{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "87d96b79-7e10-4ea7-8862-d16d2d4618f7", "code": "879499-69-1", "type": "GENERIC (FAMILY)", "url": "https://commonchemistry.cas.org/detail?cas_rn=879499-69-1", "code_system": "CAS", "references": [ "bf81a707-0dde-43cd-96fb-1341450191ab", "3f00fac1-02ef-4907-9ea1-8cae4fe37a37" ] }, { "uuid": "5e5c6561-74d0-4895-bc41-28ee6d507d8d", "code": "1649135", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1649135/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "bf81a707-0dde-43cd-96fb-1341450191ab" ] }, { "uuid": "92d192c4-c0d6-efd4-df85-df52b8f6ee05", "code": "138059611", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/138059611", "code_system": "PUBCHEM", "references": [ "48eb9058-3676-b69c-aefc-aef1d49b7939" ] }, { "uuid": "49dba32b-69f0-4c41-84ca-22fe4cb99dd5", "code": "52AOS9G13Q", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "77b95f39-5ce9-6f03-c1a8-42f20519627f", "code": "1649136", "type": "ALTERNATIVE", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1649136/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "5d686db2-5cd9-36ca-d272-585417433de9" ] }, { "uuid": "62839d3a-d3f8-e4b5-e0ee-9ed08752c967", "code": "52AOS9G13Q", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=52AOS9G13Q", "code_system": "DAILYMED", "references": [ "cd63b6de-f801-190d-0f5a-5ac85adcd775" ] } ], "relationships": [ { "uuid": "5f5a61b9-b10a-4f03-acaa-39c2bd495e80", "type": "SUB_CONCEPT->SUBSTANCE", "references": [ "89fb4afa-90dd-3744-530f-a359b99c041c" ], "related_substance": { "uuid": "58302553-826d-4e20-a075-c126c94652e6", "refuuid": "b1ce602a-549b-4058-96f2-05f943a64361", "name": "TRIS(PPG-3 BENZYL ETHER)", "linking_id": "b1ce602a-549b-4058-96f2-05f943a64361", "ref_pname": "TRIS(PPG-3 BENZYL ETHER)", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "79243b03-8f73-4637-b3e0-130e8e80b1fe", "name": "CROMOLLIENT ESP", "stdName": "CROMOLLIENT ESP", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "4ccbd04c-8311-43e9-afd4-235617f73d5f", "4c96f926-69f6-4e50-b14d-a9c23e3953b0" ], "display_name": false }, { "uuid": "4c974a7a-862e-419a-8343-8fc0fbd17abb", "name": "TRIS(PPG-3 BENZYL ETHER) CITRATE", "stdName": "TRIS(PPG-3 BENZYL ETHER) CITRATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "4ccbd04c-8311-43e9-afd4-235617f73d5f", "4c96f926-69f6-4e50-b14d-a9c23e3953b0", "18e74143-e028-476e-9f58-224f36c48401" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "9779813e-52f9-4e09-a90e-c3a1d500aadb", "name_org": "INCI" } ] } ], "references": [ { "uuid": "4c96f926-69f6-4e50-b14d-a9c23e3953b0", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4ccbd04c-8311-43e9-afd4-235617f73d5f", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bf81a707-0dde-43cd-96fb-1341450191ab", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392323000, "tags": [ "NOMEN" ] }, { "uuid": "aedc91ff-89e7-4e46-bc5f-7fbc5331c65e", "citation": "SRS import [52AOS9G13Q]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=52AOS9G13Q", "doc_type": "SRS", "public_domain": true, "document_date": 1493392323000, "tags": [ "NOMEN" ] }, { "uuid": "a14478fc-6bf7-49f6-bd2f-20186962a5b3", "citation": "http://www.ulprospector.com/documents/1000170.pdf?bs=134&b=98384&st=20", "url": "http://www.ulprospector.com/documents/1000170.pdf?bs=134&b=98384&st=20", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "18e74143-e028-476e-9f58-224f36c48401", "citation": "TRIS(PPG-3 BENZYL ETHER) CITRATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "89fb4afa-90dd-3744-530f-a359b99c041c", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3f00fac1-02ef-4907-9ea1-8cae4fe37a37", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5d686db2-5cd9-36ca-d272-585417433de9", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "48eb9058-3676-b69c-aefc-aef1d49b7939", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "cd63b6de-f801-190d-0f5a-5ac85adcd775", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ce4a7264-dbca-4d34-a258-65b5d02b514b", "id": "ce4a7264-dbca-4d34-a258-65b5d02b514b", "molfile": "\n Marvin 01132110392D \n\n 70 72 0 0 0 0 999 V2000\n 15.0280 -11.1204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7425 -10.7079 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 15.7425 -9.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0280 -9.4704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0280 -8.6454 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 15.7425 -8.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3136 -8.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3136 -7.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5991 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5991 -6.1704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8846 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1701 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1701 -7.8204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4556 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7412 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7412 -6.1704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0267 -7.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3122 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5978 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.5978 -8.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8833 -6.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1688 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4544 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.4544 -6.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7399 -7.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0254 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3109 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.3109 -8.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5964 -6.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8819 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1675 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4530 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7386 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7386 -6.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4530 -5.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1675 -6.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1701 -6.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4556 -5.7579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8846 -5.7579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8846 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5991 -4.5204 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 13.5991 -3.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3136 -4.9329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0280 -4.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7425 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 15.7425 -5.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4570 -4.5204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1714 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8859 -4.5204 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 17.8859 -3.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6004 -4.9329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3148 -4.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0293 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7438 -4.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4582 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4582 -5.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7438 -6.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0293 -5.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4570 -11.1204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4570 -11.