{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "625475aa-4a0e-472c-9ad3-c5a9b536f9dc",
          "code": "306-94-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=306-94-5",
          "code_system": "CAS",
          "references": [
            "a5b1c25f-2791-4400-8879-e064c0faa7f2",
            "9a2b0130-ef89-44ed-8e4c-8d5a31368265"
          ]
        },
        {
          "uuid": "b9c930cf-75b5-48e5-9ec1-9f20eb7d6b40",
          "code": "C90817",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C90817",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a5b1c25f-2791-4400-8879-e064c0faa7f2"
          ]
        },
        {
          "uuid": "fc6b7a52-899c-4141-819d-5712a67e5635",
          "code": "C008805",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67008805",
          "code_system": "MESH",
          "references": [
            "a5b1c25f-2791-4400-8879-e064c0faa7f2"
          ]
        },
        {
          "uuid": "719d6f9e-2d84-478f-a158-e32943076ce0",
          "code": "PERFLUORODECALIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Perfluorodecalin",
          "code_system": "WIKIPEDIA",
          "references": [
            "a5b1c25f-2791-4400-8879-e064c0faa7f2"
          ]
        },
        {
          "uuid": "343ff0ec-5c11-4027-82da-98dbfeab1c0e",
          "code": "SUB09722MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a5b1c25f-2791-4400-8879-e064c0faa7f2"
          ]
        },
        {
          "uuid": "c2324ab8-5d3f-444e-86b6-48f2c0fdcf4d",
          "code": "5045",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5045",
          "code_system": "INN",
          "references": [
            "a5b1c25f-2791-4400-8879-e064c0faa7f2"
          ]
        },
        {
          "uuid": "d3615625-c153-482f-ba25-d46b9e5f2412",
          "code": "m5485",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5485?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a5b1c25f-2791-4400-8879-e064c0faa7f2"
          ]
        },
        {
          "uuid": "ef548ef4-e2dc-4afe-a42c-373e4587c61d",
          "code": "CHEMBL1371129",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1371129",
          "code_system": "ChEMBL",
          "references": [
            "a5b1c25f-2791-4400-8879-e064c0faa7f2"
          ]
        },
        {
          "uuid": "0d6b5477-d85f-4863-83db-5b4f686fbbf8",
          "code": "206-192-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.631",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a5b1c25f-2791-4400-8879-e064c0faa7f2"
          ]
        },
        {
          "uuid": "bc8c54ef-e075-4d85-a900-758381f136fd",
          "code": "9386",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9386",
          "code_system": "PUBCHEM",
          "references": [
            "a5b1c25f-2791-4400-8879-e064c0faa7f2"
          ]
        },
        {
          "uuid": "e8154281-5aa1-0e7a-6533-a88a3c1e9aea",
          "code": "DTXSID0046511",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0046511",
          "code_system": "EPA CompTox",
          "references": [
            "70af3c20-cfe1-65e3-2ab5-36e4f26b4182"
          ]
        },
        {
          "uuid": "5be58e57-ea43-1073-6424-51f1868e5816",
          "code": "C314",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Blood Substitute",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C314",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ef029ea9-8687-d0d1-b987-d8a1c47a2cf7"
          ]
        },
        {
          "uuid": "f85a57ce-9f68-4c27-9a8c-8131edeea332",
          "code": "54A06VV62N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f8c9c79f-1736-8f2e-45ee-48bc5cf4cd72",
          "code": "2103",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2103",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ef029ea9-8687-d0d1-b987-d8a1c47a2cf7"
          ]
        },
        {
          "uuid": "3a24d279-f55d-9ff4-7336-6c08f463f932",
          "code": "2462501",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2462501/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5b2f0e11-543b-3677-6268-44b40bd60cc8"
          ]
        },
        {
          "uuid": "2144f2e8-d0ff-be44-b0ad-ce52c340821b",
          "code": "38848",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38848",
          "code_system": "CHEBI",
          "references": [
            "ef029ea9-8687-d0d1-b987-d8a1c47a2cf7"
          ]
        },
        {
          "uuid": "d78672be-07e0-247f-1922-07b740d855f7",
          "code": "97066",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=97066",
          "code_system": "NSC",
          "references": [
            "13c1e805-d69b-7a4d-399b-fd4924e32f94"
          ]
        },
        {
          "uuid": "c073a73f-9abe-db70-0985-bf62a1cbd13c",
