{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2bee64f2-d27f-4770-a8de-c1fe391d5165",
          "code": "212-925-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.751",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "393b6112-d0a5-4a7b-a171-0e5118aa4dc0"
          ]
        },
        {
          "uuid": "20f4305d-e9c2-4834-89cc-b6ecfcf56f53",
          "code": "2797",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2797",
          "code_system": "PUBCHEM",
          "references": [
            "393b6112-d0a5-4a7b-a171-0e5118aa4dc0"
          ]
        },
        {
          "uuid": "fae4896d-309e-4471-a277-73f56e5ca7b5",
          "code": "882-09-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=882-09-7",
          "code_system": "CAS",
          "references": [
            "393b6112-d0a5-4a7b-a171-0e5118aa4dc0",
            "8f0a3b92-a9f9-4792-a7e6-407f6c8d2670"
          ]
        },
        {
          "uuid": "5de5acdb-3913-4720-8fb9-15f3a897ba20",
          "code": "C81531",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81531",
          "code_system": "NCI_THESAURUS",
          "references": [
            "393b6112-d0a5-4a7b-a171-0e5118aa4dc0"
          ]
        },
        {
          "uuid": "5381aed7-3faf-41fe-8070-ce8146ddef81",
          "code": "D002995",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002995",
          "code_system": "MESH",
          "references": [
            "393b6112-d0a5-4a7b-a171-0e5118aa4dc0"
          ]
        },
        {
          "uuid": "9ae8c2e7-e295-4ce9-b7c1-10fd4da9cfbc",
          "code": "CLOFIBRIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Clofibric_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "393b6112-d0a5-4a7b-a171-0e5118aa4dc0"
          ]
        },
        {
          "uuid": "3f3fd7cc-2748-48e8-b6ba-f00ddeb55f88",
          "code": "SUB06707MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "393b6112-d0a5-4a7b-a171-0e5118aa4dc0"
          ]
        },
        {
          "uuid": "c391d83f-b8e3-441a-96c8-4030bfd0032f",
          "code": "2439",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2439",
          "code_system": "INN",
          "references": [
            "393b6112-d0a5-4a7b-a171-0e5118aa4dc0"
          ]
        },
        {
          "uuid": "40cdd95b-8865-4622-8e08-773cbef01522",
          "code": "m3641",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3641?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "393b6112-d0a5-4a7b-a171-0e5118aa4dc0"
          ]
        },
        {
          "uuid": "f7c63840-c19a-4ff0-9090-6e765a1c75eb",
          "code": "CHEMBL683",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL683",
          "code_system": "ChEMBL",
          "references": [
            "393b6112-d0a5-4a7b-a171-0e5118aa4dc0"
          ]
        },
        {
          "uuid": "e983c3b3-9ae8-1695-eee1-5c9bd57fe074",
          "code": "DTXSID1040661",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1040661",
          "code_system": "EPA CompTox",
          "references": [
            "88394e80-8abc-57ce-28c4-245cb4e04b38"
          ]
        },
        {
          "uuid": "a148ced7-d6ab-4fa7-23c7-ad6639a04820",
          "code": "C541",
          "comments": "Industrial Aid[C45678]|Pesticide[C737]|Herbicide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C541",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bf086b29-fd3a-7088-f199-b6707f3bc653"
          ]
        },
        {
          "uuid": "4014cd28-38f5-4027-a19f-54fc35f88ced",
          "code": "53PF01Q249",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "33cace91-89a7-3d45-afd5-74862ee631f2",
          "code": "695",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/695",
          "code_system": "DRUG CENTRAL",
          "references": [
            "bf086b29-fd3a-7088-f199-b6707f3bc653"
          ]
        },
        {
          "uuid": "d1957b72-f97d-01f2-03e5-092d8e31b846",
          "code": "34648",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34648",
          "code_system": "CHEBI",
          "references": [
            "bf086b29-fd3a-7088-f199-b6707f3bc653"
          ]
        },
        {
          "uuid": "e291ddeb-3e27-c543-033d-cf22994665da",
          "code": "100000084315",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "64362cb8-5d3a-046b-2933-ef2527766033"
          ]
        },
        {
          "uuid": "2039fbe8-5bf9-9f57-ed1c-6445e080c6c3",
          "code": "1149",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=1149",