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1715 -12.3579 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 17.8859 -11.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1715 -13.1829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8859 -13.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8859 -14.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6004 -14.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6004 -15.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8859 -16.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1715 -15.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1715 -14.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 59 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 1 0 0 0 0\n 37 12 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 15 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 19 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 23 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 36 31 2 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 38 37 2 0 0 0 0\n 39 37 1 0 0 0 0\n 39 40 1 0 0 0 0\n 41 40 1 0 0 0 0\n 41 42 1 0 0 0 0\n 43 41 1 0 0 0 0\n 44 43 1 0 0 0 0\n 45 44 1 0 0 0 0\n 45 46 1 0 0 0 0\n 47 45 1 0 0 0 0\n 48 47 1 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 49 51 1 0 0 0 0\n 52 51 1 0 0 0 0\n 52 53 1 0 0 0 0\n 53 54 1 0 0 0 0\n 58 53 2 0 0 0 0\n 54 55 2 0 0 0 0\n 55 56 1 0 0 0 0\n 56 57 2 0 0 0 0\n 57 58 1 0 0 0 0\n 60 59 1 0 0 0 0\n 60 61 1 0 0 0 0\n 61 62 1 0 0 0 0\n 61 63 1 0 0 0 0\n 64 63 1 0 0 0 0\n 64 65 1 0 0 0 0\n 65 66 1 0 0 0 0\n 70 65 2 0 0 0 0\n 66 67 2 0 0 0 0\n 67 68 1 0 0 0 0\n 68 69 2 0 0 0 0\n 69 70 1 0 0 0 0\nM END", "smiles": "CC(COC(C)COC(=O)CC(CC(=O)OCC(C)OCC(C)OCC(C)OCc1ccccc1)(C(=O)OCC(C)OCC(C)OCC(C)OCc2ccccc2)O)OCC(C)OCc3ccccc3", "formula": "C54H80O16", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "bf206e6c-f849-469d-a121-fc8a7fe88bbb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "985.2055", "optical_activity": "UNSPECIFIED", "stereo_centers": 9 } ], "definition_level": "REPRESENTATIVE", "uuid": "7e75f928-bae5-4d45-997d-6d6a13e09566", "version": "9", "structure": { "id": "ae50ea84-3e67-4cf7-8078-f7785effc530", "molfile": "\n Marvin 01132109032D \n\n 70 72 0 0 0 0 999 V2000\n 15.7425 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4570 -4.5204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1714 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8859 -4.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8859 -3.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6004 -4.9329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3148 -4.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0293 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7438 -4.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4582 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4582 -5.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7438 -6.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0293 -5.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0280 -4.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3136 -4.9329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5991 -4.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5991 -3.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8846 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8846 -5.7579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1701 -6.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1701 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1701 -7.8204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8846 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5991 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3136 -7.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3136 -8.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0280 -8.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0280 -9.4704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7425 -9.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7425 -10.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0280 -11.1204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4570 -11.1204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4570 -11.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1715 -12.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8859 -11.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1715 -13.1829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8859 -13.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8859 -14.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6004 -14.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6004 -15.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8859 -16.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1715 -15.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1715 -14.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7425 -8.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5991 -6.1704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4556 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7412 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0267 -7.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3122 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5978 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8833 -6.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1688 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4544 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4544 -6.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7399 -7.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0254 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3109 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3109 -8.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5964 -6.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8819 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1675 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4530 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7386 -6.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7386 -6.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4530 -5.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1675 -6.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5978 -8.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7412 -6.1704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4556 -5.7579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7425 -5.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 8 2 0 0 0 0\n 1 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 21 1 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 30 1 0 0 0 0\n 33 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 37 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 42 43 1 0 0 0 0\n 43 38 2 0 0 0 0\n 27 44 1 0 0 0 0\n 45 24 2 0 0 0 0\n 46 21 1 0 0 0 0\n 47 46 1 0 0 0 0\n 47 48 1 0 0 0 0\n 49 48 1 0 0 0 0\n 50 49 1 0 0 0 0\n 51 50 1 0 0 0 0\n 52 51 1 0 0 0 0\n 53 52 1 0 0 0 0\n 53 54 1 0 0 0 0\n 55 53 1 0 0 0 0\n 56 55 1 0 0 0 0\n 56 57 1 0 0 0 0\n 57 58 1 0 0 0 0\n 57 59 1 0 0 0 0\n 60 59 1 0 0 0 0\n 60 61 1 0 0 0 0\n 61 62 1 0 0 0 0\n 62 63 2 0 0 0 0\n 63 64 1 0 0 0 0\n 64 65 2 0 0 0 0\n 65 66 1 0 0 0 0\n 66 61 2 0 0 0 0\n 50 67 1 0 0 0 0\n 68 47 2 0 0 0 0\n 69 20 2 0 0 0 0\n 1 70 1 0 0 0 0\nM END", "smiles": "CC(COC(C)COC(=O)CC(CC(=O)OCC(C)OCC(C)OCC(C)OCc1ccccc1)(C(=O)OCC(C)OCC(C)OCC(C)OCc2ccccc2)O)OCC(C)OCc3ccccc3", "formula": "C54H80O16", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "985.2055", "optical_activity": "UNSPECIFIED", "references": [ "aedc91ff-89e7-4e46-bc5f-7fbc5331c65e", "a14478fc-6bf7-49f6-bd2f-20186962a5b3" ], "stereo_centers": 10 }, "unii": "52AOS9G13Q" } ] }