{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6802f91a-de51-4fee-b028-81edb3e371cb",
          "code": "205-829-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.301",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3e42fcc0-88f8-4f30-b434-9f6fefafdb36"
          ]
        },
        {
          "uuid": "49d80046-87cd-40e3-9c7b-0e1f0c0f2e9b",
          "code": "154-58-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=154-58-5",
          "code_system": "CAS",
          "references": [
            "3e42fcc0-88f8-4f30-b434-9f6fefafdb36",
            "137b0321-d530-4999-a9c4-5db8e375a611"
          ]
        },
        {
          "uuid": "28945126-2722-448d-8fe5-13b5083d5c4f",
          "code": "64960",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/64960",
          "code_system": "PUBCHEM",
          "references": [
            "3e42fcc0-88f8-4f30-b434-9f6fefafdb36"
          ]
        },
        {
          "uuid": "c0e5cd28-0148-49c3-229f-ad93b93d8239",
          "code": "53835-5",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|1,5-Anhydroglucitol [Mass/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/53835-5/",
          "code_system": "LOINC",
          "references": [
            "d5622dea-f871-05c4-6e31-dc917a5884bb"
          ]
        },
        {
          "uuid": "7c95793f-9816-4706-88fe-5b86ed738a89",
          "code": "54BB3B7XMZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8e2530bc-69f8-5cc3-2338-1d05ba60a342",
          "code": "16070",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16070",
          "code_system": "CHEBI",
          "references": [
            "d5622dea-f871-05c4-6e31-dc917a5884bb"
          ]
        },
        {
          "uuid": "d18b9887-44dc-2c1f-329f-c1d161694a78",
          "code": "1,5-Anhydroglucitol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/1,5-Anhydroglucitol",
          "code_system": "WIKIPEDIA",
          "references": [
            "38d29261-d537-ea74-9a58-233b5fa62c58"
          ]
        },
        {
          "uuid": "1e4a2988-de79-5f51-2e0e-3c8dce056b3d",
          "code": "DTXSID60893379",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60893379",
          "code_system": "EPA CompTox",
          "references": [
            "d5622dea-f871-05c4-6e31-dc917a5884bb"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "5fb308cb-e491-446c-8161-ae58dcc6c47d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1d76983e-2c33-43c7-bd6a-c813993d1321",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e42fcc0-88f8-4f30-b434-9f6fefafdb36",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393302000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "453f9bf5-42b1-44d4-a5fa-ab49abf8cb38",
          "citation": "SRS import [54BB3B7XMZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=54BB3B7XMZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393302000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5622dea-f871-05c4-6e31-dc917a5884bb",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "137b0321-d530-4999-a9c4-5db8e375a611",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "38d29261-d537-ea74-9a58-233b5fa62c58",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f067d53a-c117-4eec-901b-ae7f643e7110",
          "id": "f067d53a-c117-4eec-901b-ae7f643e7110",
          "molfile": "\n  Marvin  01132112282D          \n\n 11 11  0  0  1  0            999 V2000\n    8.0239  -11.2234    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.7399  -11.6360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0239  -10.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3125   -9.9858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5966  -10.3984    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.8805   -9.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1645  -10.3984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5966  -11.2234    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.8805  -11.6360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3125  -11.6360    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.3125  -12.4610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  1  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@H]([C@@H]([C@H](CO1)O)O)O)O",
          "formula": "C6H12O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3a755699-881b-4847-b959-4292f07b366b"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "164.1567",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b955f357-ca6d-4a8c-8a14-aae4b4346573",
      "version": "13",
      "structure": {
        "id": "240688f6-8fb5-4911-b79a-67c1aa2778d8",
