{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "90e994bd-1847-4a9a-80b3-e2780ecb1c30", "code": "308065-68-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=308065-68-1", "code_system": "CAS", "references": [ "42009584-2880-42d8-b49a-ebb029c0f4d0", "c878b877-2031-485e-8d8b-4384ab0aec8f" ] }, { "uuid": "483de319-d446-4909-8d27-acd5c1339e7a", "code": "1426909", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426909/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "42009584-2880-42d8-b49a-ebb029c0f4d0" ] }, { "uuid": "41d288d3-7b23-42e9-92dd-1c21f9f21013", "code": "57356744", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/57356744", "code_system": "PUBCHEM", "references": [ "42009584-2880-42d8-b49a-ebb029c0f4d0" ] }, { "uuid": "c82c9499-354f-4462-bcc8-5c042d954f3f", "code": "5323S7S2LR", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "357501e2-f354-67a9-ec05-986b2ba4f9c4", "code": "5323S7S2LR", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5323S7S2LR", "code_system": "DAILYMED", "references": [ "76f9937b-9ab5-7a65-c5e1-b0d818cc5db9" ] } ], "substance_class": "chemical", "names": [ { "uuid": "19f0c4bc-e10e-4075-99d2-1cd1f7108233", "name": "BERNEL ESTER DID", "stdName": "BERNEL ESTER DID", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "67cad366-12a7-4636-9a31-b7d6a110af91", "b85e5913-b768-4815-a52e-df49ee36369a" ], "display_name": false }, { "uuid": "861205ee-6575-4b3d-8e83-fce2559eb498", "name": "CRODAMOL DIPD", "stdName": "CRODAMOL DIPD", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "67cad366-12a7-4636-9a31-b7d6a110af91", "b85e5913-b768-4815-a52e-df49ee36369a" ], "display_name": false }, { "uuid": "06e42d40-50b8-4716-b623-57706ca3a353", "name": "CRODAMOL IPD", "stdName": "CRODAMOL IPD", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "67cad366-12a7-4636-9a31-b7d6a110af91", "b85e5913-b768-4815-a52e-df49ee36369a" ], "display_name": false }, { "uuid": "009212ee-e89d-4ddf-b227-54af9219a861", "name": "DERMOL DID", "stdName": "DERMOL DID", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "67cad366-12a7-4636-9a31-b7d6a110af91", "b85e5913-b768-4815-a52e-df49ee36369a" ], "display_name": false }, { "uuid": "395c7803-b9d7-4df0-a496-81e204dd7cd9", "name": "DIISOPROPYL DILINOLEATE", "stdName": "DIISOPROPYL DILINOLEATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "67cad366-12a7-4636-9a31-b7d6a110af91", "094e1967-b9ef-4ab6-8fde-378dfa47ea6b", "b85e5913-b768-4815-a52e-df49ee36369a" ], "display_name": true }, { "uuid": "ae18746f-e658-4621-ae92-fd5a1461c9e9", "name": "DIISOPROPYL DILINOLEATE [II]", "stdName": "DIISOPROPYL DILINOLEATE [II]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "67cad366-12a7-4636-9a31-b7d6a110af91", "b85e5913-b768-4815-a52e-df49ee36369a" ], "display_name": false }, { "uuid": "12e64ccf-9fcc-4f02-8905-d43d78d8cb01", "name": "DIISOPROPYL DIMER DILINOLEATE", "stdName": "DIISOPROPYL DIMER DILINOLEATE", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "67cad366-12a7-4636-9a31-b7d6a110af91", "1507905b-25c9-450c-88c9-1a5428d28750", "56c24bfe-21ae-469e-8c3d-70455b3d1211", "b85e5913-b768-4815-a52e-df49ee36369a" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "3b83afd3-2aba-4ab0-86b1-2d61da158324", "name_org": "INCI" } ] }, { "uuid": "c81a8d10-65ee-427c-8f61-044adb3459bc", "name": "DIISOPROPYL DIMERATE", "stdName": "DIISOPROPYL DIMERATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bce3d082-a8b9-4b06-9ac2-33d797fe2c16", "03ec0e3d-bdb1-4a0d-906d-31d8ae2d0f68" ], "display_name": false }, { "uuid": "aefa626c-f776-40e9-8921-66e9e2c2bbe2", "name": "PELEMOL D9336", "stdName": "PELEMOL D9336", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "67cad366-12a7-4636-9a31-b7d6a110af91", "b85e5913-b768-4815-a52e-df49ee36369a" ], "display_name": false }, { "uuid": "37cb07d3-35b9-4a80-9a53-e4298dda2d19", "name": "SCHERCEMOL DID", "stdName": "SCHERCEMOL DID", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "67cad366-12a7-4636-9a31-b7d6a110af91", "77968f49-b386-4bb2-96c3-c945b9143fa4" ], "display_name": false } ], "references": [ { "uuid": "67cad366-12a7-4636-9a31-b7d6a110af91", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "56c24bfe-21ae-469e-8c3d-70455b3d1211", "citation": "CTFA DL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "77968f49-b386-4bb2-96c3-c945b9143fa4", "citation": "NDA 62744", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "03ec0e3d-bdb1-4a0d-906d-31d8ae2d0f68", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bce3d082-a8b9-4b06-9ac2-33d797fe2c16", "citation": "CFTA DL", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b85e5913-b768-4815-a52e-df49ee36369a", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "42009584-2880-42d8-b49a-ebb029c0f4d0", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391873000, "tags": [ "NOMEN" ] }, { "uuid": "916c1d7d-bc62-4cf2-9508-d44a2007e834", "citation": "SRS import [5323S7S2LR]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5323S7S2LR", "doc_type": "SRS", "public_domain": true, "document_date": 1493391873000, "tags": [ "NOMEN" ] }, { "uuid": "1507905b-25c9-450c-88c9-1a5428d28750", "citation": "DIISOPROPYL DIMER DILINOLEATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "094e1967-b9ef-4ab6-8fde-378dfa47ea6b", "citation": "DIISOPROPYL DILINOLEATE [II]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c878b877-2031-485e-8d8b-4384ab0aec8f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "76f9937b-9ab5-7a65-c5e1-b0d818cc5db9", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e6356fa1-0f88-4277-9d7f-c2afa2531073", "id": "e6356fa1-0f88-4277-9d7f-c2afa2531073", "molfile": "\n Marvin 01132111552D \n\n 46 46 0 0 0 0 999 V2000\n 13.1793 -1.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3544 -1.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9419 -1.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1169 -1.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7044 -2.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8794 -2.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4669 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 9.8794 -4.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4669 -4.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6419 -4.7390 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.2293 -5.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4044 -5.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9919 -6.