{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8f4033e3-410f-4969-9942-d49e10360149",
          "code": "104040-79-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=104040-79-1",
          "code_system": "CAS",
          "references": [
            "1dd5106b-703b-4eea-91e1-bfd3ae5eb32c",
            "0ec3830f-af64-4916-860c-c40c053a9b21"
          ]
        },
        {
          "uuid": "e4e29d0c-1da6-42c4-8753-75b65de82bc6",
          "code": "128931",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1522",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "1dd5106b-703b-4eea-91e1-bfd3ae5eb32c"
          ]
        },
        {
          "uuid": "5e3628df-1103-4d2b-bcb9-6efe26045ce1",
          "code": "18772449",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18772449",
          "code_system": "PUBCHEM",
          "references": [
            "1dd5106b-703b-4eea-91e1-bfd3ae5eb32c"
          ]
        },
        {
          "uuid": "9a23f601-c798-3248-f0b6-38e2baa35bf0",
          "code": "DTXSID4034366",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4034366",
          "code_system": "EPA CompTox",
          "references": [
            "49a74813-faf5-4036-3b73-ef4aabdd9b8e"
          ]
        },
        {
          "uuid": "0a31a338-9c72-447b-8b85-37cac6ea68ad",
          "code": "53I19O3887",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5c5a345a-acb4-5f69-be60-4ae4e4d3a741",
          "code": "dicamba-diglycolamine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/dicamba-diglycolamine.html",
          "code_system": "ALANWOOD",
          "references": [
            "12efe28a-8484-1736-0511-5dd9b9f30931"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4c3b3499-2997-4058-bee6-37d7cf9b94c8",
          "name": "2-(2-AMINOETHOXY)ETHANOL 3,6-DICHLORO-O-ANISATE",
          "stdName": "2-(2-AMINOETHOXY)ETHANOL 3,6-DICHLORO-O-ANISATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7eb65b3d-086d-493f-92a7-81d64279dfe2"
          ],
          "display_name": false
        },
        {
          "uuid": "d087f5ea-1698-4c3f-8de6-52df57d9798c",
          "name": "BENZOIC ACID, 3,6-DICHLORO-2-METHOXY-, COMPD. WITH 2-(2-AMINOETHOXY)ETHANOL (1:1)",
          "stdName": "BENZOIC ACID, 3,6-DICHLORO-2-METHOXY-, COMPD. WITH 2-(2-AMINOETHOXY)ETHANOL (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad1e89dd-ae72-4b1d-a7a3-35624174cf12"
          ],
          "display_name": false
        },
        {
          "uuid": "b030d610-fa41-4071-bebe-761f7ab73f4d",
          "name": "CLARITY",
          "stdName": "CLARITY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad1e89dd-ae72-4b1d-a7a3-35624174cf12"
          ],
          "display_name": false
        },
        {
          "uuid": "4e192a39-a549-47f4-991e-b8a1331590dc",
          "name": "DICAMBA DIGLYCOLAMINE",
          "stdName": "DICAMBA DIGLYCOLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad1e89dd-ae72-4b1d-a7a3-35624174cf12"
          ],
          "display_name": false
        },
        {
          "uuid": "fcd1649c-5fda-4c4a-ad1d-7e15bbc9a13d",
          "name": "DICAMBA-DIGLYCOAMINE",
          "stdName": "DICAMBA-DIGLYCOAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f34f9fc-a73e-4dca-9907-dc56a705fed2"
          ],
          "display_name": true
        },
        {
          "uuid": "623ce59a-1d52-4ac9-a9c9-11cae4cbf3ec",
          "name": "DICAMBA-DIGLYCOLAMINE [ISO]",
          "stdName": "DICAMBA-DIGLYCOLAMINE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1209c53-2e78-405d-b229-b5e304967e9a"
          ],
          "display_name": false
        },
        {
          "uuid": "cc76a788-e83f-432d-9f3b-41ed3980b717",
          "name": "EPA PESTICIDE CHEMICAL CODE 128931",
          "stdName": "EPA PESTICIDE CHEMICAL CODE 128931",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7eb65b3d-086d-493f-92a7-81d64279dfe2"
          ],
          "display_name": false
        },
        {
          "uuid": "65cc2cee-5553-4a20-8161-fae0bb9b6234",
          "name": "ETHANOL, 2-(2-AMINOETHOXY)-, 3,6-DICHLORO-2-METHOXYBENZOATE (SALT)",
          "stdName": "ETHANOL, 2-(2-AMINOETHOXY)-, 3,6-DICHLORO-2-METHOXYBENZOATE (SALT)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad1e89dd-ae72-4b1d-a7a3-35624174cf12"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6f34f9fc-a73e-4dca-9907-dc56a705fed2",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7eb65b3d-086d-493f-92a7-81d64279dfe2",
          "citation": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:1,3,31,7,12,25:P3_XCHEMICAL_ID:1522",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:1,3,31,7,12,25:P3_XCHEMICAL_ID:1522",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad1e89dd-ae72-4b1d-a7a3-35624174cf12",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1209c53-2e78-405d-b229-b5e304967e9a",
          "citation": "AW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1dd5106b-703b-4eea-91e1-bfd3ae5eb32c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392090000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "003f0c36-c520-46f9-b0a9-49d93f1eef4f",
