{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "68fe4ac5-c7ab-da08-9705-5fa864feac30", "code": "222530-13-4", "type": "MAJOR COMPONENT STRUCTURE/SEQUENCE", "url": "https://commonchemistry.cas.org/detail?cas_rn=222530-13-4", "code_system": "CAS", "references": [ "53773e09-bbdb-0f13-0100-77638561ba14" ] }, { "uuid": "cf5b606c-6db5-2179-e75f-9b5d50ed2915", "code": "148618-57-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=148618-57-9", "code_system": "CAS", "references": [ "53773e09-bbdb-0f13-0100-77638561ba14" ] }, { "uuid": "74d9e1a3-6da6-4622-ac0e-ac1f8280e4d0", "code": "108777-93-1", "type": "GENERIC (FAMILY)", "url": "https://commonchemistry.cas.org/detail?cas_rn=108777-93-1", "code_system": "CAS", "references": [ "53773e09-bbdb-0f13-0100-77638561ba14" ] }, { "uuid": "39c402d1-b344-4890-c173-833479b4bab6", "code": "9882524", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9882524", "code_system": "PUBCHEM", "references": [ "0add68f6-2d43-f844-df23-7878ca2832d3" ] }, { "uuid": "a886ed6e-fcab-4838-8469-6311f78b585a", "code": "53CTY7PX9D", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b59f629d-99b7-67b1-1704-63cbd7ad47e7", "name": "DIGLYCERIN CAPRYLIC ACID ESTER", "stdName": "DIGLYCERIN CAPRYLIC ACID ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "53773e09-bbdb-0f13-0100-77638561ba14" ], "display_name": false }, { "uuid": "56c64d00-286d-bdc1-9f4c-b7c140ea1191", "name": "DIGLYCERYL CAPRYLATE", "stdName": "DIGLYCERYL CAPRYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5a64d447-55df-f91d-1f69-2c7bdc424591" ], "display_name": false }, { "uuid": "83d7c99b-9981-b5a7-83a4-a995d03e8f87", "name": "OCTANOIC ACID, ESTER WITH OXYBIS(PROPANEDIOL)", "stdName": "OCTANOIC ACID, ESTER WITH OXYBIS(PROPANEDIOL)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "53773e09-bbdb-0f13-0100-77638561ba14" ], "display_name": false }, { "uuid": "0f5442f3-5172-b5f8-43f2-5d0e4e8b433e", "name": "POLYGLYCERYL-2 CAPRYLATE", "stdName": "POLYGLYCERYL-2 CAPRYLATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "53773e09-bbdb-0f13-0100-77638561ba14" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "6c8084d6-c6af-79f0-8d0c-da3f03e732ea", "name_org": "INCI" } ] }, { "uuid": "0e52e682-521b-aa1a-8844-2aa9599fa51b", "name": "SALACOS DG 158", "stdName": "SALACOS DG 158", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "53773e09-bbdb-0f13-0100-77638561ba14" ], "display_name": false } ], "references": [ { "uuid": "53773e09-bbdb-0f13-0100-77638561ba14", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "document_date": 1493393769000, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5a64d447-55df-f91d-1f69-2c7bdc424591", "citation": "PCPC-DB", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true }, { "uuid": "0add68f6-2d43-f844-df23-7878ca2832d3", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "79e52215-89c8-629d-c1d6-24d7064491e2", "id": "79e52215-89c8-629d-c1d6-24d7064491e2", "molfile": "\n Marvin 01132106202D \n\n 20 19 0 0 0 0 999 V2000\n 20.1712 -6.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.1712 -5.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4566 -5.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4566 -4.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7420 -4.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7420 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0275 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0275 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7419 -1.6498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3130 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5985 -2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8840 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 15.8840 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1696 -2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4551 -1.6501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7406 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0261 -1.6503 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 13.0261 -0.8253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3117 -2.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5971 -1.6504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 17 1 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "CCCCCCCC(=O)OCC(COCC(CO)O)O", "formula": "C14H28O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e101be1b-e228-4293-a061-cb8f450cf704" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "292.3691", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "REPRESENTATIVE", "uuid": "0e249ecf-fd75-2aa7-8973-91f8c86fb5b2", "version": "6", "structure": { "id": "e2f9f648-736f-ebfc-e095-d8219f9b5efc", "molfile": "\n Marvin 01132111452D \n\n 20 19 0 0 0 0 999 V2000\n 15.8840 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0261 -0.8253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5971 -1.6504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3117 -2.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0261 -1.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7406 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4551 -1.6501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1696 -2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8840 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5985 -2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3130 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.1712 -6.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.1712 -5.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4566 -5.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4566 -4.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7420 -4.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7420 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0275 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0275 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7419 -1.6498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19 20 2 0 0 0 0\n 19 18 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 12 1 0 0 0 0\n 19 11 1 0 0 0 0\n 10 11 1 0 0 0 0\n 9 10 1 0 0 0 0\n 8 9 1 0 0 0 0\n 7 8 1 0 0 0 0\n 6 7 1 0 0 0 0\n 5 6 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 2 1 0 0 0 0\n 9 1 1 0 0 0 0\nM END", "smiles": "CCCCCCCC(=O)OCC(COCC(CO)O)O", "formula": "C14H28O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "292.3691", "optical_activity": "UNSPECIFIED", "references": [ "53773e09-bbdb-0f13-0100-77638561ba14", "5a64d447-55df-f91d-1f69-2c7bdc424591" ], "stereo_centers": 2, "stereo_comments": "Assumed mixed" }, "unii": "53CTY7PX9D" } ] }