          "code_system": "NSC",
          "references": [
            "7d7ada84-ca3c-885b-5a36-0ce51bb1165a"
          ]
        },
        {
          "uuid": "d3d83e32-d46f-9bd4-9385-2ac3cb37c068",
          "code": "clofibric acid",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/clofibric acid.html",
          "code_system": "ALANWOOD",
          "references": [
            "14ae66a1-63b1-e7b0-a48e-57ae26f9a8f8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7a8f594f-4e19-4d10-9c57-6309c1069942",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5e2b6e08-d023-46da-8792-9308e4701ff7",
            "refuuid": "c7f9571a-3279-42e8-8b8e-bbd079f1c47c",
            "name": "CLOFIBRIC ACID",
            "unii": "53PF01Q249",
            "linking_id": "53PF01Q249",
            "ref_pname": "CLOFIBRIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d6dff634-8887-4a77-a22a-8038797857ca",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "1a3a3a3a-0e3c-4dc4-a4f4-48c260c15927",
            "refuuid": "c39b3098-e239-4bcf-9f86-013f60313a0a",
            "name": "PYRIDOXINE CLOFIBRATE",
            "unii": "097241263Y",
            "linking_id": "097241263Y",
            "ref_pname": "PYRIDOXINE CLOFIBRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6d83b81d-9596-4e31-9ec9-a09da6f4c3af",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "5b1916f8-4199-4fee-ae45-b0428303b51e",
            "refuuid": "9b25bba8-08c5-4bcf-ba6b-29696ff948f6",
            "name": "MAGNESIUM CLOFIBRATE",
            "unii": "Y11SP157PJ",
            "linking_id": "Y11SP157PJ",
            "ref_pname": "MAGNESIUM CLOFIBRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "22c466de-4745-416c-8973-2bf5ee8cadac",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "9de95417-9cd6-4dc2-95f2-6a6631aecf38",
            "refuuid": "e0a89481-e587-400a-99c9-0acffb0f8d49",
            "name": "CINNARIZINE CLOFIBRATE",
            "unii": "8RJ419895I",
            "linking_id": "8RJ419895I",
            "ref_pname": "CINNARIZINE CLOFIBRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e7a96339-fee5-42c7-b100-4cb9f7c124ab",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "1ac1ab02-cc64-4261-8db8-a135b23ace22",
            "refuuid": "4d17d4a1-de71-4682-ac28-c49558b91e14",
            "name": "SODIUM CLOFIBRATE",
            "unii": "G05RA8J89U",
            "linking_id": "G05RA8J89U",
            "ref_pname": "SODIUM CLOFIBRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d1eafde5-f64e-4409-9431-66c358fb3168",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "41116b00-e986-4752-8b1b-fa2b7c927954",
            "refuuid": "912776ae-39de-4257-9698-0ac81578fd1d",
            "name": "CALCIUM CLOFIBRATE",
            "unii": "TT85QFR500",
            "linking_id": "TT85QFR500",
            "ref_pname": "CALCIUM CLOFIBRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ff710f77-bd87-4ade-91d6-8582f660a8e7",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "793edc16-7a05-422b-86af-0098aa11c951",
            "refuuid": "d9623bba-f1db-4a95-b4a2-bad99df2a6c1",
            "name": "ALUMINUM CLOFIBRATE",
            "unii": "56203T2K2X",
            "linking_id": "56203T2K2X",
            "ref_pname": "ALUMINUM CLOFIBRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "77995ab0-c74e-42e7-a503-5956198e7d3d",
          "amount": {
            "uuid": "f12db14a-3cee-44f8-b407-51a9ce436a7d",
            "average": 55,
            "units": "MICROMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->ACTIVATOR",
          "references": [
            "69d7fa0c-d9eb-18a2-a909-a7d7799fe916"
          ],
          "related_substance": {
            "uuid": "b6f660d9-eeed-4e4c-a168-174f55713277",
            "refuuid": "a7ee6a49-aa51-4d5a-96b9-cfc822e5c23b",
            "name": "PEROXISOME PROLIFERATOR-ACTIVATED RECEPTOR ALPHA",
            "unii": "2PDN1S3FVX",
            "linking_id": "2PDN1S3FVX",
            "ref_pname": "PEROXISOME PROLIFERATOR-ACTIVATED RECEPTOR ALPHA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d85919d1-0d45-438e-83ea-59d91d85e42f",
          "type": "PRODRUG->METABOLITE ACTIVE",
          "related_substance": {
            "uuid": "a8e62ae9-ca24-4b88-9af2-3bf7c2df4521",
            "refuuid": "69bfecac-f9ad-4105-8eec-ea673dd88ac4",
            "name": "CLOFIBRATE",
            "unii": "HPN91K7FU3",
            "linking_id": "HPN91K7FU3",
            "ref_pname": "CLOFIBRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a2e719bf-61fa-4716-a3eb-d4d84ef536b1",