          "code": "54A06VV62N",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=54A06VV62N",
          "code_system": "DAILYMED",
          "references": [
            "199e4c5d-4723-09ad-c202-583380bf7103"
          ]
        },
        {
          "uuid": "21cfe0d3-9b56-c749-a6e3-cbe5ce535c70",
          "code": "100000082750",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d878b1d8-3dc5-c97c-ae7a-7ab6bcd5f7b0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cd70cfcb-0616-4599-ab07-8275f2a56b26",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "84bfc1ec-7b59-40f2-bac8-761e33b10ad5",
            "refuuid": "dfc2908c-211a-494c-baaf-36e8dbbb7f43",
            "name": "PERFLUNAFENE",
            "unii": "54A06VV62N",
            "linking_id": "54A06VV62N",
            "ref_pname": "PERFLUNAFENE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ca1b2d01-8caa-439c-9639-940443025424",
          "name": "ACRI-DECA",
          "stdName": "ACRI-DECA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "794e060b-01c5-4d33-b6e7-b3daf2964ae6",
            "2a74341d-9f0e-46a5-ba19-a0135abb49a9"
          ],
          "display_name": false
        },
        {
          "uuid": "757ecaf4-7594-4c23-865e-654031351188",
          "name": "FLUOSOL DA PERFLUORODECALIN",
          "stdName": "FLUOSOL DA PERFLUORODECALIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d1da0c-7df3-4114-b218-e74d25d996bd",
            "1cf12d12-4998-47fb-b3cb-59d631325841",
            "4eef8b89-0879-45e4-9d36-80bb780e692e"
          ],
          "display_name": false
        },
        {
          "uuid": "ca845369-0b25-40fd-9e27-542316b722a5",
          "name": "FLUOSOL DA PERFLUORODECALIN [MI]",
          "stdName": "FLUOSOL DA PERFLUORODECALIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d1da0c-7df3-4114-b218-e74d25d996bd",
            "1cf12d12-4998-47fb-b3cb-59d631325841"
          ],
          "display_name": false
        },
        {
          "uuid": "62b5c367-73db-4343-9061-cec41a87d363",
          "name": "NSC-97066",
          "stdName": "NSC-97066",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cf12d12-4998-47fb-b3cb-59d631325841",
            "6e17c358-d5a2-4998-974f-c6f831f4c964"
          ],
          "display_name": false
        },
        {
          "uuid": "d0bc80ed-85bc-4301-af6d-f0537bbcd8f5",
          "name": "OCTADECAFLUORODECAHYDRONAPHTHALENE",
          "stdName": "OCTADECAFLUORODECAHYDRONAPHTHALENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d1da0c-7df3-4114-b218-e74d25d996bd"
          ],
          "display_name": false
        },
        {
          "uuid": "c253bdd6-b5c0-40a0-b328-fc843c097f31",
          "name": "PERFLUNAFENE",
          "stdName": "PERFLUNAFENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cba0ab1-a620-4a13-bdbb-1617a6c0c4b3",
            "659a146d-4c28-452f-831d-562a6885e12d",
            "fbd51afc-f7ca-4ca1-98e9-f407824452cc",
            "1a7d84ea-bcb3-4900-80f8-cac4d7308035",
            "ed34189a-520c-4ebd-867e-cf3bc954152e",
            "1cf12d12-4998-47fb-b3cb-59d631325841",
            "5a934a1b-02a7-45c3-8911-542c1a87ea49",
            "c2eb4e98-ae3c-4ccd-b661-8398b835646a"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "120c4ee6-9a57-4c7f-8d94-596479d9a8b9",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "11342f31-0e5e-48c5-ac98-a9b3ef5e2433",
          "name": "PERFLUNAFENE [MART.]",
          "stdName": "PERFLUNAFENE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cba0ab1-a620-4a13-bdbb-1617a6c0c4b3"
          ],
          "display_name": false
        },
        {
          "uuid": "ec686948-fb51-4233-a809-7f9f2f9f121e",
          "name": "PERFLUORODECALIN",
          "stdName": "PERFLUORODECALIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "11d1da0c-7df3-4114-b218-e74d25d996bd",
            "1cf12d12-4998-47fb-b3cb-59d631325841",
            "94d80ab0-00f7-46d9-a72e-af54856409d4",
            "71ac2d8d-5e6b-4fd3-92ee-07c2c41cede0",
            "e9c160f0-c028-4ed5-b957-2408e15d7ffc",
            "25d2c890-321d-4255-ad55-4f8b8f961162"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4030534e-bc93-4be5-8e2f-93200e172728",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "eafaabfa-9f55-4abd-87a7-1566f535e0d5",
          "name": "PERFLUORODECALIN [VANDF]",
          "stdName": "PERFLUORODECALIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cf12d12-4998-47fb-b3cb-59d631325841",
            "71ac2d8d-5e6b-4fd3-92ee-07c2c41cede0"
          ],
          "display_name": false
        },
        {
          "uuid": "29f86c00-21b9-18c8-bb16-dcd215a2f9a8",
          "name": "PERFTORAN COMPONENT PERFLUORODECALIN",
          "stdName": "PERFTORAN COMPONENT PERFLUORODECALIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b6ca9c2-91b2-b2e3-7ca2-417744b9e4dc"
          ],
          "display_name": false
