{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e82167e5-d2d9-4d69-8f1e-717d24a4a8ff", "code": "850334-50-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=850334-50-8", "code_system": "CAS", "references": [ "0b92d89f-e450-4c25-9564-a7397c34e6f5", "a3b0f907-d239-447c-af5f-204c3d2f0104" ] }, { "uuid": "c40bbafc-c9c1-4f40-b0d5-2dbe221355a6", "code": "28391387", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/28391387", "code_system": "PUBCHEM", "references": [ "0b92d89f-e450-4c25-9564-a7397c34e6f5" ] }, { "uuid": "c3043c11-5c65-4da4-b941-1e48f6f67346", "code": "520O970L95", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "3dbef703-efcc-48a1-8bc1-a138a4c1028e", "name": "3-HYDROXY-N-(1-ADAMANTYL)BENZAMIDE", "stdName": "3-HYDROXY-N-(1-ADAMANTYL)BENZAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5354fd7a-56f0-45fe-82cc-61692de0f862", "8d1836ef-5d32-44ed-ad8f-b454309b4d2b" ], "display_name": false }, { "uuid": "67b0998c-8a4a-4cb1-86e1-1d75d0a99278", "name": "ADAMANTANYL HYDROXYBENZAMIDE", "stdName": "ADAMANTANYL HYDROXYBENZAMIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "5354fd7a-56f0-45fe-82cc-61692de0f862", "df8bbe95-509a-4937-952e-17b2140bd014", "eccff5e8-3805-4738-86b0-1ddcedf78225", "8d1836ef-5d32-44ed-ad8f-b454309b4d2b" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "ccd79023-683d-47dc-8bc3-1d9cd3a2c11c", "name_org": "INCI" } ] }, { "uuid": "24d229b4-9655-4cb1-8de1-64b1969c0fb1", "name": "BENZAMIDE, 3-HYDROXY-N-TRICYCLO(3.3.1.13,7)DEC-1-YL-", "stdName": "BENZAMIDE, 3-HYDROXY-N-TRICYCLO(3.3.1.13,7)DEC-1-YL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5354fd7a-56f0-45fe-82cc-61692de0f862", "8d1836ef-5d32-44ed-ad8f-b454309b4d2b" ], "display_name": false }, { "uuid": "567d905a-ada0-421a-a854-aff74cf59543", "name": "SNOWIN AP-2", "stdName": "SNOWIN AP-2", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "df8bbe95-509a-4937-952e-17b2140bd014", "8d1836ef-5d32-44ed-ad8f-b454309b4d2b" ], "display_name": false } ], "references": [ { "uuid": "5354fd7a-56f0-45fe-82cc-61692de0f862", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "8d1836ef-5d32-44ed-ad8f-b454309b4d2b", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "df8bbe95-509a-4937-952e-17b2140bd014", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0b92d89f-e450-4c25-9564-a7397c34e6f5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391327000, "tags": [ "NOMEN" ] }, { "uuid": "dc6886f6-7ba4-4565-81e0-c952992cb49a", "citation": "SRS import [520O970L95]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=520O970L95", "doc_type": "SRS", "public_domain": true, "document_date": 1493391327000, "tags": [ "NOMEN" ] }, { "uuid": "eccff5e8-3805-4738-86b0-1ddcedf78225", "citation": "ADAMANTANYL HYDROXYBENZAMIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a3b0f907-d239-447c-af5f-204c3d2f0104", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f5e05625-5418-4371-be2c-330ef4f73c66", "id": "f5e05625-5418-4371-be2c-330ef4f73c66", "molfile": "\n Marvin 01132112452D \n\n 20 23 0 0 0 0 999 V2000\n 8.1021 -7.0394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2771 -7.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8579 -6.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0329 -6.3445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6271 -7.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0464 -7.7733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8713 -7.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6406 -8.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0598 -9.2022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8157 -8.4995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4099 -9.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9416 -10.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4278 -11.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4207 -10.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8949 -10.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3751 -10.4345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8482 -10.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3811 -11.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3644 -9.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8889 -9.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 7 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 19 1 0 0 0 0\n 11 20 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 18 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 20 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\nM END", "smiles": "c1cc(cc(c1)O)C(=O)NC23CC4CC(CC(C4)C2)C3", "formula": "C17H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e9f9353b-85b1-4f64-acf8-97cd0991f087" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "271.3548", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "d596cdc7-3be1-4dfd-8e27-996f013e2513", "version": "6", "structure": { "id": "161d7015-59dc-43b4-bd58-8584863093f2", "molfile": "\n Marvin 01132101212D \n\n 20 23 0 0 0 0 999 V2000\n 7.2771 -7.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8579 -6.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0329 -6.3445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6271 -7.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0464 -7.7733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8713 -7.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1021 -7.0394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6406 -8.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8157 -8.4995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0598 -9.2022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4099 -9.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8889 -9.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8949 -10.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4207 -10.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4278 -11.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9416 -10.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3644 -9.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8482 -10.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3811 -11.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3751 -10.4345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 1 6 1 0 0 0 0\n 1 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 11 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 11 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 15 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 13 20 1 0 0 0 0\nM END", "smiles": "c1cc(cc(c1)O)C(=O)NC23CC4CC(CC(C4)C2)C3", "formula": "C17H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "271.3548", "optical_activity": "NONE", "references": [ "df8bbe95-509a-4937-952e-17b2140bd014", "dc6886f6-7ba4-4565-81e0-c952992cb49a" ], "stereo_centers": 0 }, "unii": "520O970L95" } ] }