{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "de2c5125-3b46-4615-a577-6a604f7ed96d",
          "code": "163702-05-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=163702-05-4",
          "code_system": "CAS",
          "references": [
            "f005c435-fdce-4d30-b875-0173b188dc4b",
            "c007930f-50c6-4909-a0ec-c307c0da0730"
          ]
        },
        {
          "uuid": "22be8929-c05d-48c1-ba11-58942c706b7d",
          "code": "1540871",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1540871/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f005c435-fdce-4d30-b875-0173b188dc4b"
          ]
        },
        {
          "uuid": "159c0db4-73cb-49c8-a2d7-79adba862699",
          "code": "206000",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/206000",
          "code_system": "PUBCHEM",
          "references": [
            "f005c435-fdce-4d30-b875-0173b188dc4b"
          ]
        },
        {
          "uuid": "df0ea98c-2dcf-5365-3f53-8619cc00414e",
          "code": "DTXSID0073118",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0073118",
          "code_system": "EPA CompTox",
          "references": [
            "8a78b4ab-756c-852e-0148-d0fc36c6fc02"
          ]
        },
        {
          "uuid": "a07afaae-fcfd-4746-8532-b8573b3c0c98",
          "code": "520BW6FQ5U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "750323d8-5684-ee8d-e7bd-45822a67b1fd",
          "code": "520BW6FQ5U",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=520BW6FQ5U",
          "code_system": "DAILYMED",
          "references": [
            "b6133b53-c042-ccb7-cce2-b0d98e8eeca8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ea96f30a-0c0c-4008-9e02-e477e58b6935",
          "name": "(PERFLUOROBUTOXY)ETHANE",
          "stdName": "(PERFLUOROBUTOXY)ETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ede63d3-41f9-43aa-b2af-579d23d66b5a",
            "af0a95ba-7e5d-4550-b130-5365c65fa699"
          ],
          "display_name": false
        },
        {
          "uuid": "a30735c6-c446-4982-8a57-0f22602cf912",
          "name": "1-ETHOXY-1,1,2,2,3,3,4,4,4-NONAFLUOROBUTANE",
          "stdName": "1-ETHOXY-1,1,2,2,3,3,4,4,4-NONAFLUOROBUTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ede63d3-41f9-43aa-b2af-579d23d66b5a",
            "af0a95ba-7e5d-4550-b130-5365c65fa699"
          ],
          "display_name": false
        },
        {
          "uuid": "8da6d843-4424-4fa1-8078-17ed1f8e5d16",
          "name": "3M COSMETIC FLUID CF-76",
          "stdName": "3M COSMETIC FLUID CF-76",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe0d7285-0c93-45f6-aed8-93b20e9c3e30",
            "4ede63d3-41f9-43aa-b2af-579d23d66b5a"
          ],
          "display_name": false
        },
        {
          "uuid": "5cc9c601-01e7-4ee3-a2a5-a037a842231c",
          "name": "BUTANE, 1-ETHOXY-1,1,2,2,3,3,4,4,4-NONAFLUORO-",
          "stdName": "BUTANE, 1-ETHOXY-1,1,2,2,3,3,4,4,4-NONAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ede63d3-41f9-43aa-b2af-579d23d66b5a",
            "af0a95ba-7e5d-4550-b130-5365c65fa699"
          ],
          "display_name": false
        },
        {
          "uuid": "f8192fb2-0462-43b7-b68f-9f498d8233b4",
          "name": "ETHYL NONAFLUOROBUTYL ETHER",
          "stdName": "ETHYL NONAFLUOROBUTYL ETHER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ede63d3-41f9-43aa-b2af-579d23d66b5a",
            "af0a95ba-7e5d-4550-b130-5365c65fa699"
          ],
          "display_name": false
        },
        {
          "uuid": "eca33fba-1d80-4031-8c32-55868aab1479",
          "name": "ETHYL PERFLUOROBUTYL ETHER",
          "stdName": "ETHYL PERFLUOROBUTYL ETHER",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe0d7285-0c93-45f6-aed8-93b20e9c3e30",
            "4ede63d3-41f9-43aa-b2af-579d23d66b5a",
            "26b32058-40a7-4940-aeae-278a9f71a31d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a3a3d8a6-b901-4128-955f-18390b51b206",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1530a2ae-5c15-4aeb-be73-b636a510fc28",
          "name": "NONAFLUOROBUTYL ETHYL ETHER",
          "stdName": "NONAFLUOROBUTYL ETHYL ETHER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ede63d3-41f9-43aa-b2af-579d23d66b5a",
            "af0a95ba-7e5d-4550-b130-5365c65fa699"
          ],
          "display_name": false
        },
        {
          "uuid": "762c67f1-76ee-4f44-af5f-4cbbe99f57dd",
          "name": "NOVEC HFE 7200",
          "stdName": "NOVEC HFE 7200",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ede63d3-41f9-43aa-b2af-579d23d66b5a",
