{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2de04dc5-cd46-4292-96d8-caddbf6ec97b",
          "code": "N06BX06",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|citicoline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06BX06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5"
          ]
        },
        {
          "uuid": "aa491156-9f77-4787-88bf-08e7a77b3210",
          "code": "QN06BX06",
          "comments": "VATC|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|citicoline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06BX06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5"
          ]
        },
        {
          "uuid": "5a312ddc-4209-4b2c-985e-96e20d48f4d9",
          "code": "987-78-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=987-78-0",
          "code_system": "CAS",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5",
            "d3c613e1-b31b-4aaa-91e4-1db12a7cd200"
          ]
        },
        {
          "uuid": "4c01af14-b063-42f3-abaa-2a64c2db8516",
          "code": "C96743",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C96743",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5"
          ]
        },
        {
          "uuid": "e9aa6d22-ec59-4475-8887-67406c53a245",
          "code": "CITICOLINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Citicoline",
          "code_system": "WIKIPEDIA",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5"
          ]
        },
        {
          "uuid": "c87f28e7-bf95-4e38-b72f-650da67a7f8b",
          "code": "SUB07489MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5"
          ]
        },
        {
          "uuid": "44f40d44-e5e6-4775-93bf-af2eb4623f58",
          "code": "2290",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2290",
          "code_system": "INN",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5"
          ]
        },
        {
          "uuid": "51f76276-2970-47de-b4ac-9b24fd4bf2b0",
          "code": "213-580-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.346",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5"
          ]
        },
        {
          "uuid": "d13546bc-3d07-4ddb-ac8a-4a83ea12f339",
          "code": "997602",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/997602/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5"
          ]
        },
        {
          "uuid": "b2c3c793-3a88-4d88-8e50-58a74a78c61c",
          "code": "m3588",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3588?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5"
          ]
        },
        {
          "uuid": "a1eccf6d-6141-49f1-9241-acb692e14677",
          "code": "CHEMBL1618340",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1618340",
          "code_system": "ChEMBL",
          "references": [
            "0ebf9f5c-422a-4422-90db-46db69e5b9c5"
          ]
        },
        {
          "uuid": "75665dad-e6d9-db3c-cabe-419b54307835",
          "code": "DTXSID9048431",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9048431",
          "code_system": "EPA CompTox",
          "references": [
            "4cd3c70e-6d3b-9215-6b00-efad9dee243b"
          ]
        },
        {
          "uuid": "ca838533-8e2e-3997-8a76-d7ef8ff04aac",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "839d5205-84d3-2fa3-aa36-b172133d282d"
          ]
        },
        {
          "uuid": "a34f2be5-a0ad-485d-ac36-5234cdeaa09b",
          "code": "536BQ2JVC7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "865e66e2-c7e4-a45a-d0c3-ddd744301b71",
          "code": "13804",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13804",
          "code_system": "PUBCHEM",
          "references": [
            "01716cf1-2bbe-ee7d-aa7f-1e988ce3dca9"
          ]
        },
        {
          "uuid": "0c3af705-34f5-6b8b-57a0-eec6326c7ffa",
          "code": "410 (Number of products:116)",
          "comments": "Dietary Supplement Label Database|Chemical|Citicoline",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=410&item=Citicoline",
          "code_system": "DSLD",
          "references": [
            "839d5205-84d3-2fa3-aa36-b172133d282d"
          ]
        },
        {
          "uuid": "7eaeef95-6fab-fbd1-272d-d5ac8efe6576",
          "code": "664",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/664",
          "code_system": "DRUG CENTRAL",
          "references": [
            "839d5205-84d3-2fa3-aa36-b172133d282d"
          ]
        },
        {
          "uuid": "df09986c-605e-2064-721c-baf23cc8de46",
          "code": "3806 (Number of products:13)",
          "comments": "Dietary Supplement Label Database|chemical|Citicholine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3806&item=Citicholine",
          "code_system": "DSLD",
          "references": [
            "839d5205-84d3-2fa3-aa36-b172133d282d"
          ]
        },
        {
          "uuid": "dde43a48-5879-79d1-6ed8-5cb162dde271",
          "code": "DB12153",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB12153",
          "code_system": "DRUG BANK",
          "references": [
            "839d5205-84d3-2fa3-aa36-b172133d282d"
          ]
        },
        {
          "uuid": "cd9c3442-8119-8764-fbe6-c19f7774da9b",
          "code": "58779",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58779",
          "code_system": "CHEBI",
          "references": [
            "839d5205-84d3-2fa3-aa36-b172133d282d"
          ]
        },
        {
          "uuid": "055a2bda-f859-aa9d-5adf-9fdf87444b3c",
          "code": "16436",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16436",
