{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4d712b05-c655-4911-85dd-57a469efcf1a",
          "code": "104-28-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=104-28-9",
          "code_system": "CAS",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9",
            "14d7e777-49f6-474e-a45f-da007f380821"
          ]
        },
        {
          "uuid": "51fc9518-5790-4afc-82e0-c4cad6381afc",
          "code": "C76987",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76987",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "e407a126-0234-4bb4-b838-67d41b147c01",
          "code": "C018952",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67018952",
          "code_system": "MESH",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "6dd20c0e-5b96-4ac5-9d48-3cd56db88adf",
          "code": "21 CFR 352.10",
          "comments": "PART 352 -- SUNSCREEN DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE [STAYED INDEFINITELY]|Subpart B--Active Ingredients|Sec. 352.10 Sunscreen active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=352.10",
          "code_system": "CFR",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "71e2c149-a0fc-4eb1-9cbb-a71ae56c95b4",
          "code": "21 CFR 352.20",
          "comments": "PART 352 -- SUNSCREEN DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE [STAYED INDEFINITELY]|Subpart B--Active Ingredients|Sec. 352.20 Permitted combinations of active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=352.20",
          "code_system": "CFR",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "73af7bd8-83d0-4bcb-9e88-91a54bebae6a",
          "code": "CINOXATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cinoxate",
          "code_system": "WIKIPEDIA",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "9c9a0e76-d30a-4713-ac3f-4cb0a61be95d",
          "code": "SUB06310MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "4e7253a3-d89c-44ce-8397-70f011ae12b0",
          "code": "76604",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:566",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "165ae087-4470-4ef2-a25f-e38ace24c2ab",
          "code": "2761",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2761",
          "code_system": "INN",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "724a6e7d-7613-4153-932d-cddb26baf871",
          "code": "203-191-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.901",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "c110ddbd-7597-4c8f-96de-1a3f5cf2204d",
          "code": "288262",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/288262/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "3db601d7-b99c-4ecf-8008-e017ca2e1c17",
          "code": "m3580",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3580?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "d37cc24d-1111-4406-bfb6-d126e32ef8dc",
          "code": "CHEMBL2104045",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104045",
          "code_system": "ChEMBL",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "67862906-f324-4dd0-a00b-302d04f17509",
          "code": "5373773",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5373773",
          "code_system": "PUBCHEM",
          "references": [
            "9bd24845-7e93-4635-8957-face4d402fb9"
          ]
        },
        {
          "uuid": "91aaeea5-435e-fa84-17ed-5604bb6cdbb3",
          "code": "7424",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7424",
          "code_system": "HSDB",
          "references": [
            "e1850b4b-78b4-1950-db4e-1ac042b61cfc"
          ]
        },
        {
          "uuid": "1158952c-9f91-4bf5-ede7-c8737719144e",
          "code": "DTXSID2025264",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2025264",
          "code_system": "EPA CompTox",
          "references": [
            "93ca238b-0f08-5e83-baf0-53fd376f4dae"
          ]
        },
        {
          "uuid": "fbc8c572-bbfe-76dc-5021-a705150bc08e",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b140f51a-4b96-8d52-0602-109c6ec26699"
          ]
        },
        {
          "uuid": "6142ef2d-1379-4f1c-9aa9-475a59ecf1f8",
          "code": "5437O7N5BH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0142cf48-4776-0669-93e1-0d5dd4721054",
          "code": "DB15467",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB15467",
          "code_system": "DRUG BANK",
          "references": [
            "b140f51a-4b96-8d52-0602-109c6ec26699"
          ]
        },
        {
          "uuid": "2933bf76-21e6-a90a-9d9d-53b16d94dd02",
          "code": "100000081071",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8ba6a0c5-6853-a9e0-c0d4-43aff50de4f5"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4240aa04-31d3-4cfd-b317-75eb7cbae344",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "fb5c2f35-6b1f-40b6-8b0e-214401a308cc",
            "refuuid": "72f653a5-4a80-45fd-8d32-2d6b560eec76",
            "name": "CINOXATE",
            "unii": "5437O7N5BH",
            "linking_id": "5437O7N5BH",
            "ref_pname": "CINOXATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6b532b18-51c1-4e26-8ca5-dfdae444d0af",
          "name": "2-PROPENOIC ACID, 3-(4-METHOXYPHENYL)-, 2-ETHOXYETHYL ESTER",
