{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ca904112-dc7b-4aa3-abde-fc55720abc50",
          "code": "807-28-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=807-28-3",
          "code_system": "CAS",
          "references": [
            "e7a6b129-10b1-4c16-89c2-d4405dd5e24a",
            "27fe3d41-7636-4847-96f1-dbd1debe4adc"
          ]
        },
        {
          "uuid": "8ef654b2-f3e9-481b-9915-b216bec8581a",
          "code": "212-361-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.238",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e7a6b129-10b1-4c16-89c2-d4405dd5e24a"
          ]
        },
        {
          "uuid": "abccb497-42f9-407d-91f2-a36042468f31",
          "code": "13121",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13121",
          "code_system": "PUBCHEM",
          "references": [
            "e7a6b129-10b1-4c16-89c2-d4405dd5e24a"
          ]
        },
        {
          "uuid": "930f3c2e-225d-921a-75ff-845a3c822c3a",
          "code": "DTXSID7061144",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7061144",
          "code_system": "EPA CompTox",
          "references": [
            "f8018bb8-78e7-a477-fcbb-1ccee21e432c"
          ]
        },
        {
          "uuid": "b3f37cbc-da86-41a4-816c-295c088eb95b",
          "code": "54A20TN089",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a304901e-9e01-4926-8865-829cf2874fd2",
          "name": "1,1,3,3-TETRAPHENYL-1,3-DIMETHYLDISILOXANE",
          "stdName": "1,1,3,3-TETRAPHENYL-1,3-DIMETHYLDISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd2bc5ef-19fa-43ef-b962-fce1970bdef0",
            "e5bf0856-b29e-401d-b753-894a3b2a3653"
          ],
          "display_name": false
        },
        {
          "uuid": "a9024128-5d23-4f73-a271-d509ad6ffbac",
          "name": "1,1,3,3-TETRAPHENYLDIMETHYLDISILOXANE",
          "stdName": "1,1,3,3-TETRAPHENYLDIMETHYLDISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd2bc5ef-19fa-43ef-b962-fce1970bdef0",
            "e5bf0856-b29e-401d-b753-894a3b2a3653"
          ],
          "display_name": false
        },
        {
          "uuid": "fec166c0-e9b4-48e9-8a6e-2b630ab1f612",
          "name": "1,3-DIMETHYL-1,1,3,3-TETRAPHENYLDISILOXANE",
          "stdName": "1,3-DIMETHYL-1,1,3,3-TETRAPHENYLDISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd2bc5ef-19fa-43ef-b962-fce1970bdef0",
            "e5bf0856-b29e-401d-b753-894a3b2a3653"
          ],
          "display_name": false
        },
        {
          "uuid": "52be387d-00c2-4116-9c0c-ac114873c049",
          "name": "DISILOXANE, 1,3-DIMETHYL-1,1,3,3-TETRAPHENYL-",
          "stdName": "DISILOXANE, 1,3-DIMETHYL-1,1,3,3-TETRAPHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcf43bd9-07cc-4512-8bb6-b4e5a501f3c9",
            "e5bf0856-b29e-401d-b753-894a3b2a3653"
          ],
          "display_name": false
        },
        {
          "uuid": "0f690bde-1fa6-4d68-bc52-6c4f277b496e",
          "name": "T 2078",
          "stdName": "T 2078",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd2bc5ef-19fa-43ef-b962-fce1970bdef0",
            "e5bf0856-b29e-401d-b753-894a3b2a3653"
          ],
          "display_name": false
        },
        {
          "uuid": "39d13fca-131d-4b7b-8363-e5686da64bc9",
          "name": "TETRAPHENYL DIMETHYL DISILOXANE",
          "stdName": "TETRAPHENYL DIMETHYL DISILOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5561d028-5f68-49c9-9e14-826981536fe9",
            "fcf43bd9-07cc-4512-8bb6-b4e5a501f3c9",
            "e5bf0856-b29e-401d-b753-894a3b2a3653"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "04dc971c-1e18-4b3a-8d10-97155e14a789",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "fcf43bd9-07cc-4512-8bb6-b4e5a501f3c9",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e5bf0856-b29e-401d-b753-894a3b2a3653",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd2bc5ef-19fa-43ef-b962-fce1970bdef0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7a6b129-10b1-4c16-89c2-d4405dd5e24a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391616000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0b0c5ed-f62b-45f2-94b6-ad87c2fb0e6d",
          "citation": "SRS import [54A20TN089]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=54A20TN089",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391616000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5561d028-5f68-49c9-9e14-826981536fe9",
          "citation": "TETRAPHENYL DIMETHYL DISILOXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f8018bb8-78e7-a477-fcbb-1ccee21e432c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=807-28-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "27fe3d41-7636-4847-96f1-dbd1debe4adc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "22b64476-cbc7-4985-828e-0c0bb5be02aa",
          "id": "22b64476-cbc7-4985-828e-0c0bb5be02aa",
          "molfile": "\n  Marvin  01132101572D          \n\n 29 32  0  0  0  0            999 V2000\n   10.0762   -6.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4887   -5.3534    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.6637   -5.3534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0317   -5.8837    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3998   -6.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1750   -6.6961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5430   -7.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6863   -8.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4615   -8.3211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0935   -7.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9502   -6.9783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2565   -5.6015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1133   -4.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3380   -4.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7061   -5.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8493   -5.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6245   -6.1318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9012   -4.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4887   -3.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9012   -3.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7262   -3.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1387   -3.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7262   -4.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9012   -6.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7262   -6.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1387   -6.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7262   -7.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9012   -7.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4887   -6.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 18  1  0  0  0  0\n  2 24  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4 12  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 23  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 29  2  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
          "smiles": "C[Si](c1ccccc1)(c2ccccc2)O[Si](C)(c3ccccc3)c4ccccc4",
          "formula": "C26H26OSi2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7c06ff97-897c-4245-b56b-89c5fcdd0112"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "410.6558",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a155c26d-b663-4b6e-83f9-a4f9b6eca404",
      "version": "4",
      "structure": {
        "id": "0d263901-55ad-405e-9d94-c20b4aeb2ef3",
        "molfile": "\n  Marvin  01132100552D          \n\n 29 32  0  0  0  0            999 V2000\n   10.4887   -5.3534    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   10.0762   -6.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6637   -5.3534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0317   -5.8837    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3998   -6.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1750   -6.6961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5430   -7.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6863   -8.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4615   -8.3211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0935   -7.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9502   -6.9783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2565   -5.6015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1133   -4.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3380   -4.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7061   -5.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8493   -5.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6245   -6.1318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9012   -4.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4887   -3.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9012   -3.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7262   -3.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1387   -3.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7262   -4.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9012   -6.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7262   -6.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1387   -6.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7262   -7.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9012   -7.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4887   -6.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n  6 11  2  0  0  0  0\n  4 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 12 17  2  0  0  0  0\n  1 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 18 23  2  0  0  0  0\n  1 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\n 24 29  2  0  0  0  0\nM  END",
        "smiles": "C[Si](c1ccccc1)(c2ccccc2)O[Si](C)(c3ccccc3)c4ccccc4",
        "formula": "C26H26OSi2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "410.6558",
        "optical_activity": "NONE",
        "references": [
          "bd2bc5ef-19fa-43ef-b962-fce1970bdef0",
          "e0b0c5ed-f62b-45f2-94b6-ad87c2fb0e6d"
        ],
        "stereo_centers": 0
      },
      "unii": "54A20TN089"
    }
  ]
}