{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0dbdc476-cbae-4c49-b3b2-ea0de062a97c", "code": "62218-13-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=62218-13-7", "code_system": "CAS", "references": [ "5253e228-d00b-4c55-bb60-e338d4f53230", "495325c5-7806-4ef1-9bfa-f6a6f80d804d" ] }, { "uuid": "8648be52-7402-4b91-9084-12a72b135d10", "code": "196402", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/196402", "code_system": "PUBCHEM", "references": [ "5253e228-d00b-4c55-bb60-e338d4f53230" ] }, { "uuid": "d832fb04-0763-9fce-c44b-92bdea7f9937", "code": "alpha-Viniferin", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/alpha-Viniferin", "code_system": "WIKIPEDIA", "references": [ "0420d4c9-4412-f18b-7c28-7a288e075c75" ] }, { "uuid": "52837235-467f-43b2-8935-98838c58b39a", "code": "53XER6FHLX", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "9ad0d0ff-8751-661e-5b97-6b350d7d2699", "code": "DTXSID40211274", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40211274", "code_system": "EPA CompTox", "references": [ "86fa8914-91d6-1186-7c3e-1a7ac4417cd4" ] } ], "substance_class": "chemical", "names": [ { "uuid": "06e0f31e-c36f-4890-9ff1-8616677d12af", "name": "(+)-.ALPHA.-VINIFERIN", "stdName": "(+)-.ALPHA.-VINIFERIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "35521e67-3d97-4fbf-bb2b-920ec26d121a", "cb935929-65b8-45ec-8f89-919fa0283428" ], "display_name": false }, { "uuid": "6c845e7a-532d-4200-a1ca-90c500d113e5", "name": ".ALPHA.-VINIFERIN", "stdName": ".ALPHA.-VINIFERIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "35521e67-3d97-4fbf-bb2b-920ec26d121a", "cb935929-65b8-45ec-8f89-919fa0283428" ], "display_name": true }, { "uuid": "b0b92f68-b4b9-4e78-b1eb-d6360ba38f46", "name": "CYCLONONA(1,2,3-CD:4,5,6-C'D':7,8,9-C''D'')TRISBENZOFURAN-4,9,14-TRIOL, 2,2A,7,7A,12,12A-HEXAHYDRO-2,7,12-TRIS(4-HYDROXYPHENYL)-, (2R*,2AR*,7R*,7AR*,12S*,12AS*)-(+)-", "stdName": "CYCLONONA(1,2,3-CD:4,5,6-C'D':7,8,9-C''D'')TRISBENZOFURAN-4,9,14-TRIOL, 2,2A,7,7A,12,12A-HEXAHYDRO-2,7,12-TRIS(4-HYDROXYPHENYL)-, (2R*,2AR*,7R*,7AR*,12S*,12AS*)-(+)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "35521e67-3d97-4fbf-bb2b-920ec26d121a", "cb935929-65b8-45ec-8f89-919fa0283428" ], "display_name": false }, { "uuid": "9e098ed7-5488-43d1-bb7d-bbace866e901", "name": "VINIFERIN, ALPHA-", "stdName": "VINIFERIN, ALPHA-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0dd8a1e2-0a2f-4a20-9b16-b0beb6436500" ], "display_name": false } ], "references": [ { "uuid": "0dd8a1e2-0a2f-4a20-9b16-b0beb6436500", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "35521e67-3d97-4fbf-bb2b-920ec26d121a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cb935929-65b8-45ec-8f89-919fa0283428", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5253e228-d00b-4c55-bb60-e338d4f53230", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392083000, "tags": [ "NOMEN" ] }, { "uuid": "4f32131a-3ec1-4a49-8e5d-199ce6811eed", "citation": "SRS import [53XER6FHLX]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=53XER6FHLX", "doc_type": "SRS", "public_domain": true, "document_date": 1493392083000, "tags": [ "NOMEN" ] }, { "uuid": "faaa54cb-bca5-4010-82fe-19e0a9b46e58", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0420d4c9-4412-f18b-7c28-7a288e075c75", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/alpha-Viniferin", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "be58ec73-9a4a-c0b5-5143-b2ac8a1bba99", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=62218-13-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "86fa8914-91d6-1186-7c3e-1a7ac4417cd4", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "495325c5-7806-4ef1-9bfa-f6a6f80d804d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "82e19949-4721-4c41-8d18-c62c9ced2636", "id": "82e19949-4721-4c41-8d18-c62c9ced2636", "molfile": "\n Marvin 01132106472D \n\n 51 60 0 0 0 0 999 V2000\n 7.8786 -2.0237 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.2952 -1.4404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4557 -1.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6588 -1.5142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0755 -2.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2786 -1.8841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2890 -2.8945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0858 -3.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6692 -2.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4661 -2.7382 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.9683 -3.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6828 -2.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3973 -3.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1118 -2.9802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3973 -4.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6828 -4.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7109 -5.4118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9018 -5.5728 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.0084 -7.6336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1888 -7.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8607 -8.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3521 -9.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0239 -9.9044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1717 -9.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4998 -8.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4661 -4.8723 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.9683 -4.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6692 -5.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7769 -5.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1224 -6.4060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2301 -7.2239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3603 -6.0902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2525 -5.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5196 -4.9991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6806 -4.1900 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.1068 -3.5971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3334 -2.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7596 -2.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9594 -2.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3856 -1.8187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7328 -3.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3066 -3.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4946 -4.0556 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.9070 -4.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6966 -1.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0123 -1.