          "stdName": "2-PROPENOIC ACID, 3-(4-METHOXYPHENYL)-, 2-ETHOXYETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae203c2c-f2e3-4723-9434-163b491fa90f"
          ],
          "display_name": false
        },
        {
          "uuid": "218f4f62-5478-40bf-bf51-822c1eca9d03",
          "name": "CINOXATE",
          "stdName": "CINOXATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84d25d38-d19e-41d6-a52f-c12540f4ff3e",
            "d92559d4-c18c-4df6-8b87-17e988525d01",
            "32e7f556-bf1a-4329-801e-645a5a04eda9",
            "49f678f2-8a16-495c-9b30-993b7c7ef99b",
            "56976343-f3fd-4f64-b95c-ce060df4874a",
            "1a164ada-afc3-438c-8ba2-4cc3241be51f",
            "c12f69f3-0399-45ac-ad21-591cc73a3508",
            "cee21720-93d1-4941-93c5-e2356a3ad5f2",
            "70e197a3-e838-4e19-9464-299e7906a4ae",
            "f8b13c9e-9809-47cf-8890-bf67603322ab",
            "13eb20e6-e61f-4f30-8571-351b19447a31",
            "4053c5bc-0a41-43c7-bb87-e84d3402d8fd",
            "4c2b34c2-d174-4b82-b9dd-6564dda63958",
            "20c83a45-1cbd-47d2-aeb5-980441c32310",
            "945c363f-1e34-4187-ac04-fa064b73b6d5",
            "9b9edc6e-d839-4041-8c7b-df5b406cfde6",
            "9d8f0fc2-80d7-4ec2-b517-f224cf0889b0",
            "de8adc63-2b03-464f-8d2a-f7b20c1c1b2d"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "65314515-b3ea-4d6f-9017-2d9e5b1147e2",
              "name_org": "INN"
            },
            {
              "uuid": "3e591378-871c-498f-b8b2-daf3cefd939c",
              "name_org": "USAN"
            },
            {
              "uuid": "05f007c3-a1dc-497e-9e8d-d6b3383f4f78",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d71efdf2-6a0a-4798-ae31-dc072bdb92e0",
          "name": "CINOXATE [HSDB]",
          "stdName": "CINOXATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13eb20e6-e61f-4f30-8571-351b19447a31",
            "56976343-f3fd-4f64-b95c-ce060df4874a"
          ],
          "display_name": false
        },
        {
          "uuid": "ebf93f4f-ddd6-45c4-b313-ebbbff694ea1",
          "name": "CINOXATE [MART.]",
          "stdName": "CINOXATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4053c5bc-0a41-43c7-bb87-e84d3402d8fd"
          ],
          "display_name": false
        },
        {
          "uuid": "7dda270b-174f-4cda-9a60-0255e810a532",
          "name": "CINOXATE [MI]",
          "stdName": "CINOXATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84d25d38-d19e-41d6-a52f-c12540f4ff3e",
            "56976343-f3fd-4f64-b95c-ce060df4874a"
          ],
          "display_name": false
        },
        {
          "uuid": "d5244f73-fa52-4014-b269-45c0a1e45187",
          "name": "CINOXATE [USAN]",
          "stdName": "CINOXATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32e7f556-bf1a-4329-801e-645a5a04eda9"
          ],
          "display_name": false
        },
        {
          "uuid": "9d45d448-16e8-43ac-9c37-e3e63389f274",
          "name": "CINOXATE [VANDF]",
          "stdName": "CINOXATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d92559d4-c18c-4df6-8b87-17e988525d01",
            "56976343-f3fd-4f64-b95c-ce060df4874a"
          ],
          "display_name": false
        },
        {
          "uuid": "4bd9cff0-8f70-33f5-b009-4304acc697bd",
          "name": "Cinoxate [WHO-DD]",
          "stdName": "CINOXATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e0b83f4-4e83-052d-19a9-3b7331e317b4"
          ],
          "display_name": false
        },
        {
          "uuid": "4aa8b3a2-ceea-4fd6-bf1a-6cf226613376",
          "name": "cinoxate [INN]",
          "stdName": "CINOXATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a164ada-afc3-438c-8ba2-4cc3241be51f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9b9edc6e-d839-4041-8c7b-df5b406cfde6",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ae203c2c-f2e3-4723-9434-163b491fa90f",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bae9f586-0ee6-428f-ab2a-6b70e3f2838a",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a164ada-afc3-438c-8ba2-4cc3241be51f",
          "citation": "INN Proposed List 22",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL22.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "32e7f556-bf1a-4329-801e-645a5a04eda9",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4053c5bc-0a41-43c7-bb87-e84d3402d8fd",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84d25d38-d19e-41d6-a52f-c12540f4ff3e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56976343-f3fd-4f64-b95c-ce060df4874a",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8b13c9e-9809-47cf-8890-bf67603322ab",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13eb20e6-e61f-4f30-8571-351b19447a31",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20c83a45-1cbd-47d2-aeb5-980441c32310",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d92559d4-c18c-4df6-8b87-17e988525d01",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9bd24845-7e93-4635-8957-face4d402fb9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fafdcb1f-5c51-49dc-b372-dc66b5a06aa0",
          "citation": "SRS import [5437O7N5BH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5437O7N5BH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c2b34c2-d174-4b82-b9dd-6564dda63958",