          "code_system": "CHEBI",
          "references": [
            "839d5205-84d3-2fa3-aa36-b172133d282d"
          ]
        },
        {
          "uuid": "712f7f9c-7658-c6ac-47e4-0b36e8937b87",
          "code": "1135123",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1135123",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "839d5205-84d3-2fa3-aa36-b172133d282d"
          ]
        },
        {
          "uuid": "6933073a-2fa4-1a8d-3e9f-fb9ec999e623",
          "code": "122002",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=122002",
          "code_system": "NSC",
          "references": [
            "741337b1-b83d-968d-a69a-ffd919235d46"
          ]
        },
        {
          "uuid": "61583da2-e31a-63bd-9f40-595b0e47c946",
          "code": "100000092654",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1c430479-12eb-e63b-ccdf-240e0cecd65a"
          ]
        },
        {
          "uuid": "387d26a3-955d-5565-9319-9e9ecc62eea9",
          "code": "536BQ2JVC7",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=536BQ2JVC7",
          "code_system": "DAILYMED",
          "references": [
            "b855a53f-4971-b007-db10-e6080ba672b1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "937faa45-10d9-4f7f-8910-ec9650a15cab",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7a6e554b-c6f6-4fdd-9664-7a77f5deb4b2",
            "refuuid": "b3d13d8f-cd7b-40ec-91ee-c77202ea1a00",
            "name": "CITICOLINE",
            "unii": "536BQ2JVC7",
            "linking_id": "536BQ2JVC7",
            "ref_pname": "CITICOLINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "70b2091c-67c7-410f-bce5-f72dcafd1380",
          "name": "CDP-CHOLINE",
          "stdName": "CDP-CHOLINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2127d9a-3826-4480-a39d-1d32e616cbb5"
          ],
          "display_name": false
        },
        {
          "uuid": "8b55b3b5-c919-4cec-bf9c-e1376d9b08d3",
          "name": "CITICOLINE",
          "stdName": "CITICOLINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6dd66793-68b6-4d62-b023-b4a1d5c79bd4",
            "3016e76d-02c8-4d99-a95b-c529a92c65de",
            "dc2725d2-4249-40d6-8ad0-ba396f360738",
            "2947c80d-8fec-47a0-a2d5-4a82553bf41c",
            "fe147d6c-404e-4f09-a2ea-2897c3afd09f",
            "f82c2b9a-2cb3-462e-b706-d9bb05ef171a",
            "24ed7d79-fb34-4702-ba4f-b7c2cee13c9f",
            "d37b1dd6-7721-454f-aab0-c680610d6779",
            "d54b7230-5698-4b5f-9c52-e47030798d92",
            "b9cb26e4-f4ba-4fd9-9f1f-c0aa53ced668",
            "fdc7cf71-3c7d-432c-9e8f-3218289bf6b7",
            "7642795e-339e-4eb5-b6b5-d5114de5d581",
            "845cdc4c-47ee-4dbe-931e-7dc7119e3ee6"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "00433fc1-6a34-4d11-aff7-468aa855ca50",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "40e89c86-63c7-4b35-9b6c-f8d8ae2caf22",
          "name": "CITICOLINE [JAN]",
          "stdName": "CITICOLINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d37b1dd6-7721-454f-aab0-c680610d6779"
          ],
          "display_name": false
        },
        {
          "uuid": "98402f4d-8c04-4bd1-af03-5d6db9b6d137",
          "name": "CITICOLINE [MART.]",
          "stdName": "CITICOLINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2947c80d-8fec-47a0-a2d5-4a82553bf41c"
          ],
          "display_name": false
        },
        {
          "uuid": "f7f236f0-3511-4ac6-a7a9-7f9fb98405ab",
          "name": "CITICOLINE [MI]",
          "stdName": "CITICOLINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe147d6c-404e-4f09-a2ea-2897c3afd09f"
          ],
          "display_name": false
        },
        {
          "uuid": "2abf8af3-5e87-b8b3-fd41-205e457468a0",
          "name": "CITICOLINE [USP-RS]",
          "stdName": "CITICOLINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5954453e-03e2-5d09-5e82-115225317b93"
          ],
          "display_name": false
        },
        {
          "uuid": "6189da9d-e4fe-4f85-9bbf-864eb7551f31",
          "name": "CITICOLINE [VANDF]",
          "stdName": "CITICOLINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "845cdc4c-47ee-4dbe-931e-7dc7119e3ee6"
          ],
          "display_name": false
        },
        {
          "uuid": "92be6588-50f1-470f-9e38-23a5d768d6e4",
          "name": "CYTIDINE 5'-(TRIHYDROGEN DIPHOSPHATE), P'-(2-(TRIMETHYLAMMONIO)ETHYL) ESTER, INNER SALT",
          "stdName": "CYTIDINE 5'-(TRIHYDROGEN DIPHOSPHATE), P'-(2-(TRIMETHYLAMMONIO)ETHYL) ESTER, INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24ed7d79-fb34-4702-ba4f-b7c2cee13c9f"
          ],
          "display_name": false
        },
        {
          "uuid": "ad5907aa-10a0-44a1-99c0-aee92d3347c6",
          "name": "CYTIDINE 5'-DIPHOSPHATE CHOLINE",
          "stdName": "CYTIDINE 5'-DIPHOSPHATE CHOLINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c88b7e35-ebf2-4dba-920f-485df86449ef"
          ],
          "display_name": false
        },
        {
          "uuid": "b9a8353c-19d5-0c9e-aaec-6a0073a5a05b",
          "name": "Citicoline [WHO-DD]",
          "stdName": "CITICOLINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3aebd22-c8f0-f8d8-6d44-d432f3263752"
          ],
          "display_name": false
        },
        {
          "uuid": "2c7655d5-c602-48cd-a3c1-73c622ca6c83",
          "name": "IP 302",
          "stdName": "IP 302",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24ed7d79-fb34-4702-ba4f-b7c2cee13c9f"
          ],
          "display_name": false
        },
        {
          "uuid": "bcafe246-ab73-4bb5-ad0b-3e33f653216b",
