{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "42d695ec-3c93-48be-ae29-60a21670325b",
          "code": "532UJ0Y6RI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4f5d2147-c275-4e9f-bcbc-86f6e9a9f8fc",
          "code": "3488-00-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3488-00-4",
          "code_system": "CAS",
          "references": [
            "c2ed7fbe-68d7-43ed-ab07-6cc04133f9b8",
            "d09cee15-ddef-4586-8496-3ddaa17e8770"
          ]
        },
        {
          "uuid": "dc93f5a0-59f8-4269-9bc3-430fc3200d75",
          "code": "222-479-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.437",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c2ed7fbe-68d7-43ed-ab07-6cc04133f9b8"
          ]
        },
        {
          "uuid": "a777d885-c0c7-4d51-b355-2c39543ede9b",
          "code": "6437300",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6437300",
          "code_system": "PUBCHEM",
          "references": [
            "c2ed7fbe-68d7-43ed-ab07-6cc04133f9b8"
          ]
        },
        {
          "uuid": "a3f30ca2-36a2-fe6a-ac25-d2c82f06a444",
          "code": "DTXSID301317081",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301317081",
          "code_system": "EPA CompTox",
          "references": [
            "21e44ab7-47f6-6f6d-096e-3fbf540c0479"
          ]
        },
        {
          "uuid": "91188694-f4db-530a-a61f-96f01cbd6006",
          "code": "2604566",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2604566/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5fb4cffc-1638-2260-f228-c04d97e19ecc"
          ]
        },
        {
          "uuid": "483c8d58-9611-4946-312f-3b1d015a2ce5",
          "code": "532UJ0Y6RI",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=532UJ0Y6RI",
          "code_system": "DAILYMED",
          "references": [
            "3f634102-b563-9b52-1cc8-02fddd87a03a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7147bc7a-fb4d-4d54-8001-2d00c7bdf2d4",
          "name": "2-PROPENOIC ACID, 3-PHENYL-, HEXYL ESTER",
          "stdName": "2-PROPENOIC ACID, 3-PHENYL-, HEXYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d09cee15-ddef-4586-8496-3ddaa17e8770",
            "d571b29a-4b2a-4a67-915f-0dbbd3ccf38c"
          ],
          "display_name": false
        },
        {
          "uuid": "ce443638-c0e3-46c8-a3ff-738f1abbf4bb",
          "name": "CINNAMIC ACID, HEXYL ESTER",
          "stdName": "CINNAMIC ACID, HEXYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d09cee15-ddef-4586-8496-3ddaa17e8770",
            "d571b29a-4b2a-4a67-915f-0dbbd3ccf38c"
          ],
          "display_name": false
        },
        {
          "uuid": "9b376202-9e17-4d9a-a47f-3e6f336fadeb",
          "name": "HEXYL CINNAMATE",
          "stdName": "HEXYL CINNAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85ecfc69-ab62-4d76-8bf0-ab9d9b5c8ecb"
          ],
          "display_name": true
        },
        {
          "uuid": "1d5f5e64-31e0-465e-a94a-3d0cf5708ff5",
          "name": "N-HEXYL CINNAMATE",
          "stdName": "N-HEXYL CINNAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d09cee15-ddef-4586-8496-3ddaa17e8770",
            "d571b29a-4b2a-4a67-915f-0dbbd3ccf38c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "85ecfc69-ab62-4d76-8bf0-ab9d9b5c8ecb",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d571b29a-4b2a-4a67-915f-0dbbd3ccf38c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d09cee15-ddef-4586-8496-3ddaa17e8770",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c2ed7fbe-68d7-43ed-ab07-6cc04133f9b8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391111000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05ddf803-3067-4c9e-b8f2-bb77b9083091",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fb4cffc-1638-2260-f228-c04d97e19ecc",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "3f634102-b563-9b52-1cc8-02fddd87a03a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "21e44ab7-47f6-6f6d-096e-3fbf540c0479",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4967d6b3-d6d9-4bbb-bc3e-634fa925e92d",
          "id": "4967d6b3-d6d9-4bbb-bc3e-634fa925e92d",
          "molfile": "\n  Marvin  01132103512D          \n\n 17 17  0  0  0  0            999 V2000\n    3.5416   -4.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2572   -4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9637   -4.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6746   -4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3903   -4.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1014   -4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8123   -4.5752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5233   -4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5233   -3.3205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2344   -4.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2344   -5.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9453   -5.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6564   -5.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3720   -5.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3720   -6.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6564   -7.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9453   -6.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCOC(=O)/C=C/c1ccccc1",
          "formula": "C15H20O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2150cee1-7364-453e-b2dc-31e1ea14a63e"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "232.3187",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d07bb2c4-9904-49b1-851e-553efde79525",
      "version": "7",
      "structure": {
        "id": "b01ed8d9-b0e9-4202-86dd-a425558057c5",
        "molfile": "\n  Marvin  01132109082D          \n\n 17 17  0  0  0  0            999 V2000\n    9.2344   -4.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5233   -4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5233   -3.3205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8123   -4.5752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1014   -4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3903   -4.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6746   -4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9637   -4.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2572   -4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5416   -4.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2344   -5.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9453   -5.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6564   -5.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3720   -5.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3720   -6.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6564   -7.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9453   -6.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  1  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 12  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCOC(=O)/C=C/c1ccccc1",
        "formula": "C15H20O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "232.3187",
        "optical_activity": "NONE",
        "references": [
          "05ddf803-3067-4c9e-b8f2-bb77b9083091"
        ],
        "stereo_centers": 0
      },
      "unii": "532UJ0Y6RI"
    }
  ]
}