1153b770-7abc-468e-8d4c-783ce561fe74",
            "77dff235-782c-414c-8ec1-77062d4ea5dd",
            "051fbbb6-544c-44be-8021-5dae947b88ec",
            "daa1e1f3-044b-4318-9638-76de9e717aa8",
            "682251be-654e-4446-83e6-c32ef4637058",
            "220ff26c-5b49-481d-9e97-01f10f773f84"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "eaf7f693-9e65-4f86-ba05-3813370e32f3",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "f14c597c-84ef-4503-b1d7-048f9f1a330e",
          "name": "DIPHENADIONE [HSDB]",
          "stdName": "DIPHENADIONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e7f2fdb-7e6c-4c43-97ee-b3a63b832e6c",
            "1153b770-7abc-468e-8d4c-783ce561fe74"
          ],
          "display_name": false
        },
        {
          "uuid": "a57107ae-b83e-4f4e-8360-fb47db8e3c56",
          "name": "DIPHENADIONE [MART.]",
          "stdName": "DIPHENADIONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c140d15-c71d-4360-ab78-1ed1eda61f56"
          ],
          "display_name": false
        },
        {
          "uuid": "8a4ad6ee-9cfa-4946-8718-580e92ac6976",
          "name": "DIPHENYLACETYLINDANDIONE",
          "stdName": "DIPHENYLACETYLINDANDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "794cb6c2-dade-4585-b96a-8bb0e1b4b420"
          ],
          "display_name": false
        },
        {
          "uuid": "beab7eff-671c-ac24-2c37-a778a1d2a9ab",
          "name": "Diphenadione [WHO-DD]",
          "stdName": "DIPHENADIONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18e81f01-0a4c-de74-f816-305e204e9b41"
          ],
          "display_name": false
        },
        {
          "uuid": "e105b2e7-cf6c-4f81-a77f-1780be9fa2f5",
          "name": "NCI-9138",
          "stdName": "NCI-9138",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "794cb6c2-dade-4585-b96a-8bb0e1b4b420",
            "5e7f2fdb-7e6c-4c43-97ee-b3a63b832e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "ff2f2c29-3db0-426b-8d36-532ea0101dee",
          "name": "NSC-9138",
          "stdName": "NSC-9138",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "794cb6c2-dade-4585-b96a-8bb0e1b4b420",
            "bb0c3ce6-f366-4f89-8ce1-1e582bf0b925"
          ],
          "display_name": false
        },
        {
          "uuid": "0608984f-9929-487a-b492-cf89861b9c8f",
          "name": "U-1363",
          "stdName": "U-1363",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "794cb6c2-dade-4585-b96a-8bb0e1b4b420",
            "5e7f2fdb-7e6c-4c43-97ee-b3a63b832e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "2339d5d5-f47a-4d9a-ab10-a7a5cf284aa2",
          "name": "diphenadione [INN]",
          "stdName": "DIPHENADIONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "daa1e1f3-044b-4318-9638-76de9e717aa8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "051fbbb6-544c-44be-8021-5dae947b88ec",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "794cb6c2-dade-4585-b96a-8bb0e1b4b420",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb0c3ce6-f366-4f89-8ce1-1e582bf0b925",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "219e62f1-d60e-481a-b760-93ee12eb7bab",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1888760a-c2b9-4958-89e2-10362dfb90cd",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0f95a5a-c7fd-40ae-91ea-a78a251bc9ed",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "daa1e1f3-044b-4318-9638-76de9e717aa8",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3c140d15-c71d-4360-ab78-1ed1eda61f56",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0716883-5971-4163-a71a-0881332a6155",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e7f2fdb-7e6c-4c43-97ee-b3a63b832e6c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1153b770-7abc-468e-8d4c-783ce561fe74",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77dff235-782c-414c-8ec1-77062d4ea5dd",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a74a4058-6516-456a-9133-11c8140411d5",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86df574a-4025-4c56-bd83-b8cb8d3fd396",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ed0fc4a-4e3e-4a6f-a2dd-572112693e21",
          "citation": "SRS import [54CA01C6JX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=54CA01C6JX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac5c29f0-f65e-4ad0-af58-251e9e2031e4",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "682251be-654e-4446-83e6-c32ef4637058",
          "citation": "DIPHENADIONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d82f70fe-5aea-4260-a5f7-3b33e71d2b3a",
          "citation": "DIPHENADIONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3ca38090-7f06-487e-ae89-a657c32a0d65",
          "citation": "DIPHACINONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "220ff26c-5b49-481d-9e97-01f10f773f84",
          "citation": "DIPHENADIONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8ff00efa-857d-4c29-a4e1-d870cf14d589",
          "citation": "DIPHENADIONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dd17b03e-c7df-4189-a0ba-702cd54b0a42",
          "citation": "DIPHACINONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "07387738-8e18-a546-83bf-d038f75172f3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+82-66-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d99704a-8463-507a-0bd9-77e18c5d0aac",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=82-66-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eb0a8e34-8d32-d6ec-4871-51acfe24cecb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "60e15435-8497-188d-21e3-d9e02236a717",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7601007c-25a2-4fea-8cdd-653adcf97bb9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "aac54c16-bc35-2fcb-6ece-7d5a72332f6c",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "b8e5436f-b8b9-8975-edfe-551971d889f4",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "18e81f01-0a4c-de74-f816-305e204e9b41",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "251356f4-d61c-4b69-86d3-07558d4444ca",