          "name": "2-(4-CHLOROPHENOXY)-2-METHYLPROPANOIC ACID",
          "stdName": "2-(4-CHLOROPHENOXY)-2-METHYLPROPANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "156fc2c0-0fec-4e95-81aa-f4a2c5d368e9",
            "ab0f5cbf-2066-4840-b334-0389ffede3c9"
          ],
          "display_name": false
        },
        {
          "uuid": "741d950e-3020-4327-b627-ae7cdbd8db63",
          "name": "2-(4-CHLOROPHENOXY)-2-METHYLPROPIONIC ACID",
          "stdName": "2-(4-CHLOROPHENOXY)-2-METHYLPROPIONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab0f5cbf-2066-4840-b334-0389ffede3c9",
            "631eee49-fac1-4f6e-a4ba-bbff70dcca0a"
          ],
          "display_name": false
        },
        {
          "uuid": "83a19c14-ad6d-4ef4-ab2f-b750a0c9a1c1",
          "name": "2-(P-CHLOROPHENOXY)-2-METHYLPROPIONIC ACID",
          "stdName": "2-(P-CHLOROPHENOXY)-2-METHYLPROPIONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2aa40079-59a1-4cc7-862b-a3c19ea82797"
          ],
          "display_name": false
        },
        {
          "uuid": "8969fbee-fe3b-4fe0-ba3a-e26fdb855006",
          "name": "CLOFIBRIC ACID",
          "stdName": "CLOFIBRIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58c04a16-5860-4381-975b-8519e1ad2cd2",
            "2aa40079-59a1-4cc7-862b-a3c19ea82797",
            "58a7e2b7-c5ab-48d9-9c08-f25bd862cb31",
            "d659fce4-0db5-4dde-b8b4-e903c122e168",
            "22f70ecd-0916-44a2-9bfe-bc3248b5f26e",
            "5ffbe9b3-99d1-4c1a-b6a9-ff278d17c126",
            "10a72c3d-e240-44ce-b9ca-789bbe1f4381",
            "8a7be1d1-ef9c-4b85-a20b-84d4e02d0f0c"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ff623cd6-3ff9-4737-bc8d-837f392e598d",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "1e2fb251-efcf-4e1e-adf0-fc1fe7150e8f",
          "name": "CLOFIBRIC ACID [MI]",
          "stdName": "CLOFIBRIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a72c3d-e240-44ce-b9ca-789bbe1f4381",
            "8a7be1d1-ef9c-4b85-a20b-84d4e02d0f0c"
          ],
          "display_name": false
        },
        {
          "uuid": "7e3fcd99-2840-9b32-0aba-bcf486e359b0",
          "name": "Clofibric acid [WHO-DD]",
          "stdName": "CLOFIBRIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fedebc2-cfe9-12eb-8607-b11dbb19d708"
          ],
          "display_name": false
        },
        {
          "uuid": "648fc907-46e3-4c3e-bff3-ed7ccd5d10a9",
          "name": "NSC-1149",
          "stdName": "NSC-1149",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02c0a3f2-7890-40fa-a3ad-eb99006a3580",
            "8a7be1d1-ef9c-4b85-a20b-84d4e02d0f0c"
          ],
          "display_name": false
        },
        {
          "uuid": "6fbf1282-da56-4985-8bd3-65e6e6766918",
          "name": "clofibric acid [INN]",
          "stdName": "CLOFIBRIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d659fce4-0db5-4dde-b8b4-e903c122e168"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2aa40079-59a1-4cc7-862b-a3c19ea82797",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ab0f5cbf-2066-4840-b334-0389ffede3c9",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "631eee49-fac1-4f6e-a4ba-bbff70dcca0a",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "156fc2c0-0fec-4e95-81aa-f4a2c5d368e9",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d659fce4-0db5-4dde-b8b4-e903c122e168",
          "citation": "INN Proposed List 20",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL20.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "10a72c3d-e240-44ce-b9ca-789bbe1f4381",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a7be1d1-ef9c-4b85-a20b-84d4e02d0f0c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58c04a16-5860-4381-975b-8519e1ad2cd2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02c0a3f2-7890-40fa-a3ad-eb99006a3580",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "393b6112-d0a5-4a7b-a171-0e5118aa4dc0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390694000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "342fe3df-c02a-48d6-a459-b5512a8aec4f",
          "citation": "SRS import [53PF01Q249]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=53PF01Q249",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390694000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22f70ecd-0916-44a2-9bfe-bc3248b5f26e",
          "citation": "CLOFIBRIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "58a7e2b7-c5ab-48d9-9c08-f25bd862cb31",