          "citation": "SRS import [53I19O3887]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=53I19O3887",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392090000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49a74813-faf5-4036-3b73-ef4aabdd9b8e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=104040-79-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "12efe28a-8484-1736-0511-5dd9b9f30931",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "0ec3830f-af64-4916-860c-c40c053a9b21",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "815ee0c4-8c7e-47f2-8bc6-525f558cb9cf",
          "id": "815ee0c4-8c7e-47f2-8bc6-525f558cb9cf",
          "molfile": "\n  Marvin  01132106432D          \n\n  7  6  0  0  0  0            999 V2000\n    1.9981    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7145   -0.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4245    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1470   -0.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8571    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5734   -0.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2835    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\nM  END",
          "smiles": "C(COCCO)N",
          "formula": "C4H11NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "489e53cc-0762-4781-941c-2839099bf955"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "105.1358",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a13e3dec-e431-4e44-bdb3-431f67b519ee",
          "id": "a13e3dec-e431-4e44-bdb3-431f67b519ee",
          "molfile": "\n  Marvin  01132108222D          \n\n 13 13  0  0  0  0            999 V2000\n    0.0000   -2.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -2.7996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4290   -2.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4290   -1.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -1.1497    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1436   -1.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8581   -1.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8581   -2.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5726   -2.7996    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1436   -2.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1436   -3.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8581   -4.0272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4290   -4.0272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 10  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
          "smiles": "COc1c(ccc(c1C(=O)O)Cl)Cl",
          "formula": "C8H6Cl2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bd58b738-368b-4b43-a2a3-2b541361ec01"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "221.0376",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "47e16d7f-fb1b-48da-8d5e-d2b02978b383",
      "version": "4",
      "structure": {
        "id": "da16cd54-d26f-4175-a383-bfd26c2b1588",
        "molfile": "\n  Marvin  01132111192D          \n\n 20 19  0  0  0  0            999 V2000\n    5.7560   -0.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0162    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4893    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2829   -0.4283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5367    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8034   -0.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0636    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1415   -3.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8553   -4.0233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1415   -2.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -4.0233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -2.3816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8553   -2.3816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8553   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1415   -1.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7138   -1.1486    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.5691   -2.7969    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7138   -2.7969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.3816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 10 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 19  1  0  0  0  0\n 13 15  2  0  0  0  0\n 13 18  1  0  0  0  0\n 14 16  2  0  0  0  0\n 14 17  1  0  0  0  0\n 15 16  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "COc1c(ccc(c1C(=O)O)Cl)Cl.C(COCCO)N",
        "formula": "C8H6Cl2O3.C4H11NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "326.1734",
        "optical_activity": "NONE",
        "references": [
          "003f0c36-c520-46f9-b0a9-49d93f1eef4f",
          "6f34f9fc-a73e-4dca-9907-dc56a705fed2"
        ],
        "stereo_centers": 0
      },
      "unii": "53I19O3887"
    }
  ]
}