{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6ff989f0-21ed-41e8-ac90-dfa0c1f20b73",
          "code": "32860-62-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=32860-62-1",
          "code_system": "CAS",
          "references": [
            "1f452ac7-f4ae-4d4a-9380-22709c81614c",
            "d5fc276b-fbb8-47e1-bc48-ddf895689592"
          ]
        },
        {
          "uuid": "41433183-df71-4fa4-b28c-4cd99727acb3",
          "code": "251-265-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.590",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1f452ac7-f4ae-4d4a-9380-22709c81614c"
          ]
        },
        {
          "uuid": "93420f8c-026a-457f-9a3e-50dfc37c00f4",
          "code": "5288441",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5288441",
          "code_system": "PUBCHEM",
          "references": [
            "1f452ac7-f4ae-4d4a-9380-22709c81614c"
          ]
        },
        {
          "uuid": "4f1904ae-645d-49d9-bbf7-11544e6e172e",
          "code": "53T184B7B7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d5fd0c32-705a-4539-c1a0-aeb5a977cbb0",
          "code": "DTXSID80954517",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80954517",
          "code_system": "EPA CompTox",
          "references": [
            "a91bea09-8576-f9c9-8967-3c421c6138c4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "611ef9d3-4a26-4a9f-a647-8a1b7589e6a1",
          "amount": {
            "uuid": "a52c77c1-0966-4aac-8d75-f7ddb9d81773"
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7d03b52c-eaa7-4429-b68e-2ec7cc4878d7"
          ],
          "related_substance": {
            "uuid": "e8333bff-2eb4-434e-a21d-a2520c271fa3",
            "refuuid": "e2391c2f-a293-4438-b317-7630adb8efd5",
            "name": "MALTITOL",
            "unii": "D65DG142WK",
            "linking_id": "D65DG142WK",
            "ref_pname": "MALTITOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "14689721-025a-4d6d-8d36-e26035067952",
          "name": "D-GLUCITOL, O-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-O-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-",
          "stdName": "D-GLUCITOL, O-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-O-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa5373db-cda0-4a26-bbed-b1a74351106d",
            "2e2fb3c4-9436-4b88-9699-4f51728b3e9a"
          ],
          "display_name": false
        },
        {
          "uuid": "9034b72a-98fd-4439-9b15-5ae75553c11c",
          "name": "GLUCITOL, O-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-O-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-, D",
          "stdName": "GLUCITOL, O-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-O-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-, D",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa5373db-cda0-4a26-bbed-b1a74351106d",
            "2e2fb3c4-9436-4b88-9699-4f51728b3e9a"
          ],
          "display_name": false
        },
        {
          "uuid": "984c455e-d23f-ba6c-0dc0-5c1595203c25",
          "name": "MALTITOL IMPURITY B [EP IMPURITY]",
          "stdName": "MALTITOL IMPURITY B [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b3f8c7-2014-197c-71b9-799498c48c0e"
          ],
          "display_name": false
        },
        {
          "uuid": "dc28a422-f40a-4245-9cc7-d1ba82f2e2ca",
          "name": "MALTOTRIITOL",
          "stdName": "MALTOTRIITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa5373db-cda0-4a26-bbed-b1a74351106d",
            "2e2fb3c4-9436-4b88-9699-4f51728b3e9a"
          ],
          "display_name": true
        },
        {
          "uuid": "cc0d465b-0498-49f2-a996-163b9b396676",
          "name": "O-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-O-ALPHA-D-GLUCOPYRANOSYL- (1->4)-D-GLUCITOL",
          "stdName": "O-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-O-ALPHA-D-GLUCOPYRANOSYL- (1->4)-D-GLUCITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b57cbc88-723d-427b-9b88-5c5d1f7b013f",
            "2e2fb3c4-9436-4b88-9699-4f51728b3e9a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e7b3f8c7-2014-197c-71b9-799498c48c0e",
          "citation": "European Pharmacopoeia Online 9.8, Maltitol Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d5fc276b-fbb8-47e1-bc48-ddf895689592",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "aa5373db-cda0-4a26-bbed-b1a74351106d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2e2fb3c4-9436-4b88-9699-4f51728b3e9a",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b57cbc88-723d-427b-9b88-5c5d1f7b013f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f452ac7-f4ae-4d4a-9380-22709c81614c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392620000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a15c1a81-f1cc-4aee-a910-b95dae9d1fd3",
          "citation": "SRS import [53T184B7B7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=53T184B7B7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392620000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a91bea09-8576-f9c9-8967-3c421c6138c4",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "7d03b52c-eaa7-4429-b68e-2ec7cc4878d7",
          "citation": "European Pharmacopoeia Online 9.8, Maltitol Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "71dd3278-8ae1-45f4-bdb9-3f0d09d97a99",
          "id": "71dd3278-8ae1-45f4-bdb9-3f0d09d97a99",