          "name": "IP-302",
          "stdName": "IP-302",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c88b7e35-ebf2-4dba-920f-485df86449ef"
          ],
          "display_name": false
        },
        {
          "uuid": "30420541-86ec-496c-bf5c-feb5b7b7a228",
          "name": "NICHOLIN",
          "stdName": "NICHOLIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d37b1dd6-7721-454f-aab0-c680610d6779",
            "2883f095-e294-4f48-a18b-2dd7dfc4dacd"
          ],
          "display_name": false
        },
        {
          "uuid": "9ccca0ce-2a93-4e44-8e57-9c7b8bf07a7d",
          "name": "NSC-122002",
          "stdName": "NSC-122002",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b2ffc9b-07cd-4898-a7e8-eb1b4eabcd1f"
          ],
          "display_name": false
        },
        {
          "uuid": "7c290894-2194-4832-be7b-07b974fb13be",
          "name": "citicoline [INN]",
          "stdName": "CITICOLINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7642795e-339e-4eb5-b6b5-d5114de5d581"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "24ed7d79-fb34-4702-ba4f-b7c2cee13c9f",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c88b7e35-ebf2-4dba-920f-485df86449ef",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7642795e-339e-4eb5-b6b5-d5114de5d581",
          "citation": "INN Proposed List 17",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL17.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d37b1dd6-7721-454f-aab0-c680610d6779",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2947c80d-8fec-47a0-a2d5-4a82553bf41c",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe147d6c-404e-4f09-a2ea-2897c3afd09f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2883f095-e294-4f48-a18b-2dd7dfc4dacd",
          "citation": "D00057",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdc7cf71-3c7d-432c-9e8f-3218289bf6b7",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "845cdc4c-47ee-4dbe-931e-7dc7119e3ee6",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2127d9a-3826-4480-a39d-1d32e616cbb5",
          "citation": "https://en.wikipedia.org/wiki/Citicoline",
          "url": "https://en.wikipedia.org/wiki/Citicoline",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b2ffc9b-07cd-4898-a7e8-eb1b4eabcd1f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ebf9f5c-422a-4422-90db-46db69e5b9c5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389668000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b1b8b78-cecf-4805-8977-4474f526170f",
          "citation": "SRS import [536BQ2JVC7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=536BQ2JVC7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389668000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d54b7230-5698-4b5f-9c52-e47030798d92",
          "citation": "CITICOLINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6dd66793-68b6-4d62-b023-b4a1d5c79bd4",
          "citation": "CITICOLINE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f82c2b9a-2cb3-462e-b706-d9bb05ef171a",
          "citation": "CITICOLINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3016e76d-02c8-4d99-a95b-c529a92c65de",
          "citation": "CITICOLINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b9cb26e4-f4ba-4fd9-9f1f-c0aa53ced668",
          "citation": "CITICOLINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dc2725d2-4249-40d6-8ad0-ba396f360738",
          "citation": "CITICOLINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4cd3c70e-6d3b-9215-6b00-efad9dee243b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=987-78-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1c430479-12eb-e63b-ccdf-240e0cecd65a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "839d5205-84d3-2fa3-aa36-b172133d282d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d3c613e1-b31b-4aaa-91e4-1db12a7cd200",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "01716cf1-2bbe-ee7d-aa7f-1e988ce3dca9",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "5954453e-03e2-5d09-5e82-115225317b93",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "b855a53f-4971-b007-db10-e6080ba672b1",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b3aebd22-c8f0-f8d8-6d44-d432f3263752",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "741337b1-b83d-968d-a69a-ffd919235d46",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fbbd6458-b3dd-41ea-b3ef-9427c9dff763",
          "id": "fbbd6458-b3dd-41ea-b3ef-9427c9dff763",
          "molfile": "\n  Marvin  01132113022D          \n\n  1  0  0  0  1  0            999 V2000\n    5.6639  -11.1223    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1f085e3e-6863-4ac1-af49-d1b2a7531a83"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "1d4277ca-75d1-4fdc-9dfb-bfc59629c151",
          "id": "1d4277ca-75d1-4fdc-9dfb-bfc59629c151",