          "id": "251356f4-d61c-4b69-86d3-07558d4444ca",
          "molfile": "\n  Marvin  01132102042D          \n\n 26 29  0  0  0  0            999 V2000\n    3.2470   -2.6557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4424   -3.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7457   -3.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0310   -3.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0387   -2.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3292   -2.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5939   -2.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6042   -3.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3137   -3.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7560   -4.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0619   -5.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0593   -6.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7843   -6.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4964   -6.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4810   -5.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1880   -3.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6688   -2.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4194   -1.9693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4529   -2.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1701   -2.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8823   -2.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8797   -3.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1650   -4.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4529   -3.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6739   -4.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4219   -4.8539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2 16  1  0  0  0  0\n  4  3  1  0  0  0  0\n 10  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 25 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 24 19  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  2  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(c2ccccc2)C(=O)C3C(=O)c4ccccc4C3=O",
          "formula": "C23H16O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fc0539c1-1073-4284-bd9d-5b450425aeac"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "340.3722",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "50b02524-bad6-49db-8198-cb6aadb9c228",
      "version": "14",
      "structure": {
        "id": "cdf7e965-4630-401a-8f28-8d566d52d14d",
        "molfile": "\n  Marvin  01132110382D          \n\n 26 29  0  0  0  0            999 V2000\n    4.1880   -3.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6688   -2.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6739   -4.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4424   -3.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4529   -2.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4529   -3.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7457   -3.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4194   -1.9693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4219   -4.8539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2470   -2.6557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0310   -3.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7560   -4.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1650   -4.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1701   -2.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3137   -3.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0387   -2.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0619   -5.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4810   -5.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8823   -2.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8797   -3.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3292   -2.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0593   -6.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4964   -6.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6042   -3.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5939   -2.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7843   -6.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  2  2  0  0  0  0\n  9  3  2  0  0  0  0\n 10  4  2  0  0  0  0\n 11  7  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  5  1  0  0  0  0\n 15 11  1  0  0  0  0\n 16 11  2  0  0  0  0\n 17 12  2  0  0  0  0\n 18 12  1  0  0  0  0\n 19 14  2  0  0  0  0\n 20 13  2  0  0  0  0\n 21 16  1  0  0  0  0\n 22 17  1  0  0  0  0\n 23 18  2  0  0  0  0\n 24 15  2  0  0  0  0\n 25 21  2  0  0  0  0\n 26 23  1  0  0  0  0\n  6  5  2  0  0  0  0\n 20 19  1  0  0  0  0\n 26 22  2  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(c2ccccc2)C(=O)C3C(=O)c4ccccc4C3=O",
        "formula": "C23H16O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "340.3722",
        "optical_activity": "NONE",
        "references": [
          "1ed0fc4a-4e3e-4a6f-a2dd-572112693e21",
          "ac5c29f0-f65e-4ad0-af58-251e9e2031e4",
          "daa1e1f3-044b-4318-9638-76de9e717aa8"
        ],
        "stereo_centers": 0
      },
      "unii": "54CA01C6JX"
    }
  ]
}