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1669 -6.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7544 -6.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9294 -6.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5169 -7.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6919 -7.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2794 -6.8824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2794 -8.3114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4543 -8.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0418 -7.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0418 -9.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2293 -4.0245 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.4044 -4.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9919 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1669 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7544 -2.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9294 -2.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5169 -1.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6919 -1.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2794 -1.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4543 -1.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0418 -0.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4543 0.2623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2169 -0.4522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8044 0.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2169 0.9768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0206 0.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6419 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.2293 -2.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6419 -1.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2293 -1.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6419 -0.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2293 0.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6419 0.9768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 40 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 24 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 40 1 0 0 0 0\n 26 25 2 3 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 34 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\nM END", "smiles": "CCCCCCC1C=CC(CCCCCCCC(=O)OC(C)C)C(C=CCCCCCCCC(=O)OC(C)C)C1CCCCCC", "formula": "C42H76O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e614da28-5d79-42a9-b8b3-d7d82b6ea45f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "645.052", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "REPRESENTATIVE", "uuid": "abef8031-394d-4524-8b05-dcdabb19d037", "version": "5", "structure": { "id": "8eaff755-cefc-41b0-8fd6-c4b10eadf728", "molfile": "\n Marvin 01132107242D \n\n 46 46 0 0 0 0 999 V2000\n 9.4669 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6419 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2293 -2.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6419 -1.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2293 -1.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6419 -0.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2293 0.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6419 0.9768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2293 -4.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4044 -4.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9919 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1669 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7544 -2.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9294 -2.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5169 -1.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6919 -1.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2794 -1.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4543 -1.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0418 -0.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2169 -0.4522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8044 0.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2169 0.9768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0206 0.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4543 0.2623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6419 -4.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2293 -5.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4044 -5.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9919 -6.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1669 -6.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7544 -6.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9294 -6.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5169 -7.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6919 -7.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2794 -6.8824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2794 -8.3114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4543 -8.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0418 -7.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0418 -9.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4669 -4.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8794 -4.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8794 -2.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7044 -2.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1169 -1.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9419 -1.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3544 -1.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1793 -1.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 2 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 2 3 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 19 24 2 0 0 0 0\n 9 25 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 33 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 25 39 1 0 0 0 0\n 40 39 2 0 0 0 0\n 40 1 1 0 0 0 0\n 1 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\nM END", "smiles": "CCCCCCC1C=CC(CCCCCCCC(=O)OC(C)C)C(C=CCCCCCCCC(=O)OC(C)C)C1CCCCCC", "formula": "C42H76O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "645.052", "optical_activity": "UNSPECIFIED", "references": [ "916c1d7d-bc62-4cf2-9508-d44a2007e834", "03ec0e3d-bdb1-4a0d-906d-31d8ae2d0f68" ], "stereo_centers": 4 }, "unii": "5323S7S2LR" } ] }