        },
        {
          "uuid": "a532b702-9f17-e99e-e26d-435bc4a619c9",
          "name": "Perflunafene [WHO-DD]",
          "stdName": "PERFLUNAFENE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf102178-f131-51f8-c917-8a11595c549e"
          ],
          "display_name": false
        },
        {
          "uuid": "816bb38c-3d71-4ed3-883a-04a4db4a14a7",
          "name": "perflunafene [INN]",
          "stdName": "PERFLUNAFENE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a7d84ea-bcb3-4900-80f8-cac4d7308035"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "11d1da0c-7df3-4114-b218-e74d25d996bd",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "659a146d-4c28-452f-831d-562a6885e12d",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a7d84ea-bcb3-4900-80f8-cac4d7308035",
          "citation": "INN Proposed List 45",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL45.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1cba0ab1-a620-4a13-bdbb-1617a6c0c4b3",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a74341d-9f0e-46a5-ba19-a0135abb49a9",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "794e060b-01c5-4d33-b6e7-b3daf2964ae6",
          "citation": "D08338",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9c160f0-c028-4ed5-b957-2408e15d7ffc",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cf12d12-4998-47fb-b3cb-59d631325841",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a934a1b-02a7-45c3-8911-542c1a87ea49",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71ac2d8d-5e6b-4fd3-92ee-07c2c41cede0",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e17c358-d5a2-4998-974f-c6f831f4c964",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5b1c25f-2791-4400-8879-e064c0faa7f2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b14b2f9-ce73-4d43-9ec9-db3a082faad4",
          "citation": "SRS import [54A06VV62N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=54A06VV62N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed34189a-520c-4ebd-867e-cf3bc954152e",
          "citation": "PERFLUNAFENE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fbd51afc-f7ca-4ca1-98e9-f407824452cc",
          "citation": "PERFLUNAFENE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "25d2c890-321d-4255-ad55-4f8b8f961162",
          "citation": "PERFLUORODECALIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2eb4e98-ae3c-4ccd-b661-8398b835646a",
          "citation": "PERFLUNAFENE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "94d80ab0-00f7-46d9-a72e-af54856409d4",
          "citation": "PERFLUORODECALIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4eef8b89-0879-45e4-9d36-80bb780e692e",
          "citation": "FLUOSOL DA PERFLUORODECALIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "70af3c20-cfe1-65e3-2ab5-36e4f26b4182",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=306-94-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d878b1d8-3dc5-c97c-ae7a-7ab6bcd5f7b0",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6b6ca9c2-91b2-b2e3-7ca2-417744b9e4dc",
          "citation": "Maevsky, Eugene, and Genrih Ivanitsky. \"Oxygen-dependent and oxygen-independent effects of Perftoran.\" Artificial Oxygen Carrier. Springer, Tokyo, 2005. 221-228.",
          "doc_type": "BOOK",
          "public_domain": true
        },
        {
          "uuid": "ef029ea9-8687-d0d1-b987-d8a1c47a2cf7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9a2b0130-ef89-44ed-8e4c-8d5a31368265",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5b2f0e11-543b-3677-6268-44b40bd60cc8",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "13c1e805-d69b-7a4d-399b-fd4924e32f94",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cf102178-f131-51f8-c917-8a11595c549e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "199e4c5d-4723-09ad-c202-583380bf7103",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "85c6da72-9a72-478d-839c-dbdfeb365283",
          "id": "85c6da72-9a72-478d-839c-dbdfeb365283",
          "molfile": "\n  Marvin  01132106572D          \n\n 28 29  0  0  0  0            999 V2000\n    0.0000   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8672   -1.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3209   -2.5803    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8672   -1.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0186   -1.3551    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1432   -0.7346    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5858   -0.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9120    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9176   -0.1538    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3019   -1.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2700   -0.4482    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0179   -0.