          "citation": "CINOXATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cee21720-93d1-4941-93c5-e2356a3ad5f2",
          "citation": "CINOXATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "de8adc63-2b03-464f-8d2a-f7b20c1c1b2d",
          "citation": "CINOXATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "945c363f-1e34-4187-ac04-fa064b73b6d5",
          "citation": "CINOXATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c12f69f3-0399-45ac-ad21-591cc73a3508",
          "citation": "CINOXATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d8f0fc2-80d7-4ec2-b517-f224cf0889b0",
          "citation": "CINOXATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "49f678f2-8a16-495c-9b30-993b7c7ef99b",
          "citation": "CINOXATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "70e197a3-e838-4e19-9464-299e7906a4ae",
          "citation": "CINOXATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1850b4b-78b4-1950-db4e-1ac042b61cfc",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+104-28-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "93ca238b-0f08-5e83-baf0-53fd376f4dae",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=104-28-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ba6a0c5-6853-a9e0-c0d4-43aff50de4f5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b140f51a-4b96-8d52-0602-109c6ec26699",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "14d7e777-49f6-474e-a45f-da007f380821",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0e0b83f4-4e83-052d-19a9-3b7331e317b4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ab4fcc28-3149-417a-a0db-b043ec1349ce",
          "id": "ab4fcc28-3149-417a-a0db-b043ec1349ce",
          "molfile": "\n  Marvin  01132108532D          \n\n 18 18  0  0  0  0            999 V2000\n    2.5994   -3.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3138   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0283   -3.0269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7427   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4572   -3.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1716   -3.4393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8860   -3.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8860   -2.2019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6005   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3149   -3.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0294   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7438   -3.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4583   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4583   -4.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1727   -4.6768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1727   -5.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7438   -4.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0294   -4.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 18 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 17  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CCOCCOC(=O)/C=C/c1ccc(cc1)OC",
          "formula": "C14H18O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fc569b42-accd-42c2-8181-1a2cc5b3657f"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "250.2909",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "72f653a5-4a80-45fd-8d32-2d6b560eec76",
      "version": "12",
      "structure": {
        "id": "c054e761-cc28-4143-8edc-a9de689514cf",
        "molfile": "\n  Marvin  01132109562D          \n\n 18 18  0  0  0  0            999 V2000\n    8.3149   -3.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6005   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8860   -3.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1716   -3.4393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4572   -3.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7427   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0283   -3.0269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3138   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5994   -3.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8860   -2.2019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0294   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7438   -3.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4583   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4583   -4.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1727   -4.6768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1727   -5.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7438   -4.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0294   -4.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  3  2  0  0  0  0\n 11  1  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 14 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 11  2  0  0  0  0\nM  END",
        "smiles": "CCOCCOC(=O)/C=C/c1ccc(cc1)OC",
        "formula": "C14H18O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "250.2909",
        "optical_activity": "NONE",
        "references": [
          "9b9edc6e-d839-4041-8c7b-df5b406cfde6",
          "fafdcb1f-5c51-49dc-b372-dc66b5a06aa0",
          "1a164ada-afc3-438c-8ba2-4cc3241be51f"
        ],
        "stereo_centers": 0
      },
      "unii": "5437O7N5BH"
    }
  ]
}