{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4fdd9d98-6c63-4078-8b29-daf877455176",
          "code": "860-79-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=860-79-7",
          "code_system": "CAS",
          "references": [
            "ce8969d7-8843-4241-a01d-1d795f08c0e5",
            "afe8afc2-6a97-46bf-a7d4-cd6c36aa06dc"
          ]
        },
        {
          "uuid": "4da952f4-3834-425e-bbcf-76577beeaca1",
          "code": "260439",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/260439",
          "code_system": "PUBCHEM",
          "references": [
            "ce8969d7-8843-4241-a01d-1d795f08c0e5"
          ]
        },
        {
          "uuid": "c1d4b873-bb23-4534-99bf-e85a45bb3ca4",
          "code": "51GY352868",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a6b67465-3b31-a1e1-1e31-6ea48771591e",
          "code": "91722",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=91722",
          "code_system": "NSC",
          "references": [
            "459c4788-db1d-60f8-db25-cdc8256613c8"
          ]
        },
        {
          "uuid": "82992c32-16fb-c4c9-6be8-95cbeea398fd",
          "code": "DTXSID801316983",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801316983",
          "code_system": "EPA CompTox",
          "references": [
            "5be4c9f5-517a-719a-649b-12e8a5369535"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e1babc07-1967-4068-aeba-beb6f073dba3",
          "name": "9,19-CYCLO-5.ALPHA.,9.BETA.-PREGNAN-16.ALPHA.-OL, 4,4,14-TRIMETHYL-3.BETA.,20.ALPHA.-BIS(METHYLAMINO)-",
          "stdName": "9,19-CYCLO-5.ALPHA.,9.BETA.-PREGNAN-16.ALPHA.-OL, 4,4,14-TRIMETHYL-3.BETA.,20.ALPHA.-BIS(METHYLAMINO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b515f53-4c92-413f-8bcf-20341a9cc26d",
            "bd560028-5395-49a6-9f7a-f3622d5c7664"
          ],
          "display_name": false
        },
        {
          "uuid": "eba9c253-d734-4644-ade3-ad6fb93eba7e",
          "name": "9,19-CYCLOPREGNAN-16-OL, 4,4,14-TRIMETHYL-3,20-BIS(METHYLAMINO)-, (3.BETA.,5.ALPHA.,16.ALPHA.,20S)-",
          "stdName": "9,19-CYCLOPREGNAN-16-OL, 4,4,14-TRIMETHYL-3,20-BIS(METHYLAMINO)-, (3.BETA.,5.ALPHA.,16.ALPHA.,20S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b515f53-4c92-413f-8bcf-20341a9cc26d",
            "bd560028-5395-49a6-9f7a-f3622d5c7664"
          ],
          "display_name": false
        },
        {
          "uuid": "21616dec-5186-44d3-9485-7a8917a068ea",
          "name": "BEBUXINE",
          "stdName": "BEBUXINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b515f53-4c92-413f-8bcf-20341a9cc26d",
            "bd560028-5395-49a6-9f7a-f3622d5c7664"
          ],
          "display_name": false
        },
        {
          "uuid": "06d8f4cb-4b8e-4966-b636-fc275a453e62",
          "name": "CYCLOVIROBUXIN D",
          "stdName": "CYCLOVIROBUXIN D",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b515f53-4c92-413f-8bcf-20341a9cc26d",
            "bd560028-5395-49a6-9f7a-f3622d5c7664"
          ],
          "display_name": false
        },
        {
          "uuid": "9a0fcaaf-0a47-4529-865e-c2e2f1e24327",
          "name": "CYCLOVIROBUXINE",
          "stdName": "CYCLOVIROBUXINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "4d7a86ad-6bd1-480f-97da-b1d924f4c0d3",
            "74bd624f-8fd7-49ca-9748-295294c0af15",
            "8b515f53-4c92-413f-8bcf-20341a9cc26d",
            "bd560028-5395-49a6-9f7a-f3622d5c7664"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "faf6bb60-66c2-46eb-a8c6-2c27052f9a5f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "25490c2e-18ce-48d6-944b-e2bd94094e97",
          "name": "CYCLOVIROBUXINE D",
          "stdName": "CYCLOVIROBUXINE D",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28937002-376f-45cc-b3b4-d4c967702fe5",
            "8b515f53-4c92-413f-8bcf-20341a9cc26d"
          ],
          "display_name": true
        },
        {
          "uuid": "40041bb7-722c-4916-97f9-76554aea2389",
          "name": "CYCLOVIROBUXINUM D",
          "stdName": "CYCLOVIROBUXINUM D",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fe042a7-6eb9-419a-932b-ac1fcae3a519",
            "8384a00d-7215-4f3d-b76d-37dd4fe0cdde",
            "5bf22651-c114-4a63-90d4-0b78426852e2",
            "8b515f53-4c92-413f-8bcf-20341a9cc26d"
          ],
          "display_name": false
        },
        {
          "uuid": "a822ba51-c949-4a5a-9193-705ac8f14824",
          "name": "CYCLOVIROBUXINUM D [CHP]",
          "stdName": "CYCLOVIROBUXINUM D [CHP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fe042a7-6eb9-419a-932b-ac1fcae3a519",
            "8b515f53-4c92-413f-8bcf-20341a9cc26d"
          ],
          "display_name": false
        },
        {
          "uuid": "c303a9c9-b949-1345-766b-afa06be52c78",
          "name": "Cyclovirobuxine D [WHO-DD]",
          "stdName": "CYCLOVIROBUXINE D [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a863fcf-21f5-d741-cda1-267ec66fef00"
          ],
          "display_name": false
        },
        {
          "uuid": "12174f45-2fb3-45e6-abd0-2798c74ef816",
          "name": "HUANWEIHUANGYANGXING D",
          "stdName": "HUANWEIHUANGYANGXING D",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bf22651-c114-4a63-90d4-0b78426852e2",
            "8b515f53-4c92-413f-8bcf-20341a9cc26d"
          ],
          "display_name": false
        },
        {
          "uuid": "84a8bac7-e353-40cd-a561-578454e8c612",
          "name": "NSC-91722",
          "stdName": "NSC-91722",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28937002-376f-45cc-b3b4-d4c967702fe5",
            "8b515f53-4c92-413f-8bcf-20341a9cc26d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bd560028-5395-49a6-9f7a-f3622d5c7664",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8b515f53-4c92-413f-8bcf-20341a9cc26d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28937002-376f-45cc-b3b4-d4c967702fe5",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bf22651-c114-4a63-90d4-0b78426852e2",
          "citation": "CP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d7a86ad-6bd1-480f-97da-b1d924f4c0d3",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fe042a7-6eb9-419a-932b-ac1fcae3a519",
          "citation": "CHP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce8969d7-8843-4241-a01d-1d795f08c0e5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391662000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "256119e2-25f8-4e35-9fc7-dd6b82829179",
          "citation": "SRS import [51GY352868]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=51GY352868",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391662000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74bd624f-8fd7-49ca-9748-295294c0af15",
          "citation": "CYCLOVIROBUXINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8384a00d-7215-4f3d-b76d-37dd4fe0cdde",