        "molfile": "\n  Marvin  01132102002D          \n\n 11 11  0  0  1  0            999 V2000\n    8.0239  -10.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0239  -11.2234    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.7399  -11.6360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3125  -11.6360    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3125  -12.4610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5966  -11.2234    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.8805  -11.6360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5966  -10.3984    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3125   -9.9858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8805   -9.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1645  -10.3984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  6  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  1  9  1  0  0  0  0\n  8 10  1  1  0  0  0\n 10 11  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@H]([C@@H]([C@H](CO1)O)O)O)O",
        "formula": "C6H12O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "164.1567",
        "optical_activity": "( + )",
        "references": [
          "5fb308cb-e491-446c-8161-ae58dcc6c47d",
          "453f9bf5-42b1-44d4-a5fa-ab49abf8cb38"
        ],
        "stereo_centers": 4
      },
      "unii": "54BB3B7XMZ",
      "relationships": [
        {
          "uuid": "5f0fd62b-a11e-49e6-ac86-a33e2c8c5049",
          "amount": {
            "uuid": "12fe4f94-4eb7-47b6-a199-216c00a9a56c"
          },
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "f8ae4b85-2da7-45d6-a2a6-9ddeaae4b99c",
            "refuuid": "534f8e6a-9fc2-4466-b60f-a460a95be30e",
            "name": "1,5-ANHYDRO-GLUCITOL",
            "unii": "Y79RBL5ZLQ",
            "linking_id": "Y79RBL5ZLQ",
            "ref_pname": "1,5-ANHYDRO-GLUCITOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "dee1b965-9c86-452e-b85a-d1be5aba74d8",
          "amount": {
            "uuid": "82622711-ccb8-4bbd-9876-07eeacdc84d0"
          },
          "type": "ENANTIOMER->ENANTIOMER",
          "related_substance": {
            "uuid": "fe632c4a-c9a1-4e95-b272-5864bbe36b96",
            "refuuid": "ba424e2f-32e2-4ff8-85ed-c0f8a1605864",
            "name": "1,5-ANHYDRO-L-GLUCITOL",
            "unii": "A2V5Y9XXP2",
            "linking_id": "A2V5Y9XXP2",
            "ref_pname": "1,5-ANHYDRO-L-GLUCITOL"
          }
        }
      ],
      "names": [
        {
          "uuid": "f853025f-33e1-434b-bfab-bca228748687",
          "name": "1,5-ANHYDRO-D-GLUCITOL",
          "stdName": "1,5-ANHYDRO-D-GLUCITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": true
        },
        {
          "uuid": "e519e280-1b72-49fd-bdc7-3327d8b09304",
          "name": "1,5-ANHYDRO-D-SORBITOL",
          "stdName": "1,5-ANHYDRO-D-SORBITOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        },
        {
          "uuid": "a6f5ab9f-e44c-4470-b341-c498c7855515",
          "name": "1,5-ANHYDROGLUCITOL",
          "stdName": "1,5-ANHYDROGLUCITOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        },
        {
          "uuid": "d79ed084-d4f1-4092-9fd7-5ed967225036",
          "name": "1,5-ANHYDROSORBITOL",
          "stdName": "1,5-ANHYDROSORBITOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        },
        {
          "uuid": "b5c3f8bb-4a95-4639-ab0d-9ef5ed79ea07",
          "name": "1,5-SORBITAN",
          "stdName": "1,5-SORBITAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        },
        {
          "uuid": "c0c2434b-e9e0-4485-8deb-04258f88c028",
          "name": "1-DEOXY-D-GLUCOPYRANOSE",
          "stdName": "1-DEOXY-D-GLUCOPYRANOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        },
        {
          "uuid": "63cdf44f-2c63-466d-817f-38042ca3bc1b",
          "name": "1-DEOXY-D-GLUCOSE",
          "stdName": "1-DEOXY-D-GLUCOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        },
        {
          "uuid": "45d5741a-f837-4fb8-9cb1-e29fa35872e8",
          "name": "ACERITOL",
          "stdName": "ACERITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        },
        {
          "uuid": "c5d12bed-7ff7-4cdf-83bc-df6df2c0973e",
          "name": "D-GLUCITOL, 1,5-ANHYDRO-",
          "stdName": "D-GLUCITOL, 1,5-ANHYDRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        },
        {
          "uuid": "091f6200-66fc-445b-a692-bc8df628dfc6",
          "name": "D-GLUCOSE, 1-DEOXY-",
          "stdName": "D-GLUCOSE, 1-DEOXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        },
        {
          "uuid": "6a07adcf-9c88-423e-9c74-9587e8590ae9",
          "name": "GLUCITOL, 1,5-ANHYDRO-, D-",
          "stdName": "GLUCITOL, 1,5-ANHYDRO-, D-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        },
        {
          "uuid": "ad233d07-bec9-4b18-b442-9dd15f35533f",
          "name": "POLYGALITOL",
          "stdName": "POLYGALITOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb308cb-e491-446c-8161-ae58dcc6c47d",
            "1d76983e-2c33-43c7-bd6a-c813993d1321"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "a4c4621d-72c7-4c14-82d0-a87c9d6d3c97"
      }
    }
  ]
}