{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "646d082e-12e3-4ffa-aa62-5c67be1aec07",
          "code": "6151-25-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6151-25-3",
          "code_system": "CAS",
          "references": [
            "75fea17e-fba5-4216-8098-70c31e18d024",
            "aec2251a-efdb-475e-9f05-b4b5a2296b7d"
          ]
        },
        {
          "uuid": "725391af-27b3-412d-b7bd-553f075bfdc5",
          "code": "C75768",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75768",
          "code_system": "NCI_THESAURUS",
          "references": [
            "75fea17e-fba5-4216-8098-70c31e18d024"
          ]
        },
        {
          "uuid": "62b5b392-e751-4a13-b09d-2c99d18f70e0",
          "code": "m9420",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9420?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "75fea17e-fba5-4216-8098-70c31e18d024"
          ]
        },
        {
          "uuid": "efa827bc-1576-4235-ba65-ebdda01aa986",
          "code": "SUB32931",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "75fea17e-fba5-4216-8098-70c31e18d024"
          ]
        },
        {
          "uuid": "9832954f-7580-4d72-913a-1792829e6e1e",
          "code": "5284452",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5284452",
          "code_system": "PUBCHEM",
          "references": [
            "75fea17e-fba5-4216-8098-70c31e18d024"
          ]
        },
        {
          "uuid": "3049869e-89e6-46e1-24af-2c282dc55f07",
          "code": "Quercetin dihydrate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Quercetin_dihydrate",
          "code_system": "WIKIPEDIA",
          "references": [
            "ae078571-c87e-ba54-2af1-08e2bfffeee9"
          ]
        },
        {
          "uuid": "eef1b0f9-a49f-6e57-a30e-d6c9f20d1153",
          "code": "DTXSID9021219",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9021219",
          "code_system": "EPA CompTox",
          "references": [
            "6d490429-8dfb-555b-a5c5-cbc64deb2df3"
          ]
        },
        {
          "uuid": "edfbf60f-1718-2541-35dc-0340ad6398af",
          "code": "C306",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Antioxidant[C275]|Bioflavonoid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C306",
          "code_system": "NCI_THESAURUS",
          "references": [
            "06c1c1ec-dac8-0cef-8ead-3e27a20625e3"
          ]
        },
        {
          "uuid": "e9bc2204-0bd3-4750-a5d5-b39137196b35",
          "code": "53B03V78A6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "af526243-d590-4334-700a-cb044c572dce",
          "code": "100000125904",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5a8ce763-21a9-a230-e9f2-6aacfeb61dc4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ecdaac6a-72b7-9c32-212c-752d750c0aa3",
          "type": "ANHYDROUS->SOLVATE",
          "references": [
            "aec2251a-efdb-475e-9f05-b4b5a2296b7d"
          ],
          "related_substance": {
            "uuid": "84f36a74-38b6-4d9e-89db-41b62dd2988a",
            "refuuid": "04621855-3c6a-428c-a1cd-544e8f79d1fd",
            "name": "QUERCETIN",
            "unii": "9IKM0I5T1E",
            "linking_id": "9IKM0I5T1E",
            "ref_pname": "QUERCETIN"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "98fb50c6-5870-4e0a-aa51-f13d00b35ba6",
          "name": "QUERCETIN DIHYDRATE",
          "stdName": "QUERCETIN DIHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0cb9000a-cfb2-4f25-b26c-514d7b54bbc3",
            "c5856c61-5acb-4ef2-8b72-e2e2a7ce8fc9",
            "35ea6779-409e-480f-b457-dad958515f79",
            "f5fc0fb4-4293-4d02-b1b2-9679e6ace74f",
            "f85d3936-7cb0-4911-bd24-caf5db991d05",
            "5360508e-bebf-4206-baa8-aaca24391b67"
          ],
          "display_name": true
        },
        {
          "uuid": "6c97a855-313e-4041-bf15-8ece26140033",
          "name": "QUERCETIN DIHYDRATE [MI]",
          "stdName": "QUERCETIN DIHYDRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5856c61-5acb-4ef2-8b72-e2e2a7ce8fc9",
            "f85d3936-7cb0-4911-bd24-caf5db991d05"
          ],
          "display_name": false
        },
        {
          "uuid": "3632e9e2-7555-6972-bce0-581c5cf09b13",
          "name": "Quercetin dihydrate [WHO-DD]",
          "stdName": "QUERCETIN DIHYDRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f765d4a-5351-fe3b-0d81-c165ffcb4eba"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5360508e-bebf-4206-baa8-aaca24391b67",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f5fc0fb4-4293-4d02-b1b2-9679e6ace74f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f85d3936-7cb0-4911-bd24-caf5db991d05",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5856c61-5acb-4ef2-8b72-e2e2a7ce8fc9",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75fea17e-fba5-4216-8098-70c31e18d024",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390691000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54217fa4-61c8-4429-9fe0-cc5fb020a8ef",
          "citation": "SRS import [53B03V78A6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=53B03V78A6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390691000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0cb9000a-cfb2-4f25-b26c-514d7b54bbc3",
          "citation": "QUERCETIN DIHYDRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "35ea6779-409e-480f-b457-dad958515f79",