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8302 -1.0461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3325 -1.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1504 -1.5930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0168 -2.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1988 -2.5706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 10 1 1 0 0 0 0\n 1 45 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 9 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 43 8 1 0 0 0 0\n 10 9 1 6 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 27 2 0 0 0 0\n 13 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 1 0 0 0 0\n 16 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 27 16 1 0 0 0 0\n 18 17 1 1 0 0 0\n 18 19 1 0 0 0 0\n 26 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 25 19 2 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 26 27 1 6 0 0 0\n 26 28 1 0 0 0 0\n 29 28 1 0 0 0 0\n 28 44 2 0 0 0 0\n 30 29 2 0 0 0 0\n 30 31 1 0 0 0 0\n 32 30 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 44 33 1 0 0 0 0\n 35 34 1 6 0 0 0\n 35 36 1 0 0 0 0\n 35 43 1 0 0 0 0\n 36 37 1 0 0 0 0\n 42 36 2 0 0 0 0\n 37 38 2 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 39 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 43 44 1 1 0 0 0\n 46 45 1 0 0 0 0\n 45 51 2 0 0 0 0\n 47 46 2 0 0 0 0\n 48 47 1 0 0 0 0\n 48 49 1 0 0 0 0\n 50 48 2 0 0 0 0\n 51 50 1 0 0 0 0\nM END", "smiles": "c1cc(ccc1[C@H]2[C@@H]3c4cc(cc5c4[C@H](c6cc(cc7c6[C@@H](c8cc(cc(c83)O2)O)[C@H](c9ccc(cc9)O)O7)O)[C@@H](c%10ccc(cc%10)O)O5)O)O", "formula": "C42H30O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4ee7a5e1-59ff-4d38-b9ff-4c39a2824f84" }, "defined_stereo": 6, "ez_centers": 0, "molecular_weight": "678.6838", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "COMPLETE", "uuid": "b8f67fe3-bc99-4bb9-aa83-c106f097cc61", "version": "9", "structure": { "id": "102979a8-b1f3-4c04-8ce5-b1e708da7428", "molfile": "\n Marvin 01132101042D \n\n 54 63 0 0 0 0 999 V2000\n 7.4661 -4.8723 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.0077 -4.1863 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9683 -4.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9683 -3.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4661 -2.7382 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.8786 -2.0237 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.2952 -1.4404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4557 -1.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6588 -1.5142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0755 -2.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2890 -2.8945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0858 -3.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4946 -4.0556 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.6806 -4.1900 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.5196 -4.9991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2525 -5.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9070 -4.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6692 -5.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7769 -5.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1224 -6.4060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3603 -6.0902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2301 -7.2239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1068 -3.5971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3334 -2.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7596 -2.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9594 -2.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7328 -3.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3066 -3.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3856 -1.8187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0367 -3.3692 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6692 -2.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2786 -1.8841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6966 -1.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0123 -1.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8302 -1.0461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3325 -1.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0168 -2.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1988 -2.5706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1504 -1.5930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2893 -2.6843 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6828 -2.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3973 -3.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3973 -4.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6828 -4.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7109 -5.4118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9018 -5.5728 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.0084 -7.6336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1888 -7.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8607 -8.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3521 -9.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1717 -9.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4998 -8.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0239 -9.9044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1118 -2.9802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 3 1 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 13 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 16 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 18 1 1 0 0 0 0\n 14 23 1 6 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 23 1 0 0 0 0\n 26 29 1 0 0 0 0\n 13 30 1 6 0 0 0\n 12 31 2 0 0 0 0\n 8 31 1 0 0 0 0\n 31 5 1 0 0 0 0\n 10 32 1 0 0 0 0\n 6 33 1 1 0 0 0\n 34 33 2 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 2 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 2 0 0 0 0\n 33 38 1 0 0 0 0\n 36 39 1 0 0 0 0\n 5 40 1 1 0 0 0\n 41 4 1 0 0 0 0\n 42 41 2 0 0 0 0\n 43 42 1 0 0 0 0\n 44 43 2 0 0 0 0\n 3 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 1 46 1 0 0 0 0\n 46 47 1 1 0 0 0\n 47 48 2 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 2 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 2 0 0 0 0\n 52 47 1 0 0 0 0\n 50 53 1 0 0 0 0\n 42 54 1 0 0 0 0\nM END", "smiles": "c1cc(ccc1[C@H]2[C@]3([H])c4cc(cc5c4[C@]([H])(c6cc(cc7c6[C@@]([H])(c8cc(cc(c83)O2)O)[C@H](c9ccc(cc9)O)O7)O)[C@@H](c%10ccc(cc%10)O)O5)O)O", "formula": "C42H30O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "UNKNOWN", "defined_stereo": 6, "ez_centers": 0, "molecular_weight": "678.6838", "optical_activity": "UNSPECIFIED", "references": [ "4f32131a-3ec1-4a49-8e5d-199ce6811eed", "faaa54cb-bca5-4010-82fe-19e0a9b46e58" ], "stereo_centers": 6 }, "unii": "53XER6FHLX" } ] }