            "af0a95ba-7e5d-4550-b130-5365c65fa699"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fe0d7285-0c93-45f6-aed8-93b20e9c3e30",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4ede63d3-41f9-43aa-b2af-579d23d66b5a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af0a95ba-7e5d-4550-b130-5365c65fa699",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f005c435-fdce-4d30-b875-0173b188dc4b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58163de9-3be3-4fd1-b3c0-ae8019316e46",
          "citation": "SRS import [520BW6FQ5U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=520BW6FQ5U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26b32058-40a7-4940-aeae-278a9f71a31d",
          "citation": "ETHYL PERFLUOROBUTYL ETHER [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8a78b4ab-756c-852e-0148-d0fc36c6fc02",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=163702-05-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c007930f-50c6-4909-a0ec-c307c0da0730",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b6133b53-c042-ccb7-cce2-b0d98e8eeca8",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f48a6a73-3836-4d84-91ea-682ac48aead5",
          "id": "f48a6a73-3836-4d84-91ea-682ac48aead5",
          "molfile": "\n  Marvin  01132112412D          \n\n 16 15  0  0  0  0            999 V2000\n    5.6087   -6.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3167   -6.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0268   -6.2586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0268   -5.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5704   -4.7300    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1284   -5.1986    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7389   -5.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1073   -4.2041    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3481   -4.2205    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4388   -5.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1727   -6.2423    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8398   -6.1931    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1570   -5.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8691   -5.4135    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8337   -4.2287    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5069   -4.2205    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\nM  END",
          "smiles": "CCOC(C(C(C(F)(F)F)(F)F)(F)F)(F)F",
          "formula": "C6H5F9O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dda2dba5-483d-42eb-8a13-d3af3d37ad55"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "264.0892",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f4a3f1b4-6753-487a-afbc-97c562ab5b8b",
      "version": "6",
      "structure": {
        "id": "d19ec5d1-8c7c-4f35-a846-093b8840da3f",
        "molfile": "\n  Marvin  01132110502D          \n\n 16 15  0  0  0  0            999 V2000\n    5.6087   -6.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3167   -6.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8691   -5.4135    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8337   -4.2287    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5069   -4.2205    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5704   -4.7300    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1284   -5.1986    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0268   -6.2586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1727   -6.2423    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8398   -6.1931    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1570   -5.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1073   -4.2041    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3481   -4.2205    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0268   -5.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4388   -5.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7389   -5.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n 11  3  1  0  0  0  0\n 11  4  1  0  0  0  0\n 11  5  1  0  0  0  0\n 14  6  1  0  0  0  0\n 14  7  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15  9  1  0  0  0  0\n 15 10  1  0  0  0  0\n 15 11  1  0  0  0  0\n 16 12  1  0  0  0  0\n 16 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
        "smiles": "CCOC(C(C(C(F)(F)F)(F)F)(F)F)(F)F",
        "formula": "C6H5F9O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "264.0892",
        "optical_activity": "NONE",
        "references": [
          "af0a95ba-7e5d-4550-b130-5365c65fa699",
          "58163de9-3be3-4fd1-b3c0-ae8019316e46"
        ],
        "stereo_centers": 0
      },
      "unii": "520BW6FQ5U"
    }
  ]
}