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6278   -0.0663    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7288   -0.0186    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7392   -1.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3756   -0.5755    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6726   -1.3154    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7392   -1.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6726   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4578   -2.5617    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0179   -2.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7394   -3.1372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5800   -3.0895    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3019   -1.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3416   -2.8004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5858   -2.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1058   -3.1027    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9916   -3.1372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2 26  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  4  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n  7 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\n 24 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 15  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\n 18 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  1  0  0  0  0\n 21 24  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 24  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  1  0  0  0  0\nM  END",
          "smiles": "C12(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)F",
          "formula": "C10F18",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2b83b5f6-1976-4ee5-847e-b6d38dbe6ad5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "462.0786",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dfc2908c-211a-494c-baaf-36e8dbbb7f43",
      "version": "15",
      "structure": {
        "id": "bb048d4e-8eeb-40cc-bef6-afbe349d9afa",
        "molfile": "\n  Marvin  01132109402D          \n\n 28 29  0  0  0  0            999 V2000\n    2.3019   -1.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3019   -1.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5858   -0.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0179   -2.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0179   -0.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5858   -2.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7392   -1.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7392   -1.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8672   -1.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8672   -1.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9120    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9176   -0.1538    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1058   -3.1027    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9916   -3.1372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7394   -3.1372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5800   -3.0895    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6278   -0.0663    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7288   -0.0186    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3416   -2.8004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2700   -0.4482    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6726   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4578   -2.5617    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3756   -0.5755    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6726   -1.3154    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3209   -2.5803    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0186   -1.3551    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1432   -0.7346    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  4  1  0  0  0  0\n 16  4  1  0  0  0  0\n 17  5  1  0  0  0  0\n 18  5  1  0  0  0  0\n 19  2  1  0  0  0  0\n 20  1  1  0  0  0  0\n 21  9  1  0  0  0  0\n 22  7  1  0  0  0  0\n 23  7  1  0  0  0  0\n 24  8  1  0  0  0  0\n 25  8  1  0  0  0  0\n 26  9  1  0  0  0  0\n 27 10  1  0  0  0  0\n 28 10  1  0  0  0  0\n  7  4  1  0  0  0  0\n  9  6  1  0  0  0  0\nM  END",
        "smiles": "C12(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)F",
        "formula": "C10F18",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "462.0786",
        "optical_activity": "NONE",
        "references": [
          "11d1da0c-7df3-4114-b218-e74d25d996bd",
          "1b14b2f9-ce73-4d43-9ec9-db3a082faad4",
          "1a7d84ea-bcb3-4900-80f8-cac4d7308035"
        ],
        "stereo_centers": 0
      },
      "unii": "54A06VV62N"
    }
  ]
}