          "molfile": "\n  Marvin  01132105542D          \n\n 34 35  0  0  1  0            999 V2000\n    9.7844   -6.5322    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.7844   -7.3568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4990   -6.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2136   -6.5322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0698   -6.1200    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.0698   -5.2954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3552   -6.5322    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.3552   -7.3568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6680   -7.7691    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.9534   -7.3568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2388   -7.7691    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.5242   -7.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8096   -7.7691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2388   -8.5936    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.5242   -9.0059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5242   -9.8305    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.2388  -10.2428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2388  -11.0673    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.9534  -11.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6405  -11.0673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5242  -11.4796    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.5242  -12.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8096  -11.0673    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.0949  -11.4796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8096  -10.2428    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.0949   -9.8305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9534   -9.0059    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.9534   -9.8305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6680   -8.5936    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.3552   -9.0059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6680   -6.1200    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.6680   -5.2954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9534   -6.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2388   -6.1200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7 31  1  0  0  0  0\n  9  8  1  6  0  0  0\n  9 10  1  0  0  0  0\n  9 29  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 14 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  6  0  0  0\n 27 14  1  0  0  0  0\n 16 15  1  1  0  0  0\n 16 17  1  0  0  0  0\n 25 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 18 21  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  1  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  6  0  0  0\n 23 25  1  0  0  0  0\n 25 26  1  1  0  0  0\n 27 28  1  1  0  0  0\n 29 27  1  0  0  0  0\n 29 30  1  6  0  0  0\n 31 32  1  1  0  0  0\n 31 33  1  0  0  0  0\n 33 34  1  0  0  0  0\nM  END",
          "smiles": "C([C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)O)O)O)O",
          "formula": "C18H34O16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a1dc1fe8-2fb3-4d62-9315-c5d6db4bb2f9"
          },
          "defined_stereo": 14,
          "ez_centers": 0,
          "molecular_weight": "506.4537",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 14
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "da7aed2a-55b5-4617-a35b-868e65d857b8",
      "version": "8",
      "structure": {
        "id": "6e666939-b922-4cbb-8e08-7da227ab3074",
        "molfile": "\n  Marvin  01132105442D          \n\n 34 35  0  0  1  0            999 V2000\n   11.2136   -6.5322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4990   -6.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7844   -6.5322    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.7844   -7.3568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0698   -6.1200    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.0698   -5.2954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3552   -6.5322    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3552   -7.3568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6680   -7.7691    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.6680   -8.5936    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3552   -9.0059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9534   -9.0059    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9534   -9.8305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2388   -8.5936    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5242   -9.0059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5242   -9.8305    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.8096  -10.2428    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0949   -9.8305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8096  -11.0673    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.0949  -11.4796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5242  -11.4796    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5242  -12.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2388  -11.0673    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.2388  -10.2428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9534  -11.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6405  -11.0673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2388   -7.7691    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.9534   -7.3568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5242   -7.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8096   -7.7691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6680   -6.1200    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.6680   -5.2954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9534   -6.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2388   -6.1200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  6  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  9  8  1  6  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  6  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 16 15  1  1  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  1  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 16 24  1  0  0  0  0\n 23 25  1  6  0  0  0\n 25 26  1  0  0  0  0\n 14 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n  9 28  1  0  0  0  0\n 27 29  1  1  0  0  0\n 29 30  1  0  0  0  0\n  7 31  1  0  0  0  0\n 31 32  1  1  0  0  0\n 31 33  1  0  0  0  0\n 33 34  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)O)O)O)O",
        "formula": "C18H34O16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 14,
        "ez_centers": 0,
        "molecular_weight": "506.4537",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "aa5373db-cda0-4a26-bbed-b1a74351106d",
          "a15c1a81-f1cc-4aee-a910-b95dae9d1fd3"
        ],
        "stereo_centers": 14
      },
      "unii": "53T184B7B7"
    }
  ]
}