          "molfile": "\n  Marvin  01132101412D          \n\n 31 32  0  0  1  0            999 V2000\n   17.8878  -11.2334    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n   17.8878  -12.4112    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   17.5793  -13.0095    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.6024  -13.0095    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.2753  -13.7713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3034  -12.4112    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   17.0978  -11.9674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6723  -11.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8451  -11.8644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0225  -11.8644    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2000  -11.8644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3727  -11.8644    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3727  -12.6871    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.3727  -11.0419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5499  -11.8644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8395  -11.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1292  -11.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187  -11.4534    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.7035  -11.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187  -10.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7035  -11.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0225  -11.0419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0225  -12.6871    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   17.9018  -13.7713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6074  -10.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6074   -9.9950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8925   -9.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8925   -8.7564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1774   -9.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1774  -10.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3134  -11.2289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n 25  1  1  0  0  0  0\n 30  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 24  1  6  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 22 10  2  0  0  0  0\n 23 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 12  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\n 21 18  1  0  0  0  0\n 26 25  1  0  0  0  0\n 31 25  2  0  0  0  0\n 27 26  2  0  0  0  0\n 28 27  1  0  0  0  0\n 29 27  1  0  0  0  0\n 29 30  2  0  0  0  0\nM  CHG  3  13  -1  18   1  23  -1\nM  END",
          "smiles": "C[N+](C)(C)CCOP(=O)([O-])OP(=O)([O-])OC[C@@H]1[C@H]([C@H]([C@H](n2ccc(N)nc2=O)O1)O)O",
          "formula": "C14H25N4O11P2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cfeac992-f716-4179-ab2a-f46f977e17c6"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "487.3166",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b3d13d8f-cd7b-40ec-91ee-c77202ea1a00",
      "version": "26",
      "structure": {
        "id": "43bcd65b-ad5e-4075-b01c-68cafb8168a6",
        "molfile": "\n  Marvin  01132103342D          \n\n 32 32  0  0  1  0            999 V2000\n    5.6639  -11.1223    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n   17.8878  -11.2334    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n   17.8878  -12.4112    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   17.5793  -13.0095    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.6024  -13.0095    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.2753  -13.7713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3034  -12.4112    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   17.0978  -11.9674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6723  -11.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8451  -11.8644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0225  -11.8644    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2000  -11.8644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3727  -11.8644    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3727  -12.6871    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.3727  -11.0419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5499  -11.8644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8395  -11.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1292  -11.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187  -11.4534    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.7035  -11.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187  -10.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7035  -11.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0225  -11.0419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0225  -12.6871    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   17.9018  -13.7713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6074  -10.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6074   -9.9950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8925   -9.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8925   -8.7564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1774   -9.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1774  -10.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3134  -11.2289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  1  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  3  1  0  0  0  0\n  7  9  1  1  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 13  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\n 22 19  1  0  0  0  0\n 23 11  2  0  0  0  0\n 24 11  1  0  0  0  0\n  4 25  1  6  0  0  0\n 26  2  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\n 30 28  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31  2  1  0  0  0  0\n 32 26  2  0  0  0  0\nM  CHG  4   1   1  14  -1  19   1  24  -1\nM  END",
        "smiles": "C[N+](C)(C)CCOP(=O)([O-])OP(=O)([O-])OC[C@@H]1[C@H]([C@H]([C@H](n2ccc(N)nc2=O)O1)O)O.[H+]",
        "formula": "C14H25N4O11P2.H",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "488.3246",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "24ed7d79-fb34-4702-ba4f-b7c2cee13c9f",
          "8b1b8b78-cecf-4805-8977-4474f526170f",
          "7642795e-339e-4eb5-b6b5-d5114de5d581"
        ],
        "stereo_centers": 4
      },
      "unii": "536BQ2JVC7"
    }
  ]
}