          "citation": "CLOFIBRIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5ffbe9b3-99d1-4c1a-b6a9-ff278d17c126",
          "citation": "CLOFIBRIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "69d7fa0c-d9eb-18a2-a909-a7d7799fe916",
          "citation": "Ghonem, Nisanne S., David N. Assis, and James L. Boyer. \"Fibrates and cholestasis.\" Hepatology 62.2 (2015): 635-643.",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/hep.27744/full",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "88394e80-8abc-57ce-28c4-245cb4e04b38",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=882-09-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "64362cb8-5d3a-046b-2933-ef2527766033",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "bf086b29-fd3a-7088-f199-b6707f3bc653",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8f0a3b92-a9f9-4792-a7e6-407f6c8d2670",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "14ae66a1-63b1-e7b0-a48e-57ae26f9a8f8",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "c17eb24e-e731-473c-1b7a-2285c1511382",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4fedebc2-cfe9-12eb-8607-b11dbb19d708",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7d7ada84-ca3c-885b-5a36-0ce51bb1165a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "03681e67-f88b-48a0-b826-ae803ce11795",
          "id": "03681e67-f88b-48a0-b826-ae803ce11795",
          "molfile": "\n  Marvin  01132100292D          \n\n 14 14  0  0  0  0            999 V2000\n    3.4792   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0667   -0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6542   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3458    0.3750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6333   -0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6333   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9208   -1.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2042   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5083   -1.2750    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.2042   -0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9208    0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7833    0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7833    1.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4958   -0.0375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n 12  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 11  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(C(=O)O)Oc1ccc(cc1)Cl",
          "formula": "C10H11ClO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "42d8a145-476f-4ef1-8246-32b7124d217a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "214.6459",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c7f9571a-3279-42e8-8b8e-bbd079f1c47c",
      "version": "17",
      "structure": {
        "id": "346a9217-c1ed-4ada-9c8c-d5d0a79ba284",
        "molfile": "\n  Marvin  01132102482D          \n\n 14 14  0  0  0  0            999 V2000\n    3.0667   -0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7833    0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3458    0.3750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7833    1.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6333   -0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2042   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4958   -0.0375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5083   -1.2750    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.6333   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9208    0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9208   -1.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2042   -0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4792   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6542   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6 12  2  0  0  0  0\n  7  2  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  9  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14  1  1  0  0  0  0\n 11  6  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C(=O)O)Oc1ccc(cc1)Cl",
        "formula": "C10H11ClO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "214.6459",
        "optical_activity": "NONE",
        "references": [
          "2aa40079-59a1-4cc7-862b-a3c19ea82797",
          "342fe3df-c02a-48d6-a459-b5512a8aec4f",
          "d659fce4-0db5-4dde-b8b4-e903c122e168"
        ],
        "stereo_centers": 0
      },
      "unii": "53PF01Q249"
    }
  ]
}