          "citation": "CYCLOVIROBUXINUM D [CHP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7a863fcf-21f5-d741-cda1-267ec66fef00",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "afe8afc2-6a97-46bf-a7d4-cd6c36aa06dc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "459c4788-db1d-60f8-db25-cdc8256613c8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5be4c9f5-517a-719a-649b-12e8a5369535",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3bb99c40-26f7-4acc-b6a6-2a25c2f4460d",
          "id": "3bb99c40-26f7-4acc-b6a6-2a25c2f4460d",
          "molfile": "\n  Marvin  01132103102D          \n\n 29 33  0  0  1  0            999 V2000\n   11.2056   -5.0439    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.8896   -4.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4642   -4.6823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4066   -3.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2633   -5.8670    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.7482   -6.5344    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.5731   -6.5344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2633   -7.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4787   -6.9469    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.5649   -7.7673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7642   -7.3593    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.7642   -8.1844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0497   -8.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3352   -8.1844    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.3352   -7.3593    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.3352   -6.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0497   -6.9469    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.0497   -6.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7642   -5.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4787   -6.1219    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.5649   -5.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6207   -6.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9063   -7.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9063   -8.1844    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.1919   -8.5969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4774   -8.1844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6207   -8.5969    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.0333   -9.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0904   -9.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5 20  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 20  9  1  0  0  0  0\n 11 12  1  6  0  0  0\n 11 17  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 27  1  1  0  0  0\n 15 16  1  1  0  0  0\n 17 15  1  0  0  0  0\n 15 22  1  0  0  0  0\n 17 16  1  1  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  1  0  0  0\n 22 23  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  1  0  0  0\n 24 27  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H]([C@H]1C(C[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@H](CC[C@]54C[C@@]35CC[C@]12C)NC)O)NC",
          "formula": "C26H46N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "142378fa-adbf-44be-9419-7e0ead8ac09d"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "402.6572",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "165b5a62-ebd7-4d6c-8ede-7a004c1fdd9e",
      "version": "10",
      "structure": {
        "id": "c68ca2e4-0260-465d-8811-0e37449fc82b",
        "molfile": "\n  Marvin  01132110162D          \n\n 32 36  0  0  1  0            999 V2000\n   10.5649   -7.7673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4787   -6.9469    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.2633   -7.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7482   -6.5344    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.5731   -6.5344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2633   -5.8670    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.9777   -5.4545    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2056   -5.0439    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.8896   -4.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4642   -4.6823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4066   -3.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4787   -6.1219    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.5649   -5.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7642   -5.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0497   -6.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0497   -6.9469    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3352   -6.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3352   -7.3593    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.6207   -6.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9063   -7.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9063   -8.1844    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1919   -8.5969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4774   -8.1844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6207   -8.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0333   -9.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0904   -9.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3352   -8.1844    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3352   -9.0094    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0497   -8.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7642   -8.1844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7642   -7.3593    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.7642   -6.5344    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  6  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  1  0  0  0\n 10 11  1  0  0  0  0\n 12  6  1  0  0  0  0\n  2 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 17  1  1  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  1  0  0  0\n 22 23  1  0  0  0  0\n 24 21  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 27 24  1  0  0  0  0\n 18 27  1  0  0  0  0\n 27 28  1  6  0  0  0\n 29 27  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 31 16  1  0  0  0  0\n  2 31  1  0  0  0  0\n 31 32  1  1  0  0  0\nM  END",
        "smiles": "C[C@@H]([C@@]1([H])[C@@H](C[C@@]2(C)[C@]3([H])CC[C@@]4([H])C(C)(C)[C@H](CC[C@]54C[C@@]35CC[C@]12C)NC)O)NC",
        "formula": "C26H46N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "402.6572",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bd560028-5395-49a6-9f7a-f3622d5c7664",
          "256119e2-25f8-4e35-9fc7-dd6b82829179"
        ],
        "stereo_centers": 10
      },
      "unii": "51GY352868"
    }
  ]
}