          "citation": "QUERCETIN DIHYDRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae078571-c87e-ba54-2af1-08e2bfffeee9",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Quercetin_dihydrate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6d490429-8dfb-555b-a5c5-cbc64deb2df3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6151-25-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a8ce763-21a9-a230-e9f2-6aacfeb61dc4",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "06c1c1ec-dac8-0cef-8ead-3e27a20625e3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "aec2251a-efdb-475e-9f05-b4b5a2296b7d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c99fbc1a-f2de-0995-a12f-ccb8d2b9d062",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "3f765d4a-5351-fe3b-0d81-c165ffcb4eba",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "586a2317-86cc-44f4-a2b2-9257c2f12839",
          "id": "586a2317-86cc-44f4-a2b2-9257c2f12839",
          "molfile": "\n  Marvin  01132104352D          \n\n  1  0  0  0  0  0            999 V2000\n   13.5783   -4.5145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "O",
          "formula": "H2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "15dc926d-a762-42f6-b7bb-1eeb03aefd3e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "18.0153",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "33c23251-e2ca-45e8-9da8-8d7565ebf680",
          "id": "33c23251-e2ca-45e8-9da8-8d7565ebf680",
          "molfile": "\n  Marvin  01132102462D          \n\n 22 24  0  0  0  0            999 V2000\n    7.0435   -7.5822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0435   -6.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7549   -6.3474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7549   -5.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4666   -5.1051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0543   -5.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3366   -5.5217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3366   -6.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6236   -5.1144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6236   -4.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9147   -3.8802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9147   -3.0499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1951   -2.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4828   -3.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7621   -2.6371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4828   -3.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6788   -4.0911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1971   -4.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3366   -3.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3366   -3.0539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0543   -4.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7675   -3.8781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n 21  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 19  2  0  0  0  0\n 11 12  1  0  0  0  0\n 18 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  2  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1-c2c(c(=O)c3c(cc(cc3o2)O)O)O)O)O",
          "formula": "C15H10O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "eb36a344-9260-476a-be95-d46cc6054ddc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "302.2363",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5aac4153-1259-478a-9241-45a59a39ef02",
      "version": "23",
      "structure": {
        "id": "45c2b231-f034-4fe5-8f19-e003aa51a167",
        "molfile": "\n   JSDraw205282111202D\n\n 24 24  0  0  0  0              0 V2000\n   15.8912   -3.8098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2377   -3.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5980   -3.8022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5980   -5.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2415   -6.1613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8912   -5.3726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3713   -5.7705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9381   -6.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9381   -7.7050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2860   -8.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2860  -10.0345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6223  -10.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9672  -10.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9672   -8.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6427   -7.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6427   -6.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9910   -5.3679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2860   -5.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2860   -3.8098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3126   -7.6874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6223  -12.3701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5287   -3.0219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   34.9758   -6.5709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   34.9758   -6.5709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  1  6  2  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 10  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n  8 18  2  0  0  0  0\n 14 20  1  0  0  0  0\n 12 21  1  0  0  0  0\n  1 22  1  0  0  0  0\n  2  1  1  0  0  0  0\nM  STY  1   1 MUL\nM  SAL   1  2  23  24\nM  SPA   1  1  23\nM  SDI   1  4   34.1818   -7.3649   34.1818   -5.7770\nM  SDI   1  4   35.7697   -5.7770   35.7697   -7.3649\nM  SMT   1 2\nM  END",
        "smiles": "c1cc(c(cc1-c2c(c(=O)c3c(cc(cc3o2)O)O)O)O)O.O.O",
        "formula": "C15H10O7.2H2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "338.2669",
        "optical_activity": "NONE",
        "references": [
          "5360508e-bebf-4206-baa8-aaca24391b67",
          "54217fa4-61c8-4429-9fe0-cc5fb020a8ef"
        ],
        "stereo_centers": 0
      },
      "unii": "53B03V78A6"
    }
  ]
}